| Compound ID | 2578 |
| Compound Structure |  |
| Plant Source | Scleropyrum pentandrum Common Name: |
| Source Family | Santalaceae |
| Origin | India, Malaysia, Philippines, Singapore, Sri Lanka |
| Plant Part Used | Twig |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.004 µg/ml), Isoniazid (0.06 µg/ml), Kanamycin sulphate (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Scleropyric acid |
| PubChem ID | 11594149 |
| Ethnomedicinal Information | Malaria, tuberculosis |
| PubMed ID [Source Literature] | 16204994 |
| Extract Preparation | The pulverized, dry twigs (1.06 kg) were extracted successively with n - Hexane, CHCl3 and MeOH in a soxhlet extraction apparatus to yield the hexane (7.12 g), CHCl3 (3.50 g), and MeOH (12.42 g) extracts, respectively |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 264.209 |
| Molecular Formula | C17H28O2 |
| SMILES | OC(=O)CCCCCCCCCCC#CCCC=C |
| XLogP | 6.563 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn A, Buaprom M, Udtip S, Nuntawong N, Haritakun R, Kanokmedhakul S.Antimycobacterial and antiplasmodial unsaturated carboxylic acid from the twigs of Scleropyrum wallichianum.Chem Pharm Bull (Tokyo). 2005 Oct;53(10):1327-9
|
| Curator | |
| Compound ID | 3044 |
| Compound Structure |  |
| Plant Source | Alpinia purpurata (Vieill.) K. Schum Common Name:Red Ginger |
| Source Family | Zingiberaceae |
| Origin | Philippines |
| Plant Part Used | Leaf |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (99% inhibition at 0.18 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Sitosteryl - 3 - O - 6 - Palmitoyl - β - D - glucoside |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiviral activity against HIV |
| PubMed ID [Source Literature] | 21120040 |
| Extract Preparation | Air dried leaves mixed with ethanol, hexane, dichloromethane and n - butanol |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Triterpene, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H11 agar |
| Cytotoxicity Assay [AID] | Plant sterols, particularly U - Sitosterol and its glucosides, have been investigated as immune regulators of T - cell activity and as agents in maintaining the CD4+ count |
| Molecular Weight | 646.481 |
| Molecular Formula | C39H66O7
|
| SMILES | C1C[C@@H](CC2=CCC3C([C@@]12C)CC[C@@]1([C@H](CCC31)[C@H](C)CC[C@@H](CC)C(C)C)C)OC1OC(C(C(C1O)O)O)COC(=O)CCC |
| XLogP | 11.620 |
| PSA | 105.450 |
| H-bond Donor | 3 |
| H-bond Acceptor | 7 |
| No. of Rotatable Bond Count | 13 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Villaflores OB, Macabeo AP, Gehle D, Krohn K, Franzblau SG, Aguinaldo AM.Phytoconstituents from Alpinia purpurata and their in vitro inhibitory activity against Mycobacterium tuberculosis.Pharmacogn Mag. 2010 Oct;6(24):339-44
|
| Curator | Vikramjitmandal |
| Compound ID | 3045 |
| Compound Structure |  |
| Plant Source | Alpinia purpurata (Vieill.) K. Schum Common Name:Red Ginger |
| Source Family | Zingiberaceae |
| Origin | Philippines |
| Plant Part Used | Leaf |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (99% inhibition at 0.18 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | β - Sitosteryl Galactoside |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiviral activity against HIV |
| PubMed ID [Source Literature] | 21120040 |
| Extract Preparation | Air dried leaves mixed with ethanol, hexane, dichloromethane and n - butanol |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H11 agar |
| Cytotoxicity Assay [AID] | Plant sterols, particularly U - Sitosterol and its glucosides, have been investigated as immune regulators of T - cell activity and as agents in maintaining the CD4+ count |
| Molecular Weight | 576.439 |
| Molecular Formula | C35H60O6
|
| SMILES | C1C[C@@H](CC2=CCC3C([C@@]12C)CC[C@@]1([C@H](CCC31)[C@H](C)CC[C@@H](CC)C(C)C)C)OC1OC(C(C(C1O)O)O)CO |
| XLogP | 10.487 |
| PSA | 99.380 |
| H-bond Donor | 4 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 9 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Villaflores OB, Macabeo AP, Gehle D, Krohn K, Franzblau SG, Aguinaldo AM.Phytoconstituents from Alpinia purpurata and their in vitro inhibitory activity against Mycobacterium tuberculosis.Pharmacogn Mag. 2010 Oct;6(24):339-44
|
| Curator | Vikramjitmandal |
| Compound ID | 3046 |
| Compound Structure |  |
| Plant Source | Alpinia purpurata (Vieill.) K. Schum Common Name:Red Ginger |
| Source Family | Zingiberaceae |
| Origin | Philippines |
| Plant Part Used | Leaf |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (99% inhibition at 0.18 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Kumatakenin |
| PubChem ID | 5318869 |
| Ethnomedicinal Information | Antiviral activity against HIV |
| PubMed ID [Source Literature] | 21120040 |
| Extract Preparation | Air dried leaves mixed with ethanol, hexane, dichloromethane and n-butanol |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H11 agar |
| Cytotoxicity Assay [AID] | Plant sterols, particularly U - Sitosterol and its glucosides, have been investigated as immune regulators of T - cell activity and as agents in maintaining the CD4+ count |
| Molecular Weight | 314.079 |
| Molecular Formula | C17H14O6 |
| SMILES | O1c2c(c(=O)c(OC)c1c1ccc(O)cc1)c(O)cc(OC)c2 |
| XLogP | 2.021 |
| PSA | 75.990 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Villaflores OB, Macabeo AP, Gehle D, Krohn K, Franzblau SG, Aguinaldo AM.Phytoconstituents from Alpinia purpurata and their in vitro inhibitory activity against Mycobacterium tuberculosis.Pharmacogn Mag. 2010 Oct;6(24):339-44
|
| Curator | Vikramjitmandal, farzana-shamsudeen-shamsudeen |