| Compound ID | 2089 |
| Compound Structure | |
| Plant Source | Lumnitzera littorea Voigt Common Name: |
| Source Family | Combretaceae |
| Origin | India |
| Plant Part Used | Twig |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Piles |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Pongpan A, Chumsri P and Taworasate T .The antimicrobial activity of some Thai Medicinal Plants. Mahidol Univ J Pharm Sci 1982; 9 4: 88-91
|
| Curator | |
| Compound ID | 2170 |
| Compound Structure | |
| Plant Source | Mesua ferrea L Common Name:Ironwood, Mesu (English), Naagakeshara, Naagapushpa (Sanskrit) |
| Source Family | Clusiaceae |
| Origin | India |
| Plant Part Used | Twig |
| Extract | Ethanol (95 %), petroleum ether |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Sore throat, cough, asthma |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Pongpan A, Chumsri P and Taworasate T .The antimicrobial activity of some Thai Medicinal. Plants. Mahidol Univ J Pharm Sci 1982; 9 4: 88-91
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 2578 |
| Compound Structure |  |
| Plant Source | Scleropyrum pentandrum Common Name: |
| Source Family | Santalaceae |
| Origin | India, Malaysia, Philippines, Singapore, Sri Lanka |
| Plant Part Used | Twig |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.004 µg/ml), Isoniazid (0.06 µg/ml), Kanamycin sulphate (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Scleropyric acid |
| PubChem ID | 11594149 |
| Ethnomedicinal Information | Malaria, tuberculosis |
| PubMed ID [Source Literature] | 16204994 |
| Extract Preparation | The pulverized, dry twigs (1.06 kg) were extracted successively with n - Hexane, CHCl3 and MeOH in a soxhlet extraction apparatus to yield the hexane (7.12 g), CHCl3 (3.50 g), and MeOH (12.42 g) extracts, respectively |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 264.209 |
| Molecular Formula | C17H28O2 |
| SMILES | OC(=O)CCCCCCCCCCC#CCCC=C |
| XLogP | 6.563 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn A, Buaprom M, Udtip S, Nuntawong N, Haritakun R, Kanokmedhakul S.Antimycobacterial and antiplasmodial unsaturated carboxylic acid from the twigs of Scleropyrum wallichianum.Chem Pharm Bull (Tokyo). 2005 Oct;53(10):1327-9
|
| Curator | |
| Compound ID | 3861 |
| Compound Structure |  |
| Plant Source | Rhus taitensis Guill. Common Name:Pumac |
| Source Family | Anacardiaceae |
| Origin | Papua New Guinea |
| Plant Part Used | Leaf, twig |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra (ATCC 25177) |
| Assay / Test Done | MTT Assay |
| Positive Control Used (conc.) | Rifampin (0.0025 - 0.0079 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Tetrahydroxysqualene |
| PubChem ID | 25058109 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18710283 |
| Extract Preparation | Air - dried leaves and twigs (108.6 g) of Rhus taitensis were ground and extracted with 250 ml MeOH (3 × 24 hours) at room temperature. The crude extract (1.7 g) was filtered and concentrated in vacuo. 5 grams of the crude extract were dissolved in MeOH and mixed with 5 g of HP20SS and dried. The mixture was then poured into a column and fractionated using 100 % water, 75 % H2O / 25 % 2 - propanol, 50 % H2O / 50 % 2 - propanol, 25 % H2O / 75 % 2 - propanol, and 100 % MeOH to yield five fractions designated FW, F1, F2, F3, F4, respectively. The fractions were collected and the solvents evaporated using a centrifugal evaporator |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Terpene, Triterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | ADC (Remel) supplemented 7H9 medium |
| Cytotoxicity Assay [AID] | Against Human T cells |
| Molecular Weight | 474.371 |
| Molecular Formula | C30H50O4 |
| SMILES | OCC(=CCC/C(=C/CC/C(=C/CC/C=C(/CC/C=C(/CCC=C(CO)CO)C)C)/C)/C)CO |
| XLogP | 5.646 |
| PSA | 80.920 |
| H-bond Donor | 4 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 19 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Noro JC, Barrows LR, Gideon OG, Ireland CM, Koch M, Matainaho T, Piskaut P, Pond CD, Bugni TS.Tetrahdroxysqualene from Rhus taitensis shows antimycobacterial activity against Mycobacterium tuberculosis.J Nat Prod. 2008 Sep;71(9):1623-4. Epub 2008 Aug 19
|
| Curator | KeyaMukherjee, Farzana Shamsudeen, gppreetha |
