| Compound ID | 1082 |
| Compound Structure | |
| Plant Source | Agrophyron repens Linn. Beauv. Common Name:Couch Grass |
| Source Family | Gramineae |
| Origin | Worldwide |
| Plant Part Used | Rhizome |
| Extract | Methanol (6.83 %) |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antibiotic |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 1083 |
| Compound Structure | |
| Plant Source | Agrophyron repens Linn. Beauv. Common Name:Couch Grass |
| Source Family | Gramineae |
| Origin | Worldwide |
| Plant Part Used | Rhizome |
| Extract | Methanol (6.83 %) |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antibiotic |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 1201 |
| Compound Structure | |
| Plant Source | Apium graveolens L. Common Name:Celery (English), Ajmodaa, Ajmoda, Ajmodikaa, Dipyaka (Sanskrit) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Malaysia, Worldwide |
| Plant Part Used | Seed |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | 1:40 dilutions |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, asthma, chest pain, cough, anthelmintic, antifungal, fever, urinary calculi, obesity, musculoskeletal disorder, dropsy, chronic diarrhoea |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
2) http://parisaramahiti.kar.nic.in/Medicinal_plants_new/med%20plants/p18.html
|
| Curator | |
| Compound ID | 1202 |
| Compound Structure | |
| Plant Source | Apium graveolens L. Common Name:Celery (English), Ajmodaa, Ajmoda, Ajmodikaa, Dipyaka (Sanskrit) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Malaysia, Worldwide |
| Plant Part Used | Seed |
| Extract | Methanol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | 1:40 dilutions |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, asthma, chest pain, cough, anthelmintic, antifungal, fever, urinary calculi, obesity, musculoskeletal disorder, dropsy, chronic diarrhoea |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
2) http://parisaramahiti.kar.nic.in/Medicinal_plants_new/med%20plants/p18.html
|
| Curator | |
| Compound ID | 1203 |
| Compound Structure | |
| Plant Source | Apium graveolens L. Common Name:Celery (English), Ajmodaa, Ajmoda, Ajmodikaa, Dipyaka (Sanskrit) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Malaysia, Worldwide |
| Plant Part Used | Leaf |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Colorimetric Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Isoniazid (0.078 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, asthma, chest pain, cough, anthelmintic, antifungal, fever, urinary calculi, obesity, musculoskeletal disorder, dropsy, chronic diarrhoea |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Chooi, O.H., 2003. Sayuran, Khasiat Makanan dan Ubatan. Utusan Publications and Distributors Sdn Bhd, Kuala Lumpur, Malaysia
2) http://parisaramahiti.kar.nic.in/Medicinal_plants_new/med%20plants/p18.html
|
| Curator | |
| Compound ID | 1440 |
| Compound Structure |  |
| Plant Source | Chromolaena odorata Common Name:Siam Weed, Christmas Bush, Common Floss Flower |
| Source Family | Asteraceae (Compositae) |
| Origin | Neotropics, Worldwide |
| Plant Part Used | Flower |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin sulphate (2.50 µg/ml), Isoniazid (0.06 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Isosakuranetin |
| PubChem ID | 160481 |
| Ethnomedicinal Information | Treat skin wounds |
| PubMed ID [Source Literature] | 15202555, 10811796 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 286.084 |
| Molecular Formula | C16H14O5 |
| SMILES | O1[C@@H](CC(=O)c2c1cc(O)cc2O)c1ccc(OC)cc1 |
| XLogP | 1.416 |
| PSA | 75.990 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn, A., Chotipong, A., Suavansri, T., Boongird, S., Timsuksai, P., Vimuttipong, S., et al. (2004). Antimycobacterial activity and cytotoxicity of flavonoids from the flowers of Chromolaena odorata. Arch Pharm Res 27, 507u511
2) Schmidt GJ, Schilling EE.Phylogeny and biogeography of Eupatorium (Asteraceae: Eupatorieae) based on nuclear ITS sequence data.Am J Bot. 2000 May;87(5):716-26
|
| Curator | |
| Compound ID | 1441 |
| Compound Structure |  |
| Plant Source | Chromolaena odorata Common Name:Siam Weed, Christmas Bush, Common Floss Flower |
| Source Family | Asteraceae (Compositae) |
| Origin | Neotropics, Worldwide |
| Plant Part Used | Flower |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin sulphate (2.50 µg/ml), Isoniazid (0.06 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 4` - Hydroxy - 5, 6, 7 - Trimethoxyflavanone |
| PubChem ID | 244387 |
| Ethnomedicinal Information | Treats skin wounds |
| PubMed ID [Source Literature] | 15202555, 10811796 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 330.110 |
| Molecular Formula | C18H18O6 |
| SMILES | O1C(CC(=O)c2c1cc(OC)c(OC)c2OC)c1ccc(O)cc1 |
| XLogP | 1.491 |
| PSA | 74.220 |
| H-bond Donor | 1 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn, A., Chotipong, A., Suavansri, T., Boongird, S., Timsuksai, P., Vimuttipong, S., et al. (2004). Antimycobacterial activity and cytotoxicity of flavonoids from the flowers of Chromolaena odorata. Arch Pharm Res 27, 507u511
2) Schmidt GJ, Schilling EE.Phylogeny and biogeography of Eupatorium (Asteraceae: Eupatorieae) based on nuclear ITS sequence data.Am J Bot. 2000 May;87(5):716-26
|
| Curator | |
| Compound ID | 1442 |
| Compound Structure |  |
| Plant Source | Chromolaena odorata Common Name:Siam Weed, Christmas Bush, Common Floss Flower |
| Source Family | Asteraceae (Compositae) |
| Origin | Neotropics, Worldwide |
| Plant Part Used | Flower |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin sulphate (2.50 µg/ml), Isoniazid (0.06 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Acacetin |
| PubChem ID | 5280442 |
| Ethnomedicinal Information | Treats skin wounds |
| PubMed ID [Source Literature] | 15202555, 10811796 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 284.068 |
| Molecular Formula | C16H12O5 |
| SMILES | O1c2c(c(=O)cc1c1ccc(OC)cc1)c(O)cc(O)c2 |
| XLogP | 1.645 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn, A., Chotipong, A., Suavansri, T., Boongird, S., Timsuksai, P., Vimuttipong, S., et al. (2004). Antimycobacterial activity and cytotoxicity of flavonoids from the flowers of Chromolaena odorata. Arch Pharm Res 27, 507u511
2) Schmidt GJ, Schilling EE.Phylogeny and biogeography of Eupatorium (Asteraceae: Eupatorieae) based on nuclear ITS sequence data.Am J Bot. 2000 May;87(5):716-26
|
| Curator | |
| Compound ID | 1443 |
| Compound Structure |  |
| Plant Source | Chromolaena odorata Common Name:Siam Weed, Christmas Bush, Common Floss Flower |
| Source Family | Asteraceae (Compositae) |
| Origin | Neotropics, Worldwide |
| Plant Part Used | Flower |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin sulphate (2.50 µg/ml), Isoniazid (0.06 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Luteolin |
| PubChem ID | 5280445 |
| Ethnomedicinal Information | Treats skin wounds |
| PubMed ID [Source Literature] | 15202555, 10811796 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 286.048 |
| Molecular Formula | C15H10O6 |
| SMILES | O1c2c(c(=O)cc1c1cc(O)c(O)cc1)c(O)cc(O)c2 |
| XLogP | 0.592 |
| PSA | 97.990 |
| H-bond Donor | 4 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn, A., Chotipong, A., Suavansri, T., Boongird, S., Timsuksai, P., Vimuttipong, S., et al. (2004). Antimycobacterial activity and cytotoxicity of flavonoids from the flowers of Chromolaena odorata. Arch Pharm Res 27, 507u511
2) Schmidt GJ, Schilling EE.Phylogeny and biogeography of Eupatorium (Asteraceae: Eupatorieae) based on nuclear ITS sequence data.Am J Bot. 2000 May;87(5):716-26
|
| Curator | |
| Compound ID | 1854 |
| Compound Structure | |
| Plant Source | Helianthus annus Linn. Common Name:Sunflower |
| Source Family | Asteraceae (Compositae) |
| Origin | Worldwide, India |
| Plant Part Used | Petal |
| Extract | Methanol (42.56 %) |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Treatment of coughs and colds. Seeds have expectorant properties and have been used in bronchial, laryngeal and pulmonary affections and in whooping cough. |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 1855 |
| Compound Structure | |
| Plant Source | Helianthus annus Linn. Common Name:Sunflower |
| Source Family | Asteraceae (Compositae) |
| Origin | Worldwide, India |
| Plant Part Used | Petal |
| Extract | Methanol (42.56 %) |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Treatment of coughs and colds. Seeds have expectorant properties and have been used in bronchial, laryngeal and pulmonary affections and in whooping cough. |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 1944 |
| Compound Structure | |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Berry |
| Extract | Methanol (21.82 %) |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1945 |
| Compound Structure | |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Berry |
| Extract | Methanol (21.82 %) |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1946 |
| Compound Structure | |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Leaf |
| Extract | Hexane, methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Isoniazid and Ethambutol resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 13680821 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Jimenez-Arellanes A, Meckes M, Ramirez R, Torres J, Luna-Herrera J.Activity against multidrug-resistant Mycobacterium tuberculosis in Mexican plants used to treat respiratory diseases.Phytother Res. 2003 Sep;17(8):903-8
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1947 |
| Compound Structure | |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Leaf |
| Extract | Hexane, methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Rifampin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Jimenez-Arellanes A, Meckes M, Ramirez R, Torres J, Luna-Herrera J.Activity against multidrug-resistant Mycobacterium tuberculosis in Mexican plants used to treat respiratory diseases.Phytother Res. 2003 Sep;17(8):903-8
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1948 |
| Compound Structure | |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Leaf |
| Extract | Water |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Broth Dilution Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:40 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1949 |
| Compound Structure | |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Mother tinture |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (human) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:40 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 2118130 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Grange JM, Davey RW.Detection of antituberculous activity in plant extracts.J Appl Bacteriol. 1990 Jun;68(6):587-91
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1950 |
| Compound Structure | |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Whole plant |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | Isoniazid (10 µl of mg/ml) |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 50 µg extract/Disc |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) A.R. McCutcheon, R.W. Stokes, L.M. Thorson, S.M. Ellis, R.E.W. Hancock and G.H.N. Towers.Anti-Mycobacterial Screening of British Columbian Medicinal Plants.Pharmaceutical Biology, 1997, Vol. 35, No. 2 , Pages 77-83
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1951 |
| Compound Structure |  |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Low Oxygen Recovery Assay (LORA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | 97.7 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Longifolene |
| PubChem ID | 289151 |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 19755141 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Sesquiterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against mammalian Vero cells (ATCC CCL-81) |
| Molecular Weight | 204.188 |
| Molecular Formula | C15H24 |
| SMILES | C12C3C(C(=C)C1CC3)(CCCC2(C)C)C |
| XLogP | 6.444 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Gordien AY, Gray AI, Franzblau SG, Seidel V.Antimycobacterial terpenoids from Juniperus communis L. (Cuppressaceae).J Ethnopharmacol. 2009 Dec 10;126(3):500-5
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1952 |
| Compound Structure |  |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 21.1 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Totarol |
| PubChem ID | 92783 |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 19755141 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 286.230 |
| Molecular Formula | C20H30O |
| SMILES | Oc1c(c2c([C@@]3([C@H](C(CCC3)(C)C)CC2)C)cc1)C(C)C |
| XLogP | 8.211 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Gordien AY, Gray AI, Franzblau SG, Seidel V.Antimycobacterial terpenoids from Juniperus communis L. (Cuppressaceae).J Ethnopharmacol. 2009 Dec 10;126(3):500-5
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1953 |
| Compound Structure |  |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Non-replicating Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Low Oxygen Recovery Assay (LORA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 23.3 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Totarol |
| PubChem ID | 92783 |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 19755141 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 286.230 |
| Molecular Formula | C20H30O |
| SMILES | Oc1c(c2c([C@@]3([C@H](C(CCC3)(C)C)CC2)C)cc1)C(C)C |
| XLogP | 8.211 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Gordien AY, Gray AI, Franzblau SG, Seidel V.Antimycobacterial terpenoids from Juniperus communis L. (Cuppressaceae).J Ethnopharmacol. 2009 Dec 10;126(3):500-5
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1954 |
| Compound Structure |  |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (Isoniazid - resistant variant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 11 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Totarol |
| PubChem ID | 92783 |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 19755141 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 286.230 |
| Molecular Formula | C20H30O |
| SMILES | Oc1c(c2c([C@@]3([C@H](C(CCC3)(C)C)CC2)C)cc1)C(C)C |
| XLogP | 8.211 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Gordien AY, Gray AI, Franzblau SG, Seidel V.Antimycobacterial terpenoids from Juniperus communis L. (Cuppressaceae).J Ethnopharmacol. 2009 Dec 10;126(3):500-5
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1955 |
| Compound Structure |  |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (Streptomycin - resistant variant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 23.9 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Totarol |
| PubChem ID | 92783 |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 19755141 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 286.230 |
| Molecular Formula | C20H30O |
| SMILES | Oc1c(c2c([C@@]3([C@H](C(CCC3)(C)C)CC2)C)cc1)C(C)C |
| XLogP | 8.211 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Gordien AY, Gray AI, Franzblau SG, Seidel V.Antimycobacterial terpenoids from Juniperus communis L. (Cuppressaceae).J Ethnopharmacol. 2009 Dec 10;126(3):500-5
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1956 |
| Compound Structure |  |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (Moxifloxacin - resistant variant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 17.2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Totarol |
| PubChem ID | 92783 |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 19755141 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 286.230 |
| Molecular Formula | C20H30O |
| SMILES | Oc1c(c2c([C@@]3([C@H](C(CCC3)(C)C)CC2)C)cc1)C(C)C |
| XLogP | 8.211 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Gordien AY, Gray AI, Franzblau SG, Seidel V.Antimycobacterial terpenoids from Juniperus communis L. (Cuppressaceae).J Ethnopharmacol. 2009 Dec 10;126(3):500-5
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1957 |
| Compound Structure |  |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (Rifampin resistant variant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 5.8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Totarol |
| PubChem ID | 92783 |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 19755141 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 286.230 |
| Molecular Formula | C20H30O |
| SMILES | Oc1c(c2c([C@@]3([C@H](C(CCC3)(C)C)CC2)C)cc1)C(C)C |
| XLogP | 8.211 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Gordien AY, Gray AI, Franzblau SG, Seidel V.Antimycobacterial terpenoids from Juniperus communis L. (Cuppressaceae).J Ethnopharmacol. 2009 Dec 10;126(3):500-5
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |