| Compound ID | 2646 |
| Compound Structure |  |
| Plant Source | Strobilanthes cusia Common Name: |
| Source Family | Acanthaceae |
| Origin | China, Taiwan |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Tryptanthrin |
| PubChem ID | 73549 |
| Ethnomedicinal Information | Has folkloric reputation for the topical treatment of athletes foot |
| PubMed ID [Source Literature] | 9828037 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Quinazolinone, Alkaloid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.059 |
| Molecular Formula | C15H8N2O2 |
| SMILES | O=C1c2n(c3c1cccc3)c(=O)c1c(n2)cccc1 |
| XLogP | 3.519 |
| PSA | 46.500 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Mitscher LA, Baker W.Tuberculosis: a search for novel therapy starting with natural products.Med Res Rev. 1998 Nov;18(6):363-74
2) L. A. Mitscher and W. R. Baker.A search for novel chemotherapy against tuberculosis amongst natural products.Pure Appl. Chem., 1998, Vol. 70, No. 2, pp. 365-371
|
| Curator | |
| Compound ID | 2647 |
| Compound Structure |  |
| Plant Source | Strobilanthes cusia Common Name: |
| Source Family | Acanthaceae |
| Origin | China, Taiwan |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Tryptanthrin |
| PubChem ID | 73549 |
| Ethnomedicinal Information | Has folkloric reputation for the topical treatment of athletes foot |
| PubMed ID [Source Literature] | 9828037 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Quinazolinone, Alkaloid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.059 |
| Molecular Formula | C15H8N2O2 |
| SMILES | O=C1c2n(c3c1cccc3)c(=O)c1c(n2)cccc1 |
| XLogP | 3.519 |
| PSA | 46.500 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Mitscher LA, Baker W.Tuberculosis: a search for novel therapy starting with natural products.Med Res Rev. 1998 Nov;18(6):363-74
2) L. A. Mitscher and W. R. Baker.A search for novel chemotherapy against tuberculosis amongst natural products.Pure Appl. Chem., 1998, Vol. 70, No. 2, pp. 365-371
|
| Curator | |
| Compound ID | 2648 |
| Compound Structure |  |
| Plant Source | Strobilanthes cusia Common Name: |
| Source Family | Acanthaceae |
| Origin | China, Taiwan |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium avium complex |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Tryptanthrin |
| PubChem ID | 73549 |
| Ethnomedicinal Information | Has folkloric reputation for the topical treatment of athletes foot |
| PubMed ID [Source Literature] | 9828037 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Quinazolinone, Alkaloid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.059 |
| Molecular Formula | C15H8N2O2 |
| SMILES | O=C1c2n(c3c1cccc3)c(=O)c1c(n2)cccc1 |
| XLogP | 3.519 |
| PSA | 46.500 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Mitscher LA, Baker W.Tuberculosis: a search for novel therapy starting with natural products.Med Res Rev. 1998 Nov;18(6):363-74
2) L. A. Mitscher and W. R. Baker.A search for novel chemotherapy against tuberculosis amongst natural products.Pure Appl. Chem., 1998, Vol. 70, No. 2, pp. 365-371
|
| Curator | |