| Compound ID | 3752 |
| Compound Structure |  |
| Plant Source | Derris indica (Lam.) Bennet Common Name: |
| Source Family | Fabaceae |
| Origin | Southeast Asia and Pacific Islands |
| Plant Part Used | Root, stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulfate (2.0 – 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3,4-Methylenedioxy-10-methoxy-7-oxo[2]benzopyrano[4,3-b]benzopyran |
| PubChem ID | 11515333 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 16730034 |
| Extract Preparation | Extracted the stem and root parts with hexane and dichloromethane and purified with column chromatography |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Xanthanoid, Benzopyran, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 324.063 |
| Molecular Formula | C18H12O6 |
| SMILES | O1Cc2c(c3oc4c(c(=O)c13)ccc(OC)c4)cc1OCOc1c2 |
| XLogP | 2.156 |
| PSA | 53.990 |
| H-bond Donor | 0 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Koysomboon S, van Altena I, Kato S, Chantrapromma K.Antimycobacterial flavonoids from Derris indica.Phytochemistry. 2006 May;67(10):1034-40
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3753 |
| Compound Structure |  |
| Plant Source | Derris indica (Lam.) Bennet Common Name: |
| Source Family | Fabaceae |
| Origin | Southeast Asia and Pacific Islands |
| Plant Part Used | Root, stem |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulfate (2.0 – 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Karanjachromene |
| PubChem ID | 14033983 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 16730034 |
| Extract Preparation | Extracted the stem and root parts with hexane and dichloromethane and purified with column chromatography |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Flavonoid, Benzopyran, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 334.121 |
| Molecular Formula | C21H18O4 |
| SMILES | O1C(C=Cc2c1ccc1c2oc(c(OC)c1=O)c1ccccc1)(C)C |
| XLogP | 5.445 |
| PSA | 35.530 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Koysomboon S, van Altena I, Kato S, Chantrapromma K.Antimycobacterial flavonoids from Derris indica.Phytochemistry. 2006 May;67(10):1034-40
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3754 |
| Compound Structure |  |
| Plant Source | Derris indica (Lam.) Bennet Common Name: |
| Source Family | Fabaceae |
| Origin | Southeast Asia and Pacific Islands |
| Plant Part Used | Root, stem |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulfate (2.0 – 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Pinnatin |
| PubChem ID | 5320607 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 16730034 |
| Extract Preparation | Extracted the stem and root parts with hexane and dichloromethane and purified with column chromatography |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Flavonoid, Furanoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 292.074 |
| Molecular Formula | C18H12O4 |
| SMILES | O1c2c(c(OC)c3c(occ3)c2)c(=O)cc1c1ccccc1 |
| XLogP | 3.843 |
| PSA | 39.440 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Koysomboon S, van Altena I, Kato S, Chantrapromma K.Antimycobacterial flavonoids from Derris indica.Phytochemistry. 2006 May;67(10):1034-40
|
| Curator | Vsheeba, vikramjitmandal |
