| Compound ID | 3872 |
| Compound Structure |  |
| Plant Source | Cananga odorata Common Name:Ylang - Ylang Tree |
| Source Family | Annonaceae |
| Origin | Colombia |
| Plant Part Used | Flower |
| Extract | Essential oil (1.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Isoniazid (0.19 ± 0.07 µg/ml), Rifampin (0.3 ± 0.21 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 300 ± 217 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Linalool (20.7 %) |
| PubChem ID | 6549 |
| Ethnomedicinal Information | Stomach ailment, fever, inflammation, burning sensation, malarial fever, asthma with aromatherapy, hypertension, anxiety, depression and as a sexual stimulant |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | The essential oils were extracted from a 300 g sample of plant leaves and stems by microwave - assisted hydrodistillation (30 min, 250 ml water), using a Clevenger - type distillation apparatus and a Dean - Stark distillation trap in a domestic microwave oven. Sodium sulfate was added as a drying agent to the decanted essential oil |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Terpene, Monoterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Lowestein - Jensenn medium, Middlebrook 7H9 medium [The later was supplemented with 10 % OADC (Oleic Acid - Albumin - Dextrose - Catalase) and 0.001 % Tween 80] |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 154.136 |
| Molecular Formula | C10H18O |
| SMILES | OC(CCC=C(C)C)(C)C=C |
| XLogP | 2.468 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) http://ayurvedicmedicinalplants.com/index.php?option=com_zoom&Itemid=26&page=view&catid=3&key=10&hit=1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3873 |
| Compound Structure |  |
| Plant Source | Cananga odorata Common Name:Ylang - Ylang Tree |
| Source Family | Annonaceae |
| Origin | Colombia |
| Plant Part Used | Flower |
| Extract | Essential oil (1.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Isoniazid (0.19 ± 0.07 µg/ml), Rifampin (0.3 ± 0.21 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 300 ± 217 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Benzyl acetate (20.6%) |
| PubChem ID | 8785 |
| Ethnomedicinal Information | Stomach ailment, fever, inflammation, burning sensation, malarial fever, asthma with aromatherapy, hypertension, anxiety, depression and as a sexual stimulant |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | The essential oils were extracted from a 300 g sample of plant leaves and stems by microwave - assisted hydrodistillation (30 min, 250 ml water), using a Clevenger - type distillation apparatus and a Dean - Stark distillation trap in a domestic microwave oven. Sodium sulfate was added as a drying agent to the decanted essential oil |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, O-Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | Lowestein - Jensenn medium, Middlebrook 7H9 medium [The later was supplemented with 10 % OADC (Oleic Acid - Albumin - Dextrose - Catalase) and 0.001 % Tween 80] |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 150.068 |
| Molecular Formula | C9H10O2 |
| SMILES | O(Cc1ccccc1)C(=O)C |
| XLogP | 3.149 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) http://ayurvedicmedicinalplants.com/index.php?option=com_zoom&Itemid=26&page=view&catid=3&key=10&hit=1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3874 |
| Compound Structure |  |
| Plant Source | Cananga odorata Common Name:Ylang - Ylang Tree |
| Source Family | Annonaceae |
| Origin | Colombia |
| Plant Part Used | Flower |
| Extract | Essential oil (1.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Isoniazid (0.19 ± 0.07 µg/ml), Rifampin (0.3 ± 0.21 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 300 ± 217 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Benzyl benzoate (14.2 %) |
| PubChem ID | 2345 |
| Ethnomedicinal Information | Stomach ailment, fever, inflammation, burning sensation, malarial fever, asthma with aromatherapy, hypertension, anxiety, depression and as a sexual stimulant |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | The essential oils were extracted from a 300 g sample of plant leaves and stems by microwave - assisted hydrodistillation (30 min, 250 ml water), using a Clevenger - type distillation apparatus and a Dean - Stark distillation trap in a domestic microwave oven. Sodium sulfate was added as a drying agent to the decanted essential oil |
| Chemical Classification [Active Compound] | Aromatic, Ester
|
| Media / Broth Used [Antimicrobial Assay/Test] | Lowestein - Jensenn medium, Middlebrook 7H9 medium [The later was supplemented with 10 % OADC (Oleic Acid - Albumin - Dextrose - Catalase) and 0.001 % Tween 80] |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 212.084 |
| Molecular Formula | C14H12O2 |
| SMILES | O(Cc1ccccc1)C(=O)c1ccccc1 |
| XLogP | 5.895 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) http://ayurvedicmedicinalplants.com/index.php?option=com_zoom&Itemid=26&page=view&catid=3&key=10&hit=1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3875 |
| Compound Structure |  |
| Plant Source | Cananga odorata Common Name:Ylang - Ylang Tree |
| Source Family | Annonaceae |
| Origin | Colombia |
| Plant Part Used | Flower |
| Extract | Essential oil (1.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Isoniazid (0.19 ± 0.07 µg/ml), Rifampin (0.3 ± 0.21 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 300 ± 217 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Germacrene D (10.2 %) |
| PubChem ID | 5373727 |
| Ethnomedicinal Information | Stomach ailment, fever, inflammation, burning sensation, malarial fever, asthma with aromatherapy, hypertension, anxiety, depression and as a sexual stimulant |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | The essential oils were extracted from a 300 g sample of plant leaves and stems by microwave - assisted hydrodistillation (30 min, 250 ml water), using a Clevenger - type distillation apparatus and a Dean - Stark distillation trap in a domestic microwave oven. Sodium sulfate was added as a drying agent to the decanted essential oil |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Sesquiterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | Lowestein - Jensenn medium, Middlebrook 7H9 medium [The later was supplemented with 10 % OADC (Oleic Acid - Albumin - Dextrose - Catalase) and 0.001 % Tween 80] |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 204.188 |
| Molecular Formula | C15H24 |
| SMILES | C1(C(C)C)CC/C(=CCCC(=C)/C=C1)/C |
| XLogP | 6.294 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) http://ayurvedicmedicinalplants.com/index.php?option=com_zoom&Itemid=26&page=view&catid=3&key=10&hit=1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3876 |
| Compound Structure |  |
| Plant Source | Cananga odorata Common Name:Ylang - Ylang Tree |
| Source Family | Annonaceae |
| Origin | Colombia |
| Plant Part Used | Flower |
| Extract | Essential oil (1.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Isoniazid (0.19 ± 0.07 µg/ml), Rifampin (0.3 ± 0.21 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 300 ± 217 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | P - Methyl anisole (6.8%) |
| PubChem ID | 7731 |
| Ethnomedicinal Information | Stomach ailment, fever, inflammation, burning sensation, malarial fever, asthma with aromatherapy, hypertension, anxiety, depression and as a sexual stimulant |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | The essential oils were extracted from a 300 g sample of plant leaves and stems by microwave - assisted hydrodistillation (30 min, 250 ml water), using a Clevenger - type distillation apparatus and a Dean - Stark distillation trap in a domestic microwave oven. Sodium sulfate was added as a drying agent to the decanted essential oil |
| Chemical Classification [Active Compound] | Aromatic, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Lowestein - Jensenn medium, Middlebrook 7H9 medium [The later was supplemented with 10 % OADC (Oleic Acid - Albumin - Dextrose - Catalase) and 0.001 % Tween 80] |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 122.073 |
| Molecular Formula | C8H10O |
| SMILES | O(c1ccc(cc1)C)C |
| XLogP | 2.886 |
| PSA | 9.230 |
| H-bond Donor | 0 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) http://ayurvedicmedicinalplants.com/index.php?option=com_zoom&Itemid=26&page=view&catid=3&key=10&hit=1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3877 |
| Compound Structure |  |
| Plant Source | Cananga odorata Common Name:Ylang - Ylang Tree |
| Source Family | Annonaceae |
| Origin | Colombia |
| Plant Part Used | Flower |
| Extract | Essential oil (1.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Isoniazid (0.19 ± 0.07 µg/ml), Rifampin (0.3 ± 0.21 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 300 ± 217 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Cinnamyl acetate (5.1%) |
| PubChem ID | 5282110 |
| Ethnomedicinal Information | Stomach ailment, fever, inflammation, burning sensation, malarial fever, asthma with aromatherapy, hypertension, anxiety, depression and as a sexual stimulant |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | The essential oils were extracted from a 300 g sample of plant leaves and stems by microwave - assisted hydrodistillation (30 min, 250 ml water), using a Clevenger - type distillation apparatus and a Dean - Stark distillation trap in a domestic microwave oven. Sodium sulfate was added as a drying agent to the decanted essential oil |
| Chemical Classification [Active Compound] | Aromatic, Cinnamyl, O-Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | Lowestein - Jensenn medium, Middlebrook 7H9 medium [The later was supplemented with 10 % OADC (Oleic Acid - Albumin - Dextrose - Catalase) and 0.001 % Tween 80] |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 176.084 |
| Molecular Formula | C11H12O2 |
| SMILES | O(C/C=C/c1ccccc1)C(=O)C |
| XLogP | 4.548 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) http://ayurvedicmedicinalplants.com/index.php?option=com_zoom&Itemid=26&page=view&catid=3&key=10&hit=1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3878 |
| Compound Structure |  |
| Plant Source | Cananga odorata Common Name:Ylang - Ylang Tree |
| Source Family | Annonaceae |
| Origin | Colombia |
| Plant Part Used | Flower |
| Extract | Essential oil (1.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Isoniazid (0.19 ± 0.07 µg/ml), Rifampin (0.3 ± 0.21 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 300 ± 217 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Geranyl acetate (2.9 %) |
| PubChem ID | 1549026 |
| Ethnomedicinal Information | Stomach ailment, fever, inflammation, burning sensation, malarial fever, asthma with aromatherapy, hypertension, anxiety, depression and as a sexual stimulant |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | The essential oils were extracted from a 300 g sample of plant leaves and stems by microwave - assisted hydrodistillation (30 min, 250 ml water), using a Clevenger - type distillation apparatus and a Dean - Stark distillation trap in a domestic microwave oven. Sodium sulfate was added as a drying agent to the decanted essential oil |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Ester |
| Media / Broth Used [Antimicrobial Assay/Test] | Lowestein - Jensenn medium, Middlebrook 7H9 medium [The later was supplemented with 10 % OADC (Oleic Acid - Albumin - Dextrose - Catalase) and 0.001 % Tween 80] |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 196.146 |
| Molecular Formula | C12H20O2 |
| SMILES | O(C/C=C(/CCC=C(C)C)C)C(=O)C |
| XLogP | 3.264 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) http://ayurvedicmedicinalplants.com/index.php?option=com_zoom&Itemid=26&page=view&catid=3&key=10&hit=1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3879 |
| Compound Structure |  |
| Plant Source | Cananga odorata Common Name:Ylang - Ylang Tree |
| Source Family | Annonaceae |
| Origin | Colombia |
| Plant Part Used | Flower |
| Extract | Essential oil (1.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Isoniazid (0.19 ± 0.07 µg/ml), Rifampin (0.3 ± 0.21 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 300 ± 217 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | α - Humulene (2.8 %) |
| PubChem ID | 5281520 |
| Ethnomedicinal Information | Stomach ailment, fever, inflammation, burning sensation, malarial fever, asthma with aromatherapy, hypertension, anxiety, depression and as a sexual stimulant |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | The essential oils were extracted from a 300 g sample of plant leaves and stems by microwave - assisted hydrodistillation (30 min, 250 ml water), using a Clevenger - type distillation apparatus and a Dean - Stark distillation trap in a domestic microwave oven. Sodium sulfate was added as a drying agent to the decanted essential oil |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Sesquiterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | Lowestein - Jensenn medium, Middlebrook 7H9 medium [The later was supplemented with 10 % OADC (Oleic Acid - Albumin - Dextrose - Catalase) and 0.001 % Tween 80] |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 204.188 |
| Molecular Formula | C15H24 |
| SMILES | C1(C/C=C(/CC/C=C(/C/C=C/1)C)C)(C)C |
| XLogP | 5.940 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) http://ayurvedicmedicinalplants.com/index.php?option=com_zoom&Itemid=26&page=view&catid=3&key=10&hit=1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3880 |
| Compound Structure |  |
| Plant Source | Cananga odorata Common Name:Ylang - Ylang Tree |
| Source Family | Annonaceae |
| Origin | Colombia |
| Plant Part Used | Flower |
| Extract | Essential oil (1.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Isoniazid (0.19 ± 0.07 µg/ml), Rifampin (0.3 ± 0.21 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 300 ± 217 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | (E,E)-Franesene (2.4 %) |
| PubChem ID | 5281516 |
| Ethnomedicinal Information | Stomach ailment, fever, inflammation, burning sensation, malarial fever, asthma with aromatherapy, hypertension, anxiety, depression and as a sexual stimulant |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | The essential oils were extracted from a 300 g sample of plant leaves and stems by microwave - assisted hydrodistillation (30 min, 250 ml water), using a Clevenger - type distillation apparatus and a Dean - Stark distillation trap in a domestic microwave oven. Sodium sulfate was added as a drying agent to the decanted essential oil |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Terpene, Sesquiterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | Lowestein - Jensenn medium, Middlebrook 7H9 medium [The later was supplemented with 10 % OADC (Oleic Acid - Albumin - Dextrose - Catalase) and 0.001 % Tween 80] |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 204.188 |
| Molecular Formula | C15H24 |
| SMILES | C(CC=C(C)C)/C(=C/C/C=C(C)/C=C)/C |
| XLogP | 6.136 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) http://ayurvedicmedicinalplants.com/index.php?option=com_zoom&Itemid=26&page=view&catid=3&key=10&hit=1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3881 |
| Compound Structure |  |
| Plant Source | Cananga odorata Common Name:Ylang - Ylang Tree |
| Source Family | Annonaceae |
| Origin | Colombia |
| Plant Part Used | Flower |
| Extract | Essential oil (1.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Isoniazid (0.19 ± 0.07 µg/ml), Rifampin (0.3 ± 0.21 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 125 ± 0.01 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Benzyl salicylate (2.3 %) |
| PubChem ID | 8363 |
| Ethnomedicinal Information | Stomach ailment, fever, inflammation, burning sensation, malarial fever, asthma with aromatherapy, hypertension, anxiety, depression and as a sexual stimulant |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | The essential oils were extracted from a 300 g sample of plant leaves and stems by microwave - assisted hydrodistillation (30 min, 250 ml water), using a Clevenger - type distillation apparatus and a Dean - Stark distillation trap in a domestic microwave oven. Sodium sulfate was added as a drying agent to the decanted essential oil |
| Chemical Classification [Active Compound] | Aromatic, Ester, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Lowestein - Jensenn medium, Middlebrook 7H9 medium [The later was supplemented with 10 % OADC (Oleic Acid - Albumin - Dextrose - Catalase) and 0.001 % Tween 80] |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 228.079 |
| Molecular Formula | C14H12O3 |
| SMILES | O(Cc1ccccc1)C(=O)c1c(O)cccc1 |
| XLogP | 5.493 |
| PSA | 46.530 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) http://ayurvedicmedicinalplants.com/index.php?option=com_zoom&Itemid=26&page=view&catid=3&key=10&hit=1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
