| Compound ID | 3960 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium fortuitum |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (128 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 2 - (Methyldithio) Pyrimidine |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Pyrimidine, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 157.997 |
| Molecular Formula | C5H6N2S2
|
| SMILES | C1ccnc(n1)SSC |
| XLogP | 1.511 |
| PSA | 76.380 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 2 |
| No. of O | 0 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | |
| Compound ID | 3975 |
| Compound Structure |  |
| Plant Source | Allium neapolitanum Common Name: |
| Source Family | Amaryllidaceae |
| Origin | Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium abcessus (ATCC 19977) |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | Ethambutol (128 µg/ml), Isoniazid (128 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Canthin-6-one |
| PubChem ID | 97176 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 17421058 |
| Extract Preparation | 6.3 kg of macerated bulb material underwent cold extraction with hexane, chloroform and methanol (3 l) |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Carbazole, Quinoline, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 220.064 |
| Molecular Formula | C14H8N2O
|
| SMILES | O=c1n2c3c(c4c2cccc4)ccnc3cc1 |
| XLogP | 2.809 |
| PSA | 34.890 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) O'Donnell G, Gibbons S.Antibacterial activity of two canthin-6-one alkaloids from Allium neapolitanum.Phytother Res. 2007 Jul;21(7):653-7
|
| Curator | |
| Compound ID | 3974 |
| Compound Structure |  |
| Plant Source | Allium neapolitanum Common Name: |
| Source Family | Amaryllidaceae |
| Origin | Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium fortuitum (ATCC 6841) |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | Ethambutol (4 µg/ml), Isoniazid (0.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Canthin-6-one |
| PubChem ID | 97176 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 17421058 |
| Extract Preparation | 6.3 kg of macerated bulb material underwent cold extraction with hexane, chloroform and methanol (3 l) |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Carbazole, Quinoline, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 220.064 |
| Molecular Formula | C14H8N2O
|
| SMILES | O=c1n2c3c(c4c2cccc4)ccnc3cc1 |
| XLogP | 2.809 |
| PSA | 34.890 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) O'Donnell G, Gibbons S.Antibacterial activity of two canthin-6-one alkaloids from Allium neapolitanum.Phytother Res. 2007 Jul;21(7):653-7
|
| Curator | |
| Compound ID | 3796 |
| Compound Structure |  |
| Plant Source | Allium neapolitanum Common Name:NR |
| Source Family | Amaryllidaceae |
| Origin | Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium phlei (ATCC 11758) |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Canthin-6-one |
| PubChem ID | 97176 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 17421058 |
| Extract Preparation | 6.3 kg of macerated bulb material underwent cold extraction with hexane, chloroform and methanol (3 l) |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Carbazole, Quinoline, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 220.064 |
| Molecular Formula | C14H8N2O |
| SMILES | O=c1n2c3c(c4c2cccc4)ccnc3cc1 |
| XLogP | 2.809 |
| PSA | 34.890 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) O'Donnell G, Gibbons S.Antibacterial activity of two canthin-6-one alkaloids from Allium neapolitanum.Phytother Res. 2007 Jul;21(7):653-7
|
| Curator | Najiya-beegum, vikramjitmandal |
| Compound ID | 3797 |
| Compound Structure |  |
| Plant Source | Allium neapolitanum Common Name:NR |
| Source Family | Amaryllidaceae |
| Origin | Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium smegmatis (mc2 2700) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (0.25 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 8 - Hydroxy Canthin - 6 - One |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 17421058 |
| Extract Preparation | 6.3 kg of macerated bulb material underwent cold extraction with hexane, chloroform and methanol (3 l) |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Carbazole, Quinoline, Amide, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 235.063 |
| Molecular Formula | C15H9NO2 |
| SMILES | C1ccc(c2c1c1c3n2c(=O)ccc3ccc1)O |
| XLogP | 2.854 |
| PSA | 42.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 1 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) O'Donnell G, Gibbons S.Antibacterial activity of two canthin-6-one alkaloids from Allium neapolitanum.Phytother Res. 2007 Jul;21(7):653-7
|
| Curator | Najiya-beegum, vikramjitmandal |
| Compound ID | 3799 |
| Compound Structure |  |
| Plant Source | Allium neapolitanum Common Name:NR |
| Source Family | Amaryllidaceae |
| Origin | Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium smegmatis (ATCC 14468) |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | Ethambutol (0.25 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Canthin-6-one |
| PubChem ID | 97176 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 17421058 |
| Extract Preparation | 6.3 kg of macerated bulb material underwent cold extraction with hexane, chloroform and methanol (3 l) |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Carbazole, Quinoline, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 220.064 |
| Molecular Formula | C14H8N2O |
| SMILES | O=c1n2c3c(c4c2cccc4)ccnc3cc1 |
| XLogP | 2.809 |
| PSA | 34.890 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) O'Donnell G, Gibbons S.Antibacterial activity of two canthin-6-one alkaloids from Allium neapolitanum.Phytother Res. 2007 Jul;21(7):653-7
|
| Curator | Najiya-beegum, vikramjitmandal |
| Compound ID | 3800 |
| Compound Structure |  |
| Plant Source | Allium neapolitanum Common Name:NR |
| Source Family | Amaryllidaceae |
| Origin | Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium smegmatis (mc2 2700) |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | Ethambutol (0.25 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Canthin-6-one |
| PubChem ID | 97176 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 17421058 |
| Extract Preparation | 6.3 kg of macerated bulb material underwent cold extraction with hexane, chloroform and methanol (3 l) |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Carbazole, Quinoline, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 220.064 |
| Molecular Formula | C14H8N2O |
| SMILES | O=c1n2c3c(c4c2cccc4)ccnc3cc1 |
| XLogP | 2.809 |
| PSA | 34.890 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) O'Donnell G, Gibbons S.Antibacterial activity of two canthin-6-one alkaloids from Allium neapolitanum.Phytother Res. 2007 Jul;21(7):653-7
|
| Curator | Najiya-beegum, vikramjitmandal |
| Compound ID | 3902 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol, Isoniazid |
| Inhibition [%] | 90 % |
| Activity [MIC] µg/ml | 0.01 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Pyridine - N - Oxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Pyridine-N-Oxide, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 172.997 |
| Molecular Formula | C6H7NOS2 |
| SMILES | C1cc[n+](c(c1)SSC)[O-] |
| XLogP | 1.646 |
| PSA | 77.540 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3903 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium fortuitum |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Pyridine - N - Oxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Pyridine-N-Oxide, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 172.997 |
| Molecular Formula | C6H7NOS2 |
| SMILES | C1cc[n+](c(c1)SSC)[O-] |
| XLogP | 1.646 |
| PSA | 77.540 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3904 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (32 µg/ml), Isoniazid (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Pyridine - N - Oxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Pyridine-N-Oxide, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 172.997 |
| Molecular Formula | C6H7NOS2 |
| SMILES | C1cc[n+](c(c1)SSC)[O-] |
| XLogP | 1.646 |
| PSA | 77.540 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3905 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium smegmatis (mc2 2700) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | ND |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Pyridine - N - Oxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Pyridine-N-Oxide, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 172.997 |
| Molecular Formula | C6H7NOS2 |
| SMILES | C1cc[n+](c(c1)SSC)[O-] |
| XLogP | 1.646 |
| PSA | 77.540 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3906 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium phlei |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (128 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Pyridine - N - Oxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Pyridine-N-Oxide, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 172.997 |
| Molecular Formula | C6H7NOS2 |
| SMILES | C1cc[n+](c(c1)SSC)[O-] |
| XLogP | 1.646 |
| PSA | 77.540 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3907 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol, Isoniazid |
| Inhibition [%] | 90 % |
| Activity [MIC] µg/ml | 0.01 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Pyridine - N - Oxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Pyridine-N-Oxide, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 172.997 |
| Molecular Formula | C6H7NOS2 |
| SMILES | C1cc[n+](c(c1)SSC)[O-] |
| XLogP | 1.646 |
| PSA | 77.540 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3908 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol, Isoniazid |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 0.01 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - [(Methylthiomethyl) Dithio] Pyridine - N - Oxide |
| PubChem ID | 45267926 |
| Ethnomedicinal Information | Promotion of wound healing |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Dithiol, Pyridine-N-Oxide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 218.985 |
| Molecular Formula | C7H9NOS3 |
| SMILES | S(SCSC)c1[n+]([O-])cccc1 |
| XLogP | 2.259 |
| PSA | 102.840 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 3 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3909 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium fortuitum |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - [(Methylthiomethyl) Dithio] Pyridine - N - Oxide |
| PubChem ID | 45267926 |
| Ethnomedicinal Information | Promotion of wound healing |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Dithiol, Pyridine-N-Oxide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 218.985 |
| Molecular Formula | C7H9NOS3 |
| SMILES | S(SCSC)c1[n+]([O-])cccc1 |
| XLogP | 2.259 |
| PSA | 102.840 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 3 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3910 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (32 µg/ml), Isoniazid (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - [(Methylthiomethyl) Dithio] Pyridine - N - Oxide |
| PubChem ID | 45267926 |
| Ethnomedicinal Information | Promotion of wound healing |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Dithiol, Pyridine-N-Oxide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 218.985 |
| Molecular Formula | C7H9NOS3 |
| SMILES | S(SCSC)c1[n+]([O-])cccc1 |
| XLogP | 2.259 |
| PSA | 102.840 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 3 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3911 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium smegmatis (mc2 2700) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Not Tested |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - [(Methylthiomethyl) Dithio] Pyridine - N - Oxide |
| PubChem ID | 45267926 |
| Ethnomedicinal Information | Promotion of wound healing |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Dithiol, Pyridine-N-Oxide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 218.985 |
| Molecular Formula | C7H9NOS3 |
| SMILES | S(SCSC)c1[n+]([O-])cccc1 |
| XLogP | 2.259 |
| PSA | 102.840 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 3 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3912 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium phlei |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (128 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - [(Methylthiomethyl) Dithio] Pyridine - N - Oxide |
| PubChem ID | 45267926 |
| Ethnomedicinal Information | Promotion of wound healing |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Dithiol, Pyridine-N-Oxide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 218.985 |
| Molecular Formula | C7H9NOS3 |
| SMILES | S(SCSC)c1[n+]([O-])cccc1 |
| XLogP | 2.259 |
| PSA | 102.840 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 3 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3913 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol, Isoniazid |
| Inhibition [%] | 90 % |
| Activity [MIC] µg/ml | 0.01 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - [(Methylthiomethyl) Dithio] Pyridine - N - Oxide |
| PubChem ID | 45267926 |
| Ethnomedicinal Information | Promotion of wound healing |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Dithiol, Pyridine-N-Oxide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 218.985 |
| Molecular Formula | C7H9NOS3 |
| SMILES | S(SCSC)c1[n+]([O-])cccc1 |
| XLogP | 2.259 |
| PSA | 102.840 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 3 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3914 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2, 2' - Dithio - Bis - Pyridine - N - Oxide (Dipyrithione) |
| PubChem ID | 3109 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Disulfide, Dipyrithione |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 252.003 |
| Molecular Formula | C10H8N2O2S2 |
| SMILES | S(Sc1[n+]([O-])cccc1)c1[n+]([O-])cccc1 |
| XLogP | 1.726 |
| PSA | 104.480 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 2 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3915 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | NR |
| Target Bacteria | Mycobacterium fortuitum |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2, 2' - Dithio - Bis - Pyridine - N - Oxide (Dipyrithione) |
| PubChem ID | 3109 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Disulfide, Dipyrithione |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 252.003 |
| Molecular Formula | C10H8N2O2S2 |
| SMILES | S(Sc1[n+]([O-])cccc1)c1[n+]([O-])cccc1 |
| XLogP | 1.726 |
| PSA | 104.480 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 2 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3916 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | NR |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (32 µg/ml), Isoniazid (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2, 2' - Dithio - Bis - Pyridine - N - Oxide (Dipyrithione) |
| PubChem ID | 3109 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Disulfide, Dipyrithione |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 252.003 |
| Molecular Formula | C10H8N2O2S2 |
| SMILES | S(Sc1[n+]([O-])cccc1)c1[n+]([O-])cccc1 |
| XLogP | 1.726 |
| PSA | 104.480 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 2 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3917 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | NR |
| Target Bacteria | Mycobacterium smegmatis (mc2 2700) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Not Tested |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | Not tested |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2, 2' - Dithio - Bis - Pyridine - N - Oxide (Dipyrithione) |
| PubChem ID | 3109 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Disulfide, Dipyrithione |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 252.003 |
| Molecular Formula | C10H8N2O2S2 |
| SMILES | S(Sc1[n+]([O-])cccc1)c1[n+]([O-])cccc1 |
| XLogP | 1.726 |
| PSA | 104.480 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 2 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3918 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | NR |
| Target Bacteria | Mycobacterium phlei |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (128 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2, 2' - Dithio - Bis - Pyridine - N - Oxide (Dipyrithione) |
| PubChem ID | 3109 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Disulfide, Dipyrithione |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 252.003 |
| Molecular Formula | C10H8N2O2S2 |
| SMILES | S(Sc1[n+]([O-])cccc1)c1[n+]([O-])cccc1 |
| XLogP | 1.726 |
| PSA | 104.480 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 2 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3919 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | NR |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2, 2' - Dithio - Bis - Pyridine - N - Oxide (Dipyrithione) |
| PubChem ID | 3109 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Disulfide, Dipyrithione |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 252.003 |
| Molecular Formula | C10H8N2O2S2 |
| SMILES | S(Sc1[n+]([O-])cccc1)c1[n+]([O-])cccc1 |
| XLogP | 1.726 |
| PSA | 104.480 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 2 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |