| Compound ID | 3111 |
| Compound Structure |  |
| Plant Source | Euclea natalensis Common Name: |
| Source Family | Ebenaceae |
| Origin | Southern Africa |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Radiometric assay using BACTEC 460 system |
| Positive Control Used (conc.) | Ethambutol (1.25 µg/ml), Isoniazid (0.062 µg/ml), Rifampin (0.125 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Isodiospyrin |
| PubChem ID | 99298 |
| Ethnomedicinal Information | Antibacterial |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Quinone, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 374.079 |
| Molecular Formula | C22H14O6 |
| SMILES | Oc1c(c2c3c(c(O)cc2C)C(=O)C=CC3=O)c(cc2c1C(=O)C=CC2=O)C |
| XLogP | 0.964 |
| PSA | 108.740 |
| H-bond Donor | 2 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Antimycobacterial activity and possible mode of action of newly isolated neodiospyrin and other naphthoquinones from Euclea natalensis;South African Journal of Botany Volume 72, Issue 3, August 2006, Pages 349-352
|
| Curator | Vsheeba, vikramjitmandal |
