| Compound ID | 3638 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 64 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | ψ - Taraxasterol |
| PubChem ID | 5270605 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | Methanol extract, nonsaponifiable lipid fraction |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 426.386 |
| Molecular Formula | C30H50O |
| SMILES | O[C@@H]1C(C2[C@@](C3[C@]([C@]4(C(C5[C@@](CC4)(CC=C([C@H]5C)C)C)CC3)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 11.751 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
2) Traditional Chinese Medicines
|
| Curator | Vikramjitmandal |
| Compound ID | 3639 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Faradiol |
| PubChem ID | 122856 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 442.381 |
| Molecular Formula | C30H50O2 |
| SMILES | O[C@H]1C[C@]2([C@]3(C([C@@]4([C@@H](CC3)C([C@@H](O)CC4)(C)C)C)CC[C@@H]2[C@H]2[C@@]1(CC=C([C@H]2C)C)C)C)C |
| XLogP | 9.244 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
2) Traditional Chinese Medicines
|
| Curator | Vikramjitmandal |
| Compound ID | 3640 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 64 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Heliantriol |
| PubChem ID | 397879 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 458.376 |
| Molecular Formula | C30H50O3 |
| SMILES | O[C@H]1C[C@]2([C@]3([C@@H]([C@@]4([C@@H](CC3)C([C@@H](O)CC4)(C)C)C)CC[C@@H]2[C@H]2[C@@]1([C@@H](O)C=C([C@H]2C)C)C)C)C |
| XLogP | 8.058 |
| PSA | 60.690 |
| H-bond Donor | 3 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
2) Traditional Chinese Medicines
|
| Curator | Vikramjitmandal |
| Compound ID | 3641 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 22α - Methoxyfaradiol |
| PubChem ID | 5273647 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 472.392 |
| Molecular Formula | C31H52O3 |
| SMILES | O[C@@H]1[C@@]2([C@H]([C@@H]3[C@]([C@]4(C([C@@]5([C@@H](CC4)C([C@@H](O)CC5)(C)C)C)CC3)C)(C1)C)[C@@H](C(=C[C@@H]2OC)C)C)C |
| XLogP | 8.577 |
| PSA | 49.690 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
2) Traditional Chinese Medicines
|
| Curator | Vikramjitmandal |
| Compound ID | 3642 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Faradiol α - Epoxide |
| PubChem ID | 5270606 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Epoxide |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 458.376 |
| Molecular Formula | C30H50O3 |
| SMILES | O1[C@]2([C@H](C3C4[C@]([C@]5(C([C@@]6(C(CC5)C([C@@H](O)CC6)(C)C)C)CC4)C)(C[C@H](O)[C@]3(C[C@@H]12)C)C)C)C |
| XLogP | 8.233 |
| PSA | 52.990 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
2) Traditional Chinese Medicines
|
| Curator | Vikramjitmandal |
| Compound ID | 3643 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 64 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Taraxasterol |
| PubChem ID | 5270604 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 426.386 |
| Molecular Formula | C30H50O |
| SMILES | O[C@@H]1C(C2[C@@](C3[C@]([C@]4(C(C5[C@@](CC4)(CCC(=C)[C@H]5C)C)CC3)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 11.796 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
2) Traditional Chinese Medicines
|
| Curator | Vikramjitmandal |
| Compound ID | 3644 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Arnidiol |
| PubChem ID | 470259 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 442.381 |
| Molecular Formula | C30H50O2 |
| SMILES | O[C@@H]1[C@@]2([C@H]([C@@H]3[C@]([C@]4(C([C@@]5([C@@H](CC4)C([C@@H](O)CC5)(C)C)C)CC3)C)(C1)C)[C@@H](C(=C)CC2)C)C |
| XLogP | 9.289 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
|
| Curator | Vikramjitmandal |
| Compound ID | 3645 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 64 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | β-Amyrin |
| PubChem ID | 73145 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene. Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 426.386 |
| Molecular Formula | C30H50O |
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 11.546 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
|
| Curator | Vikramjitmandal |
| Compound ID | 3646 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Maniladiol |
| PubChem ID | 122858 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 442.381 |
| Molecular Formula | C30H50O2 |
| SMILES | O[C@@H]1[C@@]2([C@H](C3=CCC4[C@]([C@@]3(C1)C)(CC[C@@H]1[C@@]4(CC[C@H](O)C1(C)C)C)C)CC(CC2)(C)C)C |
| XLogP | 9.039 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
|
| Curator | Vikramjitmandal |
| Compound ID | 3647 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 64 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Erythrodiol |
| PubChem ID | 101761 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 442.381 |
| Molecular Formula | C30H50O2 |
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)CO)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.359 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
|
| Curator | Vikramjitmandal |
| Compound ID | 3648 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Longispinogenin |
| PubChem ID | 489920 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 472.392 |
| Molecular Formula | C31H52O3 |
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@]([C@H](C4)CO)(CCC(C3)(C)C)CO)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 8.313 |
| PSA | 60.690 |
| H-bond Donor | 3 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
|
| Curator | Vikramjitmandal |
| Compound ID | 3649 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 64 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Coflodiol |
| PubChem ID | 5273648 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 442.381 |
| Molecular Formula | C30H50O2 |
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=C5[C@@]([C@@H](O)C4)(CCC(C5)(C)C)C)CC3)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 8.294 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
|
| Curator | Vikramjitmandal |
| Compound ID | 3650 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | α - Amyrin |
| PubChem ID | 73170 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 426.386 |
| Molecular Formula | C30H50O |
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CC[C@H]([C@@H]3C)C)C)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 11.448 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
2) Traditional Chinese Medicines
|
| Curator | Vikramjitmandal |
| Compound ID | 3651 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 64 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Brein |
| PubChem ID | 5270607 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 442.381 |
| Molecular Formula | C30H50O2 |
| SMILES | O[C@@H]1[C@@]2(C(C3=CCC4[C@]([C@@]3(C1)C)(CCC1[C@@]4(CC[C@H](O)C1(C)C)C)C)[C@H]([C@@H](CC2)C)C)C |
| XLogP | 8.941 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
|
| Curator | Vikramjitmandal |
| Compound ID | 3652 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Uvaol |
| PubChem ID | 92802 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene,Triterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 442.381 |
| Molecular Formula | C30H50O2 |
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CC[C@H]([C@@H]3C)C)CO)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.261 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
|
| Curator | Vikramjitmandal |
| Compound ID | 3653 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 64 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Lupeol |
| PubChem ID | 44586882 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 426.386 |
| Molecular Formula | C30H50O |
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C([C@@H]5[C@@](CC4)(CC[C@H]5C(=C)C)C)CC3)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 11.901 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
|
| Curator | Vikramjitmandal |
| Compound ID | 3654 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 3 - Epilupeol |
| PubChem ID | 3083852 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene,Triterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 426.386 |
| Molecular Formula | C30H50O |
| SMILES | O[C@H]1C([C@H]2[C@@](C3[C@]([C@]4([C@@H](C5[C@@](CC4)(CC[C@H]5C(=C)C)C)CC3)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 11.901 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
|
| Curator | Vikramjitmandal |
| Compound ID | 3655 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 64 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Calenduladiol |
| PubChem ID | 461835 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 442.381 |
| Molecular Formula | C30H50O2 |
| SMILES | O[C@@H]1[C@@]2([C@@H]([C@@H]3[C@]([C@]4([C@@H]([C@@]5([C@@H](CC4)C([C@@H](O)CC5)(C)C)C)CC3)C)(C1)C)[C@@H](CC2)C(=C)C)C |
| XLogP | 9.394 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
|
| Curator | Vikramjitmandal |
| Compound ID | 3656 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 64 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Heliantriol B2 |
| PubChem ID | 5270612 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 458.376 |
| Molecular Formula | C30H50O3 |
| SMILES | O[C@@H]1[C@@]2(C(C3[C@]([C@]4(C([C@@]5(C(CC4)C([C@@H](O)CC5)(C)C)C)CC3)C)(C1)C)[C@@H](CC2)C(=C)C)CO |
| XLogP | 8.691 |
| PSA | 60.690 |
| H-bond Donor | 3 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
|
| Curator | Vikramjitmandal |
| Compound ID | 3657 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 64 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Taraxerol |
| PubChem ID | 92097 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 426.386 |
| Molecular Formula | C30H50O |
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@](C4=CC[C@@]5([C@H]([C@@]4(CC3)C)CC(CC5)(C)C)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 11.352 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
|
| Curator | Vikramjitmandal |
| Compound ID | 3658 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 64 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Cycloartenol |
| PubChem ID | 17750995 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Cycloartane, Prenylated, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 426.386 |
| Molecular Formula | C30H50O |
| SMILES | O[C@@H]1C([C@H]2[C@@]3([C@]4(C3)[C@H]([C@]3([C@](CC4)([C@H](CC3)[C@@H](CCC=C(C)C)C)C)C)CC2)CC1)(C)C |
| XLogP | 11.921 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
|
| Curator | Vikramjitmandal |
| Compound ID | 3659 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 64 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 24 - Methylenecycloartanol |
| PubChem ID | 94204 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Cycloartane, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 440.402 |
| Molecular Formula | C31H52O |
| SMILES | O[C@@H]1C([C@H]2[C@@]3([C@@]4(C3)[C@H]([C@]3([C@](CC4)([C@H](CC3)[C@@H](CCC(=C)C(C)C)C)C)C)CC2)CC1)(C)C |
| XLogP | 12.365 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
|
| Curator | Vikramjitmandal |
| Compound ID | 3660 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 64 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | (24R) - Cycloartane - 3β, 24, 25 - Triol |
| PubChem ID | 5270670 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Cycloartane, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 460.392 |
| Molecular Formula | C30H52O3 |
| SMILES | O[C@@H]1C([C@H]2[C@@]3([C@@]4(C3)[C@H]([C@]3([C@](CC4)([C@H](CC3)[C@@H](CC[C@@H](O)C(O)(C)C)C)C)C)CC2)CC1)(C)C |
| XLogP | 9.572 |
| PSA | 60.690 |
| H-bond Donor | 3 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
|
| Curator | Vikramjitmandal |
| Compound ID | 3661 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | (24S) - Cycloartane - 3β, 24, 25 - Triol |
| PubChem ID | NR |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Cycloartane, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 460.392 |
| Molecular Formula | C30H52O3 |
| SMILES | C1C[C@@H](C([C@H]2C31C1([C@@H](CC2)[C@]2([C@](CC1)([C@H](CC2)[C@H](C)CCC(C(C)(C)O)O)C)C)C3)(C)C)O |
| XLogP | 9.572 |
| PSA | 60.690 |
| H-bond Donor | 3 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
|
| Curator | Vikramjitmandal |
| Compound ID | 3662 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 64 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | (24S) - 25 - Methoxycycloartane - 3β, 24-diol |
| PubChem ID | 5270669 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene,Cycloartane, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 474.407 |
| Molecular Formula | C31H54O3 |
| SMILES | O[C@@H]1C([C@H]2[C@@]3([C@@]4(C3)[C@H]([C@]3([C@](CC4)([C@H](CC3)[C@@H](CC[C@H](O)C(OC)(C)C)C)C)C)CC2)CC1)(C)C |
| XLogP | 10.091 |
| PSA | 49.690 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
|
| Curator | Vikramjitmandal |