| Compound ID | 1191 |
| Compound Structure | |
| Plant Source | Anogeissus leiocarpus (DC.) Guill. & Perr. Common Name:African Birch |
| Source Family | Combretaceae |
| Origin | Nigeria |
| Plant Part Used | Root bark, stem bark |
| Extract | Crude methanol |
| Target Bacteria | Mycobacterium tuberculosis clinical isolate |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 78 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Asthma, cough, tuberculosis, worm killer, gonorrhoea |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mann, A., Amupitan, J.O., Oyewale, A.O., Okogun, J.I., Ibrahim, K., Oladosu, P., Lawson, L., Olajide, I., and Nnamdi, A., 2008, Evaluation of in vitro antimycobacterial activity of Nigerian plants used for treatment of respiratory diseases. Afr. J. Biotech., 7(11), 1630-1636
2) http://www.ajol.info/index.php/ajb/article/viewFile/58747/47072
|
| Curator | |
| Compound ID | 1192 |
| Compound Structure | |
| Plant Source | Anogeissus leiocarpus (DC.) Guill. & Perr. Common Name:African Birch |
| Source Family | Combretaceae |
| Origin | Nigeria |
| Plant Part Used | Root bark, stem bark |
| Extract | Hexane |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Rifampin (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 312.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Asthma, cough, tuberculosis, worm killer, gonorrhoea |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mann, A., Amupitan, J.O., Oyewale, A.O., Okogun, J.I., Ibrahim, K., Oladosu, P., Lawson, L., Olajide, I., and Nnamdi, A., 2008, Evaluation of in vitro antimycobacterial activity of Nigerian plants used for treatment of respiratory diseases. Afr. J. Biotech., 7(11), 1630-1636
2) http://www.ajol.info/index.php/ajb/article/viewFile/58747/47072
|
| Curator | |
| Compound ID | 1193 |
| Compound Structure | |
| Plant Source | Anogeissus leiocarpus (DC.) Guill. & Perr. Common Name:African Birch |
| Source Family | Combretaceae |
| Origin | Nigeria |
| Plant Part Used | Root bark, stem bark |
| Extract | Ethyl acetate soluble |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Rifampin (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 625 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Asthma, cough, tuberculosis, worm killer, gonorrhoea |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mann, A., Amupitan, J.O., Oyewale, A.O., Okogun, J.I., Ibrahim, K., Oladosu, P., Lawson, L., Olajide, I., and Nnamdi, A., 2008, Evaluation of in vitro antimycobacterial activity of Nigerian plants used for treatment of respiratory diseases. Afr. J. Biotech., 7(11), 1630-1636
2) http://www.ajol.info/index.php/ajb/article/viewFile/58747/47072
|
| Curator | |
| Compound ID | 1194 |
| Compound Structure | |
| Plant Source | Anogeissus leiocarpus (DC.) Guill. & Perr. Common Name:African Birch |
| Source Family | Combretaceae |
| Origin | Nigeria |
| Plant Part Used | Root bark, stem bark |
| Extract | Methanol |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Rifampin (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 1250 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Asthma, cough, tuberculosis, worm killer, gonorrhoea |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mann, A., Amupitan, J.O., Oyewale, A.O., Okogun, J.I., Ibrahim, K., Oladosu, P., Lawson, L., Olajide, I., and Nnamdi, A., 2008, Evaluation of in vitro antimycobacterial activity of Nigerian plants used for treatment of respiratory diseases. Afr. J. Biotech., 7(11), 1630-1636
2) http://www.ajol.info/index.php/ajb/article/viewFile/58747/47072
|
| Curator | |
| Compound ID | 1231 |
| Compound Structure | |
| Plant Source | Azadirachta indica A.juss. Common Name:Neem Tree, Margosa Tree (English), Nimba, Nimbaka (Sanskrit) |
| Source Family | Meliaceae |
| Origin | India, Kenya |
| Plant Part Used | Stem bark |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avian, Mycobacterium chelonae, Mycobacterium intracellulare, Mycobacterium tarrae |
| Assay / Test Done | Broth Dilution Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | 10 % |
| Activity [MIC] µg/ml | 8000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, asthma, consumption, phthisis, tuberculosis, anthelmintic, antiseptic. Used to treat chronic leprosy, skin diseases, intestinal worms, chronic malaria fevers, small pox, syphylictic sores |
| PubMed ID [Source Literature] | 9533435 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Fabry W, Okemo PO, Ansorg R.Antibacterial activity of East African medicinal plants.J Ethnopharmacol. 1998 Feb;60(1):79-84
|
| Curator | |
| Compound ID | 1524 |
| Compound Structure | |
| Plant Source | Combretum spp Common Name:Leadwood |
| Source Family | Combretaceae |
| Origin | Nigeria |
| Plant Part Used | Stem bark, root bark |
| Extract | Crude methanol |
| Target Bacteria | Mycobacterium tuberculosis clinical isolate |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1250 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, cough, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) A Mann, J O Amupitan, A O Oyewale, J I Okogun, K Ibrahim.An ethnobotanical survey of indigenous flora for treating tuberculosis and other respiratory diseases in Niger State, Nigeria.JOPAT Vol. 12 2007: pp. 1-21
2) http://www.bradturnsgreen.com/Wood%20Status%20List.pdf
|
| Curator | |
| Compound ID | 1557 |
| Compound Structure | |
| Plant Source | Croton macrostachyus Hochst. ex Ferret et Galinier Common Name:Broad - Leaved Croton |
| Source Family | Euphorbiaceae |
| Origin | Kenya |
| Plant Part Used | Stem bark |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC MGIT™ 960 System |
| Positive Control Used (conc.) | Isoniazid (2, 1 and 0.5 mg/ml) |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Stomach ache, tuberculosis, asthma, coughs, rheumatism |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mariita, Richard M.; Okemo, Paul O.; Orodho, John A.; Kirimuhuzya, Claude; Otieno, Joseph N.; Magadula, J. Joseph.Efficacy of 13 medicinal plants used by indigenous communities around Lake Victoria, Kenya, against tuberculosis, diarrhoea aausing bacteria and candida albicans.Pharmacy & Technology IJPT, Sep-2010, Vol. 2, Issue No.3, 771-791
2) http://www.fao.org/docrep/x5327e/x5327e07.htm
|
| Curator | |
| Compound ID | 1558 |
| Compound Structure | |
| Plant Source | Croton macrostachyus Hochst. ex Ferret et Galinier Common Name:Broad - Leaved Croton |
| Source Family | Euphorbiaceae |
| Origin | Kenya |
| Plant Part Used | Stem bark |
| Extract | Methanol |
| Target Bacteria | Mycobacterium kansasii |
| Assay / Test Done | BACTEC MGIT™ 960 System |
| Positive Control Used (conc.) | Isoniazid (2, 1 and 0.5 mg/ml) |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 0.5, 1, 2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Stomach ache, tuberculosis, asthma, coughs, rheumatism |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mariita, Richard M.; Okemo, Paul O.; Orodho, John A.; Kirimuhuzya, Claude; Otieno, Joseph N.; Magadula, J. Joseph.Efficacy of 13 medicinal plants used by indigenous communities around Lake Victoria, Kenya, against tuberculosis, diarrhoea aausing bacteria and candida albicans.Pharmacy & Technology IJPT, Sep-2010, Vol. 2, Issue No.3, 771-791
2) http://www.fao.org/docrep/x5327e/x5327e07.htm
|
| Curator | |
| Compound ID | 1559 |
| Compound Structure | |
| Plant Source | Croton macrostachyus Hochst. ex Ferret et Galinier Common Name:Broad - Leaved Croton |
| Source Family | Euphorbiaceae |
| Origin | Kenya |
| Plant Part Used | Stem bark |
| Extract | Methanol |
| Target Bacteria | Mycobacterium fortuitum |
| Assay / Test Done | BACTEC MGIT™ 960 System |
| Positive Control Used (conc.) | Isoniazid (2, 1 and 0.5 mg/ml) |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 2000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Stomach ache, tuberculosis, asthma, coughs, rheumatism |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mariita, Richard M.; Okemo, Paul O.; Orodho, John A.; Kirimuhuzya, Claude; Otieno, Joseph N.; Magadula, J. Joseph.Efficacy of 13 medicinal plants used by indigenous communities around Lake Victoria, Kenya, against tuberculosis, diarrhoea aausing bacteria and candida albicans.Pharmacy & Technology IJPT, Sep-2010, Vol. 2, Issue No.3, 771-791
2) http://www.fao.org/docrep/x5327e/x5327e07.htm
|
| Curator | |
| Compound ID | 1560 |
| Compound Structure | |
| Plant Source | Croton macrostachyus Hochst. ex Ferret et Galinier Common Name:Broad - Leaved Croton |
| Source Family | Euphorbiaceae |
| Origin | Kenya |
| Plant Part Used | Stem bark |
| Extract | Methanol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | BACTEC MGIT™ 960 System |
| Positive Control Used (conc.) | Isoniazid (2, 1 & 0.5 mg/ml) |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 0.5, 1, 2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Stomacha ache, tuberculosis, asthma, coughs, rheumatism |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mariita, Richard M.; Okemo, Paul O.; Orodho, John A.; Kirimuhuzya, Claude; Otieno, Joseph N.; Magadula, J. Joseph.Efficacy of 13 medicinal plants used by indigenous communities around Lake Victoria, Kenya, against tuberculosis, diarrhoea aausing bacteria and candida albicans.Pharmacy & Technology IJPT, Sep-2010, Vol. 2, Issue No.3, 771-791
2) http://www.fao.org/docrep/x5327e/x5327e07.htm
|
| Curator | |
| Compound ID | 1629 |
| Compound Structure | |
| Plant Source | Entada africana Guill. & Perr. Common Name: |
| Source Family | Mimosaceae |
| Origin | Nigeria |
| Plant Part Used | Stem bark, root bark |
| Extract | Crude methanol |
| Target Bacteria | Mycobacterium tuberculosis clinical isolate |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, cough, whooping cough, dysentery, fever, wound |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) A Mann, J O Amupitan, A O Oyewale, J I Okogun, K Ibrahim.An ethnobotanical survey of indigenous flora for treating tuberculosis and other respiratory diseases in Niger State, Nigeria.JOPAT Vol. 12 2007: pp. 1-21
2) Mann A, Gbate M, Nda-Umar A. Medicinal and Economic Plants of Nupeland. Bida, Niger State, Nigeria: Jube-Evans Books and Publications; 2003. p. 276
|
| Curator | |
| Compound ID | 1718 |
| Compound Structure | |
| Plant Source | Euphorbia tirucalli L. Common Name:Indian Tree Spurge, Milk Hedge, Petroleum - Plant, Aveloz, Milk Bush, Pencil Tree |
| Source Family | Euphorbiaceae |
| Origin | Kenya |
| Plant Part Used | Stem bark |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC MGIT™ 960 System |
| Positive Control Used (conc.) | Isoniazid (2,1 & 0.5 mg/ml) |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 2000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis, asthma |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mariita, Richard M.; Okemo, Paul O.; Orodho, John A.; Kirimuhuzya, Claude; Otieno, Joseph N.; Magadula, J. Joseph.Efficacy of 13 medicinal plants used by indigenous communities around Lake Victoria, Kenya, against tuberculosis, diarrhoea aausing bacteria and candida albicans.Pharmacy & Technology IJPT, Sep-2010, Vol. 2, Issue No.3, 771-791
|
| Curator | |
| Compound ID | 1806 |
| Compound Structure | |
| Plant Source | Garcinia polyantha Oliv. Common Name: |
| Source Family | Clusiaceae |
| Origin | Africa |
| Plant Part Used | Stem bark |
| Extract | Dichloromethane:Methanol |
| Target Bacteria | Mycobacterium smegmatis, Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:01 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Wounds, various uses |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Kuete V., Meli A.L., Komguem J., Louh G.N., Tangmouo J.G., Lontsi D., Meyer J.J.M., Lall N.Antimycobacterial, Antibacterial and Antifungal Activities of the Methanolic Extract and Compounds from Garcinia Polyantha. Pharmacologyonline 3 : 87-95 (2007)
|
| Curator | |
| Compound ID | 2643 |
| Compound Structure | |
| Plant Source | Sterculia setigera Del. Common Name:Karaya Gum Tree |
| Source Family | Sterculiaceae |
| Origin | Nigeria |
| Plant Part Used | Stem bark |
| Extract | Crude methanol |
| Target Bacteria | Mycobacterium tuberculosis clinical isolate |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Asthma, bronchitis, cough, wound, boils, hemoptysis fever, cancer, dysentery |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) A Mann, J O Amupitan, A O Oyewale, J I Okogun, K Ibrahim.An ethnobotanical survey of indigenous flora for treating tuberculosis and other respiratory diseases in Niger State, Nigeria.JOPAT Vol. 12 2007: pp. 1-21
2) Mann A, Gbate M, Nda-Umar A. Medicinal and Economic Plants of Nupeland. Bida, Niger State, Nigeria: Jube-Evans Books and Publications; 2003. p. 276
3) http://plants.jstor.org/upwta/5_293
|
| Curator | |
| Compound ID | 2644 |
| Compound Structure | |
| Plant Source | Stereospermum kunthianum Cham. Common Name:Pink Jacaranda |
| Source Family | Bignoniaceae |
| Origin | Nigeria |
| Plant Part Used | Stem bark |
| Extract | Crude methanol |
| Target Bacteria | Mycobacterium tuberculosis clinical isolate |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 2500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cancer, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) A Mann, J O Amupitan, A O Oyewale, J I Okogun, K Ibrahim.An ethnobotanical survey of indigenous flora for treating tuberculosis and other respiratory diseases in Niger State, Nigeria.JOPAT Vol. 12 2007: pp. 1-21
2) Mann A, Gbate M, Nda-Umar A. Medicinal and Economic Plants of Nupeland. Bida, Niger State, Nigeria: Jube-Evans Books and Publications; 2003. p. 276
3) http://www.zimbabweflora.co.zw/speciesdata/species.php?species_id=152430
|
| Curator | |
| Compound ID | 2707 |
| Compound Structure |  |
| Plant Source | Terminalia avicennioides Guill. & Perr. Common Name: |
| Source Family | Combretaceae |
| Origin | Nigeria |
| Plant Part Used | Stem bark |
| Extract | |
| Target Bacteria | Mycobacterium fortuitum |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Imberbic acid |
| PubChem ID | NR |
| Ethnomedicinal Information | Asthma, cough, hemoptysis, tuberculosis, sore throat, diarrhea |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Triterpene, Hydroxy, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 472.355 |
| Molecular Formula | C30H48O4 |
| SMILES | C1([C@H]2[C@@]([C@@H]3[C@@](CC2)([C@]2(C(=CC3)[C@H]3[C@@](CC2)(CC[C@](C3)(C(=O)O)C)C)C)C)([C@H](C[C@@H]1O)O)C)(C)C |
| XLogP | 7.389 |
| PSA | 77.760 |
| H-bond Donor | 3 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) A Mann, J O Amupitan, A O Oyewale, J I Okogun, K Ibrahim.An ethnobotanical survey of indigenous flora for treating tuberculosis and other respiratory diseases in Niger State, Nigeria.JOPAT Vol. 12 2007: pp. 1-21
2) Mann A, Gbate M, Nda-Umar A. Medicinal and Economic Plants of Nupeland. Bida, Niger State, Nigeria: Jube-Evans Books and Publications; 2003. p. 276
|
| Curator | |
| Compound ID | 3670 |
| Compound Structure |  |
| Plant Source | Micromelum hirsutum Common Name: |
| Source Family | Rutaceae |
| Origin | |
| Plant Part Used | Stem bark |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Fluorometric Alamar Blue Microassay (FMABA) |
| Positive Control Used (conc.) | Rifampin (0.040 ± 0.017 µg/ml) |
| Inhibition [%] | > 90 % |
| Activity [MIC] µg/ml | 1.5 ± 0.4 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | (-) - Z - 9 - Octadecene - 4 - Olide [Micromolide] |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15770548 |
| Extract Preparation | The dried, milled stem bark of Micromelum hirsutum was extracted with CH2Cl2 to yield 45.5 g extract, of which 32.1 g were chromatographed by vacuum liquid chromatography over a silica gel column |
| Chemical Classification [Active Compound] | Alicyclic, Butenolide, Lactone, Alkene |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 280.240 |
| Molecular Formula | C18H32O2 |
| SMILES | O1C(=O)CCC1CCCC/C=CCCCCCCCC |
| XLogP | 7.349 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Ma C, Case RJ, Wang Y, Zhang HJ, Tan GT, Van Hung N, Cuong NM, Franzblau SG, Soejarto DD, Fong HH, Pauli GF.Anti-tuberculosis constituents from the stem bark of Micromelum hirsutum.Planta Med. 2005 Mar;71(3):261-7
|
| Curator | Vikramjitmandal |
| Compound ID | 3671 |
| Compound Structure |  |
| Plant Source | Micromelum hirsutum Common Name: |
| Source Family | Rutaceae |
| Origin | |
| Plant Part Used | Stem bark |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Fluorometric Alamar Blue Microassay (FMABA) |
| Positive Control Used (conc.) | Rifampin (0.040 ± 0.017 µg/ml) |
| Inhibition [%] | > 90 % |
| Activity [MIC] µg/ml | 31.5 ± 0.2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Micromeline |
| PubChem ID | 5278450 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15770548 |
| Extract Preparation | The dried, milled stem bark of Micromelum hirsutum was extracted with CH2Cl2 to yield 45.5 g extract, of which 32.1 g were chromatographed by vacuum liquid chromatography over a silica gel column |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Alkaloid, Carbazole, Prenylated, Aldehyde, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 279.126 |
| Molecular Formula | C18H17NO2 |
| SMILES | Oc1c(c2c3c([nH]c2cc1)ccc(c3)C=O)CC=C(C)C |
| XLogP | 3.814 |
| PSA | 53.090 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Ma C, Case RJ, Wang Y, Zhang HJ, Tan GT, Van Hung N, Cuong NM, Franzblau SG, Soejarto DD, Fong HH, Pauli GF.Anti-tuberculosis constituents from the stem bark of Micromelum hirsutum.Planta Med. 2005 Mar;71(3):261-7
|
| Curator | Vikramjitmandal |
| Compound ID | 3672 |
| Compound Structure |  |
| Plant Source | Micromelum hirsutum Common Name: |
| Source Family | Rutaceae |
| Origin | |
| Plant Part Used | Stem bark |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Fluorometric Alamar Blue Microassay (FMABA) |
| Positive Control Used (conc.) | Rifampin (0.040 ± 0.017 µg/ml) |
| Inhibition [%] | > 90 % |
| Activity [MIC] µg/ml | 14.3 ± 0.9 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Lansine |
| PubChem ID | 5317755 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15770548 |
| Extract Preparation | The dried, milled stem bark of Micromelum hirsutum was extracted with CH2Cl2 to yield 45.5 g extract, of which 32.1 g were chromatographed by vacuum liquid chromatography over a silica gel column |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Alkaloid, Carbazole, Aldehyde, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 255.090 |
| Molecular Formula | C15H13NO3 |
| SMILES | O(c1cc2[nH]c3c(c2cc1C=O)ccc(OC)c3)C |
| XLogP | 2.419 |
| PSA | 51.320 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Ma C, Case RJ, Wang Y, Zhang HJ, Tan GT, Van Hung N, Cuong NM, Franzblau SG, Soejarto DD, Fong HH, Pauli GF.Anti-tuberculosis constituents from the stem bark of Micromelum hirsutum.Planta Med. 2005 Mar;71(3):261-7
|
| Curator | Vikramjitmandal |
| Compound ID | 3673 |
| Compound Structure |  |
| Plant Source | Micromelum hirsutum Common Name: |
| Source Family | Rutaceae |
| Origin | |
| Plant Part Used | Stem bark |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Fluorometric Alamar Blue Microassay (FMABA) |
| Positive Control Used (conc.) | Rifampin (0.040 ± 0.017 µg/ml) |
| Inhibition [%] | > 90 % |
| Activity [MIC] µg/ml | > 128 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 3 - Methylcarbazole |
| PubChem ID | 20746 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15770548 |
| Extract Preparation | The dried, milled stem bark of Micromelum hirsutum was extracted with CH2Cl2 to yield 45.5 g extract, of which 32.1 g were chromatographed by vacuum liquid chromatography over a silica gel column |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Carbazole, Alkaloid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 181.089 |
| Molecular Formula | C13H11N |
| SMILES | [nH]1c2c(c3c1cccc3)cc(cc2)C |
| XLogP | 4.401 |
| PSA | 15.790 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Ma C, Case RJ, Wang Y, Zhang HJ, Tan GT, Van Hung N, Cuong NM, Franzblau SG, Soejarto DD, Fong HH, Pauli GF.Anti-tuberculosis constituents from the stem bark of Micromelum hirsutum.Planta Med. 2005 Mar;71(3):261-7
|
| Curator | Vikramjitmandal |
| Compound ID | 3674 |
| Compound Structure |  |
| Plant Source | Micromelum hirsutum Common Name: |
| Source Family | Rutaceae |
| Origin | |
| Plant Part Used | Stem bark |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Fluorometric Alamar Blue Microassay (FMABA) |
| Positive Control Used (conc.) | Rifampin (0.040 ± 0.017 µg/ml) |
| Inhibition [%] | > 90 % |
| Activity [MIC] µg/ml | > 128 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Methyl Carbazole - 3 - Carboxylate |
| PubChem ID | 504069 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15770548 |
| Extract Preparation | The dried, milled stem bark of Micromelum hirsutum was extracted with CH2Cl2 to yield 45.5 g extract, of which 32.1 g were chromatographed by vacuum liquid chromatography over a silica gel column |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Alkaloid, Carbazole, Ester |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 225.079 |
| Molecular Formula | C14H11NO2 |
| SMILES | O(C(=O)c1cc2c3c([nH]c2cc1)cccc3)C |
| XLogP | 3.425 |
| PSA | 42.090 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Ma C, Case RJ, Wang Y, Zhang HJ, Tan GT, Van Hung N, Cuong NM, Franzblau SG, Soejarto DD, Fong HH, Pauli GF.Anti-tuberculosis constituents from the stem bark of Micromelum hirsutum.Planta Med. 2005 Mar;71(3):261-7
|
| Curator | Vikramjitmandal |
| Compound ID | 3675 |
| Compound Structure | |
| Plant Source | Micromelum hirsutum Common Name: |
| Source Family | Rutaceae |
| Origin | |
| Plant Part Used | Stem bark |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Fluorometric Alamar Blue Microassay (FMABA) |
| Positive Control Used (conc.) | Rifampin (0.040 ± 0.017 µg/ml) |
| Inhibition [%] | > 90 % |
| Activity [MIC] µg/ml | 42.3 ± 0.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 3 - Formylcarbazole |
| PubChem ID | 20746 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15770548 |
| Extract Preparation | The dried, milled stem bark of Micromelum hirsutum was extracted with CH2Cl2 to yield 45.5 g extract, of which 32.1 g were chromatographed by vacuum liquid chromatography over a silica gel column |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Carbazole, Alkaloid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 181.089 |
| Molecular Formula | C13H11N |
| SMILES | [nH]1c2c(c3c1cccc3)cc(cc2)C |
| XLogP | 4.401 |
| PSA | 15.790 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Ma C, Case RJ, Wang Y, Zhang HJ, Tan GT, Van Hung N, Cuong NM, Franzblau SG, Soejarto DD, Fong HH, Pauli GF.Anti-tuberculosis constituents from the stem bark of Micromelum hirsutum.Planta Med. 2005 Mar;71(3):261-7
|
| Curator | Vikramjitmandal |
| Compound ID | 3676 |
| Compound Structure |  |
| Plant Source | Micromelum hirsutum Common Name: |
| Source Family | Rutaceae |
| Origin | |
| Plant Part Used | Stem bark |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Fluorometric Alamar Blue Microassay (FMABA) |
| Positive Control Used (conc.) | Rifampin (0.040 ± 0.017 µg/ml) |
| Inhibition [%] | > 90 % |
| Activity [MIC] µg/ml | 15.6 ± 0.2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 3 - Formyl - 6 - Methoxycarbazole |
| PubChem ID | 5278452 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15770548 |
| Extract Preparation | The dried, milled stem bark of Micromelum hirsutum was extracted with CH2Cl2 to yield 45.5 g extract, of which 32.1 g were chromatographed by vacuum liquid chromatography over a silica gel column |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Carbazole, Alkaloid, Aldehyde, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 225.079 |
| Molecular Formula | C14H11NO2 |
| SMILES | O(c1cc2c3c([nH]c2cc1)ccc(c3)C=O)C |
| XLogP | 2.863 |
| PSA | 42.090 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Ma C, Case RJ, Wang Y, Zhang HJ, Tan GT, Van Hung N, Cuong NM, Franzblau SG, Soejarto DD, Fong HH, Pauli GF.Anti-tuberculosis constituents from the stem bark of Micromelum hirsutum.Planta Med. 2005 Mar;71(3):261-7
|
| Curator | Vikramjitmandal |
| Compound ID | 3677 |
| Compound Structure |  |
| Plant Source | Micromelum hirsutum Common Name: |
| Source Family | Rutaceae |
| Origin | |
| Plant Part Used | Stem bark |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis Erdman (ATCC 35 801) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Rifampin |
| Inhibition [%] | > 90 % |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 5α - Epoxyalantolactone |
| PubChem ID | 474521 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15770548 |
| Extract Preparation | The dried, milled stem bark of Micromelum hirsutum was extracted with CH2Cl2 to yield 45.5 g extract, of which 32.1 g were chromatographed by vacuum liquid chromatography over a silica gel column |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone, Epoxy |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 248.141 |
| Molecular Formula | C15H20O3 |
| SMILES | O1[C@]23[C@@](C[C@H]4OC(=O)C(=C)[C@H]4[C@H]12)(CCC[C@@H]3C)C |
| XLogP | 2.414 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Ma C, Case RJ, Wang Y, Zhang HJ, Tan GT, Van Hung N, Cuong NM, Franzblau SG, Soejarto DD, Fong HH, Pauli GF.Anti-tuberculosis constituents from the stem bark of Micromelum hirsutum.Planta Med. 2005 Mar;71(3):261-7
|
| Curator | Vikramjitmandal |
| Compound ID | 3801 |
| Compound Structure |  |
| Plant Source | Diospyros anisandra Common Name: |
| Source Family | Ebenaceae |
| Origin | Mexico |
| Plant Part Used | Stem bark |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.06–2.00 µg/ml), Ofloxacin (0.50–16.00 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Plumbagin |
| PubChem ID | 10205 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 17498888 |
| Extract Preparation | Hexane and dichloromethane extracts |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Napthalene, Quinone, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 188.047 |
| Molecular Formula | C11H8O3 |
| SMILES | Oc1c2c(C(=O)C(=CC2=O)C)ccc1 |
| XLogP | 0.756 |
| PSA | 54.370 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Borges-Argáez R, Canche-Chay CI, Peña-Rodríguez LM, Said-Fernández S, Molina-Salinas GM.Antimicrobial activity of Diospyros anisandra.Fitoterapia. 2007 Jul;78(5):370-2. Epub 2007 Apr 11
|
| Curator | Vsheeba, vikramjitmandal |
