| Compound ID | 1280 |
| Compound Structure |  |
| Plant Source | Borrichia frutescens L. Common Name:Sea Daisy |
| Source Family | Asteraceae (Compositae) |
| Origin | Southeastern USA |
| Plant Part Used | Flower, leaf, stem |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | Fusidic acid (4 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | (24R)-24,25-epoxycycloartan-3-one |
| PubChem ID | 469544 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 8988597 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Triterpene, Cycloartane, Ketone, Epoxy |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against vero cells |
| Molecular Weight | 440.365 |
| Molecular Formula | C30H48O2 |
| SMILES | O=C1C([C@H]2[C@@]3([C@@]4(C3)[C@H]([C@]3([C@](CC4)([C@H](CC3)[C@@H](CC[C@H]3OC3(C)C)C)C)C)CC2)CC1)(C)C |
| XLogP | 9.983 |
| PSA | 29.600 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Lu T, Fronczek FR, Fischer NH, Adams LB, Franzblau SG.Antimycobacterial cycloartanes from Borrichia frutescens.J Nat Prod. 1996 Dec;59(12):1131-6
|
| Curator | |
| Compound ID | 2338 |
| Compound Structure | |
| Plant Source | Pieris floribunda Common Name: |
| Source Family | Ericaceae |
| Origin | Eastern USA |
| Plant Part Used | Leaf |
| Extract | Water |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 1:640 dilution |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Fitzpatrick, F.K.Plant substances achieve against mycobacterium tuberculoses.Antibiotics and Chemotherapy, Vol 4, Pages 528-536
|
| Curator | |