| Compound ID | 3390 |
| Compound Structure |  |
| Plant Source | Erythrina gibbosa Common Name:NR |
| Source Family | Fabaceae |
| Origin | Panamanian |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Agar Dilution - Streak Assay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | >=25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Erygibisoflavone |
| PubChem ID | 392442 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9828037 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Flavonoid, Benzopyran, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 354.110 |
| Molecular Formula | C20H18O6 |
| SMILES | O1C(C=Cc2c1c(C1COc3c(C1=O)c(O)cc(O)c3)ccc2O)(C)C |
| XLogP | 1.167 |
| PSA | 96.220 |
| H-bond Donor | 3 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Mitscher LA, Baker W.Tuberculosis: a search for novel therapy starting with natural products.Med Res Rev. 1998 Nov;18(6):363-74
|
| Curator | Wvarsha, keyamukherjee, rachanake |
| Compound ID | 3391 |
| Compound Structure |  |
| Plant Source | Erythrina gibbosa Common Name:NR |
| Source Family | Fabaceae |
| Origin | Panamanian |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Agar Dilution - Streak Assay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 - 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Erythrabyssin 2 |
| PubChem ID | 10408212 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9828037 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Chromene, Benzopyran, Phenol, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 392.199 |
| Molecular Formula | C25H28O4 |
| SMILES | O1[C@@H]2[C@H](c3c1c(c(O)cc3)CC=C(C)C)COc1c2cc(c(O)c1)CC=C(C)C |
| XLogP | 4.735 |
| PSA | 58.920 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Mitscher LA, Baker W.Tuberculosis: a search for novel therapy starting with natural products.Med Res Rev. 1998 Nov;18(6):363-74
|
| Curator | Wvarsha,keyamukherjee, rachanake |
| Compound ID | 3392 |
| Compound Structure |  |
| Plant Source | Erythrina gibbosa Common Name:NR |
| Source Family | Fabaceae |
| Origin | Panamanian |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Agar Dilution - Streak Assay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 - 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Phaseolidine |
| PubChem ID | 119268 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9828037 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzopyran, Benzofuranoid, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4 |
| SMILES | O1[C@@H]2[C@H](c3c1c(c(O)cc3)CC=C(C)C)COc1c2ccc(O)c1 |
| XLogP | 3.265 |
| PSA | 58.920 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Mitscher LA, Baker W.Tuberculosis: a search for novel therapy starting with natural products.Med Res Rev. 1998 Nov;18(6):363-74
|
| Curator | Wvarsha, keyamukherjee, rachanake |
| Compound ID | 3393 |
| Compound Structure |  |
| Plant Source | Erythrina gibbosa Common Name:NR |
| Source Family | Fabaceae |
| Origin | Panamanian |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Agar Dilution - Streak Assay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 0.78 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Erythrabyssin 2 |
| PubChem ID | 10408212 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9828037 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Chromene, Benzopyran, Phenol, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 392.199 |
| Molecular Formula | C25H28O4 |
| SMILES | O1[C@@H]2[C@H](c3c1c(c(O)cc3)CC=C(C)C)COc1c2cc(c(O)c1)CC=C(C)C |
| XLogP | 4.735 |
| PSA | 58.920 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Mitscher LA, Baker W.Tuberculosis: a search for novel therapy starting with natural products.Med Res Rev. 1998 Nov;18(6):363-74
|
| Curator | Wvarsha, keyamukherjee, rachanake |