| Compound ID | 1005 |
| Compound Structure |  |
| Plant Source | Abrus precatorius L. Common Name:Indian wild liquorice, Jequirity, Crab's Eye (English), Gunja, Gunjaka (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India, Puerto Rico, Nigeria |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Abruquinone B |
| PubChem ID | 44257521 |
| Ethnomedicinal Information | Tuberculous glands, asthma, pain in chest, cough, bronchitis, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 15114511 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Benzopyran, Quinone, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 390.131 |
| Molecular Formula | C20H22O8 |
| SMILES | O1CC(Cc2c1c(OC)c(OC)c(OC)c2)C1=CC(=O)C(=C(OC)C1=O)OC |
| XLogP | 0.780 |
| PSA | 89.520 |
| H-bond Donor | 0 |
| H-bond Acceptor | 8 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 8 |
| No. of S | 0 |
| Reference(s) | 1) Limmatvapirat C, Sirisopanaporn S, Kittakoop P.Antitubercular and antiplasmodial constituents of Abrus precatorius.Planta Med. 2004 Mar;70(3):276-8
2) Indian Medicinal Plants: An Illustrated Dictionary By C.P. Khare
|
| Curator | |
| Compound ID | 1031 |
| Compound Structure | |
| Plant Source | Achillea biebersteinii Afan Common Name:Yarrow |
| Source Family | Asteraceae (Compositae) |
| Origin | Turkey |
| Plant Part Used | Aerial |
| Extract | Ethanol (70 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.0047 – 0.0095 µg/ml), Isoniazid (0.05 – 0.1 µg/ml), Kanamycin (2.5 – 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Used for diarrhea, abdominal pain, stomach ache and healing of wounds in folk medicine |
| PubMed ID [Source Literature] | 15507348 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Tosun F, Kizilay CA, Sener B, Vural M, Palittapongarnpim P.Antimycobacterial screening of some Turkish plants.J Ethnopharmacol. 2004 Dec;95(2-3):273-5
2) Akkol EK, Koca U, Pesin I, Yilmazer D.Evaluation of the Wound Healing Potential of Achillea biebersteinii Afan. (Asteraceae) by In Vivo Excision and Incision Models.Evid Based Complement Alternat Med. 2011;2011:474026
|
| Curator | |
| Compound ID | 1032 |
| Compound Structure | |
| Plant Source | Achillea millefolium L. Common Name:Yarrow (English), Brinjasipha (Sanskrit) |
| Source Family | Asteraceae (Compositae) |
| Origin | Mexico, India |
| Plant Part Used | Aerial |
| Extract | Hexane, methanol |
| Target Bacteria | |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, tuberculosis, colds, flu, fever, astringent |
| PubMed ID [Source Literature] | 13680821 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Jimenez-Arellanes A, Meckes M, Ramirez R, Torres J, Luna-Herrera J. Activity against multidrug-resistant Mycobacterium tuberculosis in Mexican plants used to treat respiratory diseases. Phytother Res. 2003 Sep;17(8):903-8
2) http://plants.usda.gov/java/profile?symbol=ACMI2
|
| Curator | |
| Compound ID | 1034 |
| Compound Structure | |
| Plant Source | Achillea nobilis L. ssp. neilreichii (Kerner) Form´anek Common Name: |
| Source Family | Asteraceae (Compositae) |
| Origin | Turkey |
| Plant Part Used | Aerial |
| Extract | Ethanol (70 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.0047 – 0.0095 µg/ml), Isoniazid (0.05 – 0.1 µg/ml), Kanamycin (2.5 – 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 15507348 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Tosun F, Kizilay CA, Sener B, Vural M, Palittapongarnpim P.Antimycobacterial screening of some Turkish plants.J Ethnopharmacol. 2004 Dec;95(2-3):273-5
|
| Curator | |
| Compound ID | 1035 |
| Compound Structure | |
| Plant Source | Achillea wilhelmsii C. Koch Common Name: |
| Source Family | Asteraceae (Compositae) |
| Origin | Turkey |
| Plant Part Used | Aerial |
| Extract | Ethanol (70 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.0047 – 0.0095 µg/ml), Isoniazid (0.05 – 0.1 µg/ml), Kanamycin (2.5 – 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 15507348 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Tosun F, Kizilay CA, Sener B, Vural M, Palittapongarnpim P.Antimycobacterial screening of some Turkish plants.J Ethnopharmacol. 2004 Dec;95(2-3):273-5
|
| Curator | |
| Compound ID | 1080 |
| Compound Structure | |
| Plant Source | Ageratum corimbosum Common Name:Flat - Top Whiteweed |
| Source Family | Asteraceae (Compositae) |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | Hexane, methanol |
| Target Bacteria | |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough |
| PubMed ID [Source Literature] | 13680821 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Jimenez-Arellanes A, Meckes M, Ramirez R, Torres J, Luna-Herrera J. Activity against multidrug-resistant Mycobacterium tuberculosis in Mexican plants used to treat respiratory diseases. Phytother Res. 2003 Sep;17(8):903-8
|
| Curator | |
| Compound ID | 1157 |
| Compound Structure | |
| Plant Source | Althaea ludwigii L. Common Name: |
| Source Family | Malvaceae |
| Origin | India |
| Plant Part Used | Aerial |
| Extract | Ethanol (80 %) |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Agar Dilution - Streak Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | Partial |
| Activity [MIC] µg/ml | 1000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Aperient used in herbal medicine for other diseases |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
|
| Curator | |
| Compound ID | 1190 |
| Compound Structure | |
| Plant Source | Anoda cristata Common Name:Spurred Anoda, Crested Anoda, Violettas |
| Source Family | Malvaceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | Hexane, methanol |
| Target Bacteria | |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough |
| PubMed ID [Source Literature] | 13680821 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Jimenez-Arellanes A, Meckes M, Ramirez R, Torres J, Luna-Herrera J. Activity against multidrug-resistant Mycobacterium tuberculosis in Mexican plants used to treat respiratory diseases. Phytother Res. 2003 Sep;17(8):903-8
2) Eduardo C. Puricelli, Delma E. Faccini, Effect of soybean spatial arrangement and glyphosate dose on Anoda cristata demography, Crop Protection, Volume 24, Issue 3, March 2005, Pages 241-249.
|
| Curator | |
| Compound ID | 1214 |
| Compound Structure | |
| Plant Source | Artemisia ludoviciana Common Name:White Sagebrush |
| Source Family | Asteraceae (Compositae) |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | Hexane, methanol |
| Target Bacteria | |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, Pneumonia |
| PubMed ID [Source Literature] | 13680821 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Jimenez-Arellanes A, Meckes M, Ramirez R, Torres J, Luna-Herrera J. Activity against multidrug-resistant Mycobacterium tuberculosis in Mexican plants used to treat respiratory diseases. Phytother Res. 2003 Sep;17(8):903-8
2) http://plants.usda.gov/java/profile?symbol=ARLU
|
| Curator | |
| Compound ID | 1258 |
| Compound Structure |  |
| Plant Source | Bocconia arborea Common Name:Bocconia |
| Source Family | Papaveraceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.06 µg/ml), Ethambutol (2 µg/ml), Rifampin (0.06 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Dihydrocheleritrine |
| PubChem ID | 485077 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Benzophenanthridine, Quinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 349.131 |
| Molecular Formula | C21H19NO4 |
| SMILES | O1c2cc3c4N(Cc5c(c4ccc3cc2OC1)ccc(OC)c5OC)C |
| XLogP | 3.232 |
| PSA | 40.160 |
| H-bond Donor | 0 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://zipcodezoo.com/Plants/B/Bocconia_arborea/
|
| Curator | |
| Compound ID | 1259 |
| Compound Structure |  |
| Plant Source | Bocconia arborea Common Name:Bocconia |
| Source Family | Papaveraceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.06 µg/ml), Ethambutol (2 µg/ml), Rifampin (0.06 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 6 - Methoxydihydrocheleritrine |
| PubChem ID | 189060 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Benzophenanthridine, Quinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 379.142 |
| Molecular Formula | C22H21NO5 |
| SMILES | O(C1N(c2c(c3c1c(OC)c(OC)cc3)ccc1c2cc2OCOc2c1)C)C |
| XLogP | 3.216 |
| PSA | 49.390 |
| H-bond Donor | 0 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://zipcodezoo.com/Plants/B/Bocconia_arborea/
|
| Curator | |
| Compound ID | 1260 |
| Compound Structure |  |
| Plant Source | Bocconia arborea Common Name:Bocconia |
| Source Family | Papaveraceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.06 µg/ml), Ethambutol (2 µg/ml), Rifampin (0.06 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 6, 12 - Dimethoxydihydrocheleritrine |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Benzophenanthridine, Quinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 409.153 |
| Molecular Formula | C23H23NO6 |
| SMILES | C1cc(c(c2c1c1c(N(C2OC)C)c2c(c(c1)OC)cc1OCOc1c2)OC)OC |
| XLogP | 2.561 |
| PSA | 58.620 |
| H-bond Donor | 0 |
| H-bond Acceptor | 7 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://zipcodezoo.com/Plants/B/Bocconia_arborea/
|
| Curator | |
| Compound ID | 1261 |
| Compound Structure |  |
| Plant Source | Bocconia arborea Common Name:Bocconia |
| Source Family | Papaveraceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.06 µg/ml), Ethambutol (2 µg/ml), Rifampin (0.06 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 6 - Methoxydihydrosanguinarine |
| PubChem ID | 14847270 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Benzophenanthridine, Quinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 363.111 |
| Molecular Formula | C21H17NO5 |
| SMILES | O(C1N(c2c(c3c1c1OCOc1cc3)ccc1c2cc2OCOc2c1)C)C |
| XLogP | 3.143 |
| PSA | 49.390 |
| H-bond Donor | 0 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 6 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://zipcodezoo.com/Plants/B/Bocconia_arborea/
|
| Curator | |
| Compound ID | 1262 |
| Compound Structure |  |
| Plant Source | Bocconia arborea Common Name:Bocconia |
| Source Family | Papaveraceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.06 µg/ml), Ethambutol (2 µg/ml), Rifampin (0.06 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 6 - Methoxydihydrochelirubine |
| PubChem ID | 15932479 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Benzophenanthridine, Quinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 393.121 |
| Molecular Formula | C22H19NO6 |
| SMILES | O(C1N(c2c(c3c1c1OCOc1cc3OC)ccc1c2cc2OCOc2c1)C)C |
| XLogP | 2.699 |
| PSA | 58.620 |
| H-bond Donor | 0 |
| H-bond Acceptor | 7 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 6 |
| No. of N | 1 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://zipcodezoo.com/Plants/B/Bocconia_arborea/
|
| Curator | |
| Compound ID | 1263 |
| Compound Structure |  |
| Plant Source | Bocconia arborea Common Name:Bocconia |
| Source Family | Papaveraceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (345) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (3.125 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Dihydrocheleritrine |
| PubChem ID | 485077 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Benzophenanthridine, Quinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 349.131 |
| Molecular Formula | C21H19NO4 |
| SMILES | O1c2cc3c4N(Cc5c(c4ccc3cc2OC1)ccc(OC)c5OC)C |
| XLogP | 3.232 |
| PSA | 40.160 |
| H-bond Donor | 0 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://zipcodezoo.com/Plants/B/Bocconia_arborea/
|
| Curator | |
| Compound ID | 1264 |
| Compound Structure |  |
| Plant Source | Bocconia arborea Common Name:Bocconia |
| Source Family | Papaveraceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (345) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (3.125 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 6 - Methoxydihydrocheleritrine |
| PubChem ID | 189060 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Benzophenanthridine, Quinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 379.142 |
| Molecular Formula | C22H21NO5 |
| SMILES | O(C1N(c2c(c3c1c(OC)c(OC)cc3)ccc1c2cc2OCOc2c1)C)C |
| XLogP | 3.216 |
| PSA | 49.390 |
| H-bond Donor | 0 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://zipcodezoo.com/Plants/B/Bocconia_arborea/
|
| Curator | |
| Compound ID | 1265 |
| Compound Structure |  |
| Plant Source | Bocconia arborea Common Name:Bocconia |
| Source Family | Papaveraceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (345) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (3.125 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 6, 12 - Dimethoxydihydrocheleritrine |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Benzophenanthridine, Quinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 409.153 |
| Molecular Formula | C23H23NO6 |
| SMILES | C1cc(c(c2c1c1c(N(C2OC)C)c2c(c(c1)OC)cc1OCOc1c2)OC)OC |
| XLogP | 2.561 |
| PSA | 58.620 |
| H-bond Donor | 0 |
| H-bond Acceptor | 7 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://zipcodezoo.com/Plants/B/Bocconia_arborea/
|
| Curator | |
| Compound ID | 1266 |
| Compound Structure |  |
| Plant Source | Bocconia arborea Common Name:Bocconia |
| Source Family | Papaveraceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (345) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (3.125 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 6 - Methoxydihydrosanguinarine |
| PubChem ID | 14847270 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Benzophenanthridine, Quinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 363.111 |
| Molecular Formula | C21H17NO5 |
| SMILES | O(C1N(c2c(c3c1c1OCOc1cc3)ccc1c2cc2OCOc2c1)C)C |
| XLogP | 3.143 |
| PSA | 49.390 |
| H-bond Donor | 0 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 6 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://zipcodezoo.com/Plants/B/Bocconia_arborea/
|
| Curator | |
| Compound ID | 1267 |
| Compound Structure |  |
| Plant Source | Bocconia arborea Common Name:Bocconia |
| Source Family | Papaveraceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (345) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (3.125 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 6 - Methoxydihydrochelirubine |
| PubChem ID | 15932479 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Benzophenanthridine, Quinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 393.121 |
| Molecular Formula | C22H19NO6 |
| SMILES | O(C1N(c2c(c3c1c1OCOc1cc3OC)ccc1c2cc2OCOc2c1)C)C |
| XLogP | 2.699 |
| PSA | 58.620 |
| H-bond Donor | 0 |
| H-bond Acceptor | 7 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 6 |
| No. of N | 1 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://zipcodezoo.com/Plants/B/Bocconia_arborea/
|
| Curator | |
| Compound ID | 1268 |
| Compound Structure |  |
| Plant Source | Bocconia arborea Common Name:Bocconia |
| Source Family | Papaveraceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M12) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (12.50 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Dihydrocheleritrine |
| PubChem ID | 485077 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Benzophenanthridine, Quinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 349.131 |
| Molecular Formula | C21H19NO4 |
| SMILES | O1c2cc3c4N(Cc5c(c4ccc3cc2OC1)ccc(OC)c5OC)C |
| XLogP | 3.232 |
| PSA | 40.160 |
| H-bond Donor | 0 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://zipcodezoo.com/Plants/B/Bocconia_arborea/
|
| Curator | |
| Compound ID | 1269 |
| Compound Structure |  |
| Plant Source | Bocconia arborea Common Name:Bocconia |
| Source Family | Papaveraceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M12) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (12.50 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 6 - Methoxydihydrocheleritrine |
| PubChem ID | 189060 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Benzophenanthridine, Quinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 379.142 |
| Molecular Formula | C22H21NO5 |
| SMILES | O(C1N(c2c(c3c1c(OC)c(OC)cc3)ccc1c2cc2OCOc2c1)C)C |
| XLogP | 3.216 |
| PSA | 49.390 |
| H-bond Donor | 0 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://zipcodezoo.com/Plants/B/Bocconia_arborea/
|
| Curator | |
| Compound ID | 1270 |
| Compound Structure |  |
| Plant Source | Bocconia arborea Common Name:Bocconia |
| Source Family | Papaveraceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M12) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (12.50 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 6, 12 - Dimethoxydihydrocheleritrine |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Benzophenanthridine, Quinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 409.153 |
| Molecular Formula | C23H23NO6 |
| SMILES | C1cc(c(c2c1c1c(N(C2OC)C)c2c(c(c1)OC)cc1OCOc1c2)OC)OC |
| XLogP | 2.561 |
| PSA | 58.620 |
| H-bond Donor | 0 |
| H-bond Acceptor | 7 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://zipcodezoo.com/Plants/B/Bocconia_arborea/
|
| Curator | |
| Compound ID | 1271 |
| Compound Structure |  |
| Plant Source | Bocconia arborea Common Name:Bocconia |
| Source Family | Papaveraceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M12) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (12.50 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 6 - Methoxydihydrosanguinarine |
| PubChem ID | 14847270 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Benzophenanthridine, Quinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 363.111 |
| Molecular Formula | C21H17NO5 |
| SMILES | O(C1N(c2c(c3c1c1OCOc1cc3)ccc1c2cc2OCOc2c1)C)C |
| XLogP | 3.143 |
| PSA | 49.390 |
| H-bond Donor | 0 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 6 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://zipcodezoo.com/Plants/B/Bocconia_arborea/
|
| Curator | |
| Compound ID | 1272 |
| Compound Structure |  |
| Plant Source | Bocconia arborea Common Name:Bocconia |
| Source Family | Papaveraceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M12) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (12.50 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 6 - Methoxydihydrochelirubine |
| PubChem ID | 15932479 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Benzophenanthridine, Quinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 393.121 |
| Molecular Formula | C22H19NO6 |
| SMILES | O(C1N(c2c(c3c1c1OCOc1cc3OC)ccc1c2cc2OCOc2c1)C)C |
| XLogP | 2.699 |
| PSA | 58.620 |
| H-bond Donor | 0 |
| H-bond Acceptor | 7 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 6 |
| No. of N | 1 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://zipcodezoo.com/Plants/B/Bocconia_arborea/
|
| Curator | |
| Compound ID | 1273 |
| Compound Structure |  |
| Plant Source | Bocconia arborea Common Name:Bocconia |
| Source Family | Papaveraceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M20) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (25 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Dihydrocheleritrine |
| PubChem ID | 485077 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Benzophenanthridine, Quinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 349.131 |
| Molecular Formula | C21H19NO4 |
| SMILES | O1c2cc3c4N(Cc5c(c4ccc3cc2OC1)ccc(OC)c5OC)C |
| XLogP | 3.232 |
| PSA | 40.160 |
| H-bond Donor | 0 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://zipcodezoo.com/Plants/B/Bocconia_arborea/
|
| Curator | |