| Compound ID | 2863 |
| Compound Structure |  |
| Plant Source | Curcuma longa Common Name:Turmeric |
| Source Family | Zingiberaceae |
| Origin | Southeast Asian countries |
| Plant Part Used | Dried rhizome |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 1961 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Demethoxycurcumin |
| PubChem ID | 5324476 |
| Ethnomedicinal Information | Folk medicine, Antioxidant, anti - HIV, antimutagenic, antiangiogenic, antimalarial, antitubercular, antiandrogenic, COX inhibitory activities |
| PubMed ID [Source Literature] | 20027668 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Curcuminoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 338.115 |
| Molecular Formula | C20H18O5 |
| SMILES | O(c1cc(ccc1O)/C=C/C(=C/C(=O)/C=C/c1ccc(O)cc1)/O)C |
| XLogP | 3.610 |
| PSA | 86.990 |
| H-bond Donor | 3 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Agrawal DK, Mishra PK.Curcumin and its analogues: potential anticancer agents.Med Res Rev. 2010 Sep;30(5):818-60
|
| Curator | Reshmi |
