| Compound ID | 1354 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Mangiferin |
| PubChem ID | 5281647 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Phenol, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 422.085 |
| Molecular Formula | C19H18O11 |
| SMILES | O1[C@H]([C@H](O)[C@@H](O)[C@H](O)[C@H]1CO)c1c(O)c2c(oc3c(c2=O)cc(O)c(O)c3)cc1O |
| XLogP | -2.646 |
| PSA | 188.140 |
| H-bond Donor | 8 |
| H-bond Acceptor | 10 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 11 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2.
|
| Curator | |
| Compound ID | 1355 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1,3,5-Trihydroxyxanthone |
| PubChem ID | 25200626 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 243.029 |
| Molecular Formula | C13H7O5 |
| SMILES | O1c2c(c(=O)c3c1c([O-])ccc3)c(O)cc(O)c2 |
| XLogP | 0.296 |
| PSA | 80.590 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2.
|
| Curator | |
| Compound ID | 1356 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1, 3 - Dihydroxy - 5 - Methoxy - 9H - Xanthen - 9 - One |
| PubChem ID | 12026489 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 258.053 |
| Molecular Formula | C14H10O5 |
| SMILES | O1c2c(c(=O)c3c1cc(O)cc3O)cccc2OC |
| XLogP | 0.815 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2.
|
| Curator | |
| Compound ID | 1357 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1 - Hydroxy - 3, 5 - Dimethoxyxanthen - 9 - One |
| PubChem ID | 5479773 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 272.068 |
| Molecular Formula | C15H12O5 |
| SMILES | O1c2c(c(=O)c3c1c(OC)ccc3)c(O)cc(OC)c2 |
| XLogP | 1.334 |
| PSA | 55.760 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2.
|
| Curator | |
| Compound ID | 1358 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1, 3, 5, 6 - Tetrahydroxyxanthen - 9 - One |
| PubChem ID | 5479774 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 260.032 |
| Molecular Formula | C13H8O6
|
| SMILES | O1c2c(c(=O)c3c1cc(O)cc3O)ccc(O)c2O |
| XLogP | -0.238 |
| PSA | 97.990 |
| H-bond Donor | 4 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2
|
| Curator | |
| Compound ID | 1359 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1, 3, 6 - Trihydroxy - 5 - Methoxyxanthen - 9 - One |
| PubChem ID | 5493675 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 274.048 |
| Molecular Formula | C14H10O6
|
| SMILES | O1c2c(c(=O)c3c1cc(O)cc3O)ccc(O)c2OC |
| XLogP | -0.148 |
| PSA | 86.990 |
| H-bond Donor | 3 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2
|
| Curator | |
| Compound ID | 1360 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1, 3, 5 - Trihydroxy - 6 - Methoxyxanthen - 9 - One |
| PubChem ID | 5479775 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 274.048 |
| Molecular Formula | C14H10O6
|
| SMILES | O1c2c(c(=O)c3c1cc(O)cc3O)ccc(OC)c2O |
| XLogP | -0.148 |
| PSA | 86.990 |
| H-bond Donor | 3 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2
|
| Curator | |
| Compound ID | 1361 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3, 5 - Dimethoxy - 1, 6 - Dihydroxyxanthone |
| PubChem ID | 5281630 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 288.063 |
| Molecular Formula | C15H12O6
|
| SMILES | O1c2c(c(=O)c3c1cc(OC)cc3O)ccc(O)c2OC |
| XLogP | 0.371 |
| PSA | 75.990 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2
|
| Curator | |
| Compound ID | 1362 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1, 3, 5, 6, 7 - Pentahydroxyxanthen - 9 - One |
| PubChem ID | 10333643 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 276.027 |
| Molecular Formula | C13H8O7
|
| SMILES | O1c2c(c(=O)c3c1cc(O)cc3O)cc(O)c(O)c2O |
| XLogP | -0.772 |
| PSA | 118.220 |
| H-bond Donor | 5 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2
|
| Curator | |
| Compound ID | 1363 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1, 6, 7 - Trihydroxy - 3, 5 - Dimethoxyxanthen - 9 - One |
| PubChem ID | 5479777 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 304.058 |
| Molecular Formula | C15H12O7
|
| SMILES | O1c2c(c(=O)c3c1cc(OC)cc3O)cc(O)c(O)c2OC |
| XLogP | -0.163 |
| PSA | 96.220 |
| H-bond Donor | 3 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2
|
| Curator | |
| Compound ID | 1364 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1, 7 - Dihydroxy - 3, 5, 6 - Trimethoxyxanthen - 9 - One |
| PubChem ID | 5491588 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 318.074 |
| Molecular Formula | C16H14O7
|
| SMILES | O1c2c(c(=O)c3c1cc(OC)cc3O)cc(O)c(OC)c2OC |
| XLogP | -0.073 |
| PSA | 85.220 |
| H-bond Donor | 2 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2
|
| Curator | |
| Compound ID | 1798 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Thailand, Malaysia |
| Plant Part Used | Fruit |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampicin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulfate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Garcinone B |
| PubChem ID | 5495928 |
| Ethnomedicinal Information | Treatment of diarrhea and dysentery and for skin diseases, to lower fever and for urinary disorders |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Xanthonoid, Benzopyran, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 394.142 |
| Molecular Formula | C23H22O6
|
| SMILES | O1C(C=Cc2c3c(oc4c(c3=O)c(O)c(c(O)c4)CC=C(C)C)cc(O)c12)(C)C |
| XLogP | 2.203 |
| PSA | 86.990 |
| H-bond Donor | 3 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | |
| Compound ID | 1796 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Thailand, Malaysia |
| Plant Part Used | Fruit |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampicin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulfate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Garcinone D |
| PubChem ID | 5495926 |
| Ethnomedicinal Information | Treatment of diarrhea and dysentery and for skin diseases, to lower fever and for urinary disorders |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Prenylated, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 428.184 |
| Molecular Formula | C24H28O7
|
| SMILES | OC(CCc1c2c(oc3c(c2=O)c(O)c(c(O)c3)CC=C(C)C)cc(O)c1OC)(C)C |
| XLogP | 1.895 |
| PSA | 107.220 |
| H-bond Donor | 4 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | |
| Compound ID | 3573 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Southeast Asian countries (Thailand, Malaysia) |
| Plant Part Used | Fruit hull, fresh aril, seed |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulphate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | α - Mangostin |
| PubChem ID | 5281650 |
| Ethnomedicinal Information | Skin infections, wounds and diarrhea, to lower fever and for urinary disorders |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | MeOH extract were obtained from the fresh green fruit hulls of Garcinia mangostana. Pulverized, fresh arils and seeds were extracted throroughly with MeOH and evaporation of the solvent gave crude extract. The crude extract was partitioned between CHCl3 and H2O to afford CHCl3 extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Prenylated, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | 7H9GC medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 410.173 |
| Molecular Formula | C24H26O6 |
| SMILES | O1c2c(c(CC=C(C)C)c(OC)c(O)c2)c(=O)c2c1cc(O)c(c2O)CC=C(C)C |
| XLogP | 2.792 |
| PSA | 86.990 |
| H-bond Donor | 3 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | Gppreetha, vikramjitmandal, reshmi |
| Compound ID | 3575 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana L. Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Southeast Asia |
| Plant Part Used | Fruit hull |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulphate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Demethylcalabaxanthone |
| PubChem ID | 509270 |
| Ethnomedicinal Information | Skin infections, wounds and diarrhea |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | MeOH extract were obtained from the fresh green fruit hulls of Garcinia mangostana. Pulverized, fresh arils and seeds were extracted throroughly with MeOH and evaporation of the solvent gave crude extract. The crude extract was partitioned between CHCl3 and H2O to afford CHCl3 extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Xanthonoid, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 378.147 |
| Molecular Formula | C23H22O5 |
| SMILES | O1C(C=Cc2c1cc1oc3c(c(=O)c1c2O)c(CC=C(C)C)c(O)cc3)(C)C |
| XLogP | 3.163 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | Gppreetha, vikramjitmandal, reshmi |
| Compound ID | 3577 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana L. Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Southeast Asia |
| Plant Part Used | Fruit hull |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulphate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Trapezifolixanthone |
| PubChem ID | 188341 |
| Ethnomedicinal Information | Skin infections, wounds and diarrhea |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | MeOH extract were obtained from the fresh green fruit hulls of Garcinia mangostana. Pulverized, fresh arils and seeds were extracted throroughly with MeOH and evaporation of the solvent gave crude extract. The crude extract was partitioned between CHCl3 and H2O to afford CHCl3 extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Xanthonoid, Benzopyran, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 378.147 |
| Molecular Formula | C23H22O5 |
| SMILES | O1C(C=Cc2c1c(c1oc3c(c(=O)c1c2O)cccc3O)CC=C(C)C)(C)C |
| XLogP | 3.166 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | Gppreetha, vikramjitmandal, reshmi |
| Compound ID | 3578 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana L. Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Southeast Asia |
| Plant Part Used | Fruit hull |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulphate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | β - mangostin |
| PubChem ID | NR |
| Ethnomedicinal Information | Skin infections, wounds and diarrhea |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | MeOH extract were obtained from the fresh green fruit hulls of Garcinia mangostana. Pulverized, fresh arils and seeds were extracted throroughly with MeOH and evaporation of the solvent gave crude extract. The crude extract was partitioned between CHCl3 and H2O to afford CHCl3 extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Prenylated, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 424.189 |
| Molecular Formula | C25H28O6 |
| SMILES | O1c2c(c(CC=C(C)C)c(c(O)c2)OC)c(=O)c2c1cc(c(c2O)CC=C(C)C)OC |
| XLogP | 3.311 |
| PSA | 75.990 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | Gppreetha, vikramjitmandal, reshmi |
| Compound ID | 3579 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana L. Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Southeast Asia |
| Plant Part Used | Fruit hull |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulphate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | γ - Mangostin |
| PubChem ID | 5464078 |
| Ethnomedicinal Information | Skin infections, wounds and diarrhea |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | MeOH extract were obtained from the fresh green fruit hulls of Garcinia mangostana. Pulverized, fresh arils and seeds were extracted throroughly with MeOH and evaporation of the solvent gave crude extract. The crude extract was partitioned between CHCl3 and H2O to afford CHCl3 extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 396.157 |
| Molecular Formula | C23H24O6 |
| SMILES | O1c2c(c(CC=C(C)C)c(O)c(O)c2)c(=O)c2c1cc(O)c(c2O)CC=C(C)C |
| XLogP | 2.702 |
| PSA | 97.990 |
| H-bond Donor | 4 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | Gppreetha, vikramjitmandal, reshmi |
| Compound ID | 3581 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana L. Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Southeast Asia |
| Plant Part Used | Fruit hull |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulphate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Mangostenol |
| PubChem ID | NR |
| Ethnomedicinal Information | Skin infections, wounds and diarrhea |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | MeOH extract were obtained from the fresh green fruit hulls of Garcinia mangostana. Pulverized, fresh arils and seeds were extracted throroughly with MeOH and evaporation of the solvent gave crude extract. The crude extract was partitioned between CHCl3 and H2O to afford CHCl3 extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 426.168 |
| Molecular Formula | C24H26O7 |
| SMILES | O1c2c(c(O)c(c(c2)O)CC(C(=C)C)O)c(=O)c2c1cc(O)c(c2CC=C(C)C)OC |
| XLogP | 1.226 |
| PSA | 107.220 |
| H-bond Donor | 4 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | Gppreetha, vikramjitmandal, reshmi |
| Compound ID | 3585 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana L. Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Southeast Asia |
| Plant Part Used | Fruit hull |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulphate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Mangostenone A |
| PubChem ID | 509267 |
| Ethnomedicinal Information | Skin infections, wounds and diarrhea |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | MeOH extract were obtained from the fresh green fruit hulls of Garcinia mangostana. Pulverized, fresh arils and seeds were extracted throroughly with MeOH and evaporation of the solvent gave crude extract. The crude extract was partitioned between CHCl3 and H2O to afford CHCl3 extract |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Xanthonoid, Benzopyran, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 460.189 |
| Molecular Formula | C28H28O6 |
| SMILES | O1C(C=Cc2c3oc4c(c(=O)c3c(c(O)c12)CC=C(C)C)c(O)c1c(OC(C=C1)(C)C)c4)(C)C |
| XLogP | 3.603 |
| PSA | 75.990 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | Gppreetha, vikramjitmandal, reshmi |
| Compound ID | 3586 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana L. Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Southeast Asia |
| Plant Part Used | Fruit hull |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulphate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Tovophyllin B |
| PubChem ID | 509268 |
| Ethnomedicinal Information | Skin infections, wounds and diarrhea |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | MeOH extract were obtained from the fresh green fruit hulls of Garcinia mangostana. Pulverized, fresh arils and seeds were extracted throroughly with MeOH and evaporation of the solvent gave crude extract. The crude extract was partitioned between CHCl3 and H2O to afford CHCl3 extract |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Xanthonoid, Benzopyran, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 460.189 |
| Molecular Formula | C28H28O6 |
| SMILES | O1C(C=Cc2c3c(oc4c(c3=O)c(O)c3c(OC(C=C3)(C)C)c4)c(c(O)c12)CC=C(C)C)(C)C |
| XLogP | 3.603 |
| PSA | 75.990 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | Gppreetha, vikramjitmandal, reshmi |
| Compound ID | 3587 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana L. Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Southeast Asia |
| Plant Part Used | Fruit hull |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulphate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Mangostanol |
| PubChem ID | 10048103 |
| Ethnomedicinal Information | Skin infections, wounds and diarrhea |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | MeOH extract were obtained from the fresh green fruit hulls of Garcinia mangostana. Pulverized, fresh arils and seeds were extracted throroughly with MeOH and evaporation of the solvent gave crude extract. The crude extract was partitioned between CHCl3 and H2O to afford CHCl3 extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Xanthonoid, Benzopyran, Prenylated, Phenol, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 426.168 |
| Molecular Formula | C24H26O7 |
| SMILES | O1C(C(O)Cc2c1cc1oc3c(c(=O)c1c2O)c(CC=C(C)C)c(OC)c(O)c3)(C)C |
| XLogP | 1.883 |
| PSA | 96.220 |
| H-bond Donor | 3 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | Gppreetha, vikramjitmandal, reshmi |
| Compound ID | 3758 |
| Compound Structure |  |
| Plant Source | Artcarpus rigidus BLUME subsp. rigidus Common Name:NR |
| Source Family | Moraceae |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Artoindonesianin C |
| PubChem ID | 10552003 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 17015984 |
| Extract Preparation | The dried root bark (1.5 kg) was milled and extracted successively with n - hexane, CHCl3 and MeOH in a Soxhlet extraction apparatus. The extracts were evaporated to dryness under reduced pressure at about 40°C. The hexane extract (brownish syrup, 8.4 g), the CHCl3 extract (dark brownish sticky solid, 16.1 g) and the methanolic extract (dark brownish mass, 45.6 g) were obtained, respectively |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Xanthonoid, Benzopyran, Phenol, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | Against human epidermoid carcinoma in the mouth (KB), human breast cancer cells (BC), human lung cancer cells (NCI - H187) |
| Molecular Weight | 462.131 |
| Molecular Formula | C26H22O8 |
| SMILES | O1c2c3c(C(O)(CC3=O)C(=O)OC)c(cc2c(=O)c2c1c1c(OC(C=C1)(C)C)cc2O)C(=C)C |
| XLogP | 1.501 |
| PSA | 110.130 |
| H-bond Donor | 2 |
| H-bond Acceptor | 7 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 8 |
| No. of S | 0 |
| Reference(s) | 1) Namdaung U, Aroonrerk N, Suksamrarn S, Danwisetkanjana K, Saenboonrueng J, Arjchomphu W, Suksamrarn A.Bioactive constituents of the root bark of Artocarpus rigidus subsp. rigidus.Chem Pharm Bull (Tokyo). 2006 Oct;54(10):1433-6
|
| Curator | Reshmi, vikramjitmandal, rachanake |
| Compound ID | 1805 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Thailand, Malaysia |
| Plant Part Used | Fruit |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampicin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulfate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Mangostinone |
| PubChem ID | 6478778 |
| Ethnomedicinal Information | Treatment of diarrhea and dysentery and for skin diseases, lower fever and for urinary disorders |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 380.162 |
| Molecular Formula | C23H24O5
|
| SMILES | O1c2c(c(O)c(C/C=C(/CCC=C(C)C)C)c(O)c2)c(=O)c2c1c(O)ccc2 |
| XLogP | 3.588 |
| PSA | 77.760 |
| H-bond Donor | 3 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | |
| Compound ID | 4074 |
| Compound Structure |  |
| Plant Source | Garcinia mangosta Common Name: |
| Source Family | Guttiferae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 15.24 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | α-Mangostin |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Prenylated, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 408.194 |
| Molecular Formula | C25H28O5
|
| SMILES | CC(=CCc1c(O)c2c(cc1O)Cc1cc(O)c(OC)c(CC=C(C)C)c1C2=O)C |
| XLogP | 3.755 |
| PSA | 86.990 |
| H-bond Donor | 3 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
