| Compound ID | 1378 |
| Compound Structure | |
| Plant Source | Carpobrotus edulis L. Common Name:Sour Fig, Cape Fig, Hottentot Fig |
| Source Family | Aizoaceae |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | Water |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Microdilution Bioassays |
| Positive Control Used (conc.) | Streptomycin (0.750 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 4690 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diarrhoea, tuberculosis, burn wounds (applied externally), sores on the oral mucosa, thrush and ulcers |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) L. V. Buwa and A. J. Afolayan.Antimicrobial activity of some medicinal plants used for the treatment of tuberculosis in the Eastern Cape Province, South Africa.African Journal of Biotechnology Vol. 8 (23), pp. 6683-6687
2) http://www.plantzAfrica.com/medmonographs/carpobrotedu.pdf
|
| Curator | |
| Compound ID | 1379 |
| Compound Structure | |
| Plant Source | Carpobrotus edulis L. Common Name:Sour Fig, Cape Fig, Hottentot Fig |
| Source Family | Aizoaceae |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Microdilution Bioassays |
| Positive Control Used (conc.) | Streptomycin (0.750 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3125 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diarrhoea, tuberculosis, burn wounds (applied externally), sores on the oral mucosa, thrush and ulcers |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) L. V. Buwa and A. J. Afolayan.Antimicrobial activity of some medicinal plants used for the treatment of tuberculosis in the Eastern Cape Province, South Africa.African Journal of Biotechnology Vol. 8 (23), pp. 6683-6687
2) http://www.plantzAfrica.com/medmonographs/carpobrotedu.pdf
|
| Curator | |
| Compound ID | 1380 |
| Compound Structure | |
| Plant Source | Carpobrotus edulis L. Common Name:Sour Fig, Cape Fig, Hottentot Fig |
| Source Family | Aizoaceae |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Microdilution Bioassays |
| Positive Control Used (conc.) | Streptomycin (0.750 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6250 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diarrhoea and to treat tuberculosis and applied externally to burn wounds, sores or to the oral mucosa to treat thrush and ulcers |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) L. V. Buwa and A. J. Afolayan.Antimicrobial activity of some medicinal plants used for the treatment of tuberculosis in the Eastern Cape Province, South Africa.African Journal of Biotechnology Vol. 8 (23), pp. 6683-6687
2) http://www.plantzAfrica.com/medmonographs/carpobrotedu.pdf
|
| Curator | |
| Compound ID | 1381 |
| Compound Structure | |
| Plant Source | Carpobrotus mellei Common Name: |
| Source Family | Aizoaceae |
| Origin | Africa |
| Plant Part Used | Leaf juice |
| Extract | Ethyl acetate |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Disc Diffusion and Bioautography |
| Positive Control Used (conc.) | Ciprofloxacin (40 µg/Disc) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 15000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis, infections |
| PubMed ID [Source Literature] | 12834010 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Springfield EP, Amabeoku G, Weitz F, Mabusela W, Johnson Q. An assessment of two Carpobrotus species extracts as potential antimicrobial agents. Phytomedicine. 2003;10(5):434-9
|
| Curator | |
| Compound ID | 1382 |
| Compound Structure | |
| Plant Source | Carpobrotus mellei Common Name: |
| Source Family | Aizoaceae |
| Origin | Africa |
| Plant Part Used | Leaf juice |
| Extract | Water |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Disc Diffusion and Bioautography |
| Positive Control Used (conc.) | Ciprofloxacin (40 µg/Disc) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 30000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis, infections |
| PubMed ID [Source Literature] | 12834010 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Springfield EP, Amabeoku G, Weitz F, Mabusela W, Johnson Q. An assessment of two Carpobrotus species extracts as potential antimicrobial agents. Phytomedicine. 2003;10(5):434-9
|
| Curator | |
| Compound ID | 1781 |
| Compound Structure | |
| Plant Source | Galenia africana L. Common Name:Yellow Bush |
| Source Family | Aizoaceae |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Rapid Radiometric Method using BACTEC - 460 System |
| Positive Control Used (conc.) | Ciprofloxacin (0.156 mg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 780 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Chest pains, tuberculosis, asthma |
| PubMed ID [Source Literature] | 18412151 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mativandlela SP, Meyer JJ, Hussein AA, Houghton PJ, Hamilton CJ, Lall N.Activity against Mycobacterium smegmatis and M. tuberculosis by extract of South African medicinal plants.Phytother Res. 2008 Jun;22(6):841-5
|
| Curator | |
| Compound ID | 1782 |
| Compound Structure | |
| Plant Source | Galenia africana L. Common Name:Yellow bush |
| Source Family | Aizoaceae |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Rapid Radiometric Method using BACTEC - 460 System |
| Positive Control Used (conc.) | Ciprofloxacin (0.156 mg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Chest pains, tuberculosis, asthma |
| PubMed ID [Source Literature] | 18412151 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mativandlela SP, Meyer JJ, Hussein AA, Houghton PJ, Hamilton CJ, Lall N.Activity against Mycobacterium smegmatis and M. tuberculosis by extract of South African medicinal plants.Phytother Res. 2008 Jun;22(6):841-5
|
| Curator | |
| Compound ID | 1783 |
| Compound Structure |  |
| Plant Source | Galenia africana L. Common Name:Yellow Bush |
| Source Family | Aizoaceae |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | Hexane:Ethyl acetate |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Rapid Radiometric Method using BACTEC - 460 System |
| Positive Control Used (conc.) | Ciprofloxacin (0.156 mg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 31.2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 5, 7, 2` - Trihydroxyflavone |
| PubChem ID | 5322064 |
| Ethnomedicinal Information | Chest pains, tuberculosis, asthma |
| PubMed ID [Source Literature] | 18412151 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 270.053 |
| Molecular Formula | C15H10O5
|
| SMILES | O1c2c(c(=O)cc1c1c(O)cccc1)c(O)cc(O)c2 |
| XLogP | 1.337 |
| PSA | 77.760 |
| H-bond Donor | 3 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Mativandlela SP, Meyer JJ, Hussein AA, Houghton PJ, Hamilton CJ, Lall N.Activity against Mycobacterium smegmatis and M. tuberculosis by extract of South African medicinal plants.Phytother Res. 2008 Jun;22(6):841-5
|
| Curator | |
| Compound ID | 1784 |
| Compound Structure |  |
| Plant Source | Galenia africana L. Common Name:Yellow Bush |
| Source Family | Aizoaceae |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | Hexane:Ethyl acetate |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Rapid Radiometric Method using BACTEC - 460 System |
| Positive Control Used (conc.) | Isoniazid (0.2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 5, 7, 2` - Trihydroxyflavone |
| PubChem ID | 5322064 |
| Ethnomedicinal Information | Chest pains, tuberculosis, asthma |
| PubMed ID [Source Literature] | 18412151 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 270.053 |
| Molecular Formula | C15H10O5
|
| SMILES | O1c2c(c(=O)cc1c1c(O)cccc1)c(O)cc(O)c2 |
| XLogP | 1.337 |
| PSA | 77.760 |
| H-bond Donor | 3 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Mativandlela SP, Meyer JJ, Hussein AA, Houghton PJ, Hamilton CJ, Lall N.Activity against Mycobacterium smegmatis and M. tuberculosis by extract of South African medicinal plants.Phytother Res. 2008 Jun;22(6):841-5
|
| Curator | |