| Compound ID | 2006 |
| Compound Structure | |
| Plant Source | Laurelia novae - zelandiae Common Name:Pukatea |
| Source Family | Atherospermataceae |
| Origin | New Zealand |
| Plant Part Used | Inner Bark |
| Extract | Methanol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | 96 well - plate format assay for bacteriostatic activity, two - fold serial dilution to measure any background optical density or fluorescence associated with the extract |
| Positive Control Used (conc.) | Rifampin (100 µM), Streptomycin (100 µM) |
| Inhibition [%] | 90 % |
| Activity [MIC] µg/ml | 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Sores, ulcers, toothache and tuberculosis |
| PubMed ID [Source Literature] | 20537175 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Earl EA, Altaf M, Murikoli RV, Swift S, O Toole R.Native New Zealand plants with inhibitory activity towards Mycobacterium tuberculosis.BMC Complement Altern Med. 2010 Jun 10;10:25
|
| Curator | |
| Compound ID | 2007 |
| Compound Structure | |
| Plant Source | Laurelia novae - zelandiae Common Name:Pukatea |
| Source Family | Atherospermataceae |
| Origin | New Zealand |
| Plant Part Used | Inner Bark |
| Extract | Methanol |
| Target Bacteria | Mycobacterium bovis |
| Assay / Test Done | 97 well - plate format assay for bacteriostatic activity, two - fold serial dilution to measure any background optical density or fluorescence associated with the extract |
| Positive Control Used (conc.) | Rifampin (100 µM), Streptomycin (100 µM) |
| Inhibition [%] | 90 % |
| Activity [MIC] µg/ml | 2500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Sores, ulcers, toothache and tuberculosis |
| PubMed ID [Source Literature] | 20537175 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Earl EA, Altaf M, Murikoli RV, Swift S, O Toole R.Native New Zealand plants with inhibitory activity towards Mycobacterium tuberculosis.BMC Complement Altern Med. 2010 Jun 10;10:25
|
| Curator | |
| Compound ID | 2008 |
| Compound Structure | |
| Plant Source | Laurelia novae - zelandiae Common Name:Pukatea |
| Source Family | Atherospermataceae |
| Origin | New Zealand |
| Plant Part Used | Inner Bark |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | 98 well - plate format assay for bacteriostatic activity, two - fold serial dilution to measure any background optical density or fluorescence associated with the extract |
| Positive Control Used (conc.) | Rifampin (100 µM), Streptomycin (100 µM) |
| Inhibition [%] | 90 % |
| Activity [MIC] µg/ml | 3750 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Sores, ulcers, toothache and tuberculosis |
| PubMed ID [Source Literature] | 20537175 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Earl EA, Altaf M, Murikoli RV, Swift S, O Toole R.Native New Zealand plants with inhibitory activity towards Mycobacterium tuberculosis.BMC Complement Altern Med. 2010 Jun 10;10:25
|
| Curator | |
| Compound ID | 2274 |
| Compound Structure |  |
| Plant Source | Oplopanax horridus Smith Miq. Common Name:Devil's Club |
| Source Family | Araliaceae |
| Origin | USA |
| Plant Part Used | Inner bark |
| Extract | Methanol, dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | Isoniazid (100 µg/disk) |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 100 µg/disk |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Falcarindiol |
| PubChem ID | 6436239 |
| Ethnomedicinal Information | Diabetes, rheumatism, tuberculosis, colds, headaches and lung ailments |
| PubMed ID [Source Literature] | 9392889 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 260.178 |
| Molecular Formula | C17H24O2 |
| SMILES | O[C@@H](/C=CCCCCCCC)C#CC#C[C@@H](O)C=C |
| XLogP | 4.573 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Kobaisy M, Abramowski Z, Lermer L, Saxena G, Hancock RE, Towers GH, Doxsee D, Stokes RW.Antimycobacterial polyynes of Devils Club (Oplopanax horridus), a North American native medicinal plant.J Nat Prod. 1997 Nov;60(11):1210-3
2) Turner, N. J., L. C. Thompson, M. T. Thompson and A. Z. York. 1990. Thompson Ethnobotany: Knowledge and usage of plants by the Thompson Indians of British Columbia. Victoria: Royal British Columbia Museum, Memoir No. 3
|
| Curator | |
| Compound ID | 2275 |
| Compound Structure |  |
| Plant Source | Oplopanax horridus Smith Miq. Common Name:Devil's Club |
| Source Family | Araliaceae |
| Origin | USA |
| Plant Part Used | Inner bark |
| Extract | Methanol, dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 20 µg/disk |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Falcarinol |
| PubChem ID | 5469789 |
| Ethnomedicinal Information | Diabetes, rheumatism, tuberculosis, colds, headaches and lung ailments |
| PubMed ID [Source Literature] | 9392889 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 244.183 |
| Molecular Formula | C17H24O |
| SMILES | O[C@H](C#CC#CC/C=CCCCCCCC)C=C |
| XLogP | 6.197 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Kobaisy M, Abramowski Z, Lermer L, Saxena G, Hancock RE, Towers GH, Doxsee D, Stokes RW.Antimycobacterial polyynes of Devils Club (Oplopanax horridus), a North American native medicinal plant.J Nat Prod. 1997 Nov;60(11):1210-3
2) Turner, N. J., L. C. Thompson, M. T. Thompson and A. Z. York. 1990. Thompson Ethnobotany: Knowledge and Usage of Plants by the Thompson Indians of British Columbia. Victoria, British Columbia, Royal British Columbia Museum
|
| Curator | |
| Compound ID | 2276 |
| Compound Structure |  |
| Plant Source | Oplopanax horridus Smith Miq. Common Name:Devil's Club |
| Source Family | Araliaceae |
| Origin | USA |
| Plant Part Used | Inner bark |
| Extract | Methanol, dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | Isoniazid |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/disk |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oplopandiol |
| PubChem ID | 6474833 |
| Ethnomedicinal Information | Diabetes, rheumatism, tuberculosis, colds, headaches and lung ailments |
| PubMed ID [Source Literature] | 9392889 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 262.193 |
| Molecular Formula | C17H26O2 |
| SMILES | O[C@@H](/C=CCCCCCCC)C#CC#C[C@@H](O)CC |
| XLogP | 4.977 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Kobaisy M, Abramowski Z, Lermer L, Saxena G, Hancock RE, Towers GH, Doxsee D, Stokes RW.Antimycobacterial polyynes of Devils Club (Oplopanax horridus), a North American native medicinal plant.J Nat Prod. 1997 Nov;60(11):1210-3
2) Turner, N. J., L. C. Thompson, M. T. Thompson and A. Z. York. 1990. Thompson Ethnobotany: Knowledge and Usage of Plants by the Thompson Indians of British Columbia. Victoria, British Columbia, Royal British Columbia Museum
|
| Curator | |
| Compound ID | 2277 |
| Compound Structure | |
| Plant Source | Oplopanax horridus Smith Miq. Common Name:Devil's Club |
| Source Family | Araliaceae |
| Origin | USA |
| Plant Part Used | Inner bark |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | Isoniazid |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diabetes, rheumatism, tuberculosis, colds, headaches and lung ailments |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) A.R. McCutcheon, R.W. Stokes, L.M. Thorson, S.M. Ellis, R.E.W. Hancock and G.H.N. Towers.Anti-Mycobacterial Screening of British Columbian Medicinal Plants.Pharmaceutical Biology, 1997, Vol. 35, No. 2 , Pages 77-83
2) http://cms.herbalgram.org/herbalgram/issue62/article2697.html
|
| Curator | |