| Compound ID | 1332 |
| Compound Structure | |
| Plant Source | Caesalpinia pulcherrima Common Name:Poinciana, Peacock Flower, Red Bird of Paradise |
| Source Family | Fabaceae |
| Origin | Native to Central America, grown widely in South and Southeast Asia |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Fever, sores, cough, breathing difficulty and chest pain |
| PubMed ID [Source Literature] | 14531033 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Promsawan N, Kittakoop P, Boonphong S, Nongkunsarn P.Antitubercular cassane furanoditerpenoids from the roots of Caesalpinia pulcherrima.Planta Med. 2003 Aug;69(8):776-7
2) "Taxon: Caesalpinia pulcherrima (L.) Sw.". Germplasm Resources Information Network. United States Department of Agriculture. 2004-03-26
3) S. Allen Counter (2006-07-24). "Amazon mystery: A medicine man understood the secrets of this plant long before we did. How?". The Boston Globe.
|
| Curator | |
| Compound ID | 1333 |
| Compound Structure | |
| Plant Source | Caesalpinia pulcherrima Common Name:Poinciana, Peacock Flower, Red Bird of Paradise |
| Source Family | Fabaceae |
| Origin | Native to Central America, grown widely in South and Southeast Asia |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 14531033 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Promsawan N, Kittakoop P, Boonphong S, Nongkunsarn P.Antitubercular cassane furanoditerpenoids from the roots of Caesalpinia pulcherrima.Planta Med. 2003 Aug;69(8):776-7
|
| Curator | |
| Compound ID | 2379 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.050 µg/ml), Kanamycin sulfate (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Pellitorine |
| PubChem ID | 5318516 |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 15234750 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkaloid, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 223.194 |
| Molecular Formula | C14H25NO
|
| SMILES | O=C(NCC(C)C)/C=C/C=C/CCCCC |
| XLogP | 4.469 |
| PSA | 29.100 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 9 |
| No. of Rings | 0 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Rukachaisirikul T, Siriwattanakit P, Sukcharoenphol K, Wongvein C, Ruttanaweang P, Wongwattanavuch P, Suksamrarn A.Chemical constituents and bioactivity of Piper sarmentosum.J Ethnopharmacol. 2004 Aug;93(2-3):173-6
|
| Curator | |
| Compound ID | 2380 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.050 µg/ml), Kanamycin sulfate (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Guineensine |
| PubChem ID | 6442405 |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 15234750 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Amide, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 383.246 |
| Molecular Formula | C24H33NO3
|
| SMILES | O1c2cc(/C=C/CCCCCC/C=C/C=C/C(=O)NCC(C)C)ccc2OC1 |
| XLogP | 7.275 |
| PSA | 47.560 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 13 |
| No. of Rings | 2 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Rukachaisirikul T, Siriwattanakit P, Sukcharoenphol K, Wongvein C, Ruttanaweang P, Wongwattanavuch P, Suksamrarn A.Chemical constituents and bioactivity of Piper sarmentosum.J Ethnopharmacol. 2004 Aug;93(2-3):173-6
|
| Curator | |
| Compound ID | 2381 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.050 µg/ml), Kanamycin sulfate (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Brachyamide B |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 15234750 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Alkaloid, Pyrrolidine, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 327.183 |
| Molecular Formula | C20H25NO3 |
| SMILES | C1N(CCC1)C(=O)/C=C/CCCC/C=C/c1cc2c(cc1)OCO2 |
| XLogP | 5.013 |
| PSA | 38.770 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Rukachaisirikul T, Siriwattanakit P, Sukcharoenphol K, Wongvein C, Ruttanaweang P, Wongwattanavuch P, Suksamrarn A.Chemical constituents and bioactivity of Piper sarmentosum.J Ethnopharmacol. 2004 Aug;93(2-3):173-6
|
| Curator | |
| Compound ID | 2382 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.050 µg/ml), Kanamycin sulfate (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sarmentosine |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 15234750 |
| Extract Preparation | The pulverized, dried fruits of Piper sarmentosum (2.39 kg) were extracted successively with hexane and MeOH in a Soxhlet apparatus. After removal of solvent in vacuo, the hexane extract (70.7 g) was subjected to quick CC (silica gel) eluting with hexane, hexane–CHCl3, CHCl3, CHCl3–MeOH and MeOH to give 6 main fractions |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Alkaloid, Pyrrolidine, Amide, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 299.152 |
| Molecular Formula | C18H21NO3 |
| SMILES | C1c2c(ccc1/C=C/CC/C=C/C(=O)N1CCCC1)OCO2 |
| XLogP | 3.875 |
| PSA | 38.770 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Rukachaisirikul T, Siriwattanakit P, Sukcharoenphol K, Wongvein C, Ruttanaweang P, Wongwattanavuch P, Suksamrarn A.Chemical constituents and bioactivity of Piper sarmentosum.J Ethnopharmacol. 2004 Aug;93(2-3):173-6
|
| Curator | |
| Compound ID | 2383 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sesamin |
| PubChem ID | 72307 |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 15234750 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Polycyclic, Lignan, Furanoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 354.110 |
| Molecular Formula | C20H18O6 |
| SMILES | O1[C@@H]([C@@H]2[C@@H]([C@H](OC2)c2cc3OCOc3cc2)C1)c1cc2OCOc2cc1 |
| XLogP | 2.576 |
| PSA | 55.380 |
| H-bond Donor | 0 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Rukachaisirikul T, Siriwattanakit P, Sukcharoenphol K, Wongvein C, Ruttanaweang P, Wongwattanavuch P, Suksamrarn A.Chemical constituents and bioactivity of Piper sarmentosum.J Ethnopharmacol. 2004 Aug;93(2-3):173-6
|
| Curator | |
| Compound ID | 2384 |
| Compound Structure | N/A |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Whole plant |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Colorimetric Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Isoniazid (0.078 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 800 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Zakaria, M., Mohd, M.A., 1994. Traditional Malay Medicinal Plants. Fajar Bakti Sdn Bhd, Kuala Lumpur, Malaysia
|
| Curator | |
| Compound ID | 2385 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fresh root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | 17758236 |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Alkaloid, Thiophene, Benzopyran, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 485.202 |
| Molecular Formula | C30H31NO3S
|
| SMILES | S1c(/C=C/2Oc3c(c4c2c2c(NC(C=C2C)(C)C)cc4)c(OC)c(O)cc3)c(/C(=C/CC)/C)cc1 |
| XLogP | 7.049 |
| PSA | 78.960 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 1 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | |
| Compound ID | 2386 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fresh root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N - [9 - (3, 4 - Methylenedioxyphenyl) - 2E, 4E, 8E - Nonatrienoyl] Pyrrolidine |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Phenylpropanoid, Pyrrolidine, Amide, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 325.168 |
| Molecular Formula | C20H23NO3 |
| SMILES | C1c2c(ccc1/C=C/CC/C=C/C=C/C(=O)N1CCCC1)OCO2 |
| XLogP | 4.569 |
| PSA | 38.770 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | |
| Compound ID | 2387 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fresh root, fruit |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sarmentine |
| PubChem ID | 6440616 |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Alkene, Pyrrolidine, Amide, Alkaloid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 221.178 |
| Molecular Formula | C14H23NO |
| SMILES | O=C(N1CCCC1)/C=C/C=C/CCCCC |
| XLogP | 4.039 |
| PSA | 20.310 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | |
| Compound ID | 2388 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fresh Root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Brachyamide B |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Alkaloid, Pyrrolidine, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 327.183 |
| Molecular Formula | C20H25NO3 |
| SMILES | C1N(CCC1)C(=O)/C=C/CCCC/C=C/c1cc2c(cc1)OCO2 |
| XLogP | 5.013 |
| PSA | 38.770 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | |
| Compound ID | 2389 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fresh root |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sarmentosine |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Alkaloid, Pyrrolidine, Amide, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 299.152 |
| Molecular Formula | C18H21NO3 |
| SMILES | C1c2c(ccc1/C=C/CC/C=C/C(=O)N1CCCC1)OCO2 |
| XLogP | 3.875 |
| PSA | 38.770 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | |
| Compound ID | 2390 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fresh root |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Pellitorine |
| PubChem ID | 5318516 |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkaloid, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 223.194 |
| Molecular Formula | C14H25NO
|
| SMILES | O=C(NCC(C)C)/C=C/C=C/CCCCC |
| XLogP | 4.469 |
| PSA | 29.100 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 9 |
| No. of Rings | 0 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | |
| Compound ID | 2863 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asian countries |
| Plant Part Used | Dried rhizome |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 1961 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Demethoxycurcumin |
| PubChem ID | 5324476 |
| Ethnomedicinal Information | Folk medicine, Antioxidant, anti - HIV, antimutagenic, antiangiogenic, antimalarial, antitubercular, antiandrogenic, COX inhibitory activities |
| PubMed ID [Source Literature] | 20027668 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 338.115 |
| Molecular Formula | C20H18O5 |
| SMILES | O(c1cc(ccc1O)/C=C/C(=C/C(=O)/C=C/c1ccc(O)cc1)/O)C |
| XLogP | 3.610 |
| PSA | 86.990 |
| H-bond Donor | 3 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Agrawal DK, Mishra PK.Curcumin and its analogues: potential anticancer agents.Med Res Rev. 2010 Sep;30(5):818-60
|
| Curator | Reshmi |
| Compound ID | 2989 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M3 (MDR (Multi - drug - resistant) strains which are Isoniazid, Rifampin and Streptomycin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 0.39 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)O)OC)on1)OCCCCC)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | Lekha Raveendran, wvarsha |
| Compound ID | 2990 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M4 (MDR (Multi - drug - resistant) strains which are Isoniazid, Rifampin and Streptomycin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 1.56 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)O)OC)on1)OCCCCC)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | Wvarsha, Lekha Raveendran |
| Compound ID | 2991 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M5 (MDR (Multi - drug - resistant) strains which are Isoniazid, Rifampin and Streptomycin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 1.56 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)O)OC)on1)OCCCCC)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | Wvarsha, vsheeba |
| Compound ID | 2992 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M6 (MDR (Multi - drug - resistant) strains which are Isoniazid and Rifampin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 0.78 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)O)OC)on1)OCCCCC)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | Wvarsha, vsheeba |
| Compound ID | 2993 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M8 (Isoniazid, Rifampin, Ethambutol, Streptomycin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 3.125 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)O)OC)on1)OCCCCC)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | Wvarsha, vsheeba |
| Compound ID | 2994 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M11 (MDR (Multi - drug - resistant) strains which are Isoniazid and Rifampin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 3.125 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)O)OC)on1)OCCCCC)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | Wvarsha, vsheeba |
| Compound ID | 2995 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M16 (MDR (Multi - drug - resistant) strains which are Isoniazid, Rifampin and Ethambutol resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 1.25 µg/spot |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)O)OC)on1)OCCCCC)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | Wvarsha, vsheeba |
| Compound ID | 2996 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M21 (MDR (Multi - drug - resistant) strains which are Isoniazid, Rifampin, Ethambutol and Streptomycin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 3.125 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)O)OC)on1)OCCCCC)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | Wvarsha, vsheeba |
| Compound ID | 2997 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M22 (MDR (Multi - drug - resistant) strains which are Isoniazid and Rifampin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 0.78 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Teatment wit Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)O)OC)on1)OCCCCC)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | Wvarsha, vsheeba |
| Compound ID | 2998 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asia |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis M27 (MDR (Multi - drug - resistant) strains which are Isoniazid and Rifampin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin (2.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.004 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 0.39 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Mono - Pentoxy - Curcumin Isoxazole |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20691508 |
| Extract Preparation | Treatment with hydroxylamine hydrochloride in pyridin, HPLC, NMR analysis, shade - dried, ground and extracted |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Isoxazole, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9GC |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.205 |
| Molecular Formula | C26H29NO5 |
| SMILES | C1c(c(ccc1/C=C/c1cc(/C=C/c2cc(c(cc2)O)OC)on1)OCCCCC)OC |
| XLogP | 6.765 |
| PSA | 73.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Changtam C, Hongmanee P, Suksamrarn A.Isoxazole analogs of curcuminoids with highly potent multidrug-resistant antimycobacterial activity.Eur J Med Chem. 2010 Oct;45(10):4446-57
|
| Curator | Wvarsha, vsheeba |