| Compound ID | 2646 |
| Compound Structure |  |
| Plant Source | Strobilanthes cusia Common Name: |
| Source Family | Acanthaceae |
| Origin | China, Taiwan |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Tryptanthrin |
| PubChem ID | 73549 |
| Ethnomedicinal Information | Has folkloric reputation for the topical treatment of athletes foot |
| PubMed ID [Source Literature] | 9828037 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Quinazolinone, Alkaloid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.059 |
| Molecular Formula | C15H8N2O2 |
| SMILES | O=C1c2n(c3c1cccc3)c(=O)c1c(n2)cccc1 |
| XLogP | 3.519 |
| PSA | 46.500 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Mitscher LA, Baker W.Tuberculosis: a search for novel therapy starting with natural products.Med Res Rev. 1998 Nov;18(6):363-74
2) L. A. Mitscher and W. R. Baker.A search for novel chemotherapy against tuberculosis amongst natural products.Pure Appl. Chem., 1998, Vol. 70, No. 2, pp. 365-371
|
| Curator | |
| Compound ID | 2647 |
| Compound Structure |  |
| Plant Source | Strobilanthes cusia Common Name: |
| Source Family | Acanthaceae |
| Origin | China, Taiwan |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Tryptanthrin |
| PubChem ID | 73549 |
| Ethnomedicinal Information | Has folkloric reputation for the topical treatment of athletes foot |
| PubMed ID [Source Literature] | 9828037 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Quinazolinone, Alkaloid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.059 |
| Molecular Formula | C15H8N2O2 |
| SMILES | O=C1c2n(c3c1cccc3)c(=O)c1c(n2)cccc1 |
| XLogP | 3.519 |
| PSA | 46.500 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Mitscher LA, Baker W.Tuberculosis: a search for novel therapy starting with natural products.Med Res Rev. 1998 Nov;18(6):363-74
2) L. A. Mitscher and W. R. Baker.A search for novel chemotherapy against tuberculosis amongst natural products.Pure Appl. Chem., 1998, Vol. 70, No. 2, pp. 365-371
|
| Curator | |
| Compound ID | 2648 |
| Compound Structure |  |
| Plant Source | Strobilanthes cusia Common Name: |
| Source Family | Acanthaceae |
| Origin | China, Taiwan |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium avium complex |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Tryptanthrin |
| PubChem ID | 73549 |
| Ethnomedicinal Information | Has folkloric reputation for the topical treatment of athletes foot |
| PubMed ID [Source Literature] | 9828037 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Quinazolinone, Alkaloid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.059 |
| Molecular Formula | C15H8N2O2 |
| SMILES | O=C1c2n(c3c1cccc3)c(=O)c1c(n2)cccc1 |
| XLogP | 3.519 |
| PSA | 46.500 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Mitscher LA, Baker W.Tuberculosis: a search for novel therapy starting with natural products.Med Res Rev. 1998 Nov;18(6):363-74
2) L. A. Mitscher and W. R. Baker.A search for novel chemotherapy against tuberculosis amongst natural products.Pure Appl. Chem., 1998, Vol. 70, No. 2, pp. 365-371
|
| Curator | |
| Compound ID | 3699 |
| Compound Structure | |
| Plant Source | Stachys sylvatica Common Name:NR |
| Source Family | Lamiaceae |
| Origin | Brazil |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Traditional use against tuberculosis |
| PubMed ID [Source Literature] | 16302058 |
| Extract Preparation | Water |
| Chemical Classification [Active Compound] | Aromatic, Quinazolinone, Alkaloid |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Reference(s) | 1) Basso LA, da Silva LH, Fett-Neto AG, de Azevedo WF Jr, Moreira Ide S, Palma MS, Calixto JB, Astolfi Filho S, dos Santos RR, Soares MB, Santos DS.The use of biodiversity as source of new chemical entities against defined molecular targets for treatment of malaria, tuberculosis, and T-cell mediated diseases--a review.Mem Inst Oswaldo Cruz. 2005 Oct;100(6):475-506. Epub 2005 Nov 8
|
| Curator | Rachana, gppreetha |