| Compound ID | 1763 |
| Compound Structure | |
| Plant Source | Foeniculum vulgare Mill. Common Name:Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Pakistan, Mediterranean region, Mexico, Africa |
| Plant Part Used | Seed |
| Extract | Methanol (13.26 %) |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diseases of the chest, cough, fever, respiratory diseases, digestion, over - weight, boosting metabolism as well as for stomach cramps |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) http://www.ageless.co.za/fennel.htm
|
| Curator | |
| Compound ID | 1764 |
| Compound Structure | |
| Plant Source | Foeniculum vulgare Mill. Common Name:Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Pakistan, Mediterranean region, Mexico,Africa |
| Plant Part Used | Seed |
| Extract | Methanol (13.26 %) |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diseases of the chest, cough, fever, respiratory diseases,digestion, over - weight, boosting metabolism as well as for stomach cramps |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) http://www.ageless.co.za/fennel.htm
|
| Curator | |
| Compound ID | 1765 |
| Compound Structure | |
| Plant Source | Foeniculum vulgare Mill. Common Name:Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Pakistan, Mediterranean region,Mexico,Africa |
| Plant Part Used | Aerial |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Sensitive) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diseases of the chest, cough, fever, respiratory diseases,digestion, over - weight, boosting metabolism as well as for stomach cramps |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.ageless.co.za/fennel.htm
|
| Curator | |
| Compound ID | 1766 |
| Compound Structure | |
| Plant Source | Foeniculum vulgare Mill. Common Name:Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Pakistan, Mediterranean region, Mexico, Africa |
| Plant Part Used | Aerial |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Rifampin resistant), Mycobacterium tuberculosis (Isoniazid resistant), Mycobacterium tuberculosis (Streptomycin resistant), Mycobacterium tuberculosis (Ethambutol resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diseases of the chest, cough, fever, respiratory diseases,digestion, over - weight, boosting metabolism as well as for stomach cramps |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.ageless.co.za/fennel.htm
|
| Curator | |
| Compound ID | 1767 |
| Compound Structure | |
| Plant Source | Foeniculum vulgare Mill. Common Name:Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Pakistan, Mediterranean region, Mexico, Africa |
| Plant Part Used | Aerial |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Sensitive) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diseases of the chest, cough, fever, respiratory diseases,digestion, over - weight, boosting metabolism as well as for stomach cramps |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.ageless.co.za/fennel.htm
|
| Curator | |
| Compound ID | 1768 |
| Compound Structure | |
| Plant Source | Foeniculum vulgare Mill. Common Name:Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Pakistan, Mediterranean region, Mexico, Africa |
| Plant Part Used | Aerial |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Rifampin resistant), Mycobacterium tuberculosis (Isoniazid resistant), Mycobacterium tuberculosis (Streptomycin resistant), Mycobacterium tuberculosis (Ethambutol resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diseases of the chest, cough, fever, respiratory diseases, digestion, over - weight, boosting metabolism as well as for stomach cramps |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.ageless.co.za/fennel.htm
|
| Curator | |
| Compound ID | 1769 |
| Compound Structure | |
| Plant Source | Foeniculum vulgare Mill. Common Name:Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Pakistan, Mediterranean region, Mexico,Africa |
| Plant Part Used | Aerial |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Sensitive) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diseases of the chest, cough, fever, respiratory diseases, digestion, over - weight, boosting metabolism as well as for stomach cramps |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.ageless.co.za/fennel.htm
|
| Curator | |
| Compound ID | 1770 |
| Compound Structure | |
| Plant Source | Foeniculum vulgare Mill. Common Name:Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Pakistan, Mediterranean region, Mexico, Africa |
| Plant Part Used | Aerial |
| Extract | Water |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Sensitive) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diseases of the chest, cough, fever, respiratory diseases, digestion, over - weight, boosting metabolism as well as for stomach cramps |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.ageless.co.za/fennel.htm
|
| Curator | |
| Compound ID | 1771 |
| Compound Structure | |
| Plant Source | Foeniculum vulgare Mill. Common Name:Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Pakistan, Mediterranean region, Mexico, Africa |
| Plant Part Used | Fruit |
| Extract | Essential oil |
| Target Bacteria | |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diseases of the chest, cough, fever, respiratory diseases, digestion, over - weight, boosting metabolism as well as for stomach cramps |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Bruneton, J. 1995. Pharmacognosy, phytochemistry, medicinal plants. Intercept Ltd., Andover, Hampshire, England
2) Grieve, M. 1967. A modern herbal. Hafner Publishing Co., New York, Dictionary of Natural Products (2003). CD-ROM. London: Chapman & Hall/CRC, http://plants.usda.gov/java/profile?symbol=FOVU
3) http://www.ageless.co.za/fennel.htm
|
| Curator | |
| Compound ID | 2949 |
| Compound Structure |  |
| Plant Source | Haloxylon salicornicum Bunge ex Boiss Common Name:NR |
| Source Family | Chenopodiaceae |
| Origin | Pakistan, Egypt, Jordan, Palestine, Iran, Iraq and Kuwait (in unfertile areas) |
| Plant Part Used | Whole plant |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Isoniazid (0.02 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 1'-Hydroxytetracosanyl cyclohexane |
| PubChem ID | 49797775 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20542692 |
| Extract Preparation | Methanol extract further partitioned with water and hexane. The water layer was further extracted with chloroform and subjected to silica gel column chromatography |
| Chemical Classification [Active Compound] | Alkanol, Alicyclic |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 408.433 |
| Molecular Formula | C28H56O |
| SMILES | OCCCCCCCCCCCCCCCCCCCCCCC1CCCCC1 |
| XLogP | 14.106 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 22 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bibi N, Tanoli SA, Farheen S, Afza N, Siddiqi S, Zhang Y, Kazmi SU, Malik A.In vitro antituberculosis activities of the constituents isolated from Haloxylon salicornicum.Bioorg Med Chem Lett. 2010 Jul 15;20(14):4173-6
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 2950 |
| Compound Structure |  |
| Plant Source | Haloxylon salicornicum Bunge ex Boiss Common Name:NR |
| Source Family | Chenopodiaceae |
| Origin | Pakistan, Egypt, Jordan, Palestine, Iran, Iraq and Kuwait (in unfertile areas) |
| Plant Part Used | Whole plant |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Isoniazid (0.02 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 1'-Hydroxydocasanyl cyclohexane |
| PubChem ID | 49797776 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20542692 |
| Extract Preparation | Methanol extract further partitioned with water and hexane. The water layer was further extracted with chloroform and subjected to silica gel column chromatography |
| Chemical Classification [Active Compound] | Alkanol, Alicyclic |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 380.402 |
| Molecular Formula | C26H52O |
| SMILES | OCCCCCCCCCCCCCCCCCCCCC1CCCCC1 |
| XLogP | 12.968 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 20 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bibi N, Tanoli SA, Farheen S, Afza N, Siddiqi S, Zhang Y, Kazmi SU, Malik A.In vitro antituberculosis activities of the constituents isolated from Haloxylon salicornicum.Bioorg Med Chem Lett. 2010 Jul 15;20(14):4173-6
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 2951 |
| Compound Structure |  |
| Plant Source | Haloxylon salicornicum Bunge ex Boiss Common Name:NR |
| Source Family | Chenopodiaceae |
| Origin | Pakistan, Egypt, Jordan, Palestine, Iran, Iraq and Kuwait (in unfertile areas) |
| Plant Part Used | Whole plant |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Isoniazid (0.02 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 24-Ethyl cholesta-3,5-diene |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20542692 |
| Extract Preparation | Methanol extract further partitioned with water and hexane. The water layer was further extracted with chloroform and subjected to silica gel column chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 426.386 |
| Molecular Formula | C30H50O |
| SMILES | C1=CC(CC2=C1C1C(C3(C(CC1)CCC3C(C)CCCCCCCCCC)C)CC2)O |
| XLogP | 12.044 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 10 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bibi N, Tanoli SA, Farheen S, Afza N, Siddiqi S, Zhang Y, Kazmi SU, Malik A.In vitro antituberculosis activities of the constituents isolated from Haloxylon salicornicum.Bioorg Med Chem Lett. 2010 Jul 15;20(14):4173-6
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 2952 |
| Compound Structure |  |
| Plant Source | Haloxylon salicornicum Bunge ex Boiss Common Name:NR |
| Source Family | Chenopodiaceae |
| Origin | Pakistan, Egypt, Jordan, Palestine, Iran, Iraq and Kuwait (in unfertile areas) |
| Plant Part Used | Whole plant |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Isoniazid (0.02 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 24-Nor-12-ursene |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20542692 |
| Extract Preparation | Methanol extract further partitioned with water and hexane. The water layer was further extracted with chloroform and subjected to silica gel column chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 382.360 |
| Molecular Formula | C28H46 |
| SMILES | C1CCC(C2[C@]1(C1[C@@](CC2)(C2C(=CC1)C1[C@@](CC2)(CCC([C@@H]1C)C)C)C)C)C |
| XLogP | 12.937 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bibi N, Tanoli SA, Farheen S, Afza N, Siddiqi S, Zhang Y, Kazmi SU, Malik A.In vitro antituberculosis activities of the constituents isolated from Haloxylon salicornicum.Bioorg Med Chem Lett. 2010 Jul 15;20(14):4173-6
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 2953 |
| Compound Structure |  |
| Plant Source | Haloxylon salicornicum Bunge ex Boiss Common Name:NR |
| Source Family | Chenopodiaceae |
| Origin | Pakistan, Egypt, Jordan, Palestine, Iran, Iraq and Kuwait (in unfertile areas) |
| Plant Part Used | Whole plant |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Isoniazid (0.02 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 24-Hydroxy-4-octacosanone |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20542692 |
| Extract Preparation | Methanol extract further partitioned with water and hexane. The water layer was further extracted with chloroform and subjected to silica gel column chromatography |
| Chemical Classification [Active Compound] | Aliphatic, Ketone, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 424.428 |
| Molecular Formula | C28H56O2 |
| SMILES | CCCC(=O)CCCCCCCCCCCCCCCCCCCC(CCCC)O |
| XLogP | 11.693 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 25 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Bibi N, Tanoli SA, Farheen S, Afza N, Siddiqi S, Zhang Y, Kazmi SU, Malik A.In vitro antituberculosis activities of the constituents isolated from Haloxylon salicornicum.Bioorg Med Chem Lett. 2010 Jul 15;20(14):4173-6
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 2954 |
| Compound Structure |  |
| Plant Source | Haloxylon salicornicum Bunge ex Boiss Common Name:NR |
| Source Family | Chenopodiaceae |
| Origin | Pakistan, Egypt, Jordan, Palestine, Iran, Iraq and Kuwait (in unfertile areas) |
| Plant Part Used | Whole plant |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Isoniazid (0.02 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Lupeol |
| PubChem ID | 44586882 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20542692 |
| Extract Preparation | Methanol extract further partitioned with water and hexane. The water layer was further extracted with chloroform and subjected to silica gel column chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 426.386 |
| Molecular Formula | C30H50O |
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C([C@@H]5[C@@](CC4)(CC[C@H]5C(=C)C)C)CC3)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 11.901 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bibi N, Tanoli SA, Farheen S, Afza N, Siddiqi S, Zhang Y, Kazmi SU, Malik A.In vitro antituberculosis activities of the constituents isolated from Haloxylon salicornicum.Bioorg Med Chem Lett. 2010 Jul 15;20(14):4173-6
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 2955 |
| Compound Structure |  |
| Plant Source | Haloxylon salicornicum Bunge ex Boiss Common Name:NR |
| Source Family | Chenopodiaceae |
| Origin | Pakistan, Egypt, Jordan, Palestine, Iran, Iraq and Kuwait (in unfertile areas) |
| Plant Part Used | Whole plant |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Isoniazid (0.02 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Lupeol acetate |
| PubChem ID | 92157 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20542692 |
| Extract Preparation | Methanol extract further partitioned with water and hexane. The water layer was further extracted with chloroform and subjected to silica gel column chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, O-Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 468.397 |
| Molecular Formula | C32H52O2 |
| SMILES | O([C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4([C@@H]([C@@H]5[C@@](CC4)(CC[C@H]5C(=C)C)C)CC3)C)(CC2)C)(CC1)C)(C)C)C(=O)C |
| XLogP | 12.641 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Bibi N, Tanoli SA, Farheen S, Afza N, Siddiqi S, Zhang Y, Kazmi SU, Malik A.In vitro antituberculosis activities of the constituents isolated from Haloxylon salicornicum.Bioorg Med Chem Lett. 2010 Jul 15;20(14):4173-6
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 2956 |
| Compound Structure |  |
| Plant Source | Haloxylon salicornicum Bunge ex Boiss Common Name:NR |
| Source Family | Chenopodiaceae |
| Origin | Pakistan, Egypt, Jordan, Palestine, Iran, Iraq and Kuwait (in unfertile areas) |
| Plant Part Used | Whole plant |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Isoniazid (0.02 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | β-Amyrin |
| PubChem ID | 73145 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20542692 |
| Extract Preparation | Methanol extract further partitioned with water and hexane. The water layer was further extracted with chloroform and subjected to silica gel column chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene. Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 426.386 |
| Molecular Formula | C30H50O |
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 11.546 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bibi N, Tanoli SA, Farheen S, Afza N, Siddiqi S, Zhang Y, Kazmi SU, Malik A.In vitro antituberculosis activities of the constituents isolated from Haloxylon salicornicum.Bioorg Med Chem Lett. 2010 Jul 15;20(14):4173-6
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 2957 |
| Compound Structure |  |
| Plant Source | Haloxylon salicornicum Bunge ex Boiss Common Name:NR |
| Source Family | Chenopodiaceae |
| Origin | Pakistan, Egypt, Jordan, Palestine, Iran, Iraq and Kuwait (in unfertile areas) |
| Plant Part Used | Whole plant |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Isoniazid (0.02 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | β-Amyrin acetate |
| PubChem ID | 5318302 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20542692 |
| Extract Preparation | Methanol extract further partitioned with water and hexane. The water layer was further extracted with chloroform and subjected to silica gel column chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, O-Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 468.397 |
| Molecular Formula | C32H52O2 |
| SMILES | O([C@@H]1C(C2[C@@](C3[C@](C4(C(=CC3)C3[C@@](CC4)(CCC(C3)(C)C)C)C)(CC2)C)(CC1)C)(C)C)C(=O)C |
| XLogP | 12.286 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Bibi N, Tanoli SA, Farheen S, Afza N, Siddiqi S, Zhang Y, Kazmi SU, Malik A.In vitro antituberculosis activities of the constituents isolated from Haloxylon salicornicum.Bioorg Med Chem Lett. 2010 Jul 15;20(14):4173-6
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 2958 |
| Compound Structure |  |
| Plant Source | Haloxylon salicornicum Bunge ex Boiss Common Name:NR |
| Source Family | Chenopodiaceae |
| Origin | Pakistan, Egypt, Jordan, Palestine, Iran, Iraq and Kuwait (in unfertile areas) |
| Plant Part Used | Whole plant |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Isoniazid (0.02 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 7,8-Dimthoxy-6-hydroxy cumarine |
| PubChem ID | 11345068 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20542692 |
| Extract Preparation | Methanol extract further partitioned with water and hexane. The water layer was further extracted with chloroform and subjected to silica gel column chromatography |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Coumarin, Phenol, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 222.053 |
| Molecular Formula | C11H10O5 |
| SMILES | O1c2c(cc(O)c(OC)c2OC)ccc1=O |
| XLogP | 1.168 |
| PSA | 55.760 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Bibi N, Tanoli SA, Farheen S, Afza N, Siddiqi S, Zhang Y, Kazmi SU, Malik A.In vitro antituberculosis activities of the constituents isolated from Haloxylon salicornicum.Bioorg Med Chem Lett. 2010 Jul 15;20(14):4173-6
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 2959 |
| Compound Structure |  |
| Plant Source | Haloxylon salicornicum Bunge ex Boiss Common Name:NR |
| Source Family | Chenopodiaceae |
| Origin | Pakistan, Egypt, Jordan, Palestine, Iran, Iraq and Kuwait (in unfertile areas) |
| Plant Part Used | Whole plant |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Isoniazid (0.02 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Ursolic acid |
| PubChem ID | 64945 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20542692 |
| Extract Preparation | Methanol extract further partitioned with water and hexane. The water layer was further extracted with chloroform and subjected to silica gel column chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3 |
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CC[C@H]([C@@H]3C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 8.954 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bibi N, Tanoli SA, Farheen S, Afza N, Siddiqi S, Zhang Y, Kazmi SU, Malik A.In vitro antituberculosis activities of the constituents isolated from Haloxylon salicornicum.Bioorg Med Chem Lett. 2010 Jul 15;20(14):4173-6
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 2960 |
| Compound Structure |  |
| Plant Source | Haloxylon salicornicum Bunge ex Boiss Common Name:NR |
| Source Family | Chenopodiaceae |
| Origin | Pakistan, Egypt, Jordan, Palestine, Iran, Iraq and Kuwait (in unfertile areas) |
| Plant Part Used | Whole plant |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Isoniazid (0.02 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Olean-12(13) en-3β-hexadecanoate |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20542692 |
| Extract Preparation | Methanol extract further partitioned with water and hexane. The water layer was further extracted with chloroform and subjected to silica gel column chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Ester |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 692.647 |
| Molecular Formula | C48H84O2 |
| SMILES | C1C[C@@H](C([C@]2([C@]1([C@H]1[C@@](CC2)([C@]2(C(=CC1)[C@]1([C@@](CC2)(CCC(C1)(C)C)C)C)C)C)C)C)(C)C)OC(=O)CCCCCCCCCCCCCCC |
| XLogP | 20.954 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 16 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Bibi N, Tanoli SA, Farheen S, Afza N, Siddiqi S, Zhang Y, Kazmi SU, Malik A.In vitro antituberculosis activities of the constituents isolated from Haloxylon salicornicum.Bioorg Med Chem Lett. 2010 Jul 15;20(14):4173-6
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 2961 |
| Compound Structure |  |
| Plant Source | Haloxylon salicornicum Bunge ex Boiss Common Name:NR |
| Source Family | Chenopodiaceae |
| Origin | Pakistan, Egypt, Jordan, Palestine, Iran, Iraq and Kuwait (in unfertile areas) |
| Plant Part Used | Whole plant |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Isoniazid (0.02 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Stigmasterol |
| PubChem ID | 5280794 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20542692 |
| Extract Preparation | Methanol extract further partitioned with water and hexane. The water layer was further extracted with chloroform and subjected to silica gel column chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 412.371 |
| Molecular Formula | C29H48O |
| SMILES | O[C@@H]1CC2=CC[C@H]3[C@H]4[C@@]([C@H](CC4)[C@H](C)/C=C/[C@H](C(C)C)CC)(CC[C@@H]3[C@]2(CC1)C)C |
| XLogP | 11.071 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bibi N, Tanoli SA, Farheen S, Afza N, Siddiqi S, Zhang Y, Kazmi SU, Malik A.In vitro antituberculosis activities of the constituents isolated from Haloxylon salicornicum.Bioorg Med Chem Lett. 2010 Jul 15;20(14):4173-6
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 2962 |
| Compound Structure |  |
| Plant Source | Haloxylon salicornicum Bunge ex Boiss Common Name:NR |
| Source Family | Chenopodiaceae |
| Origin | Pakistan, Egypt, Jordan, Palestine, Iran, Iraq and Kuwait (in unfertile areas) |
| Plant Part Used | Whole plant |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Isoniazid (0.02 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Haloxyline A |
| PubChem ID | 11362138 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20542692 |
| Extract Preparation | Methanol extract further partitioned with water and hexane. The water layer was further extracted with chloroform and subjected to silica gel column chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Alkene, Piperidine, Alkaloid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 419.376 |
| Molecular Formula | C27H49NO2 |
| SMILES | O=C(N1CCCCC1)/C=CC=C/CCCCCCCCCCCCCCCCCO |
| XLogP | 9.460 |
| PSA | 40.540 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 20 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Bibi N, Tanoli SA, Farheen S, Afza N, Siddiqi S, Zhang Y, Kazmi SU, Malik A.In vitro antituberculosis activities of the constituents isolated from Haloxylon salicornicum.Bioorg Med Chem Lett. 2010 Jul 15;20(14):4173-6
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 2963 |
| Compound Structure |  |
| Plant Source | Haloxylon salicornicum Bunge ex Boiss Common Name:NR |
| Source Family | Chenopodiaceae |
| Origin | Pakistan, Egypt, Jordan, Palestine, Iran, Iraq and Kuwait (in unfertile areas) |
| Plant Part Used | Whole plant |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Isoniazid (0.02 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Haloxyline B |
| PubChem ID | 11453345 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20542692 |
| Extract Preparation | Methanol extract further partitioned with water and hexane. The water layer was further extracted with chloroform and subjected to silica gel column chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Alkene, Pyrrolidine, Amide, Alcohol, Alkaloid |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.371 |
| Molecular Formula | C27H49NO3 |
| SMILES | O[C@@H]1CCCN(C1)C(=O)/C=CC=C/CCCCCCCCCCCCCCCCCO |
| XLogP | 8.430 |
| PSA | 60.770 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 20 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bibi N, Tanoli SA, Farheen S, Afza N, Siddiqi S, Zhang Y, Kazmi SU, Malik A.In vitro antituberculosis activities of the constituents isolated from Haloxylon salicornicum.Bioorg Med Chem Lett. 2010 Jul 15;20(14):4173-6
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 2964 |
| Compound Structure |  |
| Plant Source | Haloxylon salicornicum Bunge ex Boiss Common Name:NR |
| Source Family | Chenopodiaceae |
| Origin | Pakistan, Egypt, Jordan, Palestine, Iran, Iraq and Kuwait (in unfertile areas) |
| Plant Part Used | Whole plant |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Isoniazid (0.02 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 5α-Epidioxyergosta-6,9(11), 22-triene |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20542692 |
| Extract Preparation | Methanol extract further partitioned with water and hexane. The water layer was further extracted with chloroform and subjected to silica gel column chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Peroxy, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 426.313 |
| Molecular Formula | C28H42O3 |
| SMILES | C1C[C@@H](C[C@@]23[C@]1(C1=CC[C@@]4(C(CC[C@H]4[C@]1(C=C2)OO3)[C@@H](/C=C/[C@H](C(C)C)C)C)C)C)O |
| XLogP | 7.484 |
| PSA | 38.690 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bibi N, Tanoli SA, Farheen S, Afza N, Siddiqi S, Zhang Y, Kazmi SU, Malik A.In vitro antituberculosis activities of the constituents isolated from Haloxylon salicornicum.Bioorg Med Chem Lett. 2010 Jul 15;20(14):4173-6
|
| Curator | KeyaMukherjee, vsheeba |