| Compound ID | 1049 |
| Compound Structure | N/A |
| Plant Source | Acorus calamus L. var. americanus (Raf.) Common Name:Sweetflag |
| Source Family | Araceae |
| Origin | North America |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | |
| Assay / Test Done | Microplate Resazurin Assay (MRA) |
| Positive Control Used (conc.) | Rifampin (2 and 0.4 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Adjuvant, analgesic, antihelmintic, antihemorrhagic, anti-inflammatory, antipyretic, antirheumatic, cold, cough, dermatological, emetic, gastrointestinal, gynaecological, child birth, hallucinogen, panacea, tonic, pediatric, pulmonary, stimulant, venereal infection |
| PubMed ID [Source Literature] | 20657619 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Duncan Webster, Timothy D.G. Lee, Jill MoWebster D, Lee TD, Moore J, Manning T, Kunimoto D, LeBlanc D, Johnson JA, Gray CA.Antimycobacterial screening of traditional medicinal plants using the microplate resazurin assay.Can J Microbiol. 2010 Jun;56(6):487-94
|
| Curator | |
| Compound ID | 1278 |
| Compound Structure | |
| Plant Source | Borago officinalis Linn. Common Name:Borage |
| Source Family | Boraginaceae |
| Origin | Europe, North Africa, North America |
| Plant Part Used | Herb |
| Extract | Methanol (19.44 %) |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Used in pulmonary diseases, consumption and to treat fever |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 1279 |
| Compound Structure | |
| Plant Source | Borago officinalis Linn. Common Name:Borage |
| Source Family | Boraginaceae |
| Origin | Europe, North Africa, North America |
| Plant Part Used | Herb |
| Extract | Methanol (19.44 %) |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Used in pulmonary diseases, consumption and to treat fever |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 1876 |
| Compound Structure |  |
| Plant Source | Hydrastis canadensis Common Name:Goldenseal |
| Source Family | Ranunculaceae |
| Origin | North America |
| Plant Part Used | Root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium smegmatis (ATCC 607) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Streptomycin sulfate (1.56 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Berberine |
| PubChem ID | 2353 |
| Ethnomedicinal Information | Berberine has been demonstrated to reduce the infectivity of bacteria, fungi and protozoa in animals and humans by inhibiting the adherence of microorganisms to the host cells |
| PubMed ID [Source Literature] | 9784149, 4906191 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Isoquinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 336.124 |
| Molecular Formula | C20H18NO4 |
| SMILES | O1c2cc3CC[n+]4c(c3cc2OC1)cc1c(c4)c(OC)c(OC)cc1 |
| XLogP | 2.896 |
| PSA | 40.800 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Gentry EJ, Jampani HB, Keshavarz-Shokri A, Morton MD, Velde DV, Telikepalli H, Mitscher LA, Shawar R, Humble D, Baker W.Antitubercular natural products: berberine from the roots of commercial Hydrastis canadensis powder. Isolation of inactive 8-oxotetrahydrothalifendine, canadine, beta-hydrastine, and two new quinic acid esters, hycandinic acid esters-1 and -2.J Nat Prod. 1998 Oct;61(10):1187-93
2) Amin AH, Subbaiah TV, Abbasi KM.Berberine sulfate: antimicrobial activity, bioassay, and mode of action.Can J Microbiol. 1969 Sep;15(9):1067-76
|
| Curator | |
| Compound ID | 1877 |
| Compound Structure |  |
| Plant Source | Hydrastis canadensis Common Name:Goldenseal |
| Source Family | Ranunculaceae |
| Origin | North America |
| Plant Part Used | Root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Berberine |
| PubChem ID | 2353 |
| Ethnomedicinal Information | Berberine has been demonstrated to reduce the infectivity of bacteria, fungi and protozoa in animals and humans by inhibiting the adherence of microorganisms to the host cells |
| PubMed ID [Source Literature] | 9784149, 4906191 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Isoquinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 336.124 |
| Molecular Formula | C20H18NO4 |
| SMILES | O1c2cc3CC[n+]4c(c3cc2OC1)cc1c(c4)c(OC)c(OC)cc1 |
| XLogP | 2.896 |
| PSA | 40.800 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Gentry EJ, Jampani HB, Keshavarz-Shokri A, Morton MD, Velde DV, Telikepalli H, Mitscher LA, Shawar R, Humble D, Baker W.Antitubercular natural products: berberine from the roots of commercial Hydrastis canadensis powder. Isolation of inactive 8-oxotetrahydrothalifendine, canadine, beta-hydrastine, and two new quinic acid esters, hycandinic acid esters-1 and -2.J Nat Prod. 1998 Oct;61(10):1187-93
2) Amin AH, Subbaiah TV, Abbasi KM.Berberine sulfate: antimicrobial activity, bioassay, and mode of action.Can J Microbiol. 1969 Sep;15(9):1067-76
|
| Curator | |
| Compound ID | 1878 |
| Compound Structure |  |
| Plant Source | Hydrastis canadensis Common Name:Goldenseal |
| Source Family | Ranunculaceae |
| Origin | North America |
| Plant Part Used | Root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium avium complex |
| Assay / Test Done | |
| Positive Control Used (conc.) | Streptomycin sulfate (6.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Berberine |
| PubChem ID | 2353 |
| Ethnomedicinal Information | Berberine has been demonstrated to reduce the infectivity of bacteria, fungi and protozoa in animals and humans by inhibiting the adherence of microorganisms to the host cells |
| PubMed ID [Source Literature] | 9784149, 4906191 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Isoquinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 336.124 |
| Molecular Formula | C20H18NO4 |
| SMILES | O1c2cc3CC[n+]4c(c3cc2OC1)cc1c(c4)c(OC)c(OC)cc1 |
| XLogP | 2.896 |
| PSA | 40.800 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Gentry EJ, Jampani HB, Keshavarz-Shokri A, Morton MD, Velde DV, Telikepalli H, Mitscher LA, Shawar R, Humble D, Baker W.Antitubercular natural products: berberine from the roots of commercial Hydrastis canadensis powder. Isolation of inactive 8-oxotetrahydrothalifendine, canadine, beta-hydrastine, and two new quinic acid esters, hycandinic acid esters-1 and -2.J Nat Prod. 1998 Oct;61(10):1187-93
2) Amin AH, Subbaiah TV, Abbasi KM.Berberine sulfate: antimicrobial activity, bioassay, and mode of action.Can J Microbiol. 1969 Sep;15(9):1067-76
|
| Curator | |
| Compound ID | 1931 |
| Compound Structure |  |
| Plant Source | Ipomoea leptophylla Common Name:Bush Morning Glory, Manroot |
| Source Family | Convolvulaceae |
| Origin | North America |
| Plant Part Used | Leaf |
| Extract | Soluble extract |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC 460 radiometric system |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR (inactive) |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Operculinic acid |
| PubChem ID | 44584575 |
| Ethnomedicinal Information | Treatment for stomach troubles, tuberculosis |
| PubMed ID [Source Literature] | 14640518 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Fatty acid, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 1018.520 |
| Molecular Formula | C46H82O24 |
| SMILES | O([C@@H]1O[C@H]([C@H](O[C@@H]2O[C@H]([C@H](O)[C@@H](O)[C@H]2O)C)[C@@H](O)[C@H]1O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO)C)[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O[C@H]1C)O[C@@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]1O[C@H](CCCCCCCCCC(=O)O)CCCCC)C |
| XLogP | 1.041 |
| PSA | 372.360 |
| H-bond Donor | 13 |
| H-bond Acceptor | 24 |
| No. of Rotatable Bond Count | 25 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 24 |
| No. of S | 0 |
| Reference(s) | 1) Barnes CC, Smalley MK, Manfredi KP, Kindscher K, Loring H, Sheeley DM.Characterization of an anti-tuberculosis resin glycoside from the prairie medicinal plant Ipomoea leptophylla.J Nat Prod. 2003 Nov;66(11):1457-62
|
| Curator | |
| Compound ID | 1932 |
| Compound Structure |  |
| Plant Source | Ipomoea leptophylla Common Name:Bush Morning Glory, Manroot |
| Source Family | Convolvulaceae |
| Origin | North America |
| Plant Part Used | Leaf |
| Extract | Soluble extract |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC 460 radiometric system |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Trans - Cinnamic Acid |
| PubChem ID | 444539 |
| Ethnomedicinal Information | Treatment for stomach troubles, tuberculosis |
| PubMed ID [Source Literature] | 14640518 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 148.052 |
| Molecular Formula | C9H8O2 |
| SMILES | OC(=O)/C=C/c1ccccc1 |
| XLogP | 3.904 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Barnes CC, Smalley MK, Manfredi KP, Kindscher K, Loring H, Sheeley DM.Characterization of an anti-tuberculosis resin glycoside from the prairie medicinal plant Ipomoea leptophylla.J Nat Prod. 2003 Nov;66(11):1457-62
|
| Curator | |
| Compound ID | 1933 |
| Compound Structure |  |
| Plant Source | Ipomoea leptophylla Common Name:Bush Morning Glory, Manroot |
| Source Family | Convolvulaceae |
| Origin | North America |
| Plant Part Used | Leaf |
| Extract | Soluble extract |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC 460 radiometric system |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Propanoic acid |
| PubChem ID | 1032 |
| Ethnomedicinal Information | Treatment for stomach troubles, tuberculosis |
| PubMed ID [Source Literature] | 14640518 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Acid
|
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 74.037 |
| Molecular Formula | C3H6O2 |
| SMILES | OC(=O)CC |
| XLogP | 0.173 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Barnes CC, Smalley MK, Manfredi KP, Kindscher K, Loring H, Sheeley DM.Characterization of an anti-tuberculosis resin glycoside from the prairie medicinal plant Ipomoea leptophylla.J Nat Prod. 2003 Nov;66(11):1457-62
|
| Curator | |
| Compound ID | 1934 |
| Compound Structure |  |
| Plant Source | Ipomoea leptophylla Common Name:Bush Morning Glory, Manroot |
| Source Family | Convolvulaceae |
| Origin | North America |
| Plant Part Used | Leaf |
| Extract | Soluble extract |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC 460 radiometric system |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Lauric acid |
| PubChem ID | 3893 |
| Ethnomedicinal Information | Treatment for stomach troubles, tuberculosis |
| PubMed ID [Source Literature] | 14640518 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 200.178 |
| Molecular Formula | C12H24O2 |
| SMILES | OC(=O)CCCCCCCCCCC |
| XLogP | 5.294 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 10 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Barnes CC, Smalley MK, Manfredi KP, Kindscher K, Loring H, Sheeley DM.Characterization of an anti-tuberculosis resin glycoside from the prairie medicinal plant Ipomoea leptophylla.J Nat Prod. 2003 Nov;66(11):1457-62
|
| Curator | |
| Compound ID | 2549 |
| Compound Structure | |
| Plant Source | Sanguinaria canadensis Linn. Common Name:Bloodroot |
| Source Family | Papaveraceae |
| Origin | North America |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 62.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Expectorant, antimicrobial, antiviral, dentrifice, has anaesthetic properties, used to treat skin infections, pulmonary consumption, fever and epithelial tumours, cough |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 2550 |
| Compound Structure | |
| Plant Source | Sanguinaria canadensis Linn. Common Name:Bloodroot |
| Source Family | Papaveraceae |
| Origin | North America |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Expectorant, antimicrobial, antiviral, dentrifice, has anaesthetic properties, used to treat skin infections, pulmonary consumption, fever and epithelial tumours, cough |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 2551 |
| Compound Structure |  |
| Plant Source | Sanguinaria canadensis Linn. Common Name:Bloodroot |
| Source Family | Papaveraceae |
| Origin | North America |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (1.14 ± 0.02 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 9.61 ± 4.52 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sanguinarine |
| PubChem ID | 5154 |
| Ethnomedicinal Information | Expectorant, antimicrobial, antiviral, dentrifice, has anaesthetic properties, used to treat skin infections, pulmonary consumption, fever and epithelial tumours, cough |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Quinoline, Alkaloid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 332.092 |
| Molecular Formula | C20H14NO4
|
| SMILES | O1c2c3c(c4c([n+](c3)C)c3c(cc4)cc4OCOc4c3)ccc2OC1 |
| XLogP | 3.297 |
| PSA | 40.800 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 6 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 2552 |
| Compound Structure |  |
| Plant Source | Sanguinaria canadensis Linn. Common Name:Bloodroot |
| Source Family | Papaveraceae |
| Origin | North America |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (0.17 ± 0.04 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 41.18 ± 16.85 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sanguinarine |
| PubChem ID | 5154 |
| Ethnomedicinal Information | Expectorant, antimicrobial, antiviral, dentrifice, has anaesthetic properties, used to treat skin infections, pulmonary consumption, fever and epithelial tumours, cough |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Quinoline, Alkaloid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 332.092 |
| Molecular Formula | C20H14NO4
|
| SMILES | O1c2c3c(c4c([n+](c3)C)c3c(cc4)cc4OCOc4c3)ccc2OC1 |
| XLogP | 3.297 |
| PSA | 40.800 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 6 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 2553 |
| Compound Structure |  |
| Plant Source | Sanguinaria canadensis Linn. Common Name:Bloodroot |
| Source Family | Papaveraceae |
| Origin | North America |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 24.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sanguinarine |
| PubChem ID | 5154 |
| Ethnomedicinal Information | Expectorant, antimicrobial, antiviral, dentrifice, has anaesthetic properties, used to treat skin infections, pulmonary consumption, fever and epithelial tumours, cough |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Quinoline, Alkaloid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 332.092 |
| Molecular Formula | C20H14NO4
|
| SMILES | O1c2c3c(c4c([n+](c3)C)c3c(cc4)cc4OCOc4c3)ccc2OC1 |
| XLogP | 3.297 |
| PSA | 40.800 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 6 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 2554 |
| Compound Structure |  |
| Plant Source | Sanguinaria canadensis Linn. Common Name:Bloodroot |
| Source Family | Papaveraceae |
| Origin | North America |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (1.14 ± 0.02 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 7.30 ± 1.91 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Chelerythrine |
| PubChem ID | 2703 |
| Ethnomedicinal Information | Expectorant, antimicrobial, antiviral, dentrifice, has anaesthetic properties, used to treat skin infections, pulmonary consumption, fever and epithelial tumours, cough |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Quinoline,Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 348.124 |
| Molecular Formula | C21H18NO4
|
| SMILES | O1c2cc3c4[n+](cc5c(c4ccc3cc2OC1)ccc(OC)c5OC)C |
| XLogP | 3.370 |
| PSA | 40.800 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 2555 |
| Compound Structure |  |
| Plant Source | Sanguinaria canadensis Linn. Common Name:Bloodroot |
| Source Family | Papaveraceae |
| Origin | North America |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (0.17 ± 0.04 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 29.00 ± 17.60 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Chelerythrine |
| PubChem ID | 2703 |
| Ethnomedicinal Information | Expectorant, antimicrobial, antiviral, dentrifice, has anaesthetic properties, used to treat skin infections, pulmonary consumption, fever and epithelial tumours, cough |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Quinoline,Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 348.124 |
| Molecular Formula | C21H18NO4
|
| SMILES | O1c2cc3c4[n+](cc5c(c4ccc3cc2OC1)ccc(OC)c5OC)C |
| XLogP | 3.370 |
| PSA | 40.800 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 2556 |
| Compound Structure |  |
| Plant Source | Sanguinaria canadensis Linn. Common Name:Bloodroot |
| Source Family | Papaveraceae |
| Origin | North America |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (0.17 ± 0.04 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 14.3 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Chelerythrine |
| PubChem ID | 2703 |
| Ethnomedicinal Information | Expectorant, antimicrobial, antiviral, dentrifice, has anaesthetic properties, used to treat skin infections, pulmonary consumption, fever and epithelial tumours, cough |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Quinoline,Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 348.124 |
| Molecular Formula | C21H18NO4
|
| SMILES | O1c2cc3c4[n+](cc5c(c4ccc3cc2OC1)ccc(OC)c5OC)C |
| XLogP | 3.370 |
| PSA | 40.800 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 2557 |
| Compound Structure | |
| Plant Source | Sanguinaria canadensis Linn. Common Name:Bloodroot |
| Source Family | Papaveraceae |
| Origin | North America |
| Plant Part Used | Root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Expectorant, antimicrobial, antiviral, dentrifice, has anaesthetic properties, used to treat skin infections, pulmonary consumption, fever and epithelial tumours, cough |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gottshall RY, Lucas EH, Lickfeldt A, Roberts JM. 1949. The occurrence of antibacterial substances active against Mycobacterium tuberculosis in seed plants. J Clin Invest 28: 920±92
|
| Curator | |
| Compound ID | 2614 |
| Compound Structure |  |
| Plant Source | Solidago canadensis L. Common Name:Goldenrod, Woundwort |
| Source Family | Asteraceae (Compositae) |
| Origin | North America |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (0.25 - 0.125 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | (2Z)-8-dehydromatricaria ester |
| PubChem ID | NR |
| Ethnomedicinal Information | Urinary and kidney infections and stones, catarrh. The plant has a cleansing action on the kidneys, and a reputation for clearing upper respiratory mucus |
| PubMed ID [Source Literature] | 9810277 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Ester |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 174.068 |
| Molecular Formula | C11H10O2
|
| SMILES | C(=O)(OC)/C=C/C#CC#C/C=C/C |
| XLogP | 3.071 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Lu T, Cantrell CL, Robbs SL, Franzblau SG, Fischer NH.Antimycobacterial matricaria esters and lactones from Astereae species.Planta Med. 1998 Oct;64(7):665-7
2) http://www.anniesremedy.com/herb_detail365.php
|
| Curator | |
| Compound ID | 2617 |
| Compound Structure |  |
| Plant Source | Solidago rugosa Mill Common Name:Wrinkleleaf Goldenrod |
| Source Family | Asteraceae (Compositae) |
| Origin | North America |
| Plant Part Used | Root, Aerial |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Kolavenol |
| PubChem ID | 6442554 |
| Ethnomedicinal Information | Anti - inflammatory, tuberculosis |
| PubMed ID [Source Literature] | 7772306 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Alcohol, Alkene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 290.261 |
| Molecular Formula | C20H34O
|
| SMILES | OC/C=C(/CC[C@@]1([C@@H]2[C@@](CC[C@H]1C)(C(=CCC2)C)C)C)C |
| XLogP | 7.061 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Lu T, Vargas D, Franzblau SG, Fischer NH. Diterpenes from Solidago rugosa.Phytochemistry.1995 Jan;38(2):451-6
|
| Curator | |
| Compound ID | 2618 |
| Compound Structure |  |
| Plant Source | Solidago rugosa Mill Common Name:Wrinkleleaf Goldenrod |
| Source Family | Asteraceae (Compositae) |
| Origin | North America |
| Plant Part Used | Root, Aerial |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Hardwickiic acid |
| PubChem ID | 479908 |
| Ethnomedicinal Information | Anti - inflammatory, tuberculosis |
| PubMed ID [Source Literature] | 7772306 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Diterpene, Terpene, Furanoid, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 302.188 |
| Molecular Formula | C19H26O3
|
| SMILES | OC(=O)C1=CCC[C@@H]2[C@]([C@@H](CC[C@@H]12)C)(CCc1ccoc1)C |
| XLogP | 5.727 |
| PSA | 50.440 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Lu T, Vargas D, Franzblau SG, Fischer NH. Diterpenes from Solidago rugosa.Phytochemistry.1995 Jan;38(2):451-6
|
| Curator | |
| Compound ID | 2619 |
| Compound Structure |  |
| Plant Source | Solidago rugosa Mill Common Name:Wrinkleleaf Goldenrod |
| Source Family | Asteraceae (Compositae) |
| Origin | North America |
| Plant Part Used | Root, Aerial |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | (+)-3β - Hydroxymanool |
| PubChem ID | 479909 |
| Ethnomedicinal Information | Anti - inflammatory, tuberculosis |
| PubMed ID [Source Literature] | 7772306 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Alcohol, Alkene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 306.256 |
| Molecular Formula | C20H34O2
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@H](C(=C)CC2)CC[C@](O)(C)C=C)(CC1)C)(C)C |
| XLogP | 4.737 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Lu T, Vargas D, Franzblau SG, Fischer NH. Diterpenes from Solidago rugosa.Phytochemistry.1995 Jan;38(2):451-6
|
| Curator | |
| Compound ID | 2620 |
| Compound Structure |  |
| Plant Source | Solidago rugosa Mill Common Name:Wrinkleleaf Goldenrod |
| Source Family | Asteraceae (Compositae) |
| Origin | North America |
| Plant Part Used | Root, Aerial |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Monoacetate |
| PubChem ID | 3035155 |
| Ethnomedicinal Information | Anti - inflammatory, tuberculosis |
| PubMed ID [Source Literature] | 7772306 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Lactone, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 806.445 |
| Molecular Formula | C43H66O14
|
| SMILES | OC12[C@H]3[C@@H]([C@@]4([C@H](CC3)C[C@@H](O[C@H]3O[C@@H]([C@@H](O[C@H]5O[C@@H]([C@@H](OC(=O)C)[C@@H](O)C5)C)[C@@H](O[C@H]5O[C@@H]([C@@H](O)[C@@H](O)C5)C)C3)C)CC4)C)CC[C@@]1([C@H](CC2)C1=CC(=O)OC1)C |
| XLogP | 4.155 |
| PSA | 188.900 |
| H-bond Donor | 4 |
| H-bond Acceptor | 14 |
| No. of Rotatable Bond Count | 9 |
| No. of Rings | 8 |
| No. of N | 0 |
| No. of O | 14 |
| No. of S | 0 |
| Reference(s) | 1) Lu T, Vargas D, Franzblau SG, Fischer NH. Diterpenes from Solidago rugosa.Phytochemistry.1995 Jan;38(2):451-6
|
| Curator | |
| Compound ID | 2621 |
| Compound Structure |  |
| Plant Source | Solidago rugosa Mill Common Name:Wrinkleleaf Goldenrod |
| Source Family | Asteraceae (Compositae) |
| Origin | North America |
| Plant Part Used | Root, Aerial |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Entabietic acid |
| PubChem ID | 479912 |
| Ethnomedicinal Information | Anti - inflammatory, tuberculosis |
| PubMed ID [Source Literature] | 7772306 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 272.250 |
| Molecular Formula | C20H32
|
| SMILES | [C@@]12([C@@H](C(CCC1)(C)C)CC=C1[C@H]2CCC(=C1)C(C)C)C |
| XLogP | 8.607 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Lu T, Vargas D, Franzblau SG, Fischer NH. Diterpenes from Solidago rugosa.Phytochemistry.1995 Jan;38(2):451-6
|
| Curator | |