| Compound ID | 2385 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fresh root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | 17758236 |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Alkaloid, Thiophene, Benzopyran, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 485.202 |
| Molecular Formula | C30H31NO3S
|
| SMILES | S1c(/C=C/2Oc3c(c4c2c2c(NC(C=C2C)(C)C)cc4)c(OC)c(O)cc3)c(/C(=C/CC)/C)cc1 |
| XLogP | 7.049 |
| PSA | 78.960 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 1 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | |
| Compound ID | 3936 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | NR |
| Target Bacteria | Mycobacterium fortuitum |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (128 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 128 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Thiophene |
| PubChem ID | 45272211 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Thiophene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 161.963 |
| Molecular Formula | C5H6S3 |
| SMILES | S1c(SSC)ccc1 |
| XLogP | 2.741 |
| PSA | 78.840 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 3 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3937 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | NR |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (128 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 64 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Thiophene |
| PubChem ID | 45272211 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Thiophene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 161.963 |
| Molecular Formula | C5H6S3 |
| SMILES | S1c(SSC)ccc1 |
| XLogP | 2.741 |
| PSA | 78.840 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 3 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3938 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | NR |
| Target Bacteria | Mycobacterium smegmatis (mc2 2700) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (128 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | Not tested |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Thiophene |
| PubChem ID | 45272211 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Thiophene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 161.963 |
| Molecular Formula | C5H6S3 |
| SMILES | S1c(SSC)ccc1 |
| XLogP | 2.741 |
| PSA | 78.840 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 3 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3939 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | NR |
| Target Bacteria | Mycobacterium phlei |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (128 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 128 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Thiophene |
| PubChem ID | 45272211 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Thiophene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 161.963 |
| Molecular Formula | C5H6S3 |
| SMILES | S1c(SSC)ccc1 |
| XLogP | 2.741 |
| PSA | 78.840 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 3 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |