| Compound ID | 1785 |
| Compound Structure | |
| Plant Source | Galipea officinalis Common Name:Angustura Vera |
| Source Family | Rutaceae |
| Origin | South America |
| Plant Part Used | Bark |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:320 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Used to treat diarrhoea and fevers |
| PubMed ID [Source Literature] | 2118130 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Grange JM, Davey RW.Detection of antituberculous activity in plant extracts.J Appl Bacteriol. 1990 Jun;68(6):587-91
|
| Curator | |
| Compound ID | 1786 |
| Compound Structure |  |
| Plant Source | Galipea officinalis Common Name:Angustura Vera |
| Source Family | Rutaceae |
| Origin | South America |
| Plant Part Used | Bark |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | Isoniazid (0.12 µg/ml), Rifampin (0.001 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Cusparine |
| PubChem ID | 442893 |
| Ethnomedicinal Information | Used to treat diarrhoea and fevers |
| PubMed ID [Source Literature] | 10232071 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkaloid, Quinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 307.121 |
| Molecular Formula | C19H17NO3
|
| SMILES | O1c2cc(CCc3nc4c(c(OC)c3)cccc4)ccc2OC1 |
| XLogP | 4.688 |
| PSA | 40.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 4 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Houghton PJ, Woldemariam TZ, Watanabe Y, Yates M.Activity against Mycobacterium tuberculosis of alkaloid constituents of Angostura bark, Galipea officinalis.Planta Med. 1999 Apr;65(3):250-4
|
| Curator | |
| Compound ID | 1787 |
| Compound Structure |  |
| Plant Source | Galipea officinalis Common Name:Angustura Vera |
| Source Family | Rutaceae |
| Origin | South America |
| Plant Part Used | Bark |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | Isoniazid (0.12 µg/ml), Rifampin (0.001 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Galipine |
| PubChem ID | 68235 |
| Ethnomedicinal Information | Used to treat diarrhoea and fevers |
| PubMed ID [Source Literature] | 10232071 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Quinoline, Alkaloid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 323.152 |
| Molecular Formula | C20H21NO3
|
| SMILES | O(c1c2c(nc(CCc3cc(OC)c(OC)cc3)c1)cccc2)C |
| XLogP | 4.761 |
| PSA | 40.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Houghton PJ, Woldemariam TZ, Watanabe Y, Yates M.Activity against Mycobacterium tuberculosis of alkaloid constituents of Angostura bark, Galipea officinalis.Planta Med. 1999 Apr;65(3):250-4
|
| Curator | |
| Compound ID | 1788 |
| Compound Structure |  |
| Plant Source | Galipea officinalis Common Name:Angustura Vera |
| Source Family | Rutaceae |
| Origin | South America |
| Plant Part Used | Bark |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | Isoniazid (0.12 µg/ml), Rifampin (0.001 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 4 - Methoxy - 2 - N - Pentylquinoleine |
| PubChem ID | 3009247 |
| Ethnomedicinal Information | Used to treat diarrhoea and fevers |
| PubMed ID [Source Literature] | 10232071 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkaloid, Quinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 229.147 |
| Molecular Formula | C15H19NO
|
| SMILES | O(c1cc(nc2c1cccc2)CCCCC)C |
| XLogP | 5.146 |
| PSA | 22.120 |
| H-bond Donor | 0 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 2 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Houghton PJ, Woldemariam TZ, Watanabe Y, Yates M.Activity against Mycobacterium tuberculosis of alkaloid constituents of Angostura bark, Galipea officinalis.Planta Med. 1999 Apr;65(3):250-4
|
| Curator | |
| Compound ID | 1789 |
| Compound Structure |  |
| Plant Source | Galipea officinalis Common Name:Angustura Vera |
| Source Family | Rutaceae |
| Origin | South America |
| Plant Part Used | Bark |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | Isoniazid (0.12 µg/ml), Rifampin (0.001 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N - Methyl - 2 - Quinolone |
| PubChem ID | 11820 |
| Ethnomedicinal Information | Used to treat diarrhoea and fevers |
| PubMed ID [Source Literature] | 10232071 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Quinolone, Alkaloid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 159.068 |
| Molecular Formula | C10H9NO
|
| SMILES | O=c1n(c2c(cc1)cccc2)C |
| XLogP | 2.261 |
| PSA | 17.070 |
| H-bond Donor | 0 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 2 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Houghton PJ, Woldemariam TZ, Watanabe Y, Yates M.Activity against Mycobacterium tuberculosis of alkaloid constituents of Angostura bark, Galipea officinalis.Planta Med. 1999 Apr;65(3):250-4
|
| Curator | |
| Compound ID | 2789 |
| Compound Structure | |
| Plant Source | Viola odorata Linn. Common Name:Sweet Violet (English) |
| Source Family | Violaceae |
| Origin | Europe including Britain, Northern Asia, North Tropical and South America, India |
| Plant Part Used | Leaf |
| Extract | Methanol (14.35 %) |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiseptic, expectorant and used to treat cough, bronchitis, catarrh, flowers were used to treat consumption in the days of Charles II and were sold by all apothecaries |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 2790 |
| Compound Structure | |
| Plant Source | Viola odorata Linn. Common Name:Sweet Violet (English) |
| Source Family | Violaceae |
| Origin | Europe including Britain, Northern Asia, North Tropical and South America, India |
| Plant Part Used | Leaf |
| Extract | Methanol (14.35 %) |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiseptic, expectorant and used to treat cough, bronchitis, catarrh, the flowers were used to treat consumption in the days of Charles II and were sold by all apothecaries |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |