| Compound ID | 1332 |
| Compound Structure | |
| Plant Source | Caesalpinia pulcherrima Common Name:Poinciana, Peacock Flower, Red Bird of Paradise |
| Source Family | Fabaceae |
| Origin | Native to Central America, grown widely in South and Southeast Asia |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Fever, sores, cough, breathing difficulty and chest pain |
| PubMed ID [Source Literature] | 14531033 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Promsawan N, Kittakoop P, Boonphong S, Nongkunsarn P.Antitubercular cassane furanoditerpenoids from the roots of Caesalpinia pulcherrima.Planta Med. 2003 Aug;69(8):776-7
2) "Taxon: Caesalpinia pulcherrima (L.) Sw.". Germplasm Resources Information Network. United States Department of Agriculture. 2004-03-26
3) S. Allen Counter (2006-07-24). "Amazon mystery: A medicine man understood the secrets of this plant long before we did. How?". The Boston Globe.
|
| Curator | |
| Compound ID | 1333 |
| Compound Structure | |
| Plant Source | Caesalpinia pulcherrima Common Name:Poinciana, Peacock Flower, Red Bird of Paradise |
| Source Family | Fabaceae |
| Origin | Native to Central America, grown widely in South and Southeast Asia |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 14531033 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Promsawan N, Kittakoop P, Boonphong S, Nongkunsarn P.Antitubercular cassane furanoditerpenoids from the roots of Caesalpinia pulcherrima.Planta Med. 2003 Aug;69(8):776-7
|
| Curator | |
| Compound ID | 1918 |
| Compound Structure | |
| Plant Source | Inula helenium L. Common Name:Scabwort, Horse Heal, Wild Sunflower |
| Source Family | Asteraceae (Compositae) |
| Origin | Europe and temperate Asia, USA, China |
| Plant Part Used | Root |
| Extract | Dichloromethane, hexane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | Rifampin, Clarithromycin |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 1000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Used for stomach ulcers and chronic cough, respiratory tract infections, digestive support |
| PubMed ID [Source Literature] | 23195767 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) C.L. Cantrell, N.H. Fischer, L. Urbatsch, M.S. McGuire, S.G. Franzblau.Antimycobacterial crude plant extracts from South, Central, and North America.Phytomedicine, Volume 5, Issue 2, April 1998, Pages 137–145
|
| Curator | |
| Compound ID | 1919 |
| Compound Structure | |
| Plant Source | Inula helenium L. Common Name:Scabwort, Horse Heal, Wild Sunflower |
| Source Family | Asteraceae (Compositae) |
| Origin | Europe and Temperate Asia, USA, China |
| Plant Part Used | Root |
| Extract | Methanol (12.26 %) |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Used for stomach ulcers and chronic cough, respiratory tract infections, digestive support |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 1920 |
| Compound Structure | |
| Plant Source | Inula helenium L. Common Name:Scabwort, Horse Heal, Wild Sunflower |
| Source Family | Asteraceae (Compositae) |
| Origin | Europe and Temperate Asia, USA, China |
| Plant Part Used | Root |
| Extract | Methanol (12.26 %) |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Used for stomach ulcers and chronic cough, respiratory tract infections, digestive support |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 1971 |
| Compound Structure |  |
| Plant Source | Kaempferia parviflora Common Name:Krachai Dhum |
| Source Family | Zingiberaceae |
| Origin | Asia |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3, 5, 7, 4' - Tetramethoxyflavone |
| PubChem ID | 631095 |
| Ethnomedicinal Information | Anti-mycobacterial |
| PubMed ID [Source Literature] | 14693228 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB (oral human epidermoid carcinoma), BC (breast cancer), and NCI-H187 (human, small cell lung cancer) cell lines |
| Molecular Weight | 342.110 |
| Molecular Formula | C19H18O6
|
| SMILES | O1c2c(c(=O)c(OC)c1c1ccc(OC)cc1)c(OC)cc(OC)c2 |
| XLogP | 3.059 |
| PSA | 53.990 |
| H-bond Donor | 0 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Yenjai C, Prasanphen K, Daodee S, Wongpanich V, Kittakoop P.Bioactive flavonoids from Kaempferia parviflora.Fitoterapia. 2004 Jan;75(1):89-92
|
| Curator | |
| Compound ID | 1972 |
| Compound Structure |  |
| Plant Source | Kaempferia parviflora Common Name:Krachai Dhum |
| Source Family | Zingiberaceae |
| Origin | Asia |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulfate (2.0 – 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 5, 7, 4` - Trimethoxyflavone |
| PubChem ID | 79730 |
| Ethnomedicinal Information | Anti-mycobacterial |
| PubMed ID [Source Literature] | 14693228 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB (oral human epidermoid carcinoma), BC (breast cancer), and NCI-H187 (human, small cell lung cancer) cell lines |
| Molecular Weight | 312.100 |
| Molecular Formula | C18H16O5 |
| SMILES | O1c2c(c(OC)cc(OC)c2)c(=O)cc1c1ccc(OC)cc1 |
| XLogP | 2.683 |
| PSA | 44.760 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Yenjai C, Prasanphen K, Daodee S, Wongpanich V, Kittakoop P.Bioactive flavonoids from Kaempferia parviflora.Fitoterapia. 2004 Jan;75(1):89-92
|
| Curator | |
| Compound ID | 2379 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.050 µg/ml), Kanamycin sulfate (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Pellitorine |
| PubChem ID | 5318516 |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 15234750 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkaloid, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 223.194 |
| Molecular Formula | C14H25NO
|
| SMILES | O=C(NCC(C)C)/C=C/C=C/CCCCC |
| XLogP | 4.469 |
| PSA | 29.100 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 9 |
| No. of Rings | 0 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Rukachaisirikul T, Siriwattanakit P, Sukcharoenphol K, Wongvein C, Ruttanaweang P, Wongwattanavuch P, Suksamrarn A.Chemical constituents and bioactivity of Piper sarmentosum.J Ethnopharmacol. 2004 Aug;93(2-3):173-6
|
| Curator | |
| Compound ID | 2380 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.050 µg/ml), Kanamycin sulfate (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Guineensine |
| PubChem ID | 6442405 |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 15234750 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Amide, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 383.246 |
| Molecular Formula | C24H33NO3
|
| SMILES | O1c2cc(/C=C/CCCCCC/C=C/C=C/C(=O)NCC(C)C)ccc2OC1 |
| XLogP | 7.275 |
| PSA | 47.560 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 13 |
| No. of Rings | 2 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Rukachaisirikul T, Siriwattanakit P, Sukcharoenphol K, Wongvein C, Ruttanaweang P, Wongwattanavuch P, Suksamrarn A.Chemical constituents and bioactivity of Piper sarmentosum.J Ethnopharmacol. 2004 Aug;93(2-3):173-6
|
| Curator | |
| Compound ID | 2381 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.050 µg/ml), Kanamycin sulfate (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Brachyamide B |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 15234750 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Alkaloid, Pyrrolidine, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 327.183 |
| Molecular Formula | C20H25NO3 |
| SMILES | C1N(CCC1)C(=O)/C=C/CCCC/C=C/c1cc2c(cc1)OCO2 |
| XLogP | 5.013 |
| PSA | 38.770 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Rukachaisirikul T, Siriwattanakit P, Sukcharoenphol K, Wongvein C, Ruttanaweang P, Wongwattanavuch P, Suksamrarn A.Chemical constituents and bioactivity of Piper sarmentosum.J Ethnopharmacol. 2004 Aug;93(2-3):173-6
|
| Curator | |
| Compound ID | 2382 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.050 µg/ml), Kanamycin sulfate (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sarmentosine |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 15234750 |
| Extract Preparation | The pulverized, dried fruits of Piper sarmentosum (2.39 kg) were extracted successively with hexane and MeOH in a Soxhlet apparatus. After removal of solvent in vacuo, the hexane extract (70.7 g) was subjected to quick CC (silica gel) eluting with hexane, hexane–CHCl3, CHCl3, CHCl3–MeOH and MeOH to give 6 main fractions |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Alkaloid, Pyrrolidine, Amide, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 299.152 |
| Molecular Formula | C18H21NO3 |
| SMILES | C1c2c(ccc1/C=C/CC/C=C/C(=O)N1CCCC1)OCO2 |
| XLogP | 3.875 |
| PSA | 38.770 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Rukachaisirikul T, Siriwattanakit P, Sukcharoenphol K, Wongvein C, Ruttanaweang P, Wongwattanavuch P, Suksamrarn A.Chemical constituents and bioactivity of Piper sarmentosum.J Ethnopharmacol. 2004 Aug;93(2-3):173-6
|
| Curator | |
| Compound ID | 2383 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sesamin |
| PubChem ID | 72307 |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 15234750 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Polycyclic, Lignan, Furanoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 354.110 |
| Molecular Formula | C20H18O6 |
| SMILES | O1[C@@H]([C@@H]2[C@@H]([C@H](OC2)c2cc3OCOc3cc2)C1)c1cc2OCOc2cc1 |
| XLogP | 2.576 |
| PSA | 55.380 |
| H-bond Donor | 0 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Rukachaisirikul T, Siriwattanakit P, Sukcharoenphol K, Wongvein C, Ruttanaweang P, Wongwattanavuch P, Suksamrarn A.Chemical constituents and bioactivity of Piper sarmentosum.J Ethnopharmacol. 2004 Aug;93(2-3):173-6
|
| Curator | |
| Compound ID | 2384 |
| Compound Structure | N/A |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Whole plant |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Colorimetric Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Isoniazid (0.078 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 800 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Zakaria, M., Mohd, M.A., 1994. Traditional Malay Medicinal Plants. Fajar Bakti Sdn Bhd, Kuala Lumpur, Malaysia
|
| Curator | |
| Compound ID | 2385 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fresh root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | 17758236 |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Alkaloid, Thiophene, Benzopyran, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 485.202 |
| Molecular Formula | C30H31NO3S
|
| SMILES | S1c(/C=C/2Oc3c(c4c2c2c(NC(C=C2C)(C)C)cc4)c(OC)c(O)cc3)c(/C(=C/CC)/C)cc1 |
| XLogP | 7.049 |
| PSA | 78.960 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 1 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | |
| Compound ID | 2386 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fresh root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N - [9 - (3, 4 - Methylenedioxyphenyl) - 2E, 4E, 8E - Nonatrienoyl] Pyrrolidine |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Phenylpropanoid, Pyrrolidine, Amide, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 325.168 |
| Molecular Formula | C20H23NO3 |
| SMILES | C1c2c(ccc1/C=C/CC/C=C/C=C/C(=O)N1CCCC1)OCO2 |
| XLogP | 4.569 |
| PSA | 38.770 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | |
| Compound ID | 2387 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fresh root, fruit |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sarmentine |
| PubChem ID | 6440616 |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Alkene, Pyrrolidine, Amide, Alkaloid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 221.178 |
| Molecular Formula | C14H23NO |
| SMILES | O=C(N1CCCC1)/C=C/C=C/CCCCC |
| XLogP | 4.039 |
| PSA | 20.310 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | |
| Compound ID | 2388 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fresh Root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Brachyamide B |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Alkaloid, Pyrrolidine, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 327.183 |
| Molecular Formula | C20H25NO3 |
| SMILES | C1N(CCC1)C(=O)/C=C/CCCC/C=C/c1cc2c(cc1)OCO2 |
| XLogP | 5.013 |
| PSA | 38.770 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | |
| Compound ID | 2389 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fresh root |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sarmentosine |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Alkaloid, Pyrrolidine, Amide, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 299.152 |
| Molecular Formula | C18H21NO3 |
| SMILES | C1c2c(ccc1/C=C/CC/C=C/C(=O)N1CCCC1)OCO2 |
| XLogP | 3.875 |
| PSA | 38.770 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | |
| Compound ID | 2390 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fresh root |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Pellitorine |
| PubChem ID | 5318516 |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkaloid, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 223.194 |
| Molecular Formula | C14H25NO
|
| SMILES | O=C(NCC(C)C)/C=C/C=C/CCCCC |
| XLogP | 4.469 |
| PSA | 29.100 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 9 |
| No. of Rings | 0 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | |
| Compound ID | 2500 |
| Compound Structure | |
| Plant Source | Rosa canina Linn. Common Name:Dog Rose |
| Source Family | Rosaceae |
| Origin | Europe, North Africa and parts of Asia |
| Plant Part Used | Hips |
| Extract | Methanol (37.28 %) |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Consumption, cough and spitting of blood |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 2501 |
| Compound Structure | |
| Plant Source | Rosa canina Linn. Common Name:Dog Rose |
| Source Family | Rosaceae |
| Origin | Europe, North Africa and parts of Asia |
| Plant Part Used | Hips |
| Extract | Methanol (37.28 %) |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Consumption, cough and spitting of blood |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 2601 |
| Compound Structure | |
| Plant Source | Solanum dulcamara Linn. Common Name:Woody Night Shade, Bittersweet, Bitter Nightshade, Felonwort (English), Kaakamaachi Vishesha, Valli Kantakaarikaa (Sanskrit) |
| Source Family | Solanaceae |
| Origin | British Isles, Europe, Asia, North Africa, India |
| Plant Part Used | Leaf |
| Extract | Water |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Broth Dilution Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | < 1:40 dilution |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antifungal activity and used in treatment of warts, tumours and skin infections, chronic bronchial catarrh, asthma and whooping cough |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
2) Chopra, R.N., Nayar, S.L., Chopra, R.C., 1956. Glossary of Indian Medicinal Plants. Council of Scientific and Industrial Research, New Delhi, India.
|
| Curator | |
| Compound ID | 2602 |
| Compound Structure | |
| Plant Source | Solanum dulcamara Linn. Common Name:Woody Night Shade, Bittersweet, Bitter Nightshade, Felonwort (English), Kaakamaachi Vishesha, Valli Kantakaarikaa (Sanskrit) |
| Source Family | Solanaceae |
| Origin | British Isles, Europe, Asia, North Africa, India |
| Plant Part Used | Whole plant |
| Extract | Methanol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antifungal activity and used in treatment of warts, tumours and skin infections, chronic bronchial catarrh, asthma and whooping cough. |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 2603 |
| Compound Structure | |
| Plant Source | Solanum dulcamara Linn. Common Name:Woody Night Shade, Bittersweet, Bitter Nightshade, Felonwort (English), Kaakamaachi Vishesha, Valli Kantakaarikaa (Sanskrit) |
| Source Family | Solanaceae |
| Origin | British Isles, Europe, Asia, North Africa, India |
| Plant Part Used | Whole plant |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antifungal activity and used in treatment of warts, tumours and skin infections, chronic bronchial catarrh, asthma and whooping cough. |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 2604 |
| Compound Structure | |
| Plant Source | Solanum dulcamara Linn. Common Name:Woody Night Shade, Bittersweet, Bitter Nightshade, Felonwort (English), Kaakamaachi Vishesha, Valli Kantakaarikaa (Sanskrit) |
| Source Family | Solanaceae |
| Origin | British Isles, Europe, Asia, North Africa, India |
| Plant Part Used | Herb |
| Extract | Methanol (5.15 %) |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antifungal activity and used in treatment of warts, tumours and skin infections, chronic bronchial catarrh, asthma and whooping cough. |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |