| Compound ID | 1806 |
| Compound Structure | |
| Plant Source | Garcinia polyantha Oliv. Common Name: |
| Source Family | Clusiaceae |
| Origin | Africa |
| Plant Part Used | Stem bark |
| Extract | Dichloromethane:Methanol |
| Target Bacteria | Mycobacterium smegmatis, Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:01 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Wounds, various uses |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Kuete V., Meli A.L., Komguem J., Louh G.N., Tangmouo J.G., Lontsi D., Meyer J.J.M., Lall N.Antimycobacterial, Antibacterial and Antifungal Activities of the Methanolic Extract and Compounds from Garcinia Polyantha. Pharmacologyonline 3 : 87-95 (2007)
|
| Curator | |
| Compound ID | 3588 |
| Compound Structure |  |
| Plant Source | Caleolaria pinnifolia Cav. Common Name:NR |
| Source Family | Scrophulariaceae |
| Origin | NR |
| Plant Part Used | Aerial |
| Extract | Dichloromethane:Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.06 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 19 - Malonyloxydehydroabietinol |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 12898418 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, Malonyl |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 372.230 |
| Molecular Formula | C23H32O4 |
| SMILES | C1CC[C@](C2[C@@]1(c1c(CC2)cc(cc1)C(C)C)C)(C)COC(=O)CC(=O)O |
| XLogP | 8.774 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Woldemichael GM, Franzblau SG, Zhang F, Wang Y, Timmermann BN.Inhibitory effect of sterols from Ruprechtia triflora and diterpenes from Calceolaria pinnifolia on the growth of Mycobacterium tuberculosis.Planta Med. 2003 Jul;69(7):628-31
|
| Curator | Reshmi, vikramjitmandal |
| Compound ID | 3589 |
| Compound Structure |  |
| Plant Source | Caleolaria pinnifolia Cav. Common Name:NR |
| Source Family | Scrophulariaceae |
| Origin | NR |
| Plant Part Used | Aerial |
| Extract | Dichloromethane:Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.06 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 19 - Methylmalonyloxy - Ent - Isopimara - 8(9), 15 - Diene |
| PubChem ID | 639656 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 12898418 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, Malonyl |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 388.261 |
| Molecular Formula | C24H36O4 |
| SMILES | O(C[C@]1([C@@H]2[C@](C3=C(CC2)C[C@](CC3)(C)C=C)(CCC1)C)C)C(=O)CC(=O)OC |
| XLogP | 6.720 |
| PSA | 52.600 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Woldemichael GM, Franzblau SG, Zhang F, Wang Y, Timmermann BN.Inhibitory effect of sterols from Ruprechtia triflora and diterpenes from Calceolaria pinnifolia on the growth of Mycobacterium tuberculosis.Planta Med. 2003 Jul;69(7):628-31
|
| Curator | Reshmi, vikramjitmandal |
| Compound ID | 3590 |
| Compound Structure |  |
| Plant Source | Caleolaria pinnifolia Cav. Common Name:NR |
| Source Family | Scrophulariaceae |
| Origin | NR |
| Plant Part Used | Aerial |
| Extract | Dichloromethane:Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.06 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 3 - Epi - Ursolic Acid |
| PubChem ID | 64945 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 12898418 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3 |
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CC[C@H]([C@@H]3C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 8.954 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Woldemichael GM, Franzblau SG, Zhang F, Wang Y, Timmermann BN.Inhibitory effect of sterols from Ruprechtia triflora and diterpenes from Calceolaria pinnifolia on the growth of Mycobacterium tuberculosis.Planta Med. 2003 Jul;69(7):628-31
|
| Curator | Reshmi, vikramjitmandal |
| Compound ID | 3591 |
| Compound Structure |  |
| Plant Source | Ruprechtia trifolia Griseb Common Name: |
| Source Family | Polynaceae |
| Origin | |
| Plant Part Used | Aerial |
| Extract | Dichloromethane:Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.06 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 5α, 8α - Epidioxyergosta - 6, 22 - Dien - 3β - Yl Stearate |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 12898418 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Peroxy, Ester, Stearate |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 694.590 |
| Molecular Formula | C46H78O4 |
| SMILES | C12[C@@]3([C@@]4(C=C[C@@]1(C1[C@](CC2)([C@H](CC1)[C@@H](/C=C/[C@@H](C(C)C)C)C)C)OO4)C[C@H](CC3)OC(=O)CCCCCCCCCCCCCCCCC)C |
| XLogP | 17.911 |
| PSA | 44.760 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 22 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Woldemichael GM, Franzblau SG, Zhang F, Wang Y, Timmermann BN.Inhibitory effect of sterols from Ruprechtia triflora and diterpenes from Calceolaria pinnifolia on the growth of Mycobacterium tuberculosis.Planta Med. 2003 Jul;69(7):628-31
|
| Curator | Rachana, vikramjitmandal |
| Compound ID | 3593 |
| Compound Structure |  |
| Plant Source | Ruprechtia trifolia Griseb Common Name: |
| Source Family | Polynaceae |
| Origin | |
| Plant Part Used | Aerial |
| Extract | Dichloromethane:Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.06 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Stigmast - 4 - En - 6β - Ol - 3 - One |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 12898418 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Ketone, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 428.365 |
| Molecular Formula | C29H48O2 |
| SMILES | C1CC(=O)C=C2C(CC3C4CCC(C4(C)CCC3C12C)C(C)CCC(CC)C(C)C)O |
| XLogP | 9.980 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Woldemichael GM, Franzblau SG, Zhang F, Wang Y, Timmermann BN.Inhibitory effect of sterols from Ruprechtia triflora and diterpenes from Calceolaria pinnifolia on the growth of Mycobacterium tuberculosis.Planta Med. 2003 Jul;69(7):628-31
|
| Curator | Rachana, vikramjitmandal |