| Compound ID | 1297 |
| Compound Structure |  |
| Plant Source | Brucea javanica (L.) Merrill syn. Rhus javanica L. Common Name:Java Brucea |
| Source Family | Simaroubaceae |
| Origin | India, China |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | Rifampin |
| Inhibition [%] | 7 % |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Bruceoside D |
| PubChem ID | 460525 |
| Ethnomedicinal Information | Treatment of amoebic dysentery and malaria, stomach complaints |
| PubMed ID [Source Literature] | 9332005 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Quassinoid, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 668.232 |
| Molecular Formula | C31H40O16 |
| SMILES | O1C2([C@H]3[C@]4([C@@H]([C@@]5([C@@H](C[C@H]4OC(=O)[C@@H]3OC(=O)C=C(C)C)[C@@H](C(=O)C(=C5)O[C@@H]3O[C@@H]([C@@H](O)[C@H](O)[C@H]3O)CO)C)C)[C@@H](O)[C@@H]2O)C1)C(=O)O |
| XLogP | -0.909 |
| PSA | 256.040 |
| H-bond Donor | 7 |
| H-bond Acceptor | 16 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 16 |
| No. of S | 0 |
| Reference(s) | 1) Rahman S, Fukamiya N, Okano M, Tagahara K, Lee KH.Anti-tuberculosis activity of quassinoids.Chem Pharm Bull (Tokyo). 1997 Sep;45(9):1527-9
2) http://www.hear.org/pier/commonnames/details/brucea_javanica.htm
|
| Curator | |
| Compound ID | 1354 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Mangiferin |
| PubChem ID | 5281647 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Phenol, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 422.085 |
| Molecular Formula | C19H18O11 |
| SMILES | O1[C@H]([C@H](O)[C@@H](O)[C@H](O)[C@H]1CO)c1c(O)c2c(oc3c(c2=O)cc(O)c(O)c3)cc1O |
| XLogP | -2.646 |
| PSA | 188.140 |
| H-bond Donor | 8 |
| H-bond Acceptor | 10 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 11 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2.
|
| Curator | |
| Compound ID | 1412 |
| Compound Structure |  |
| Plant Source | Cephaelis dichroa Common Name: |
| Source Family | Rubiaceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.06 µg/ml), Ethambutol (2 µg/ml), Rifampin (0.06 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Strictosidine |
| PubChem ID | 161336 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Alkaloid, Indole, Pyran, Ester, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 530.226 |
| Molecular Formula | C27H34N2O9
|
| SMILES | O([C@@H]1OC=C([C@@H](C[C@@H]2NCCc3c2[nH]c2c3cccc2)[C@H]1C=C)C(=O)OC)[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO |
| XLogP | 1.559 |
| PSA | 162.730 |
| H-bond Donor | 6 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 5 |
| No. of N | 2 |
| No. of O | 9 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1413 |
| Compound Structure |  |
| Plant Source | Cephaelis dichroa Common Name: |
| Source Family | Rubiaceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.06 µg/ml), Ethambutol (2 µg/ml), Rifampin (0.06 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Peracetyl - Strictosidine Lactam |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Alkaloid, Carbazole, Pyran, Isoquinoline, O-Acetyl, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 650.284 |
| Molecular Formula | C35H42N2O10 |
| SMILES | C1cccc2c1c1c([nH]2)C2N(CC1)CC1=COC(C(C1C2)C=C)OC1O[C@H]([C@@H]([C@H]([C@@H]1OC(=O)C)CC(=O)C)OC(=O)C)COC(=O)C |
| XLogP | 3.192 |
| PSA | 142.690 |
| H-bond Donor | 1 |
| H-bond Acceptor | 12 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 6 |
| No. of N | 2 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1414 |
| Compound Structure |  |
| Plant Source | Cephaelis dichroa Common Name: |
| Source Family | Rubiaceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (345) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (3.125 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Strictosidine |
| PubChem ID | 161336 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Alkaloid, Indole, Pyran, Ester, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 530.226 |
| Molecular Formula | C27H34N2O9
|
| SMILES | O([C@@H]1OC=C([C@@H](C[C@@H]2NCCc3c2[nH]c2c3cccc2)[C@H]1C=C)C(=O)OC)[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO |
| XLogP | 1.559 |
| PSA | 162.730 |
| H-bond Donor | 6 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 5 |
| No. of N | 2 |
| No. of O | 9 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1415 |
| Compound Structure |  |
| Plant Source | Cephaelis dichroa Common Name: |
| Source Family | Rubiaceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (345) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (3.125 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Peracetyl - Strictosidine Lactam |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Alkaloid, Carbazole, Pyran, Isoquinoline, O-Acetyl, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 650.284 |
| Molecular Formula | C35H42N2O10 |
| SMILES | C1cccc2c1c1c([nH]2)C2N(CC1)CC1=COC(C(C1C2)C=C)OC1O[C@H]([C@@H]([C@H]([C@@H]1OC(=O)C)CC(=O)C)OC(=O)C)COC(=O)C |
| XLogP | 3.192 |
| PSA | 142.690 |
| H-bond Donor | 1 |
| H-bond Acceptor | 12 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 6 |
| No. of N | 2 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1416 |
| Compound Structure |  |
| Plant Source | Cephaelis dichroa Common Name: |
| Source Family | Rubiaceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M12) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (12.50 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Strictosidine |
| PubChem ID | 161336 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Alkaloid, Indole, Pyran, Ester, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 530.226 |
| Molecular Formula | C27H34N2O9
|
| SMILES | O([C@@H]1OC=C([C@@H](C[C@@H]2NCCc3c2[nH]c2c3cccc2)[C@H]1C=C)C(=O)OC)[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO |
| XLogP | 1.559 |
| PSA | 162.730 |
| H-bond Donor | 6 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 5 |
| No. of N | 2 |
| No. of O | 9 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1417 |
| Compound Structure |  |
| Plant Source | Cephaelis dichroa Common Name: |
| Source Family | Rubiaceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M12) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (12.50 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Peracetyl - strictosidine lactam |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Alkaloid, Carbazole, Pyran, Isoquinoline, O-Acetyl, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 650.284 |
| Molecular Formula | C35H42N2O10 |
| SMILES | C1cccc2c1c1c([nH]2)C2N(CC1)CC1=COC(C(C1C2)C=C)OC1O[C@H]([C@@H]([C@H]([C@@H]1OC(=O)C)CC(=O)C)OC(=O)C)COC(=O)C |
| XLogP | 3.192 |
| PSA | 142.690 |
| H-bond Donor | 1 |
| H-bond Acceptor | 12 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 6 |
| No. of N | 2 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1418 |
| Compound Structure |  |
| Plant Source | Cephaelis dichroa Common Name: |
| Source Family | Rubiaceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M20) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (25 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Strictosidine |
| PubChem ID | 161336 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Alkaloid, Indole, Pyran, Ester, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 530.226 |
| Molecular Formula | C27H34N2O9
|
| SMILES | O([C@@H]1OC=C([C@@H](C[C@@H]2NCCc3c2[nH]c2c3cccc2)[C@H]1C=C)C(=O)OC)[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO |
| XLogP | 1.559 |
| PSA | 162.730 |
| H-bond Donor | 6 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 5 |
| No. of N | 2 |
| No. of O | 9 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1419 |
| Compound Structure |  |
| Plant Source | Cephaelis dichroa Common Name: |
| Source Family | Rubiaceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M20) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (25 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Peracetyl - Strictosidine Lactam |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Alkaloid, Carbazole, Pyran, Isoquinoline, O-Acetyl, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 650.284 |
| Molecular Formula | C35H42N2O10 |
| SMILES | C1cccc2c1c1c([nH]2)C2N(CC1)CC1=COC(C(C1C2)C=C)OC1O[C@H]([C@@H]([C@H]([C@@H]1OC(=O)C)CC(=O)C)OC(=O)C)COC(=O)C |
| XLogP | 3.192 |
| PSA | 142.690 |
| H-bond Donor | 1 |
| H-bond Acceptor | 12 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 6 |
| No. of N | 2 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1523 |
| Compound Structure |  |
| Plant Source | Combretum molle R. Br. Ex G. Don Common Name:Velvet Leaf Willow, Velvet Leaf Combretum, Velvet Bush Willow |
| Source Family | Combretaceae |
| Origin | Africa |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 0.6 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Punicalagin |
| PubChem ID | 16149716 |
| Ethnomedicinal Information | Cough, tuberculosis, juice drunk to treat chest complaints |
| PubMed ID [Source Literature] | 15110681 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Polyphenol, Ellagitannin, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 0.000 |
| Molecular Formula | C48H28O30
|
| SMILES | O1[C@H]2[C@@H](OC(=O)c3c(c4c5c6c7c(c(c8c(C(=O)OC2)cc(O)c(O)c8O)c(O)c(O)c7oc5=O)c(=O)oc6c(O)c4O)c(O)c(O)c(O)c3)[C@@H]2OC(=O)c3c(c4c(C(=O)O[C@H]2[C@H]1O)cc(O)c(O)c4O)c(O)c(O)c(O)c3 |
| XLogP | 0.000 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Okunade AL, Elvin-Lewis MP, Lewis WH.Natural antimycobacterial metabolites: current status.Phytochemistry. 2004 Apr;65(8):1017-32
|
| Curator | |
| Compound ID | 1931 |
| Compound Structure |  |
| Plant Source | Ipomoea leptophylla Common Name:Bush Morning Glory, Manroot |
| Source Family | Convolvulaceae |
| Origin | North America |
| Plant Part Used | Leaf |
| Extract | Soluble extract |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC 460 radiometric system |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR (inactive) |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Operculinic acid |
| PubChem ID | 44584575 |
| Ethnomedicinal Information | Treatment for stomach troubles, tuberculosis |
| PubMed ID [Source Literature] | 14640518 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Fatty acid, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 1018.520 |
| Molecular Formula | C46H82O24 |
| SMILES | O([C@@H]1O[C@H]([C@H](O[C@@H]2O[C@H]([C@H](O)[C@@H](O)[C@H]2O)C)[C@@H](O)[C@H]1O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO)C)[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O[C@H]1C)O[C@@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]1O[C@H](CCCCCCCCCC(=O)O)CCCCC)C |
| XLogP | 1.041 |
| PSA | 372.360 |
| H-bond Donor | 13 |
| H-bond Acceptor | 24 |
| No. of Rotatable Bond Count | 25 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 24 |
| No. of S | 0 |
| Reference(s) | 1) Barnes CC, Smalley MK, Manfredi KP, Kindscher K, Loring H, Sheeley DM.Characterization of an anti-tuberculosis resin glycoside from the prairie medicinal plant Ipomoea leptophylla.J Nat Prod. 2003 Nov;66(11):1457-62
|
| Curator | |
| Compound ID | 2620 |
| Compound Structure |  |
| Plant Source | Solidago rugosa Mill Common Name:Wrinkleleaf Goldenrod |
| Source Family | Asteraceae (Compositae) |
| Origin | North America |
| Plant Part Used | Root, Aerial |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Monoacetate |
| PubChem ID | 3035155 |
| Ethnomedicinal Information | Anti - inflammatory, tuberculosis |
| PubMed ID [Source Literature] | 7772306 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Lactone, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 806.445 |
| Molecular Formula | C43H66O14
|
| SMILES | OC12[C@H]3[C@@H]([C@@]4([C@H](CC3)C[C@@H](O[C@H]3O[C@@H]([C@@H](O[C@H]5O[C@@H]([C@@H](OC(=O)C)[C@@H](O)C5)C)[C@@H](O[C@H]5O[C@@H]([C@@H](O)[C@@H](O)C5)C)C3)C)CC4)C)CC[C@@]1([C@H](CC2)C1=CC(=O)OC1)C |
| XLogP | 4.155 |
| PSA | 188.900 |
| H-bond Donor | 4 |
| H-bond Acceptor | 14 |
| No. of Rotatable Bond Count | 9 |
| No. of Rings | 8 |
| No. of N | 0 |
| No. of O | 14 |
| No. of S | 0 |
| Reference(s) | 1) Lu T, Vargas D, Franzblau SG, Fischer NH. Diterpenes from Solidago rugosa.Phytochemistry.1995 Jan;38(2):451-6
|
| Curator | |
| Compound ID | 2966 |
| Compound Structure |  |
| Plant Source | Haloxylon salicornicum Bunge ex Boiss Common Name:NR |
| Source Family | Chenopodiaceae |
| Origin | Pakistan, Egypt, Jordan, Palestine, Iran, Iraq and Kuwait (in unfertile areas) |
| Plant Part Used | Whole plant |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Isoniazid (0.02 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 24β (24S)-Ethyl-cholesta-4-22 E diene 3-O-β-D-glucoside |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20542692 |
| Extract Preparation | Methanol extract further partitioned with water and hexane. The water layer was further extracted with chloroform and subjected to silica gel column chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 588.439 |
| Molecular Formula | C36H60O6 |
| SMILES | C1CC(C=C2[C@]1([C@@H]1[C@@](CC2)([C@H]2[C@](CC1)(C(CC2)[C@@H](/C=C/[C@H](C(C)C)CC)C)C)C)C)OC1O[C@@H]([C@H]([C@H](O)[C@H]1O)O)CO |
| XLogP | 10.835 |
| PSA | 99.380 |
| H-bond Donor | 4 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Bibi N, Tanoli SA, Farheen S, Afza N, Siddiqi S, Zhang Y, Kazmi SU, Malik A.In vitro antituberculosis activities of the constituents isolated from Haloxylon salicornicum.Bioorg Med Chem Lett. 2010 Jul 15;20(14):4173-6
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 2967 |
| Compound Structure |  |
| Plant Source | Haloxylon salicornicum Bunge ex Boiss Common Name:NR |
| Source Family | Chenopodiaceae |
| Origin | Pakistan, Egypt, Jordan, Palestine, Iran, Iraq and Kuwait (in unfertile areas) |
| Plant Part Used | Whole plant |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Isoniazid (0.02 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 24β (24S)-Ethyl cholesta-4-22 E diene 3-O-α-L-rhamnoside |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20542692 |
| Extract Preparation | Methanol extract further partitioned with water and hexane. The water layer was further extracted with chloroform and subjected to silica gel column chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 558.428 |
| Molecular Formula | C35H58O5 |
| SMILES | C1CC(C=C2[C@]1([C@@H]1[C@@H](CC2)[C@H]2[C@](CC1)(C(CC2)[C@@H](/C=C/[C@H](C(C)C)CC)C)C)C)OC1[C@@H]([C@@H]([C@H]([C@@H](O1)C)O)O)O |
| XLogP | 10.932 |
| PSA | 79.150 |
| H-bond Donor | 3 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Bibi N, Tanoli SA, Farheen S, Afza N, Siddiqi S, Zhang Y, Kazmi SU, Malik A.In vitro antituberculosis activities of the constituents isolated from Haloxylon salicornicum.Bioorg Med Chem Lett. 2010 Jul 15;20(14):4173-6
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 2968 |
| Compound Structure |  |
| Plant Source | Haloxylon salicornicum Bunge ex Boiss Common Name:NR |
| Source Family | Chenopodiaceae |
| Origin | Pakistan, Egypt, Jordan, Palestine, Iran, Iraq and Kuwait (in unfertile areas) |
| Plant Part Used | Whole plant |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Isoniazid (0.02 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Stigmasterol-3-O-β-D-glucopyranoside |
| PubChem ID | 44237224 |
| Ethnomedicinal Information | Healing of internal ulcers, insect stings |
| PubMed ID [Source Literature] | 20542692 |
| Extract Preparation | Methanol extract further partitioned with water and hexane. The water layer was further extracted with chloroform and subjected to silica gel column chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 574.423 |
| Molecular Formula | C35H58O6 |
| SMILES | O([C@@H]1CC2=CCC3C4[C@@](C(CC4)[C@H](C)/C=C/[C@H](C(C)C)CC)(CCC3[C@]2(CC1)C)C)C1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO |
| XLogP | 9.963 |
| PSA | 99.380 |
| H-bond Donor | 4 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Bibi N, Tanoli SA, Farheen S, Afza N, Siddiqi S, Zhang Y, Kazmi SU, Malik A.In vitro antituberculosis activities of the constituents isolated from Haloxylon salicornicum.Bioorg Med Chem Lett. 2010 Jul 15;20(14):4173-6
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 3044 |
| Compound Structure |  |
| Plant Source | Alpinia purpurata (Vieill.) K. Schum Common Name:Red Ginger |
| Source Family | Zingiberaceae |
| Origin | Philippines |
| Plant Part Used | Leaf |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (99% inhibition at 0.18 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Sitosteryl - 3 - O - 6 - Palmitoyl - β - D - glucoside |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiviral activity against HIV |
| PubMed ID [Source Literature] | 21120040 |
| Extract Preparation | Air dried leaves mixed with ethanol, hexane, dichloromethane and n - butanol |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Triterpene, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H11 agar |
| Cytotoxicity Assay [AID] | Plant sterols, particularly U - Sitosterol and its glucosides, have been investigated as immune regulators of T - cell activity and as agents in maintaining the CD4+ count |
| Molecular Weight | 646.481 |
| Molecular Formula | C39H66O7
|
| SMILES | C1C[C@@H](CC2=CCC3C([C@@]12C)CC[C@@]1([C@H](CCC31)[C@H](C)CC[C@@H](CC)C(C)C)C)OC1OC(C(C(C1O)O)O)COC(=O)CCC |
| XLogP | 11.620 |
| PSA | 105.450 |
| H-bond Donor | 3 |
| H-bond Acceptor | 7 |
| No. of Rotatable Bond Count | 13 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Villaflores OB, Macabeo AP, Gehle D, Krohn K, Franzblau SG, Aguinaldo AM.Phytoconstituents from Alpinia purpurata and their in vitro inhibitory activity against Mycobacterium tuberculosis.Pharmacogn Mag. 2010 Oct;6(24):339-44
|
| Curator | Vikramjitmandal |
| Compound ID | 3045 |
| Compound Structure |  |
| Plant Source | Alpinia purpurata (Vieill.) K. Schum Common Name:Red Ginger |
| Source Family | Zingiberaceae |
| Origin | Philippines |
| Plant Part Used | Leaf |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (99% inhibition at 0.18 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | β - Sitosteryl Galactoside |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiviral activity against HIV |
| PubMed ID [Source Literature] | 21120040 |
| Extract Preparation | Air dried leaves mixed with ethanol, hexane, dichloromethane and n - butanol |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H11 agar |
| Cytotoxicity Assay [AID] | Plant sterols, particularly U - Sitosterol and its glucosides, have been investigated as immune regulators of T - cell activity and as agents in maintaining the CD4+ count |
| Molecular Weight | 576.439 |
| Molecular Formula | C35H60O6
|
| SMILES | C1C[C@@H](CC2=CCC3C([C@@]12C)CC[C@@]1([C@H](CCC31)[C@H](C)CC[C@@H](CC)C(C)C)C)OC1OC(C(C(C1O)O)O)CO |
| XLogP | 10.487 |
| PSA | 99.380 |
| H-bond Donor | 4 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 9 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Villaflores OB, Macabeo AP, Gehle D, Krohn K, Franzblau SG, Aguinaldo AM.Phytoconstituents from Alpinia purpurata and their in vitro inhibitory activity against Mycobacterium tuberculosis.Pharmacogn Mag. 2010 Oct;6(24):339-44
|
| Curator | Vikramjitmandal |
| Compound ID | 3298 |
| Compound Structure |  |
| Plant Source | Euphorbia peplis L. Common Name: |
| Source Family | Euphorbiaceae |
| Origin | India, Northern Italy |
| Plant Part Used | Leaf, stem |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ciprofloxacin (0.125 – 0.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 160 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1 - O - (β - D - Glucopyranosyl) - (2S, 3S, 4R, 8Z) - 2N - [(2R) - 2 - Hydroxytetracosenoil] - 8 (Z) - Octadecene - 1, 3, 4 - Triol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 14643323 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Cerebroside, Amide, Alcohol, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 843.680 |
| Molecular Formula | C48H93NO10 |
| SMILES | C(=O)(N[C@@H](CO[C@@H]1OC(C([C@H]([C@@H]1O)O)O)CO)[C@H](O)[C@@H](CCC/C=C/CCCCCCCCC)O)[C@H](O)CCCCCCCCCCCCCCCCCCCCCC |
| XLogP | 14.906 |
| PSA | 189.170 |
| H-bond Donor | 8 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 42 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) Cateni F, Zilic J, Falsone G, Scialino G, Banfi E.New cerebrosides from Euphorbia peplis L.: antimicrobial activity evaluation.Bioorg Med Chem Lett. 2003 Dec 15;13(24):4345-50
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3299 |
| Compound Structure |  |
| Plant Source | Euphorbia peplis L. Common Name: |
| Source Family | Euphorbiaceae |
| Origin | India, Northern Italy |
| Plant Part Used | Leaf, stem |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ciprofloxacin (0.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 40 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1 - O - (β - D - Glucopyranosyl) - (2S, 3S, 4R, 8Z) - 2N - [(2R) - 2 - Hydroxyhexacosenoil] - 8 (Z) - Octadecene - 1, 3, 4 - Triol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 14643323 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Cerebroside, Amide, Alcohol, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 869.696 |
| Molecular Formula | C50H95NO10 |
| SMILES | C(=O)(N[C@@H](CO[C@@H]1OC(C([C@H]([C@@H]1O)O)O)CO)[C@H](O)[C@@H](CCC/C=C/CCCCCCCCC)O)[C@H](O)CCCCCCCCCCCCCC/C=C/CCCCCCCC |
| XLogP | 15.528 |
| PSA | 189.170 |
| H-bond Donor | 8 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 43 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) Cateni F, Zilic J, Falsone G, Scialino G, Banfi E.New cerebrosides from Euphorbia peplis L.: antimicrobial activity evaluation.Bioorg Med Chem Lett. 2003 Dec 15;13(24):4345-50
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3300 |
| Compound Structure |  |
| Plant Source | Euphorbia peplis L. Common Name: |
| Source Family | Euphorbiaceae |
| Origin | India, Northern Italy |
| Plant Part Used | Leaf, stem |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H242 |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ciprofloxacin (0.125 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 160 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1 - O - (β - D - Glucopyranosyl) - (2S, 3S, 4R, 8Z) - 2N - [(2R) - 2 - Hydroxytetracosanoil] - 8 (Z) - Octadecene - 1, 3, 4 - Triol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 14643323 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Cerebroside, Amide, Alcohol, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 843.680 |
| Molecular Formula | C48H93NO10 |
| SMILES | C(=O)(N[C@@H](CO[C@@H]1OC(C([C@H]([C@@H]1O)O)O)CO)[C@H](O)[C@@H](CCC/C=C/CCCCCCCCC)O)[C@H](O)CCCCCCCCCCCCCCCCCCCCCC |
| XLogP | 14.906 |
| PSA | 189.170 |
| H-bond Donor | 8 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 42 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) Cateni F, Zilic J, Falsone G, Scialino G, Banfi E.New cerebrosides from Euphorbia peplis L.: antimicrobial activity evaluation.Bioorg Med Chem Lett. 2003 Dec 15;13(24):4345-50
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3301 |
| Compound Structure |  |
| Plant Source | Euphorbia peplis L. Common Name: |
| Source Family | Euphorbiaceae |
| Origin | India, Northern Italy |
| Plant Part Used | Leaf, stem |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H172 |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ciprofloxacin (0.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 160 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1 - O - (β - D - Glucopyranosyl) - (2S, 3S, 4E, 8E) - 2N - [(2R) - 2 - Hydroxyhexadecanoylamino] - 4 (E), 8 (E) - Octadecadiene - 1, 3 - Diol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 14643323 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Cerebroside, Amide, Alcohol, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 713.544 |
| Molecular Formula | C40H75NO9 |
| SMILES | C(=O)(N[C@@H](CO[C@@H]1OC(C([C@H]([C@@H]1O)O)O)CO)[C@H](O)/C=C/CCC/C=C/CCCCCCCC)[C@H](O)CCCCCCCCCCCCCC |
| XLogP | 11.345 |
| PSA | 168.940 |
| H-bond Donor | 7 |
| H-bond Acceptor | 10 |
| No. of Rotatable Bond Count | 33 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 9 |
| No. of S | 0 |
| Reference(s) | 1) Cateni F, Zilic J, Falsone G, Scialino G, Banfi E.New cerebrosides from Euphorbia peplis L.: antimicrobial activity evaluation.Bioorg Med Chem Lett. 2003 Dec 15;13(24):4345-50
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3303 |
| Compound Structure |  |
| Plant Source | Euphorbia peplis L. Common Name: |
| Source Family | Euphorbiaceae |
| Origin | India, Northern Italy |
| Plant Part Used | Leaf, stem |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H331 |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ciprofloxacin (0.125 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 40 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1 - O - (β - D - Glucopyranosyl) - (2S, 3S, 4R, 8Z) - 2N - [(2R) - 2 - Hydroxyhexacosenoil] - 8 (Z) - Octadecene - 1, 3, 4 - Triol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 14643323 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Cerebroside, Amide, Alcohol, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 869.696 |
| Molecular Formula | C50H95NO10 |
| SMILES | C(=O)(N[C@@H](CO[C@@H]1OC(C([C@H]([C@@H]1O)O)O)CO)[C@H](O)[C@@H](CCC/C=C/CCCCCCCCC)O)[C@H](O)CCCCCCCCCCCCCC/C=C/CCCCCCCC |
| XLogP | 15.528 |
| PSA | 189.170 |
| H-bond Donor | 8 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 43 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) Cateni F, Zilic J, Falsone G, Scialino G, Banfi E.New cerebrosides from Euphorbia peplis L.: antimicrobial activity evaluation.Bioorg Med Chem Lett. 2003 Dec 15;13(24):4345-50
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3304 |
| Compound Structure |  |
| Plant Source | Euphorbia peplis L. Common Name: |
| Source Family | Euphorbiaceae |
| Origin | India, Northern Italy |
| Plant Part Used | Leaf, stem |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H242 |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ciprofloxacin (0.125 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 80 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1 - O - (β - D - Glucopyranosyl) - (2S, 3S, 4R, 8Z) - 2N - [(2R) - 2 - Hydroxyhexacosenoil] - 8 (Z) - Octadecene - 1, 3, 4 - Triol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 14643323 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Cerebroside, Amide, Alcohol, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 869.696 |
| Molecular Formula | C50H95NO10 |
| SMILES | C(=O)(N[C@@H](CO[C@@H]1OC(C([C@H]([C@@H]1O)O)O)CO)[C@H](O)[C@@H](CCC/C=C/CCCCCCCCC)O)[C@H](O)CCCCCCCCCCCCCC/C=C/CCCCCCCC |
| XLogP | 15.528 |
| PSA | 189.170 |
| H-bond Donor | 8 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 43 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) Cateni F, Zilic J, Falsone G, Scialino G, Banfi E.New cerebrosides from Euphorbia peplis L.: antimicrobial activity evaluation.Bioorg Med Chem Lett. 2003 Dec 15;13(24):4345-50
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3305 |
| Compound Structure |  |
| Plant Source | Euphorbia peplis L. Common Name: |
| Source Family | Euphorbiaceae |
| Origin | India, Northern Italy |
| Plant Part Used | Leaf, stem |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H172 |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ciprofloxacin (0.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 40 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1 - O - (β - D - Glucopyranosyl) - (2S, 3S, 4R, 8Z) - 2N - [(2R) - 2 - Hydroxyhexacosenoil] - 8 (Z) - Octadecene - 1, 3, 4 - Triol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 14643323 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Cerebroside, Amide, Alcohol, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 869.696 |
| Molecular Formula | C50H95NO10 |
| SMILES | C(=O)(N[C@@H](CO[C@@H]1OC(C([C@H]([C@@H]1O)O)O)CO)[C@H](O)[C@@H](CCC/C=C/CCCCCCCCC)O)[C@H](O)CCCCCCCCCCCCCC/C=C/CCCCCCCC |
| XLogP | 15.528 |
| PSA | 189.170 |
| H-bond Donor | 8 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 43 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) Cateni F, Zilic J, Falsone G, Scialino G, Banfi E.New cerebrosides from Euphorbia peplis L.: antimicrobial activity evaluation.Bioorg Med Chem Lett. 2003 Dec 15;13(24):4345-50
|
| Curator | Vsheeba, vikramjitmandal |