| Compound ID | 1052 |
| Compound Structure | N/A |
| Plant Source | Adhatoda vasica Nees Common Name:Malabar Nut Tree (English), Vasaka (Sanskrit) |
| Source Family | Acanthaceae |
| Origin | India |
| Plant Part Used | Leaf |
| Extract | Water |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Middlebrook 7H9 Broth using BacT/ALERT 3D System |
| Positive Control Used (conc.) | Isoniazid, Rifampin |
| Inhibition [%] | 70 % |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Treatment of tuberculosis, asthma and also as expectorants, bronchial disorders such as acute and chronic cough, bronchitis |
| PubMed ID [Source Literature] | 20571171 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gupta R, Thakur B, Singh P, Singh HB, Sharma VD, Katoch VM, Chauhan SV.Anti-tuberculosis activity of selected medicinal plants against multi-drug resistant Mycobacterium tuberculosis isolates.Indian J Med Res. 2010 Jun;131:809-13
|
| Curator | |
| Compound ID | 1053 |
| Compound Structure | N/A |
| Plant Source | Adhatoda vasica Nees Common Name:Malabar Nut Tree (English), Vasaka (Sanskrit) |
| Source Family | Acanthaceae |
| Origin | India |
| Plant Part Used | Leaf |
| Extract | Water |
| Target Bacteria | Mycobacterium tuberculosis (Multi - Drug Resistant isolate DKU 156) |
| Assay / Test Done | Middlebrook 7H9 Broth using BacT/ALERT 3D System |
| Positive Control Used (conc.) | Isoniazid, Rifampin |
| Inhibition [%] | 32 % |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Treatment of tuberculosis, asthma and also as expectorants, bronchial disorders such as acute and chronic cough, bronchitis |
| PubMed ID [Source Literature] | 20571171 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gupta R, Thakur B, Singh P, Singh HB, Sharma VD, Katoch VM, Chauhan SV.Anti-tuberculosis activity of selected medicinal plants against multi-drug resistant Mycobacterium tuberculosis isolates.Indian J Med Res. 2010 Jun;131:809-13
|
| Curator | |
| Compound ID | 1054 |
| Compound Structure | N/A |
| Plant Source | Adhatoda vasica Nees Common Name:Malabar Nut Tree (English),Vasaka (Sanskrit) |
| Source Family | Acanthaceae |
| Origin | India |
| Plant Part Used | Leaf |
| Extract | Water |
| Target Bacteria | MDR stain of Mycobacterium tuberculosis (JAL1236) |
| Assay / Test Done | Middlebrook 7H9 Broth using BacT/ALERT 3D System |
| Positive Control Used (conc.) | Isoniazid, Rifampin |
| Inhibition [%] | 86 % |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Treatment of tuberculosis, asthma and also as expectorants, bronchial disorders such as acute and chronic cough, bronchitis |
| PubMed ID [Source Literature] | 20571171 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gupta R, Thakur B, Singh P, Singh HB, Sharma VD, Katoch VM, Chauhan SV.Anti-tuberculosis activity of selected medicinal plants against multi-drug resistant Mycobacterium tuberculosis isolates.Indian J Med Res. 2010 Jun;131:809-13
|
| Curator | |
| Compound ID | 1055 |
| Compound Structure | N/A |
| Plant Source | Adhatoda vasica Nees Common Name:Malabar Nut Tree (English), Vasaka (Sanskrit) |
| Source Family | Acanthaceae |
| Origin | India |
| Plant Part Used | Leaf |
| Extract | Water |
| Target Bacteria | Mycobacterium fortuitum (TMC 1529) |
| Assay / Test Done | Middlebrook 7H9 Broth using BacT/ALERT 3D System |
| Positive Control Used (conc.) | Isoniazid, Rifampin |
| Inhibition [%] | 0 % |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Treatment of tuberculosis, asthma and also as expectorants, bronchial disorders such as acute and chronic cough, bronchitis |
| PubMed ID [Source Literature] | 20571171 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gupta R, Thakur B, Singh P, Singh HB, Sharma VD, Katoch VM, Chauhan SV.Anti-tuberculosis activity of selected medicinal plants against multi-drug resistant Mycobacterium tuberculosis isolates.Indian J Med Res. 2010 Jun;131:809-13
|
| Curator | |
| Compound ID | 1056 |
| Compound Structure |  |
| Plant Source | Adhatoda vasica Nees Common Name:Malabar Nut Tree (English), Vasaka (Sanskrit) |
| Source Family | Acanthaceae |
| Origin | India |
| Plant Part Used | Leaf |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Broth Dilution Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Bromhexine |
| PubChem ID | 2442 |
| Ethnomedicinal Information | Treatment of tuberculosis, asthma and also as expectorants, bronchial disorders such as acute and chronic cough, bronchitis |
| PubMed ID [Source Literature] | 8778507 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Cyclohexane, Amine, Haloginated |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 373.999 |
| Molecular Formula | C14H20Br2N2
|
| SMILES | Brc1c(N)c(CN(C2CCCCC2)C)cc(Br)c1 |
| XLogP | 4.004 |
| PSA | 29.260 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 2 |
| No. of N | 2 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Grange JM, Snell NJ.Activity of bromhexine and ambroxol, semi-synthetic derivatives of vasicine from the Indian shrub Adhatoda vasica, against Mycobacterium tuberculosis in vitro.J Ethnopharmacol. 1996 Jan;50(1):49-53
|
| Curator | |
| Compound ID | 1057 |
| Compound Structure |  |
| Plant Source | Adhatoda vasica Nees Common Name:Malabar Nut Tree (English), Vasaka (Sanskrit) |
| Source Family | Acanthaceae |
| Origin | India |
| Plant Part Used | Leaf |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Broth Dilution Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 64 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ambroxol |
| PubChem ID | 2132 |
| Ethnomedicinal Information | Treatment of tuberculosis, asthma and also as expectorants, bronchial disorders such as acute and chronic cough, bronchitis |
| PubMed ID [Source Literature] | 8778507 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Cyclohexane, Amine, Haloginated, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 375.979 |
| Molecular Formula | C13H18Br2N2O
|
| SMILES | Brc1c(N)c(CNC2CCC(O)CC2)cc(Br)c1 |
| XLogP | 2.524 |
| PSA | 58.280 |
| H-bond Donor | 3 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 2 |
| No. of N | 2 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Grange JM, Snell NJ.Activity of bromhexine and ambroxol, semi-synthetic derivatives of vasicine from the Indian shrub Adhatoda vasica, against Mycobacterium tuberculosis in vitro.J Ethnopharmacol. 1996 Jan;50(1):49-53
|
| Curator | |
| Compound ID | 1493 |
| Compound Structure |  |
| Plant Source | Clinacanthus siamensis Brem. Common Name:Sophaghni, Vishaghni, Vishalata (Sanskrit) |
| Source Family | Acanthaceae |
| Origin | Thailand |
| Plant Part Used | Fresh leaf |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 - 0.090 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Trans - 3 - Methylthioacrylamide |
| PubChem ID | 11819072 |
| Ethnomedicinal Information | Poison bites, inflammation, traumatic edema and swelling due to poison stings. |
| PubMed ID [Source Literature] | 14646322 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Amide, Thioether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 117.025 |
| Molecular Formula | C4H7NOS
|
| SMILES | S(/C=C/C(=O)N)C |
| XLogP | 0.313 |
| PSA | 68.390 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 0 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 1 |
| Reference(s) | 1) Tuntiwachwuttikul P, Pootaeng-on Y, Pansa P, Srisanpang T, Taylor WC.Sulfur-containing compounds from Clinacanthus siamensis.Chem Pharm Bull (Tokyo). 2003 Dec;51(12):1423-5
2) http://ayurvedicmedicinalplants.com/index.php?option=com_zoom&Itemid=26&page=view&catid=3&key=63&hit=1
|
| Curator | |
| Compound ID | 1970 |
| Compound Structure | |
| Plant Source | Justicia gendarussa Burm.f. Common Name:Gandarusa, Warer Willow (English), Kasanah, Vaidyasinha (Sanskrit) |
| Source Family | Acanthaceae |
| Origin | Malaysia |
| Plant Part Used | Leaf |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Colorimetric Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Isoniazid (0.078 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1600 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough and asthma, rheumatism and colics of children |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Wart, C., 2000. Medicinal Plants of Southeast Asia. Pelanduk Publications, Petaling Jaya, Selangor, Malaysia
2) Image on Flickr http://www.flickr.com/photos/dinesh_valke/3294969815/
|
| Curator | |
| Compound ID | 2520 |
| Compound Structure | |
| Plant Source | Rungia parviflora Nees var.pectinata C. B. Clarke Common Name:Parpata (Sanskrit) |
| Source Family | Acanthaceae |
| Origin | India |
| Plant Part Used | Aerial |
| Extract | Methanol |
| Target Bacteria | Mycobacterium phlei |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | Chloramphenicol |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 300000 µg/ml of dried plant material |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Leprosy, small - pox, urinary complaints |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
|
| Curator | |
| Compound ID | 2548 |
| Compound Structure | |
| Plant Source | Sanchezia sprucei Lindau Common Name: |
| Source Family | Acanthaceae |
| Origin | Peru |
| Plant Part Used | Stem |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis (ATCC 27294) |
| Assay / Test Done | BACTEC 460 (Becton Dickinson Diagnostic Instrument Systems, Sparks MD) radiometric assay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Ethambutol (7.5 µg/ml) |
| Inhibition [%] | < 50 % |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 13678239 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Graham JG, Pendland SL, Prause JL, Danzinger LH, Schunke Vigo J, Cabieses F, Farnsworth NR.Antimycobacterial evaluation of Peruvian plants.Phytomedicine. 2003;10(6-7):528-35
|
| Curator | |
| Compound ID | 2646 |
| Compound Structure |  |
| Plant Source | Strobilanthes cusia Common Name: |
| Source Family | Acanthaceae |
| Origin | China, Taiwan |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Tryptanthrin |
| PubChem ID | 73549 |
| Ethnomedicinal Information | Has folkloric reputation for the topical treatment of athletes foot |
| PubMed ID [Source Literature] | 9828037 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Quinazolinone, Alkaloid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.059 |
| Molecular Formula | C15H8N2O2 |
| SMILES | O=C1c2n(c3c1cccc3)c(=O)c1c(n2)cccc1 |
| XLogP | 3.519 |
| PSA | 46.500 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Mitscher LA, Baker W.Tuberculosis: a search for novel therapy starting with natural products.Med Res Rev. 1998 Nov;18(6):363-74
2) L. A. Mitscher and W. R. Baker.A search for novel chemotherapy against tuberculosis amongst natural products.Pure Appl. Chem., 1998, Vol. 70, No. 2, pp. 365-371
|
| Curator | |
| Compound ID | 2647 |
| Compound Structure | |
| Plant Source | Strobilanthes cusia Common Name: |
| Source Family | Acanthaceae |
| Origin | China, Taiwan |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Tryptanthrin |
| PubChem ID | 73549 |
| Ethnomedicinal Information | Has folkloric reputation for the topical treatment of athletes foot |
| PubMed ID [Source Literature] | 9828037 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Quinazolinone, Alkaloid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.059 |
| Molecular Formula | C15H8N2O2 |
| SMILES | O=C1c2n(c3c1cccc3)c(=O)c1c(n2)cccc1 |
| XLogP | 3.519 |
| PSA | 46.500 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Mitscher LA, Baker W.Tuberculosis: a search for novel therapy starting with natural products.Med Res Rev. 1998 Nov;18(6):363-74
2) L. A. Mitscher and W. R. Baker.A search for novel chemotherapy against tuberculosis amongst natural products.Pure Appl. Chem., 1998, Vol. 70, No. 2, pp. 365-371
|
| Curator | |
| Compound ID | 2648 |
| Compound Structure | |
| Plant Source | Strobilanthes cusia Common Name: |
| Source Family | Acanthaceae |
| Origin | China, Taiwan |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium avium complex |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Tryptanthrin |
| PubChem ID | 73549 |
| Ethnomedicinal Information | Has folkloric reputation for the topical treatment of athletes foot |
| PubMed ID [Source Literature] | 9828037 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Quinazolinone, Alkaloid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.059 |
| Molecular Formula | C15H8N2O2 |
| SMILES | O=C1c2n(c3c1cccc3)c(=O)c1c(n2)cccc1 |
| XLogP | 3.519 |
| PSA | 46.500 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Mitscher LA, Baker W.Tuberculosis: a search for novel therapy starting with natural products.Med Res Rev. 1998 Nov;18(6):363-74
2) L. A. Mitscher and W. R. Baker.A search for novel chemotherapy against tuberculosis amongst natural products.Pure Appl. Chem., 1998, Vol. 70, No. 2, pp. 365-371
|
| Curator | |
| Compound ID | 3321 |
| Compound Structure | NR |
| Plant Source | Acanthus mollis Common Name:Acanto |
| Source Family | Acanthaceae |
| Origin | Spanish Mediterranean Area |
| Plant Part Used | Aerial |
| Extract | Methanol |
| Target Bacteria | Mycobacterium phlei (CECT 3009) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Gentamicin (10 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 1000 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Disinfectant, wound - healing, diuretic |
| PubMed ID [Source Literature] | 3325696 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | NR |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Reference(s) | 1) Ríos JL, Recio MC, Villar A.Antimicrobial activity of selected plants employed in the Spanish Mediterranean area.J Ethnopharmacol. 1987 Nov;21(2):139-52
|
| Curator | KeyaMukherjee, Najiya Beegum |
