| Compound ID | 2238 |
| Compound Structure | |
| Plant Source | Nectandra hihua (R. & P.) Rowher Common Name: |
| Source Family | Lauraceae |
| Origin | Peru |
| Plant Part Used | Bark |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis (ATCC 27294) |
| Assay / Test Done | BACTEC 460 (Becton Dickinson Diagnostic Instrument Systems, Sparks MD) Radiometric Assay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Ethambutol (7.5 µg/ml) |
| Inhibition [%] | 98 % |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 13678239 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Graham JG, Pendland SL, Prause JL, Danzinger LH, Schunke Vigo J, Cabieses F, Farnsworth NR.Antimycobacterial evaluation of Peruvian plants.Phytomedicine. 2003;10(6-7):528-35
|
| Curator | |
| Compound ID | 3569 |
| Compound Structure |  |
| Plant Source | Haplopappus sonorensis (A. Gray) S.F. Blake Common Name: |
| Source Family | Asteraceae (Compositae) |
| Origin | Mexico |
| Plant Part Used | Whole plant |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | Rifampin |
| Inhibition [%] | 98 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ermanin |
| PubChem ID | 5352001 |
| Ethnomedicinal Information | Antiviral, anti-inflammatory |
| PubMed ID [Source Literature] | 12727485 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | Against HCT - 116 (ATCC CCL - 247) |
| Molecular Weight | 314.079 |
| Molecular Formula | C17H14O6 |
| SMILES | O1c(c(OC)c(=O)c2c1cc(O)cc2O)c1ccc(OC)cc1 |
| XLogP | 2.045 |
| PSA | 75.990 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Murillo JI, Encarnación-Dimayuga R, Malmstrĝm J, Christophersen C, Franzblau SG.Antimycobacterial flavones from Haplopappus sonorensis.Fitoterapia. 2003 Apr;74(3):226-30
|
| Curator | Gppreetha, vikramjitmandal |
