| Compound ID | 3074 |
| Compound Structure |  |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium aurum (Pasteur Institute 104482) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Ferulenol |
| PubChem ID | 54679300 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 366.219 |
| Molecular Formula | C24H30O3 |
| SMILES | O1c2c(c(O)c(C/C=C(/CC/C=C(/CCC=C(C)C)C)C)c1=O)cccc2 |
| XLogP | 8.182 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3075 |
| Compound Structure |  |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium fortuitum (ATCC 6841) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (8 µg/ml), Isoniazid (0.5 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Ferulenol |
| PubChem ID | 54679300 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 366.219 |
| Molecular Formula | C24H30O3 |
| SMILES | O1c2c(c(O)c(C/C=C(/CC/C=C(/CCC=C(C)C)C)C)c1=O)cccc2 |
| XLogP | 8.182 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3076 |
| Compound Structure |  |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium phlei (ATCC 11758) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (4 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Ferulenol |
| PubChem ID | 54679300 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 366.219 |
| Molecular Formula | C24H30O3 |
| SMILES | O1c2c(c(O)c(C/C=C(/CC/C=C(/CCC=C(C)C)C)C)c1=O)cccc2 |
| XLogP | 8.182 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3077 |
| Compound Structure |  |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium smegmatis (ATCC 14468) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml), Isoniazid (1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 0.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Ferulenol |
| PubChem ID | 54679300 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 366.219 |
| Molecular Formula | C24H30O3 |
| SMILES | O1c2c(c(O)c(C/C=C(/CC/C=C(/CCC=C(C)C)C)C)c1=O)cccc2 |
| XLogP | 8.182 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3078 |
| Compound Structure |  |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium fortuitum (ATCC 6841) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (8 µg/ml), Isoniazid (0.5 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | E - ω - Benzoyloxyferulenol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol, Benzoyl |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 486.241 |
| Molecular Formula | C31H34O5
|
| SMILES | C1ccc2c(c1)c(c(c(=O)o2)C/C=C(/CC/C=C(/CC/C=C(/COC(=O)c1ccccc1)C)C)C)O |
| XLogP | 8.550 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vikramjitmandal |
| Compound ID | 3079 |
| Compound Structure |  |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium phlei (ATCC 11758) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (4 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | E - ω - Benzoyloxyferulenol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol, Benzoyl |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 486.241 |
| Molecular Formula | C31H34O5
|
| SMILES | C1ccc2c(c1)c(c(c(=O)o2)C/C=C(/CC/C=C(/CC/C=C(/COC(=O)c1ccccc1)C)C)C)O |
| XLogP | 8.550 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vikramjitmandal |
| Compound ID | 3080 |
| Compound Structure |  |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium aurum (Pasteur Institute 104482) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | E - ω - Benzoyloxyferulenol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol, Benzoyl |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 486.241 |
| Molecular Formula | C31H34O5
|
| SMILES | C1ccc2c(c1)c(c(c(=O)o2)C/C=C(/CC/C=C(/CC/C=C(/COC(=O)c1ccccc1)C)C)C)O |
| XLogP | 8.550 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vikramjitmandal |
| Compound ID | 3081 |
| Compound Structure |  |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium smegmatis (ATCC 144680) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml), Isoniazid (1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | E - ω - Benzoyloxyferulenol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol, Benzoyl |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 486.241 |
| Molecular Formula | C31H34O5
|
| SMILES | C1ccc2c(c1)c(c(c(=O)o2)C/C=C(/CC/C=C(/CC/C=C(/COC(=O)c1ccccc1)C)C)C)O |
| XLogP | 8.550 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vikramjitmandal |
| Compound ID | 3082 |
| Compound Structure |  |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium fortuitum (ATCC 6841) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (8 µg/ml), Isoniazid (0.5 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 64 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | E - ω - Hydroxyferulenol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 382.214 |
| Molecular Formula | C24H30O4
|
| SMILES | C1ccc2c(c1)c(c(c(=O)o2)C/C=C(/CC/C=C(/CC/C=C(/CO)C)C)C)O |
| XLogP | 5.064 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 9 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vikramjitmandal |
| Compound ID | 3083 |
| Compound Structure |  |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium phlei (ATCC 11758) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (4 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | E - ω - Hydroxyferulenol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 382.214 |
| Molecular Formula | C24H30O4
|
| SMILES | C1ccc2c(c1)c(c(c(=O)o2)C/C=C(/CC/C=C(/CC/C=C(/CO)C)C)C)O |
| XLogP | 5.064 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 9 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vikramjitmandal |
| Compound ID | 3084 |
| Compound Structure |  |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium aurum (Pasteur Institute 104482) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | E - ω - Hydroxyferulenol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 382.214 |
| Molecular Formula | C24H30O4
|
| SMILES | C1ccc2c(c1)c(c(c(=O)o2)C/C=C(/CC/C=C(/CC/C=C(/CO)C)C)C)O |
| XLogP | 5.064 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 9 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vikramjitmandal |
| Compound ID | 3085 |
| Compound Structure |  |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium smegmatis (ATCC 144680) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml), Isoniazid (1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | E - ω - Hydroxyferulenol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 382.214 |
| Molecular Formula | C24H30O4
|
| SMILES | C1ccc2c(c1)c(c(c(=O)o2)C/C=C(/CC/C=C(/CC/C=C(/CO)C)C)C)O |
| XLogP | 5.064 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 9 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vikramjitmandal |
| Compound ID | 3086 |
| Compound Structure |  |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium fortuitum (ATCC 6841) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (8 µg/ml), Isoniazid (0.5 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | ω - acetoxy derivative of ferulenol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, O-Acetyl, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 424.225 |
| Molecular Formula | C26H32O5
|
| SMILES | C1cccc2c1c(c(c(=O)o2)C/C=C(/CC/C=C(/CC/C=C(/COC(=O)C)C)C)C)O |
| XLogP | 5.804 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vikramjitmandal |
| Compound ID | 3087 |
| Compound Structure |  |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium phlei (ATCC 11758) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (4 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | ω - acetoxy derivative of ferulenol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, O-Acetyl, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 424.225 |
| Molecular Formula | C26H32O5
|
| SMILES | C1cccc2c1c(c(c(=O)o2)C/C=C(/CC/C=C(/CC/C=C(/COC(=O)C)C)C)C)O |
| XLogP | 5.804 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vikramjitmandal |
| Compound ID | 3088 |
| Compound Structure |  |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium aurum (Pasteur Institute 104482) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | ω - acetoxy derivative of ferulenol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, O-Acetyl, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 424.225 |
| Molecular Formula | C26H32O5
|
| SMILES | C1cccc2c1c(c(c(=O)o2)C/C=C(/CC/C=C(/CC/C=C(/COC(=O)C)C)C)C)O |
| XLogP | 5.804 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vikramjitmandal |
| Compound ID | 3089 |
| Compound Structure |  |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium smegmatis (ATCC 144680) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml), Isoniazid (1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | ω - acetoxy derivative of ferulenol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, O-Acetyl, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 424.225 |
| Molecular Formula | C26H32O5
|
| SMILES | C1cccc2c1c(c(c(=O)o2)C/C=C(/CC/C=C(/CC/C=C(/COC(=O)C)C)C)C)O |
| XLogP | 5.804 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vikramjitmandal |
| Compound ID | 3294 |
| Compound Structure | |
| Plant Source | Euphorbia peplis L. Common Name: |
| Source Family | Euphorbiaceae |
| Origin | India, Northern Italy |
| Plant Part Used | Leaf, stem |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | Ciprofloxacin (0.125 – 0.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 80 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 14643323 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Reference(s) | 1) Cateni F, Zilic J, Falsone G, Scialino G, Banfi E.New cerebrosides from Euphorbia peplis L.: antimicrobial activity evaluation.Bioorg Med Chem Lett. 2003 Dec 15;13(24):4345-50
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3295 |
| Compound Structure | |
| Plant Source | Euphorbia peplis L. Common Name: |
| Source Family | Euphorbiaceae |
| Origin | India, Northern Italy |
| Plant Part Used | Leaf, stem |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H331 |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ciprofloxacin (0.125 – 0.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 40 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 14643323 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Reference(s) | 1) Cateni F, Zilic J, Falsone G, Scialino G, Banfi E.New cerebrosides from Euphorbia peplis L.: antimicrobial activity evaluation.Bioorg Med Chem Lett. 2003 Dec 15;13(24):4345-50
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3296 |
| Compound Structure | |
| Plant Source | Euphorbia peplis L. Common Name: |
| Source Family | Euphorbiaceae |
| Origin | India, Northern Italy |
| Plant Part Used | Leaf, stem |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H242 |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ciprofloxacin (0.125 – 0.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 80 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 14643323 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Reference(s) | 1) Cateni F, Zilic J, Falsone G, Scialino G, Banfi E.New cerebrosides from Euphorbia peplis L.: antimicrobial activity evaluation.Bioorg Med Chem Lett. 2003 Dec 15;13(24):4345-50
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3297 |
| Compound Structure | |
| Plant Source | Euphorbia peplis L. Common Name: |
| Source Family | Euphorbiaceae |
| Origin | India, Northern Italy |
| Plant Part Used | Leaf, stem |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H172 |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ciprofloxacin (0.125 – 0.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 80 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 14643323 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Reference(s) | 1) Cateni F, Zilic J, Falsone G, Scialino G, Banfi E.New cerebrosides from Euphorbia peplis L.: antimicrobial activity evaluation.Bioorg Med Chem Lett. 2003 Dec 15;13(24):4345-50
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3298 |
| Compound Structure |  |
| Plant Source | Euphorbia peplis L. Common Name: |
| Source Family | Euphorbiaceae |
| Origin | India, Northern Italy |
| Plant Part Used | Leaf, stem |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ciprofloxacin (0.125 – 0.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 160 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1 - O - (β - D - Glucopyranosyl) - (2S, 3S, 4R, 8Z) - 2N - [(2R) - 2 - Hydroxytetracosenoil] - 8 (Z) - Octadecene - 1, 3, 4 - Triol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 14643323 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Cerebroside, Amide, Alcohol, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 843.680 |
| Molecular Formula | C48H93NO10 |
| SMILES | C(=O)(N[C@@H](CO[C@@H]1OC(C([C@H]([C@@H]1O)O)O)CO)[C@H](O)[C@@H](CCC/C=C/CCCCCCCCC)O)[C@H](O)CCCCCCCCCCCCCCCCCCCCCC |
| XLogP | 14.906 |
| PSA | 189.170 |
| H-bond Donor | 8 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 42 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) Cateni F, Zilic J, Falsone G, Scialino G, Banfi E.New cerebrosides from Euphorbia peplis L.: antimicrobial activity evaluation.Bioorg Med Chem Lett. 2003 Dec 15;13(24):4345-50
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3299 |
| Compound Structure |  |
| Plant Source | Euphorbia peplis L. Common Name: |
| Source Family | Euphorbiaceae |
| Origin | India, Northern Italy |
| Plant Part Used | Leaf, stem |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ciprofloxacin (0.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 40 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1 - O - (β - D - Glucopyranosyl) - (2S, 3S, 4R, 8Z) - 2N - [(2R) - 2 - Hydroxyhexacosenoil] - 8 (Z) - Octadecene - 1, 3, 4 - Triol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 14643323 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Cerebroside, Amide, Alcohol, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 869.696 |
| Molecular Formula | C50H95NO10 |
| SMILES | C(=O)(N[C@@H](CO[C@@H]1OC(C([C@H]([C@@H]1O)O)O)CO)[C@H](O)[C@@H](CCC/C=C/CCCCCCCCC)O)[C@H](O)CCCCCCCCCCCCCC/C=C/CCCCCCCC |
| XLogP | 15.528 |
| PSA | 189.170 |
| H-bond Donor | 8 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 43 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) Cateni F, Zilic J, Falsone G, Scialino G, Banfi E.New cerebrosides from Euphorbia peplis L.: antimicrobial activity evaluation.Bioorg Med Chem Lett. 2003 Dec 15;13(24):4345-50
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3300 |
| Compound Structure |  |
| Plant Source | Euphorbia peplis L. Common Name: |
| Source Family | Euphorbiaceae |
| Origin | India, Northern Italy |
| Plant Part Used | Leaf, stem |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H242 |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ciprofloxacin (0.125 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 160 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1 - O - (β - D - Glucopyranosyl) - (2S, 3S, 4R, 8Z) - 2N - [(2R) - 2 - Hydroxytetracosanoil] - 8 (Z) - Octadecene - 1, 3, 4 - Triol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 14643323 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Cerebroside, Amide, Alcohol, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 843.680 |
| Molecular Formula | C48H93NO10 |
| SMILES | C(=O)(N[C@@H](CO[C@@H]1OC(C([C@H]([C@@H]1O)O)O)CO)[C@H](O)[C@@H](CCC/C=C/CCCCCCCCC)O)[C@H](O)CCCCCCCCCCCCCCCCCCCCCC |
| XLogP | 14.906 |
| PSA | 189.170 |
| H-bond Donor | 8 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 42 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) Cateni F, Zilic J, Falsone G, Scialino G, Banfi E.New cerebrosides from Euphorbia peplis L.: antimicrobial activity evaluation.Bioorg Med Chem Lett. 2003 Dec 15;13(24):4345-50
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3301 |
| Compound Structure |  |
| Plant Source | Euphorbia peplis L. Common Name: |
| Source Family | Euphorbiaceae |
| Origin | India, Northern Italy |
| Plant Part Used | Leaf, stem |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H172 |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ciprofloxacin (0.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 160 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1 - O - (β - D - Glucopyranosyl) - (2S, 3S, 4E, 8E) - 2N - [(2R) - 2 - Hydroxyhexadecanoylamino] - 4 (E), 8 (E) - Octadecadiene - 1, 3 - Diol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 14643323 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Cerebroside, Amide, Alcohol, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 713.544 |
| Molecular Formula | C40H75NO9 |
| SMILES | C(=O)(N[C@@H](CO[C@@H]1OC(C([C@H]([C@@H]1O)O)O)CO)[C@H](O)/C=C/CCC/C=C/CCCCCCCC)[C@H](O)CCCCCCCCCCCCCC |
| XLogP | 11.345 |
| PSA | 168.940 |
| H-bond Donor | 7 |
| H-bond Acceptor | 10 |
| No. of Rotatable Bond Count | 33 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 9 |
| No. of S | 0 |
| Reference(s) | 1) Cateni F, Zilic J, Falsone G, Scialino G, Banfi E.New cerebrosides from Euphorbia peplis L.: antimicrobial activity evaluation.Bioorg Med Chem Lett. 2003 Dec 15;13(24):4345-50
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3303 |
| Compound Structure |  |
| Plant Source | Euphorbia peplis L. Common Name: |
| Source Family | Euphorbiaceae |
| Origin | India, Northern Italy |
| Plant Part Used | Leaf, stem |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H331 |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ciprofloxacin (0.125 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 40 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1 - O - (β - D - Glucopyranosyl) - (2S, 3S, 4R, 8Z) - 2N - [(2R) - 2 - Hydroxyhexacosenoil] - 8 (Z) - Octadecene - 1, 3, 4 - Triol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 14643323 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Cerebroside, Amide, Alcohol, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 869.696 |
| Molecular Formula | C50H95NO10 |
| SMILES | C(=O)(N[C@@H](CO[C@@H]1OC(C([C@H]([C@@H]1O)O)O)CO)[C@H](O)[C@@H](CCC/C=C/CCCCCCCCC)O)[C@H](O)CCCCCCCCCCCCCC/C=C/CCCCCCCC |
| XLogP | 15.528 |
| PSA | 189.170 |
| H-bond Donor | 8 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 43 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) Cateni F, Zilic J, Falsone G, Scialino G, Banfi E.New cerebrosides from Euphorbia peplis L.: antimicrobial activity evaluation.Bioorg Med Chem Lett. 2003 Dec 15;13(24):4345-50
|
| Curator | Vsheeba, vikramjitmandal |