| Compound ID | 1024 |
| Compound Structure | |
| Plant Source | Acacia xanthophloea Benth Common Name:Fever Tree |
| Source Family | Fabaceae |
| Origin | Africa |
| Plant Part Used | Bark |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis symptoms |
| PubMed ID [Source Literature] | 10473184 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Lall N, Meyer JJ.In vitro inhibition of drug-resistant and drug-sensitive strains of Mycobacterium tuberculosis by ethnobotanically selected South African plants.J Ethnopharmacol. 1999 Sep;66(3):347-54
|
| Curator | |
| Compound ID | 1221 |
| Compound Structure | |
| Plant Source | Asclepias fruticosa L. (and Asclepias physocarpa (E. Mey.) Schltr.) Common Name:African Milkweed |
| Source Family | Asclepiadaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Rifampin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (2.00 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Used for diarrhoea and stomach pain, facilitate child-birth, asthma, diabetes, tuberculosis, headache and emetic to strengthen the body |
| PubMed ID [Source Literature] | 20447452 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Green E, Samie A, Obi CL, Bessong PO, Ndip RN.Inhibitory properties of selected South African medicinal plants against Mycobacterium tuberculosis.J Ethnopharmacol. 2010 Jul 6;130(1):151-7
|
| Curator | |
| Compound ID | 1222 |
| Compound Structure | |
| Plant Source | Asclepias fruticosa L. (and Asclepias physocarpa (E. Mey.) Schltr.) Common Name:African Milkweed |
| Source Family | Asclepiadaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis 2 (Clinical isolates resistant to Streptomycin, Rifampin, Ethambutol, Isoniazid) |
| Assay / Test Done | Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Rifampin (100 µg/ml), Isoniazid (4.6 µg/ml), Ethambutol (12 µg/ml), Streptomycin (120 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Used for diarrhoea and stomach pain, facilitate child-birth, asthma, diabetes, tuberculosis, headache and emetic to strengthen the body |
| PubMed ID [Source Literature] | 20447452 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Green E, Samie A, Obi CL, Bessong PO, Ndip RN.Inhibitory properties of selected South African medicinal plants against Mycobacterium tuberculosis.J Ethnopharmacol. 2010 Jul 6;130(1):151-7
|
| Curator | |
| Compound ID | 1251 |
| Compound Structure | |
| Plant Source | Berchemia discolor (Klotzsch) Hemsl. Common Name:Bird - Plum, Brown Ivory |
| Source Family | Rhamnaceae |
| Origin | Africa |
| Plant Part Used | Bark |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Rifampin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (2 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Infertility and Menorrhagia |
| PubMed ID [Source Literature] | 20447452 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Green E, Samie A, Obi CL, Bessong PO, Ndip RN.Inhibitory properties of selected South African medicinal plants against Mycobacterium tuberculosis.J Ethnopharmacol. 2010 Jul 6;130(1):151-7
|
| Curator | |
| Compound ID | 1252 |
| Compound Structure | |
| Plant Source | Berchemia discolor (Klotzsch) Hemsl. Common Name:Bird - Plum, Brown Ivory |
| Source Family | Rhamnaceae |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Rifampin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (2 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Infertility and Menorrhagia |
| PubMed ID [Source Literature] | 20447452 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Green E, Samie A, Obi CL, Bessong PO, Ndip RN.Inhibitory properties of selected South African medicinal plants against Mycobacterium tuberculosis.J Ethnopharmacol. 2010 Jul 6;130(1):151-7
|
| Curator | |
| Compound ID | 1253 |
| Compound Structure | |
| Plant Source | Berchemia discolor (Klotzsch) Hemsl. Common Name:Bird - Plum, Brown Ivory |
| Source Family | Rhamnaceae |
| Origin | Africa |
| Plant Part Used | Bark |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis 2 (Clinical isolates resistant to Streptomycin, Rifampin, Ethambutol, Isoniazid) |
| Assay / Test Done | Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Rifampin (100 µg/ml), Isoniazid (4.6 µg/ml), Ethambutol (12 µg/ml), Streptomycin (120 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Infertility and Menorrhagia |
| PubMed ID [Source Literature] | 20447452 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Green E, Samie A, Obi CL, Bessong PO, Ndip RN.Inhibitory properties of selected South African medicinal plants against Mycobacterium tuberculosis.J Ethnopharmacol. 2010 Jul 6;130(1):151-7
|
| Curator | |
| Compound ID | 1254 |
| Compound Structure | |
| Plant Source | Berchemia discolor (Klotzsch) Hemsl. Common Name:Bird - Plum, Brown Ivory |
| Source Family | Rhamnaceae |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis 2 (Clinical isolates resistant to Streptomycin, Rifampin, Ethambutol, Isoniazid) |
| Assay / Test Done | Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Rifampin (100 µg/ml), Isoniazid (4.6 µg/ml), Ethambutol (12 µg/ml), Streptomycin (120 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Infertility and Menorrhagia |
| PubMed ID [Source Literature] | 20447452 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Green E, Samie A, Obi CL, Bessong PO, Ndip RN.Inhibitory properties of selected South African medicinal plants against Mycobacterium tuberculosis.J Ethnopharmacol. 2010 Jul 6;130(1):151-7
|
| Curator | |
| Compound ID | 1291 |
| Compound Structure | |
| Plant Source | Bridelia micrantha (Hochst.) Baill Common Name:Coast Gold Leaf |
| Source Family | Euphorbiaceae |
| Origin | Africa |
| Plant Part Used | Bark |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Rifampin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (2.00 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Stomach aches, tapeworms, diarrhoea, headaches, sore joints, sore eyes, venereal diseases and fever |
| PubMed ID [Source Literature] | 20447452 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Green E, Samie A, Obi CL, Bessong PO, Ndip RN.Inhibitory properties of selected South African medicinal plants against Mycobacterium tuberculosis.J Ethnopharmacol. 2010 Jul 6;130(1):151-7
|
| Curator | |
| Compound ID | 1292 |
| Compound Structure | |
| Plant Source | Bridelia micrantha (Hochst.) Baill Common Name:Coast Gold Leaf |
| Source Family | Euphorbiaceae |
| Origin | Africa |
| Plant Part Used | Bark |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis 2 (Clinical isolates resistant to Streptomycin, Rifampin, Ethambutol, Isoniazid) |
| Assay / Test Done | Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Rifampin (100 µg/ml), Isoniazid (4.6 µg/ml), Ethambutol (12 µg/ml), Streptomycin (120 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Stomach aches, tapeworms, diarrhoea, headaches, sore joints, sore eyes, venereal diseases and fever |
| PubMed ID [Source Literature] | 20447452 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Green E, Samie A, Obi CL, Bessong PO, Ndip RN.Inhibitory properties of selected South African medicinal plants against Mycobacterium tuberculosis.J Ethnopharmacol. 2010 Jul 6;130(1):151-7
|
| Curator | |
| Compound ID | 1386 |
| Compound Structure | |
| Plant Source | Cassia petersiana Bolle Common Name:Monkey Pod |
| Source Family | Fabaceae |
| Origin | Africa |
| Plant Part Used | Bark |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Rifampin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (2 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 20447452 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Green E, Samie A, Obi CL, Bessong PO, Ndip RN.Inhibitory properties of selected South African medicinal plants against Mycobacterium tuberculosis.J Ethnopharmacol. 2010 Jul 6;130(1):151-7
|
| Curator | |
| Compound ID | 1387 |
| Compound Structure | |
| Plant Source | Cassia petersiana Bolle Common Name:Monkey pod |
| Source Family | Fabaceae |
| Origin | Africa |
| Plant Part Used | Bark |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis 2 (Clinical isolates resistant to Streptomycin, Rifampin, Ethambutol, Isoniazid) |
| Assay / Test Done | Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Rifampin (100 µg/ml), Isoniazid (4.6 µg/ml), Ethambutol (12 µg/ml), Streptomycin (120 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 20447452 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Green E, Samie A, Obi CL, Bessong PO, Ndip RN.Inhibitory properties of selected South African medicinal plants against Mycobacterium tuberculosis.J Ethnopharmacol. 2010 Jul 6;130(1):151-7
|
| Curator | |
| Compound ID | 1389 |
| Compound Structure | |
| Plant Source | Cassine papillosa (Hochst.) Kuntze Common Name: |
| Source Family | Celastraceae |
| Origin | Africa |
| Plant Part Used | Bark |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Chest congestion, tuberculosis |
| PubMed ID [Source Literature] | 10473184 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Lall N, Meyer JJ.In vitro inhibition of drug-resistant and drug-sensitive strains of Mycobacterium tuberculosis by ethnobotanically selected South African plants.J Ethnopharmacol. 1999 Sep;66(3):347-54
|
| Curator | |
| Compound ID | 1436 |
| Compound Structure | |
| Plant Source | Chenopodium ambrosioides L. Common Name:Indian Wormseed, Sweet Pigweed, Mexican Tea (English), Sugandh - Vaastuuka, Kshetra - Vaastuuka (Sanskrit) |
| Source Family | Chenopodiaceae |
| Origin | India, Africa |
| Plant Part Used | Aerial |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, pulmonary complaints, tuberculosis |
| PubMed ID [Source Literature] | 10473184 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Lall N, Meyer JJ.In vitro inhibition of drug-resistant and drug-sensitive strains of Mycobacterium tuberculosis by ethnobotanically selected South African plants.J Ethnopharmacol. 1999 Sep;66(3):347-54
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1522 |
| Compound Structure | |
| Plant Source | Combretum molle R. Br. Ex G. Don Common Name:Velvet Leaf Willow, Velvet Leaf Combretum, Velvet Bush Willow |
| Source Family | Combretaceae |
| Origin | Africa |
| Plant Part Used | Bark |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, tuberculosis, juice drunk to treat chest complaints |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Hutchings, A., Johnson, C.Glimpses of a Xhosa herbal.Veld & flora.June 1986. v. 72 (2)
2) Lall N, Meyer JJ.In vitro inhibition of drug-resistant and drug-sensitive strains of Mycobacterium tuberculosis by ethnobotanically selected South African plants.J Ethnopharmacol. 1999 Sep;66(3):347-54
3) http://www.worldagroforestry.org/treedb2/AFTPDFS/Combretum_molle.pdf
|
| Curator | |
| Compound ID | 1561 |
| Compound Structure | |
| Plant Source | Croton pseudopulchellus Pax Common Name: |
| Source Family | Euphorbiaceae |
| Origin | Africa |
| Plant Part Used | Aerial |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 10473184 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Lall N, Meyer JJ.In vitro inhibition of drug-resistant and drug-sensitive strains of Mycobacterium tuberculosis by ethnobotanically selected South African plants.J Ethnopharmacol. 1999 Sep;66(3):347-54
|
| Curator | |
| Compound ID | 1565 |
| Compound Structure | |
| Plant Source | Cryptocarya latifolia Sond. Common Name:Broad - Leaved Quince |
| Source Family | Lauraceae |
| Origin | Africa |
| Plant Part Used | Bark |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 0.001 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Chest ailments, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Lall, N., Meyer, J.J., Wang, Y., Bapela, N.B., van Rensburg, C.E.J., Fourie, B., Franzblau, S.G..Characterization of Intracellular Activity of Antitubercular Constituents the Roots of Euclea natalensis.Pharmaceutical Biology (Formerly International Journal of Pharmacognosy), Volume 43, Number 4, June 2005 , pp. 353-357
2) http://www.growwild.co.za/node/223
|
| Curator | |
| Compound ID | 1623 |
| Compound Structure | |
| Plant Source | Ekebergia capensis Sparrm. Common Name:Cape Ash, Dogplum |
| Source Family | Meliaceae |
| Origin | Africa |
| Plant Part Used | Root, leaf, bark |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Chronic coughs, respiratory chest complaints, Tuberculosis |
| PubMed ID [Source Literature] | 10473184 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Lall N, Meyer JJ.In vitro inhibition of drug-resistant and drug-sensitive strains of Mycobacterium tuberculosis by ethnobotanically selected South African plants.J Ethnopharmacol. 1999 Sep;66(3):347-54
2) http://www.plantzAfrica.com/plantefg/ekebergcap.htm
3) Watt, John Mitchell, and Maria Gerdina Breyer-Brandwijk. 1962. The medicinal and poisonous plants of southern and eastern Africa; being an account of their medicinal and other uses, chemical composition, pharmacological effects and toxicology in man and animal. Edinburgh: Livingstone (2nd Editio
|
| Curator | |
| Compound ID | 1670 |
| Compound Structure | |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (2.93 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 5.7 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
| Compound ID | 1673 |
| Compound Structure | |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium fortuitum |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (1.95 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 58.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
| Compound ID | 1676 |
| Compound Structure | |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (3.26 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 260.38 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
| Compound ID | 1679 |
| Compound Structure | |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium bovis ATCC |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (1.49 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 26.01 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
| Compound ID | 1682 |
| Compound Structure | |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (0.062 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
| Compound ID | 1684 |
| Compound Structure |  |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (2.93 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2.44 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Diospyrin |
| PubChem ID | 308140 |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | Powdered plant material was combined in a 1 : 10 ratio with solvent and shaken vigorously for 30 min using a mechanical shaker before being filtered through Whatman No. 1 filter paper. The solvent was removed in a stream of air and the residues redissolved in DMSO to a concentration of 200 mg/ml |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Nathalene, Quinone, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth supplemented with 10 % OADC medium |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 374.079 |
| Molecular Formula | C22H14O6
|
| SMILES | Oc1c(C2=CC(=O)c3c(C2=O)cc(cc3O)C)c(cc2c1C(=O)C=CC2=O)C |
| XLogP | 1.294 |
| PSA | 108.740 |
| H-bond Donor | 2 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
| Compound ID | 1686 |
| Compound Structure |  |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (2.93 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.57 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 7 - Methyljuglone |
| PubChem ID | 26905 |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | Powdered plant material was combined in a 1 : 10 ratio with solvent and shaken vigorously for 30 min using a mechanical shaker before being filtered through Whatman No. 1 filter paper. The solvent was removed in a stream of air and the residues redissolved in DMSO to a concentration of 200 mg/ml |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Napthalene, Quinone, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth supplemented with 10 % OADC medium |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 188.047 |
| Molecular Formula | C11H8O3
|
| SMILES | Oc1c2c(cc(c1)C)C(=O)C=CC2=O |
| XLogP | 0.898 |
| PSA | 54.370 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
| Compound ID | 1688 |
| Compound Structure | |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium fortuitum |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (1.95 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 41.67 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Diospyrin |
| PubChem ID | 308140 |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | Powdered plant material was combined in a 1 : 10 ratio with solvent and shaken vigorously for 30 min using a mechanical shaker before being filtered through Whatman No. 1 filter paper. The solvent was removed in a stream of air and the residues redissolved in DMSO to a concentration of 200 mg/ml |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Nathalene, Quinone, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth supplemented with 10 % OADC medium |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 374.079 |
| Molecular Formula | C22H14O6
|
| SMILES | Oc1c(C2=CC(=O)c3c(C2=O)cc(cc3O)C)c(cc2c1C(=O)C=CC2=O)C |
| XLogP | 1.294 |
| PSA | 108.740 |
| H-bond Donor | 2 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
