| Compound ID | 2048 |
| Compound Structure |  |
| Plant Source | Lippia alba (Miller) N. E.Brown Common Name: |
| Source Family | Verbenaceae |
| Origin | Colombia, Puerto Rico, India |
| Plant Part Used | Leaf, stem |
| Extract | Essential oil (2.5 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Geranial |
| PubChem ID | 638011 |
| Ethnomedicinal Information | Digestive troubles in general, nausea, bronchitis, sore throat, flu, cough, cold, hypertension, skin diseases, wounds, stomach ache, nervous complaints, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Terpene, Monoterpene, Aldehyde |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 152.120 |
| Molecular Formula | C10H16O
|
| SMILES | O=C/C=C(/CCC=C(C)C)C |
| XLogP | 2.701 |
| PSA | 17.070 |
| H-bond Donor | 0 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) Thierry Hennebelle, Sevser Sahpaz, Henry Joseph, François Bailleul.Ethnopharmacology of Lippia alba.Journal of Ethnopharmacology, Volume 116, Issue 2, 5 March 2008, Pages 211-222
|
| Curator | |
| Compound ID | 2049 |
| Compound Structure |  |
| Plant Source | Lippia alba (Miller) N. E.Brown Common Name: |
| Source Family | Verbenaceae |
| Origin | Colombia, Puerto Rico, India |
| Plant Part Used | Leaf, stem |
| Extract | Essential oil (2.5 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Neral |
| PubChem ID | 643779 |
| Ethnomedicinal Information | Digestive troubles in general, nausea, bronchitis, sore throat, flu, cough, cold, hypertension, skin diseases, wounds, stomach ache, nervous complaints, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Aldehyde |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 152.120 |
| Molecular Formula | C10H16O
|
| SMILES | O=C/C=C(CCC=C(C)C)/C |
| XLogP | 2.701 |
| PSA | 17.070 |
| H-bond Donor | 0 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) Thierry Hennebelle, Sevser Sahpaz, Henry Joseph, François Bailleul.Ethnopharmacology of Lippia alba.Journal of Ethnopharmacology, Volume 116, Issue 2, 5 March 2008, Pages 211-222
|
| Curator | |
| Compound ID | 2050 |
| Compound Structure |  |
| Plant Source | Lippia alba (Miller) N. E.Brown Common Name: |
| Source Family | Verbenaceae |
| Origin | Colombia, Puerto Rico, India |
| Plant Part Used | Leaf, stem |
| Extract | Essential oil (2.5 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 64 - 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Geraniol |
| PubChem ID | 637566 |
| Ethnomedicinal Information | Digestive troubles in general, nausea, bronchitis, sore throat, flu, cough, cold, hypertension, skin diseases, wounds, stomach ache, nervous complaints, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 154.136 |
| Molecular Formula | C10H18O
|
| SMILES | OC/C=C(/CCC=C(C)C)C |
| XLogP | 2.524 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) Thierry Hennebelle, Sevser Sahpaz, Henry Joseph, François Bailleul.Ethnopharmacology of Lippia alba.Journal of Ethnopharmacology, Volume 116, Issue 2, 5 March 2008, Pages 211-222
|
| Curator | |
| Compound ID | 2051 |
| Compound Structure |  |
| Plant Source | Lippia alba (Miller) N. E.Brown Common Name: |
| Source Family | Verbenaceae |
| Origin | Colombia, Puerto Rico, India |
| Plant Part Used | Leaf, stem |
| Extract | Essential oil (2.5 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Trans - β - Caryophyllene (5.8 %) |
| PubChem ID | 5281515 |
| Ethnomedicinal Information | Digestive troubles in general, nausea, bronchitis, sore throat, flu, cough, cold, hypertension, skin diseases, wounds, stomach ache, nervous complaints, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Sesquiterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 204.188 |
| Molecular Formula | C15H24
|
| SMILES | C1([C@H]2[C@H](C1)C(=C)CC/C=C(/CC2)C)(C)C |
| XLogP | 6.044 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) Thierry Hennebelle, Sevser Sahpaz, Henry Joseph, François Bailleul.Ethnopharmacology of Lippia alba.Journal of Ethnopharmacology, Volume 116, Issue 2, 5 March 2008, Pages 211-222
|
| Curator | |
| Compound ID | 2052 |
| Compound Structure |  |
| Plant Source | Lippia alba (Miller) N. E.Brown Common Name: |
| Source Family | Verbenaceae |
| Origin | Colombia, Puerto Rico, India |
| Plant Part Used | Leaf, stem |
| Extract | Essential oil (2.5 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Geranyl acetate (3.6 %) |
| PubChem ID | 1549026 |
| Ethnomedicinal Information | Digestive troubles in general, nausea, bronchitis, sore throat, flu, cough, cold, hypertension, skin diseases, wounds, stomach ache, nervous complaints, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Ester |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 196.146 |
| Molecular Formula | C12H20O2
|
| SMILES | O(C/C=C(/CCC=C(C)C)C)C(=O)C |
| XLogP | 3.264 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) Thierry Hennebelle, Sevser Sahpaz, Henry Joseph, François Bailleul.Ethnopharmacology of Lippia alba.Journal of Ethnopharmacology, Volume 116, Issue 2, 5 March 2008, Pages 211-222
|
| Curator | |
| Compound ID | 2053 |
| Compound Structure |  |
| Plant Source | Lippia alba (Miller) N. E.Brown Common Name: |
| Source Family | Verbenaceae |
| Origin | Colombia, Puerto Rico, India |
| Plant Part Used | Leaf, stem |
| Extract | Essential oil (2.5 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 ± 72 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Limonene (30.2 %) |
| PubChem ID | 22311 |
| Ethnomedicinal Information | Digestive troubles in general, nausea, bronchitis, sore throat, flu, cough, cold, hypertension, skin diseases, wounds, stomach ache, nervous complaints, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C1(CCC(=CC1)C)C(=C)C |
| XLogP | 3.729 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) Thierry Hennebelle, Sevser Sahpaz, Henry Joseph, François Bailleul.Ethnopharmacology of Lippia alba.Journal of Ethnopharmacology, Volume 116, Issue 2, 5 March 2008, Pages 211-222
|
| Curator | |
| Compound ID | 2054 |
| Compound Structure |  |
| Plant Source | Lippia alba (Miller) N. E.Brown Common Name: |
| Source Family | Verbenaceae |
| Origin | Colombia, Puerto Rico, India |
| Plant Part Used | Leaf, stem |
| Extract | Essential oil (1.6 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 6 - Methyl - 5 - hepten - 2 - one (2.1 %) |
| PubChem ID | 9862 |
| Ethnomedicinal Information | Digestive troubles in general, nausea, bronchitis, sore throat, flu, cough, cold, hypertension, skin diseases, wounds, stomach ache, nervous complaints, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Ketone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 126.104 |
| Molecular Formula | C8H14O
|
| SMILES | O=C(CCC=C(C)C)C |
| XLogP | 1.796 |
| PSA | 17.070 |
| H-bond Donor | 0 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) Thierry Hennebelle, Sevser Sahpaz, Henry Joseph, François Bailleul.Ethnopharmacology of Lippia alba.Journal of Ethnopharmacology, Volume 116, Issue 2, 5 March 2008, Pages 211-222
|
| Curator | |
| Compound ID | 2055 |
| Compound Structure |  |
| Plant Source | Lippia alba (Miller) N. E.Brown Common Name: |
| Source Family | Verbenaceae |
| Origin | Colombia, Puerto Rico, India |
| Plant Part Used | Leaf, stem |
| Extract | Essential oil (1.6 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Cis - Verbenol (1.9 %) |
| PubChem ID | 87839 |
| Ethnomedicinal Information | Digestive troubles in general, nausea, bronchitis, sore throat, flu, cough, cold, hypertension, skin diseases, wounds, stomach ache, nervous complaints, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Monoterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 152.120 |
| Molecular Formula | C10H16O
|
| SMILES | O[C@@H]1[C@@H]2C([C@@H](C2)C(=C1)C)(C)C |
| XLogP | 2.147 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) Thierry Hennebelle, Sevser Sahpaz, Henry Joseph, François Bailleul.Ethnopharmacology of Lippia alba.Journal of Ethnopharmacology, Volume 116, Issue 2, 5 March 2008, Pages 211-222
|
| Curator | |
| Compound ID | 2056 |
| Compound Structure |  |
| Plant Source | Lippia alba (Miller) N. E.Brown Common Name: |
| Source Family | Verbenaceae |
| Origin | Colombia, Puerto Rico, India |
| Plant Part Used | Leaf, stem |
| Extract | Essential oil (1.6 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Trans - Verbenol (1.5 %) |
| PubChem ID | 89664 |
| Ethnomedicinal Information | Digestive troubles in general, nausea, bronchitis, sore throat, flu, cough, cold, hypertension, skin diseases, wounds, stomach ache, nervous complaints, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Monoterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 152.120 |
| Molecular Formula | C10H16O
|
| SMILES | O[C@@H]1[C@H]2C([C@H](C2)C(=C1)C)(C)C |
| XLogP | 2.147 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) Thierry Hennebelle, Sevser Sahpaz, Henry Joseph, François Bailleul.Ethnopharmacology of Lippia alba.Journal of Ethnopharmacology, Volume 116, Issue 2, 5 March 2008, Pages 211-222
|
| Curator | |
| Compound ID | 2057 |
| Compound Structure |  |
| Plant Source | Lippia alba (Miller) N. E.Brown Common Name: |
| Source Family | Verbenaceae |
| Origin | Colombia, Puerto Rico, India |
| Plant Part Used | Leaf, stem |
| Extract | Essential oil (1.6 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | α - Humulene (1.4 %) |
| PubChem ID | 5281520 |
| Ethnomedicinal Information | Digestive troubles in general, nausea, bronchitis, sore throat, flu, cough, cold, hypertension, skin diseases, wounds, stomach ache, nervous complaints, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Sesquiterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 204.188 |
| Molecular Formula | C15H24
|
| SMILES | C1(C/C=C(/CC/C=C(/C/C=C/1)C)C)(C)C |
| XLogP | 5.940 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) Thierry Hennebelle, Sevser Sahpaz, Henry Joseph, François Bailleul.Ethnopharmacology of Lippia alba.Journal of Ethnopharmacology, Volume 116, Issue 2, 5 March 2008, Pages 211-222
|
| Curator | |
| Compound ID | 2058 |
| Compound Structure | |
| Plant Source | Lippia alba (Miller) N. E.Brown Common Name: |
| Source Family | Verbenaceae |
| Origin | Colombia, Puerto Rico, India |
| Plant Part Used | Stem |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (1 µg/ml) |
| Inhibition [%] | 19 % |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Digestive troubles in general, nausea, bronchitis, sore throat, flu, cough, cold, hypertension, skin diseases, wounds, stomach ache, nervous complaints, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 11746852 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Antoun MD, Ramos Z, Vazques J, Oquendo I, Proctor GR, Gerena L, Franzblau SG.Evaluation of the flora of Puerto Rico for in vitro antiplasmodial and antimycobacterial activities.Phytother Res. 2001 Nov;15(7):638-42
|
| Curator | |
| Compound ID | 2059 |
| Compound Structure | |
| Plant Source | Lippia alba (Miller) N. E.Brown Common Name: |
| Source Family | Verbenaceae |
| Origin | Colombia, Puerto Rico, India |
| Plant Part Used | Leaf |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (1) |
| Inhibition [%] | 82 % |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Digestive troubles in general, nausea, bronchitis, sore throat, flu, cough, cold, hypertension, skin diseases, wounds, stomach ache, nervous complaints, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 11746852 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Antoun MD, Ramos Z, Vazques J, Oquendo I, Proctor GR, Gerena L, Franzblau SG.Evaluation of the flora of Puerto Rico for in vitro antiplasmodial and antimycobacterial activities.Phytother Res. 2001 Nov;15(7):638-42
|
| Curator | |
| Compound ID | 2351 |
| Compound Structure |  |
| Plant Source | Piper auritum Common Name:Eared Pepper, False Kava (Hawaii), False Kava - Kava, Hierba Santa, Hoja Santa |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (2.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 400 ± 220 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Safrol |
| PubChem ID | 5144 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.068 |
| Molecular Formula | C10H10O2
|
| SMILES | O1c2c(OC1)ccc(c2)CC=C |
| XLogP | 2.930 |
| PSA | 18.460 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2352 |
| Compound Structure |  |
| Plant Source | Piper auritum Common Name:Eared Pepper, False Kava (Hawaii), False Kava - Kava, Hierba Santa, Hoja Santa |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (2.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 400 ± 220 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Methyl eugenol |
| PubChem ID | 7127 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Phenylpropanoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 178.099 |
| Molecular Formula | C11H14O2
|
| SMILES | O(c1cc(CC=C)ccc1OC)C |
| XLogP | 3.003 |
| PSA | 18.460 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2353 |
| Compound Structure |  |
| Plant Source | Piper auritum Common Name:Eared Pepper, False Kava (Hawaii), False Kava - Kava, Hierba Santa, Hoja Santa |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (2.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 400 ± 220 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | α - Terpinolene |
| PubChem ID | 11463 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C1C(=C(C)C)CC=C(C1)C |
| XLogP | 3.326 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2354 |
| Compound Structure |  |
| Plant Source | Piper auritum Common Name:Eared Pepper, False Kava (Hawaii), False Kava - Kava, Hierba Santa, Hoja Santa |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (2.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 400 ± 220 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | γ - Terpinene |
| PubChem ID | 7461 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C(C1=CCC(=CC1)C)(C)C |
| XLogP | 3.852 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2355 |
| Compound Structure |  |
| Plant Source | Piper auritum Common Name:Eared Pepper, False Kava (Hawaii), False Kava - Kava, Hierba Santa, Hoja Santa |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (2.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 400 ± 220 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | P - Cymene (0.2 %) |
| PubChem ID | 7463 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | The essential oils were extracted from a 300 g sample of plant leaves and stems by microwave - assisted hydrodistillation (30 min, 250 ml water), using a Clevenger - type distillation apparatus and a Dean - Stark distillation trap in a domestic microwave oven. Sodium sulfate was added as a drying agent to the decanted essential oil |
| Chemical Classification [Active Compound] | Aromatic, Alkyl |
| Media / Broth Used [Antimicrobial Assay/Test] | Lowestein - Jensenn medium, Middlebrook 7H9 medium [The later was supplemented with 10 % OADC (Oleic Acid - Albumin - Dextrose - Catalase) and 0.001 % Tween 80] |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 134.110 |
| Molecular Formula | C10H14
|
| SMILES | C(c1ccc(cc1)C)(C)C |
| XLogP | 5.785 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2356 |
| Compound Structure |  |
| Plant Source | Piper auritum Common Name:Eared Pepper, False Kava (Hawaii), False Kava - Kava, Hierba Santa, Hoja Santa |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (2.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 400 ± 220 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Trans - β - Caryophyllene |
| PubChem ID | 5281515 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Sesquiterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 204.188 |
| Molecular Formula | C15H24
|
| SMILES | C1([C@H]2[C@H](C1)C(=C)CC/C=C(/CC2)C)(C)C |
| XLogP | 6.044 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2357 |
| Compound Structure |  |
| Plant Source | Piper auritum Common Name:Eared Pepper, False Kava (Hawaii), False Kava - Kava, Hierba Santa, Hoja Santa |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (2.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 400 ± 220 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Eugenol |
| PubChem ID | 3314 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 164.084 |
| Molecular Formula | C10H12O2
|
| SMILES | O(c1cc(CC=C)ccc1O)C |
| XLogP | 2.484 |
| PSA | 29.460 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2358 |
| Compound Structure |  |
| Plant Source | Piper auritum Common Name:Eared Pepper, False Kava (Hawaii), False Kava - Kava, Hierba Santa, Hoja Santa |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (2.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 400 ± 220 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Elemicin |
| PubChem ID | 10248 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 208.110 |
| Molecular Formula | C12H16O3
|
| SMILES | O(c1c(OC)cc(CC=C)cc1OC)C |
| XLogP | 2.559 |
| PSA | 27.690 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2359 |
| Compound Structure |  |
| Plant Source | Piper auritum Common Name:Eared Pepper, False Kava (Hawaii), False Kava - Kava, Hierba Santa, Hoja Santa |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (2.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 400 ± 220 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Spathulenol |
| PubChem ID | 522266 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 220.183 |
| Molecular Formula | C15H24O
|
| SMILES | OC1(C2C3C(C3CCC(=C)C2CC1)(C)C)C |
| XLogP | 4.157 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2362 |
| Compound Structure |  |
| Plant Source | Piper bogotense Common Name: |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (0.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sesquisabinene hydrate |
| PubChem ID | 6428435 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Sesquiterpene, Alcohol, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 222.198 |
| Molecular Formula | C15H26O
|
| SMILES | O[C@]1(C2[C@](C2)(CC1)C(CCC=C(C)C)C)C |
| XLogP | 4.683 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2363 |
| Compound Structure |  |
| Plant Source | Piper bogotense Common Name: |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (0.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | α - Phellandrene |
| PubChem ID | 7460 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C1(C(C)C)CC=C(C=C1)C |
| XLogP | 4.427 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2364 |
| Compound Structure |  |
| Plant Source | Piper bogotense Common Name: |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (0.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | α - Pinene (8.7 %) |
| PubChem ID | 6654 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C1(C2CC1C(=CC2)C)(C)C |
| XLogP | 4.177 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2365 |
| Compound Structure |  |
| Plant Source | Piper bogotense Common Name: |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (0.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Limonene (5.3 %) |
| PubChem ID | 22311 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C1(CCC(=CC1)C)C(=C)C |
| XLogP | 3.729 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |