| Compound ID | 3117 |
| Compound Structure |  |
| Plant Source | Alpinia galanga Common Name:Thai Ginger |
| Source Family | Zingiberaceae |
| Origin | South Asia and Indonesia |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 1 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Acetylchavicole Acetate |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 16243360 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Acetate |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 234.089 |
| Molecular Formula | C13H14O4 |
| SMILES | C1cc(ccc1[C@H](C=C)OC(=O)C)OC(=O)C |
| XLogP | 3.011 |
| PSA | 52.600 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Pauli GF, Case RJ, Inui T, Wang Y, Cho S, Fischer NH, Franzblau SG.New perspectives on natural products in TB drug research.Life Sci. 2005 Dec 22;78(5):485-94
|
| Curator | KeyaMukherjee, reshmi |
