| Compound ID | 1192 |
| Compound Structure | |
| Plant Source | Anogeissus leiocarpus (DC.) Guill. & Perr. Common Name:African Birch |
| Source Family | Combretaceae |
| Origin | Nigeria |
| Plant Part Used | Root bark, stem bark |
| Extract | Hexane |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Rifampin (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 312.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Asthma, cough, tuberculosis, worm killer, gonorrhoea |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mann, A., Amupitan, J.O., Oyewale, A.O., Okogun, J.I., Ibrahim, K., Oladosu, P., Lawson, L., Olajide, I., and Nnamdi, A., 2008, Evaluation of in vitro antimycobacterial activity of Nigerian plants used for treatment of respiratory diseases. Afr. J. Biotech., 7(11), 1630-1636
2) http://www.ajol.info/index.php/ajb/article/viewFile/58747/47072
|
| Curator | |
| Compound ID | 1301 |
| Compound Structure |  |
| Plant Source | Buddleja saligna L. Common Name:Squarestem Butterflybush |
| Source Family | Buddlejaceae |
| Origin | Africa |
| Plant Part Used | Leaf, stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | Rifampin (2.5 µg/disk) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 5 µg/Disk |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleanolic acid |
| PubChem ID | 10494 |
| Ethnomedicinal Information | Tuberculosis symptoms |
| PubMed ID [Source Literature] | 18384988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.052 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bamuamba K, Gammon DW, Meyers P, Dijoux-Franca MG, Scott G.Anti-mycobacterial activity of five plant species used as traditional medicines in the Western Cape Province (South Africa).J Ethnopharmacol. 2008 May 8;117(2):385-90
|
| Curator | |
| Compound ID | 1302 |
| Compound Structure |  |
| Plant Source | Buddleja saligna L. Common Name:Squarestem Butterflybush |
| Source Family | Buddlejaceae |
| Origin | Africa |
| Plant Part Used | Leaf, stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Bioautography on TLC plates |
| Positive Control Used (conc.) | Rifampin (2.5 µg/spot) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2.5 µg/spot |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleanolic acid |
| PubChem ID | 10494 |
| Ethnomedicinal Information | Tuberculosis symptoms |
| PubMed ID [Source Literature] | 18384988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.052 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bamuamba K, Gammon DW, Meyers P, Dijoux-Franca MG, Scott G.Anti-mycobacterial activity of five plant species used as traditional medicines in the Western Cape Province (South Africa).J Ethnopharmacol. 2008 May 8;117(2):385-90
|
| Curator | |
| Compound ID | 1303 |
| Compound Structure |  |
| Plant Source | Buddleja saligna L. Common Name:Squarestem Butterflybush |
| Source Family | Buddlejaceae |
| Origin | Africa |
| Plant Part Used | Leaf, stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium avium (ATCC 25291) |
| Assay / Test Done | Bioautography on TLC plates |
| Positive Control Used (conc.) | Rifampin (2.5 µg/spot) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.25 µg/spot |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleanolic acid |
| PubChem ID | 10494 |
| Ethnomedicinal Information | Tuberculosis symptoms |
| PubMed ID [Source Literature] | 18384988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.052 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bamuamba K, Gammon DW, Meyers P, Dijoux-Franca MG, Scott G.Anti-mycobacterial activity of five plant species used as traditional medicines in the Western Cape Province (South Africa).J Ethnopharmacol. 2008 May 8;117(2):385-90
|
| Curator | |
| Compound ID | 1304 |
| Compound Structure |  |
| Plant Source | Buddleja saligna L. Common Name:Squarestem Butterflybush |
| Source Family | Buddlejaceae |
| Origin | Africa |
| Plant Part Used | Leaf, stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium scrofulaceum (ATCC 19981) |
| Assay / Test Done | Bioautography on TLC plates |
| Positive Control Used (conc.) | Rifampin (2.5 µg/spot) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.25 µg/spot |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleanolic acid |
| PubChem ID | 10494 |
| Ethnomedicinal Information | Tuberculosis symptoms |
| PubMed ID [Source Literature] | 18384988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.052 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bamuamba K, Gammon DW, Meyers P, Dijoux-Franca MG, Scott G.Anti-mycobacterial activity of five plant species used as traditional medicines in the Western Cape Province (South Africa).J Ethnopharmacol. 2008 May 8;117(2):385-90
|
| Curator | |
| Compound ID | 1305 |
| Compound Structure |  |
| Plant Source | Buddleja saligna L. Common Name:Squarestem Butterflybush |
| Source Family | Buddlejaceae |
| Origin | Africa |
| Plant Part Used | Leaf, stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium microti (ATCC 19422) |
| Assay / Test Done | Bioautography on TLC plates |
| Positive Control Used (conc.) | Rifampin (2.5 µg/spot) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2.5 µg/spot |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleanolic acid |
| PubChem ID | 10494 |
| Ethnomedicinal Information | Tuberculosis symptoms |
| PubMed ID [Source Literature] | 18384988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.052 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bamuamba K, Gammon DW, Meyers P, Dijoux-Franca MG, Scott G.Anti-mycobacterial activity of five plant species used as traditional medicines in the Western Cape Province (South Africa).J Ethnopharmacol. 2008 May 8;117(2):385-90
|
| Curator | |
| Compound ID | 1426 |
| Compound Structure | |
| Plant Source | Chamaedora tepejilote Common Name:Pacaya Palm |
| Source Family | Arecaceae (Palmae) |
| Origin | Mexico |
| Plant Part Used | Leaf |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Radiorespirometric BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, Pneumonia |
| PubMed ID [Source Literature] | 16041726 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Jiménez A, Meckes M, Alvarez V, Torres J, Parra R. Secondary metabolites from Chamaedora tepejilote (Palmae) are active against Mycobacterium tuberculosis.Phytother Res. 2005 Apr;19(4):320-2
|
| Curator | |
| Compound ID | 1428 |
| Compound Structure |  |
| Plant Source | Chamaedora tepejilote Common Name:Pacaya Palm |
| Source Family | Arecaceae (Palmae) |
| Origin | Mexico |
| Plant Part Used | Leaf |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Radiorespirometric BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | 99 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ursolic acid |
| PubChem ID | 64945 |
| Ethnomedicinal Information | Cough, Pneumonia |
| PubMed ID [Source Literature] | 16041726 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CC[C@H]([C@@H]3C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 8.954 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Jiménez A, Meckes M, Alvarez V, Torres J, Parra R. Secondary metabolites from Chamaedora tepejilote (Palmae) are active against Mycobacterium tuberculosis.Phytother Res. 2005 Apr;19(4):320-2
|
| Curator | |
| Compound ID | 1429 |
| Compound Structure |  |
| Plant Source | Chamaedora tepejilote Common Name:Pacaya Palm |
| Source Family | Arecaceae (Palmae) |
| Origin | Mexico |
| Plant Part Used | Leaf |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Radiorespirometric BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | 99 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Squalene |
| PubChem ID | 638072 |
| Ethnomedicinal Information | Cough, Pneumonia |
| PubMed ID [Source Literature] | 16041726 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Terpene, Triterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 410.391 |
| Molecular Formula | C30H50
|
| SMILES | C(C/C=C(/CCC=C(C)C)C)/C(=C/CC/C=C(/CC/C=C(/CCC=C(C)C)C)C)/C |
| XLogP | 11.482 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 15 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Jiménez A, Meckes M, Alvarez V, Torres J, Parra R. Secondary metabolites from Chamaedora tepejilote (Palmae) are active against Mycobacterium tuberculosis.Phytother Res. 2005 Apr;19(4):320-2
|
| Curator | |
| Compound ID | 1430 |
| Compound Structure |  |
| Plant Source | Chamaedora tepejilote Common Name:Pacaya Palm |
| Source Family | Arecaceae (Palmae) |
| Origin | Mexico |
| Plant Part Used | Leaf |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Radiorespirometric BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | 99 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Farnesol |
| PubChem ID | 445070 |
| Ethnomedicinal Information | Cough, Pneumonia |
| PubMed ID [Source Literature] | 16041726 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Terpene, Sesquiterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 222.198 |
| Molecular Formula | C15H26O
|
| SMILES | OC/C=C(/CC/C=C(/CCC=C(C)C)C)C |
| XLogP | 4.346 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Jiménez A, Meckes M, Alvarez V, Torres J, Parra R. Secondary metabolites from Chamaedora tepejilote (Palmae) are active against Mycobacterium tuberculosis.Phytother Res. 2005 Apr;19(4):320-2
|
| Curator | |
| Compound ID | 1461 |
| Compound Structure | |
| Plant Source | Citrus aurantifolia Common Name:Lime, Common Lime, Sour Lime |
| Source Family | Rutaceae |
| Origin | Mexico |
| Plant Part Used | Peel |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Sensitive) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory diseases, antiseptic |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.flowersofIndia.net/catalog/slides/Lime.html
|
| Curator | |
| Compound ID | 1462 |
| Compound Structure | |
| Plant Source | Citrus aurantifolia Common Name:Lime, Common Lime, Sour Lime |
| Source Family | Rutaceae |
| Origin | Mexico |
| Plant Part Used | Peel |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Rifampin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory diseases, antiseptic |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.flowersofIndia.net/catalog/slides/Lime.html
|
| Curator | |
| Compound ID | 1463 |
| Compound Structure | |
| Plant Source | Citrus aurantifolia Common Name:Lime, Common Lime, Sour Lime |
| Source Family | Rutaceae |
| Origin | Mexico |
| Plant Part Used | Peel |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis (Isoniazid resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory diseases, antiseptic |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.flowersofIndia.net/catalog/slides/Lime.html
|
| Curator | |
| Compound ID | 1464 |
| Compound Structure | |
| Plant Source | Citrus aurantifolia Common Name:Lime, Common Lime, Sour Lime |
| Source Family | Rutaceae |
| Origin | Mexico |
| Plant Part Used | Peel |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis (Streptomycin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory diseases, antiseptic |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.flowersofIndia.net/catalog/slides/Lime.html
|
| Curator | |
| Compound ID | 1465 |
| Compound Structure | |
| Plant Source | Citrus aurantifolia Common Name:Lime, Common Lime, Sour Lime |
| Source Family | Rutaceae |
| Origin | Mexico |
| Plant Part Used | Peel |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis (Ethambutol resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory diseases, antiseptic |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.flowersofIndia.net/catalog/slides/Lime.html
|
| Curator | |
| Compound ID | 1468 |
| Compound Structure | |
| Plant Source | Citrus sinensis Common Name:Sweet Orange, Navel Orange, Blood Orange |
| Source Family | Rutaceae |
| Origin | Mexico |
| Plant Part Used | Peel |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Sensitive) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory diseases, antiseptic, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1469 |
| Compound Structure | |
| Plant Source | Citrus sinensis Common Name:Sweet Orange, Navel Orange, Blood Orange |
| Source Family | Rutaceae |
| Origin | Mexico |
| Plant Part Used | Peel |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Rifampin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory diseases, antiseptic, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1470 |
| Compound Structure | |
| Plant Source | Citrus sinensis Common Name:Sweet Orange, Navel Orange, Blood Orange |
| Source Family | Rutaceae |
| Origin | Mexico |
| Plant Part Used | Peel |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis (Isoniazid resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory diseases, antiseptic, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1471 |
| Compound Structure | |
| Plant Source | Citrus sinensis Common Name:Sweet Orange, Navel Orange, Blood Orange |
| Source Family | Rutaceae |
| Origin | Mexico |
| Plant Part Used | Peel |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis (Streptomycin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory diseases, antiseptic, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1472 |
| Compound Structure | |
| Plant Source | Citrus sinensis Common Name:Sweet Orange, Navel Orange, Blood Orange |
| Source Family | Rutaceae |
| Origin | Mexico |
| Plant Part Used | Peel |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis (Ethambutol resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory diseases, antiseptic, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1479 |
| Compound Structure |  |
| Plant Source | Clausena excavata Burm. f. Common Name:Clausena (English) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Rhizome |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3 - Methoxycarbonylcarbazole |
| PubChem ID | NR |
| Ethnomedicinal Information | Fever, indigestion, malaria, colic, muscular pain, diuretic and as tonic; the allied species C. wampi Blanco for bronchitis, in Thai folk medicine for cold |
| PubMed ID [Source Literature] | 12624822 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Alkaloid, Carbazole, Ester |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 225.079 |
| Molecular Formula | C14H11NO2 |
| SMILES | [nH]1c2c(c3c1ccc(c3)C(=O)OC)cccc2 |
| XLogP | 3.425 |
| PSA | 42.090 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Sunthitikawinsakul A, Kongkathip N, Kongkathip B, Phonnakhu S, Daly JW, Spande TF, Nimit Y, Rochanaruangrai S.Coumarins and carbazoles from Clausena excavata exhibited antimycobacterial and antifungal activities.Planta Med. 2003 Feb;69(2):155-7
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1480 |
| Compound Structure |  |
| Plant Source | Clausena excavata Burm. f. Common Name:Clausena (English) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Rhizome |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 2 - Hydroxy - 3 - Formyl - 7 - Methoxycarbazole |
| PubChem ID | 189687 |
| Ethnomedicinal Information | Fever, indigestion, malaria, colic, muscular pain, diuretic and as tonic; the allied species C. wampi Blanco for bronchitis, in Thai folk medicine for cold |
| PubMed ID [Source Literature] | 12624822 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Alkaloid, Carbazole, Aldehyde, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 241.074 |
| Molecular Formula | C14H11NO3
|
| SMILES | O(c1cc2[nH]c3c(c2cc1)cc(c(O)c3)C=O)C |
| XLogP | 2.329 |
| PSA | 62.320 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Sunthitikawinsakul A, Kongkathip N, Kongkathip B, Phonnakhu S, Daly JW, Spande TF, Nimit Y, Rochanaruangrai S.Coumarins and carbazoles from Clausena excavata exhibited antimycobacterial and antifungal activities.Planta Med. 2003 Feb;69(2):155-7
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1608 |
| Compound Structure | |
| Plant Source | Diospyros mespiliformis Hochst Common Name:Jackalberry Tree, African Ebony |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Rifampin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (2.00 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Dried leaves are used for sleeping sickness, malaria, headache and anthelmintic, dried barks are used for cough and leprosy |
| PubMed ID [Source Literature] | 20447452 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Green E, Samie A, Obi CL, Bessong PO, Ndip RN.Inhibitory properties of selected South African medicinal plants against Mycobacterium tuberculosis.J Ethnopharmacol. 2010 Jul 6;130(1):151-7
|
| Curator | |
| Compound ID | 1609 |
| Compound Structure | |
| Plant Source | Diospyros mespiliformis Hochst Common Name:Jackalberry Tree, African Ebony |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis 2 (Clinical isolates resistant to Streptomycin, Rifampin, Ethambutol, Isoniazid) |
| Assay / Test Done | Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Rifampin (100 µg/ml), Isoniazid (4.6 µg/ml), Ethambutol (12 µg/ml), Streptomycin (120 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Dried leaves are used for sleeping sickness, malaria, headache and anthelmintic, dried barks are used for cough and leprosy |
| PubMed ID [Source Literature] | 20447452 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Green E, Samie A, Obi CL, Bessong PO, Ndip RN.Inhibitory properties of selected South African medicinal plants against Mycobacterium tuberculosis.J Ethnopharmacol. 2010 Jul 6;130(1):151-7
|
| Curator | |
| Compound ID | 1765 |
| Compound Structure | |
| Plant Source | Foeniculum vulgare Mill. Common Name:Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Pakistan, Mediterranean region,Mexico,Africa |
| Plant Part Used | Aerial |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Sensitive) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diseases of the chest, cough, fever, respiratory diseases,digestion, over - weight, boosting metabolism as well as for stomach cramps |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.ageless.co.za/fennel.htm
|
| Curator | |