| Compound ID | 1243 |
| Compound Structure |  |
| Plant Source | Bauhinia saccocalyx Common Name: |
| Source Family | Fabaceae |
| Origin | Thailand |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Bauhinoxepins A |
| PubChem ID | 11723631 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Oxapin, Benzopyran, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against Vero, human epidermoid carcinoma in the mouth (KB) and human breast cancer cells (BC) |
| Molecular Weight | 322.121 |
| Molecular Formula | C20H18O4
|
| SMILES | O1C(C=Cc2c1c(c(O)c1Oc3c(C=Cc21)c(O)ccc3)C)(C)C |
| XLogP | 3.407 |
| PSA | 58.920 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Prasat Kittakoop, Sombat Nopichai, Nuntawan Thongon, Panarat Charoenchai, Yodhathai Thebtaranonth.Bauhinoxepins A and B: New Antimycobacterial Dibenzo[b,f]oxepins from Bauhinia saccocalyx.Helvetica Chimica Acta, Volume 87, Issue 1, pages 175–179, January 2004
|
| Curator | |
| Compound ID | 1244 |
| Compound Structure |  |
| Plant Source | Bauhinia saccocalyx Common Name: |
| Source Family | Fabaceae |
| Origin | Thailand |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Bauhinoxepins B |
| PubChem ID | 3009552 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Oxapin, Prenylated, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against Vero, human epidermoid carcinoma in the mouth (KB) and human breast cancer cells (BC) |
| Molecular Weight | 338.152 |
| Molecular Formula | C21H22O4
|
| SMILES | O1c2c(c(O)c(CC=C(C)C)cc2)C=Cc2c1c(OC)c(c(O)c2)C |
| XLogP | 3.996 |
| PSA | 58.920 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Prasat Kittakoop, Sombat Nopichai, Nuntawan Thongon, Panarat Charoenchai, Yodhathai Thebtaranonth.Bauhinoxepins A and B: New Antimycobacterial Dibenzo[b,f]oxepins from Bauhinia saccocalyx.Helvetica Chimica Acta, Volume 87, Issue 1, pages 175–179, January 2004
|
| Curator | |
| Compound ID | 1493 |
| Compound Structure |  |
| Plant Source | Clinacanthus siamensis Brem. Common Name:Sophaghni, Vishaghni, Vishalata (Sanskrit) |
| Source Family | Acanthaceae |
| Origin | Thailand |
| Plant Part Used | Fresh leaf |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 - 0.090 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Trans - 3 - Methylthioacrylamide |
| PubChem ID | 11819072 |
| Ethnomedicinal Information | Poison bites, inflammation, traumatic edema and swelling due to poison stings. |
| PubMed ID [Source Literature] | 14646322 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Amide, Thioether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 117.025 |
| Molecular Formula | C4H7NOS
|
| SMILES | S(/C=C/C(=O)N)C |
| XLogP | 0.313 |
| PSA | 68.390 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 0 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 1 |
| Reference(s) | 1) Tuntiwachwuttikul P, Pootaeng-on Y, Pansa P, Srisanpang T, Taylor WC.Sulfur-containing compounds from Clinacanthus siamensis.Chem Pharm Bull (Tokyo). 2003 Dec;51(12):1423-5
2) http://ayurvedicmedicinalplants.com/index.php?option=com_zoom&Itemid=26&page=view&catid=3&key=63&hit=1
|
| Curator | |
| Compound ID | 1624 |
| Compound Structure |  |
| Plant Source | Elateriospermum tapos Blume Common Name: |
| Source Family | Euphorbiaceae |
| Origin | Thailand |
| Plant Part Used | Leaf |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.05 µg/ml), Kanamycin (1.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3.13 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 2, 3 - Seco - Taraxer - 14 - Ene - 2, 3, 28 - Trioic Acid 2, 3 - Dimethyl Ester |
| PubChem ID | 44448123 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 18179177 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Triterpene, Ester, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 530.361 |
| Molecular Formula | C32H50O6
|
| SMILES | OC(=O)[C@]12C([C@]3(C(=CC1)[C@]1(C([C@](C(CC1)C(C)(C)C(=O)OC)(CC(=O)OC)C)CC3)C)C)CC(CC2)(C)C |
| XLogP | 7.979 |
| PSA | 89.900 |
| H-bond Donor | 1 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Pattamadilok D, Suttisri R.Seco-terpenoids and other constituents from Elateriospermum tapos.J Nat Prod. 2008 Feb;71(2):292-4
|
| Curator | |
| Compound ID | 2043 |
| Compound Structure |  |
| Plant Source | Limnophila geoffrayi Common Name:Geoffrey's Marshweed |
| Source Family | Scrophulariaceae |
| Origin | Thailand |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampicin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin Sulfate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Nevadensin |
| PubChem ID | 160921 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 14609129 |
| Extract Preparation | The pulverized, dried aerial plant material (615 g) was extracted successively with n-hexane, CHCl3 and MeOH in a Soxhlet apparatus to give the hexane (7.52 g), CHCl3 (7.79 g) and MeOH (50.10 g) extracts, respectively |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 344.090 |
| Molecular Formula | C18H16O7
|
| SMILES | O1c2c(c(O)c(OC)c(O)c2OC)c(=O)cc1c1ccc(OC)cc1 |
| XLogP | 0.757 |
| PSA | 85.220 |
| H-bond Donor | 2 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn A, Poomsing P, Aroonrerk N, Punjanon T, Suksamrarn S, Kongkun S.Antimycobacterial and antioxidant flavones from Limnophila geoffrayi.Arch Pharm Res. 2003 Oct;26(10):816-20
2) http://www.oswaldasia.org/species/l/limge/limge_en.html
|
| Curator | |
| Compound ID | 2044 |
| Compound Structure |  |
| Plant Source | Limnophila geoffrayi Common Name:Geoffrey's Marshweed |
| Source Family | Scrophulariaceae |
| Origin | Thailand |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampicin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin Sulfate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Isothymusin |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 14609129 |
| Extract Preparation | The pulverized, dried aerial plant material (615 g) was extracted successively with n-hexane, CHCl3 and MeOH in a Soxhlet apparatus to give the hexane (7.52 g), CHCl3 (7.79 g) and MeOH (50.10 g) extracts, respectively |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Flavonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 330.074 |
| Molecular Formula | C17H14O7
|
| SMILES | C1(c(c(c(c2c1oc(cc2=O)c1ccc(cc1)O)O)OC)OC)O |
| XLogP | 0.595 |
| PSA | 96.220 |
| H-bond Donor | 3 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn A, Poomsing P, Aroonrerk N, Punjanon T, Suksamrarn S, Kongkun S.Antimycobacterial and antioxidant flavones from Limnophila geoffrayi.Arch Pharm Res. 2003 Oct;26(10):816-20
2) http://www.oswaldasia.org/species/l/limge/limge_en.html
|
| Curator | |
| Compound ID | 2298 |
| Compound Structure |  |
| Plant Source | Pedilanthus tithymaloides Common Name:Devil's Backbone, Zigzag Plant, Jacob's Ladder |
| Source Family | Euphorbiaceae |
| Origin | Thailand, Tropical America |
| Plant Part Used | Milky juice or latex |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.1 µg/ml), Kanamycin (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1α, 13β, 14α - trihydroxy - 3β, 7β - dibenzoyloxy - 9β, 15β - diacetoxyjatropha - 5, 11 E - diene |
| PubChem ID | 23642402 |
| Ethnomedicinal Information | Anti - inflammatory, antioxidant, anti - malaria |
| PubMed ID [Source Literature] | 17844996 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Jatrophane, Benzoyl, Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 678.304 |
| Molecular Formula | C38H46O11
|
| SMILES | O([C@@]12[C@H]([C@@H](OC(=O)c3ccccc3)[C@H]([C@@H]1O)C)/C=C([C@H](OC(=O)c1ccccc1)C[C@H](OC(=O)C)C(/C=C/[C@](O)([C@H]2O)C)(C)C)/C)C(=O)C |
| XLogP | 6.947 |
| PSA | 165.890 |
| H-bond Donor | 3 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 10 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 11 |
| No. of S | 0 |
| Reference(s) | 1) Mongkolvisut W, Sutthivaiyakit S.Antimalarial and antituberculous poly-O-acylated jatrophane diterpenoids from Pedilanthus tithymaloides.J Nat Prod. 2007 Sep;70(9):1434-8
2) http://www.flowersofIndia.net/catalog/slides/Devil%27s%20Backbone.html
|
| Curator | |
| Compound ID | 2299 |
| Compound Structure |  |
| Plant Source | Pedilanthus tithymaloides Common Name:Devil's Backbone, Zigzag Plant, Jacob's Ladder |
| Source Family | Euphorbiaceae |
| Origin | Thailand, Tropical America |
| Plant Part Used | Milky juice or latex |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.1 µg/ml), Kanamycin (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1α, 7β, 13β, 14α - tetrahydroxy - 3β - benzoyloxy - 9β, 15β - diacetoxyjatropha - 5,11 E - diene |
| PubChem ID | 23642403 |
| Ethnomedicinal Information | Anti - inflammatory, antioxidant, anti - malaria |
| PubMed ID [Source Literature] | 17844996 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Jatrophane, Benzoyl, Acetyl, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 574.278 |
| Molecular Formula | C31H42O10
|
| SMILES | O([C@@]12[C@H]([C@@H](OC(=O)c3ccccc3)[C@H]([C@@H]1O)C)/C=C([C@H](O)C[C@H](OC(=O)C)C(/C=C/[C@](O)([C@H]2O)C)(C)C)/C)C(=O)C |
| XLogP | 3.461 |
| PSA | 159.820 |
| H-bond Donor | 4 |
| H-bond Acceptor | 10 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) Mongkolvisut W, Sutthivaiyakit S.Antimalarial and antituberculous poly-O-acylated jatrophane diterpenoids from Pedilanthus tithymaloides.J Nat Prod. 2007 Sep;70(9):1434-8
2) http://www.flowersofIndia.net/catalog/slides/Devil%27s%20Backbone.html
|
| Curator | |
| Compound ID | 2300 |
| Compound Structure |  |
| Plant Source | Pedilanthus tithymaloides Common Name:Devil's Backbone, Zigzag Plant, Jacob's Ladder |
| Source Family | Euphorbiaceae |
| Origin | Thailand, Tropical America |
| Plant Part Used | Milky juice or latex |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.1 µg/ml), Kanamycin (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1α, 8β, 9β, 14α, 15β - pentaacetoxy - 3β - benzoyloxy - 7 - oxojatropha - 5, 12 - diene |
| PubChem ID | 23642498 |
| Ethnomedicinal Information | Anti - inflammatory, antioxidant, anti - malaria |
| PubMed ID [Source Literature] | 17844996 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Jatrophane, Ketone, Benzoyl, Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 698.294 |
| Molecular Formula | C37H46O13
|
| SMILES | O([C@@]12[C@H]([C@@H](OC(=O)c3ccccc3)[C@H]([C@@H]1OC(=O)C)C)/C=C(C(=O)[C@H](OC(=O)C)[C@H](OC(=O)C)C(C/C=C(/[C@H]2OC(=O)C)C)(C)C)/C)C(=O)C |
| XLogP | 5.514 |
| PSA | 174.870 |
| H-bond Donor | 0 |
| H-bond Acceptor | 13 |
| No. of Rotatable Bond Count | 13 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 13 |
| No. of S | 0 |
| Reference(s) | 1) Mongkolvisut W, Sutthivaiyakit S.Antimalarial and antituberculous poly-O-acylated jatrophane diterpenoids from Pedilanthus tithymaloides.J Nat Prod. 2007 Sep;70(9):1434-8
2) http://www.flowersofIndia.net/catalog/slides/Devil%27s%20Backbone.html
|
| Curator | |
| Compound ID | 2301 |
| Compound Structure |  |
| Plant Source | Pedilanthus tithymaloides Common Name:Devil's Backbone, Zigzag Plant, Jacob's Ladder |
| Source Family | Euphorbiaceae |
| Origin | Thailand,Tropical America |
| Plant Part Used | Milky juice or latex |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.1 µg/ml), Kanamycin (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 7, 8β, 9β, 14α, 15β - Pentaacetoxy - 3β - benzoyloxy - 1α, 5β - dihydroxyjatropha - 6 (7), 12 - diene |
| PubChem ID | 23642499 |
| Ethnomedicinal Information | Anti - inflammatory, antioxidant, anti - malaria |
| PubMed ID [Source Literature] | 17844996 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Jatrophane, Benzoyl, Acetyl, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 716.304 |
| Molecular Formula | C37H48O14
|
| SMILES | O([C@@]12[C@H]([C@@H](OC(=O)c3ccccc3)[C@H]([C@@H]1O)C)[C@H](O)/C(=C(/OC(=O)C)[C@H](OC(=O)C)[C@H](OC(=O)C)C(C/C=C(/[C@H]2OC(=O)C)C)(C)C)/C)C(=O)C |
| XLogP | 4.498 |
| PSA | 198.260 |
| H-bond Donor | 2 |
| H-bond Acceptor | 14 |
| No. of Rotatable Bond Count | 13 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 14 |
| No. of S | 0 |
| Reference(s) | 1) Mongkolvisut W, Sutthivaiyakit S.Antimalarial and antituberculous poly-O-acylated jatrophane diterpenoids from Pedilanthus tithymaloides.J Nat Prod. 2007 Sep;70(9):1434-8
2) http://www.flowersofIndia.net/catalog/slides/Devil%27s%20Backbone.html
|
| Curator | |
| Compound ID | 2302 |
| Compound Structure |  |
| Plant Source | Pedilanthus tithymaloides Common Name:Devil's Backbone, Zigzag Plant, Jacob's Ladder |
| Source Family | Euphorbiaceae |
| Origin | Thailand,Tropical America |
| Plant Part Used | Milky juice or latex |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.1 µg/ml), Kanamycin (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1α, 7, 8β, 9β, 14α, 15β - Hexaacetoxy - 3β - benzoyloxy - 5β - hydroxyjatropha - 6 (7), 12 - diene |
| PubChem ID | 23642500 |
| Ethnomedicinal Information | Anti - inflammatory, antioxidant, anti - malaria |
| PubMed ID [Source Literature] | 17844996 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Jatrophane, Benzoyl, Acetyl, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 758.315 |
| Molecular Formula | C39H50O15
|
| SMILES | O([C@@]12[C@H]([C@@H](OC(=O)c3ccccc3)[C@H]([C@@H]1OC(=O)C)C)[C@H](O)/C(=C(/OC(=O)C)[C@H](OC(=O)C)[C@H](OC(=O)C)C(C/C=C(/[C@H]2OC(=O)C)C)(C)C)/C)C(=O)C |
| XLogP | 5.238 |
| PSA | 204.330 |
| H-bond Donor | 1 |
| H-bond Acceptor | 15 |
| No. of Rotatable Bond Count | 15 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 15 |
| No. of S | 0 |
| Reference(s) | 1) Mongkolvisut W, Sutthivaiyakit S.Antimalarial and antituberculous poly-O-acylated jatrophane diterpenoids from Pedilanthus tithymaloides.J Nat Prod. 2007 Sep;70(9):1434-8
2) http://www.flowersofIndia.net/catalog/slides/Devil%27s%20Backbone.html
|
| Curator | |
| Compound ID | 2414 |
| Compound Structure |  |
| Plant Source | Polyalthia cerasoides (Roxb.) Benth. ex Bedd Common Name: |
| Source Family | Annonaceae |
| Origin | Thailand |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.05 µg/ml), Kanamycin (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Bidebiline E |
| PubChem ID | 23642920 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 17845001 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Quinoline, Aporphine, Alkaloid
|
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 584.195 |
| Molecular Formula | C36H28N2O6
|
| SMILES | O1c2c3c4c(NCCc4cc2OC1)c(c1c2NCCc4c2c(c2c1cc(OC)cc2)c1OCOc1c4)c1c3ccc(OC)c1 |
| XLogP | 4.472 |
| PSA | 79.440 |
| H-bond Donor | 2 |
| H-bond Acceptor | 8 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 10 |
| No. of N | 2 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Kanokmedhakul S, Kanokmedhakul K, Lekphrom R.Bioactive constituents of the roots of Polyalthia cerasoides.J Nat Prod. 2007 Sep;70(9):1536-8
|
| Curator | |
| Compound ID | 2415 |
| Compound Structure |  |
| Plant Source | Polyalthia cerasoides (Roxb.) Benth. ex Bedd Common Name: |
| Source Family | Annonaceae |
| Origin | Thailand |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.05 µg/ml), Kanamycin (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Octadeca - 9, 11, 13 - Triynoic Acid |
| PubChem ID | 11778027 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 17845001 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkyne, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 272.178 |
| Molecular Formula | C18H24O2 |
| SMILES | OC(=O)CCCCCCCC#CC#CC#CCCCC |
| XLogP | 6.542 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 9 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Kanokmedhakul S, Kanokmedhakul K, Lekphrom R.Bioactive constituents of the roots of Polyalthia cerasoides.J Nat Prod. 2007 Sep;70(9):1536-8
|
| Curator | |
| Compound ID | 2416 |
| Compound Structure |  |
| Plant Source | Polyalthia cerasoides (Roxb.) Benth. ex Bedd Common Name: |
| Source Family | Annonaceae |
| Origin | Thailand |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.05 µg/ml), Kanamycin (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | α - Humulene |
| PubChem ID | 5281520 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 17845001 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Sesquiterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 204.188 |
| Molecular Formula | C15H24
|
| SMILES | C1(C/C=C(/CC/C=C(/C/C=C/1)C)C)(C)C |
| XLogP | 5.940 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Kanokmedhakul S, Kanokmedhakul K, Lekphrom R.Bioactive constituents of the roots of Polyalthia cerasoides.J Nat Prod. 2007 Sep;70(9):1536-8
|
| Curator | |
| Compound ID | 1799 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Thailand, Malaysia |
| Plant Part Used | Arils and seed |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampicin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulfate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 9 - Hydroxycalabaxanthone |
| PubChem ID | NR |
| Ethnomedicinal Information | Treatment of diarrhea and dysentery and for skin diseases, to lower fever and for urinary disorders |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Xanthanoid, Benzopyran, Prenylated, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 422.173 |
| Molecular Formula | C25H26O6 |
| SMILES | C1(c(c(cc2c1c(=O)c1c(o2)cc2c(c1O)C=CC(O2)(C)C)O)OC)CCC=C(C)C |
| XLogP | 3.609 |
| PSA | 85.220 |
| H-bond Donor | 2 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | |
| Compound ID | 3090 |
| Compound Structure |  |
| Plant Source | Prismatomeris fragrans E.T. Geddes Common Name:Khao - San |
| Source Family | Rubiaceae |
| Origin | Northeastern, Eastern and Southeastern parts of Thailand and in the Northwest of Laos |
| Plant Part Used | Root, stem |
| Extract | Hexane, dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin Sulphate (2.5 µg/ml), Isoniazid (0.05 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Nordamnacanthal |
| PubChem ID | 160712 |
| Ethnomedicinal Information | Antimalarial, antifungal |
| PubMed ID [Source Literature] | 15885942 |
| Extract Preparation | Air dried roots and stems ground and extracted with solvents hexane and dichloromethane |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Quinone, Phenol, Aldehyde |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | Against human epidermoid carcinoma in the mouth (KB), human breast cancer cells (BC), human lung cancer cells (NCI - H187) |
| Molecular Weight | 268.037 |
| Molecular Formula | C15H8O5 |
| SMILES | Oc1c2c(C(=O)c3c(C2=O)cccc3)cc(O)c1C=O |
| XLogP | 2.235 |
| PSA | 91.670 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Kanokmedhakul K, Kanokmedhakul S, Phatchana R.Biological activity of Anthraquinones and Triterpenoids from Prismatomeris fragrans.J Ethnopharmacol. 2005 Sep 14;100(3):284-8
|
| Curator | KeyaMukherjee |
| Compound ID | 3091 |
| Compound Structure |  |
| Plant Source | Prismatomeris fragrans E.T. Geddes Common Name:Khao - San |
| Source Family | Rubiaceae |
| Origin | Northeastern, Eastern and Southeastern parts of Thailand and in the Northwest of Laos |
| Plant Part Used | Root, stem |
| Extract | Hexane, dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin Sulphate (2.5 µg/ml), Isoniazid (0.05 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Damnacanthal |
| PubChem ID | 2948 |
| Ethnomedicinal Information | Antimalarial, antifungal |
| PubMed ID [Source Literature] | 15885942 |
| Extract Preparation | Air dried roots and stems ground and extracted with solvents hexane and dichloromethane |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Alkaloid, Anthraquinone, Aldehyde |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | Against human epidermoid carcinoma in the mouth (KB), human breast cancer cells (BC), human lung cancer cells (NCI - H187) |
| Molecular Weight | 282.053 |
| Molecular Formula | C16H10O5 |
| SMILES | O(c1c2c(C(=O)c3c(C2=O)cccc3)cc(O)c1C=O)C |
| XLogP | 2.325 |
| PSA | 80.670 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Kanokmedhakul K, Kanokmedhakul S, Phatchana R.Biological activity of Anthraquinones and Triterpenoids from Prismatomeris fragrans.J Ethnopharmacol. 2005 Sep 14;100(3):284-8
|
| Curator | KeyaMukherjee |
| Compound ID | 3092 |
| Compound Structure |  |
| Plant Source | Prismatomeris fragrans E.T. Geddes Common Name:Khao - San |
| Source Family | Rubiaceae |
| Origin | Northeastern, Eastern and Southeastern parts of Thailand and in the Northwest of Laos |
| Plant Part Used | Root, stem |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin Sulphate (2.5 µg/ml), Isoniazid (0.05 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Rubiadin |
| PubChem ID | 124062 |
| Ethnomedicinal Information | Antimalarial, antifungal |
| PubMed ID [Source Literature] | 15885942 |
| Extract Preparation | Air dried roots and stems ground and extracted with solvents hexane and dichloromethane |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Anthraquinone, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | Against human epidermoid carcinoma in the mouth (KB), human breast cancer cells (BC), human lung cancer cells (NCI - H187) |
| Molecular Weight | 254.058 |
| Molecular Formula | C15H10O4 |
| SMILES | Oc1c2c(C(=O)c3c(C2=O)cccc3)cc(O)c1C |
| XLogP | 1.838 |
| PSA | 74.600 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Kanokmedhakul K, Kanokmedhakul S, Phatchana R.Biological activity of Anthraquinones and Triterpenoids from Prismatomeris fragrans.J Ethnopharmacol. 2005 Sep 14;100(3):284-8
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 3093 |
| Compound Structure |  |
| Plant Source | Prismatomeris fragrans E.T. Geddes Common Name:Khao - San |
| Source Family | Rubiaceae |
| Origin | Northeastern, Eastern and Southeastern parts of Thailand and in the Northwest of Laos |
| Plant Part Used | Root, stem |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin Sulphate (2.5 µg/ml), Isoniazid (0.05 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 1 - Hydroxy - 2 - Hydroxymethyl - 3 - Methoxyanthraquinone |
| PubChem ID | 10085264 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 15885942 |
| Extract Preparation | Air dried roots and stems ground and extracted with solvents hexane and dichloromethane |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Anthraquinone, Alcohol, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | Against human epidermoid carcinoma in the mouth (KB), human breast cancer cells (BC), human lung cancer cells (NCI - H187) |
| Molecular Weight | 284.068 |
| Molecular Formula | C16H12O5 |
| SMILES | O(c1c(c(O)c2c(C(=O)c3c(C2=O)cccc3)c1)CO)C |
| XLogP | 1.654 |
| PSA | 83.830 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Kanokmedhakul K, Kanokmedhakul S, Phatchana R.Biological activity of Anthraquinones and Triterpenoids from Prismatomeris fragrans.J Ethnopharmacol. 2005 Sep 14;100(3):284-8
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 3094 |
| Compound Structure |  |
| Plant Source | Prismatomeris fragrans E.T. Geddes Common Name:Khao - San |
| Source Family | Rubiaceae |
| Origin | Northeastern, Eastern and Southeastern parts of Thailand and in the Northwest of Laos |
| Plant Part Used | Root, stem |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin Sulphate (2.5 µg/ml), Isoniazid (0.07 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 3 - β - Acetylolean - 12 - En - 28 - Olic Acid |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 15885942 |
| Extract Preparation | Air dried roots and stems ground and extracted with solvents hexane and dichloromethane |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Terpene, Triterpene, O-Acetyl, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | Against human epidermoid carcinoma in the mouth (KB), human breast cancer cells (BC), human lung cancer cells (NCI - H187) |
| Molecular Weight | 498.371 |
| Molecular Formula | C32H50O4 |
| SMILES | C1C[C@@H](C(C2[C@]1(C1[C@@](CC2)(C2(C(=CC1)C1[C@@](CC2)(CCC(C1)(C)C)C(=O)O)C)C)C)(C)C)OC(=O)C |
| XLogP | 9.792 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Kanokmedhakul K, Kanokmedhakul S, Phatchana R.Biological activity of Anthraquinones and Triterpenoids from Prismatomeris fragrans.J Ethnopharmacol. 2005 Sep 14;100(3):284-8
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 1798 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Thailand, Malaysia |
| Plant Part Used | Fruit |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampicin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulfate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Garcinone B |
| PubChem ID | 5495928 |
| Ethnomedicinal Information | Treatment of diarrhea and dysentery and for skin diseases, to lower fever and for urinary disorders |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Xanthonoid, Benzopyran, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 394.142 |
| Molecular Formula | C23H22O6
|
| SMILES | O1C(C=Cc2c3c(oc4c(c3=O)c(O)c(c(O)c4)CC=C(C)C)cc(O)c12)(C)C |
| XLogP | 2.203 |
| PSA | 86.990 |
| H-bond Donor | 3 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | |
| Compound ID | 1796 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Thailand, Malaysia |
| Plant Part Used | Fruit |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampicin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulfate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Garcinone D |
| PubChem ID | 5495926 |
| Ethnomedicinal Information | Treatment of diarrhea and dysentery and for skin diseases, to lower fever and for urinary disorders |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Prenylated, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 428.184 |
| Molecular Formula | C24H28O7
|
| SMILES | OC(CCc1c2c(oc3c(c2=O)c(O)c(c(O)c3)CC=C(C)C)cc(O)c1OC)(C)C |
| XLogP | 1.895 |
| PSA | 107.220 |
| H-bond Donor | 4 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | |
| Compound ID | 3573 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Southeast Asian countries (Thailand, Malaysia) |
| Plant Part Used | Fruit hull, fresh aril, seed |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulphate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | α - Mangostin |
| PubChem ID | 5281650 |
| Ethnomedicinal Information | Skin infections, wounds and diarrhea, to lower fever and for urinary disorders |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | MeOH extract were obtained from the fresh green fruit hulls of Garcinia mangostana. Pulverized, fresh arils and seeds were extracted throroughly with MeOH and evaporation of the solvent gave crude extract. The crude extract was partitioned between CHCl3 and H2O to afford CHCl3 extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Prenylated, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | 7H9GC medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 410.173 |
| Molecular Formula | C24H26O6 |
| SMILES | O1c2c(c(CC=C(C)C)c(OC)c(O)c2)c(=O)c2c1cc(O)c(c2O)CC=C(C)C |
| XLogP | 2.792 |
| PSA | 86.990 |
| H-bond Donor | 3 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | Gppreetha, vikramjitmandal, reshmi |
| Compound ID | 3705 |
| Compound Structure |  |
| Plant Source | Kaempferia marginata Common Name:Tup Mup |
| Source Family | Zingiberaceae |
| Origin | Thailand |
| Plant Part Used | Whole plant |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.1 µg/ml), Kanamycin (2.5 µg/ml), Rifampin (0.0023 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Sandaracopimaradien - 1 - α - Ol |
| PubChem ID | NR |
| Ethnomedicinal Information | Roots have been used in the treatment of allergy, fever and swollen leg |
| PubMed ID [Source Literature] | 16309313 |
| Extract Preparation | The dried and milled whole plant (619 g) was extracted three times (3 × 2 l) by maceration with MeOH at room temperature. After filtration and evaporation of the solvent under reduced pressure, the combined crude MeOH extract was partitioned between CH2Cl2 and H2O to afford CH2Cl2 (41 g) and H2O - MeOH (22.8 g) extracts. The CH2Cl2 - soluble extract was subjected to silica gel column chromatography to yield the fractions |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 302.261 |
| Molecular Formula | C21H34O
|
| SMILES | C1=C2[C@](CC[C@]1(C)C=C)([C@]1(CCC[C@]([C@@]1(CC2)C)(C)O)C)C |
| XLogP | 7.243 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Thongnest S, Mahidol C, Sutthivaiyakit S, Ruchirawat S.Oxygenated pimarane diterpenes from Kaempferia marginata.J Nat Prod. 2005 Nov;68(11):1632-6
|
| Curator | Gppreetha |
| Compound ID | 3706 |
| Compound Structure |  |
| Plant Source | Kaempferia marginata Common Name:Tup Mup |
| Source Family | Zingiberaceae |
| Origin | Thailand |
| Plant Part Used | Whole plant |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.1 µg/ml), Kanamycin (2.5 µg/ml), Rifampin (0.0023 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2α - Acetoxysandaracopimaradien - 1α - Ol |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 16309313 |
| Extract Preparation | The dried and milled whole plant (619 g) was extracted three times (3 × 2 l) by maceration with MeOH at room temperature. After filtration and evaporation of the solvent under reduced pressure, the combined crude MeOH extract was partitioned between CH2Cl2 and H2O to afford CH2Cl2 (41 g) and H2O - MeOH (22.8 g) extracts. The CH2Cl2 - soluble extract was subjected to silica gel column chromatography to yield the fractions |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, Acetoxy |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 302.225 |
| Molecular Formula | C20H30O2
|
| SMILES | C1(=O)CCC([C@H]2[C@]1([C@@H]1C(=C[C@@](CC1)(C)C=C)C[C@H]2O)C)(C)C |
| XLogP | 4.441 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Thongnest S, Mahidol C, Sutthivaiyakit S, Ruchirawat S.Oxygenated pimarane diterpenes from Kaempferia marginata.J Nat Prod. 2005 Nov;68(11):1632-6
|
| Curator | Gppreetha |