| Compound ID | 1169 |
| Compound Structure | |
| Plant Source | Ammi visnaga (L.) Lam. syn.aucus visnaga L. Common Name:Khella (English) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (human) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:40 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Kidney stones, renal colic, antispasmodic, vasodilators, random screening |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
|
| Curator | |
| Compound ID | 1183 |
| Compound Structure | |
| Plant Source | Angelica archangelica L Common Name:Chandaa, Chandaamshuka, Kathachoraa (Sanskrit) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India |
| Plant Part Used | Seed |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium smegmatis, Mycobacterium phlei |
| Assay / Test Done | Agar - Well Diffusion Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | 13 - 18 mm |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchial cold, expectorant |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
|
| Curator | |
| Compound ID | 1199 |
| Compound Structure | |
| Plant Source | Apium graveolens L. Common Name:Celery (English), Ajmodaa, Ajmoda, Ajmodikaa, Dipyaka (Sanskrit) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India |
| Plant Part Used | Leaf |
| Extract | Water |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Broth Dilution Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:40 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, asthma, chest pain, cough, anthelmintic, antifungal, fever, urinary calculi, obesity, musculoskeletal disorder, dropsy, chronic diarrhoea |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
2) http://parisaramahiti.kar.nic.in/Medicinal_plants_new/med%20plants/p18.html
|
| Curator | |
| Compound ID | 1200 |
| Compound Structure | |
| Plant Source | Apium graveolens L. Common Name:Celery (English), Ajmodaa, Ajmoda, Ajmodikaa, Dipyaka (Sanskrit) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India |
| Plant Part Used | N/A |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (human) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:40 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, asthma, chest pain, cough, anthelmintic, antifungal, fever, urinary calculi, obesity, musculoskeletal disorder, dropsy, chronic diarrhoea |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
2) http://parisaramahiti.kar.nic.in/Medicinal_plants_new/med%20plants/p18.html
|
| Curator | |
| Compound ID | 1201 |
| Compound Structure | |
| Plant Source | Apium graveolens L. Common Name:Celery (English), Ajmodaa, Ajmoda, Ajmodikaa, Dipyaka (Sanskrit) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Malaysia, Worldwide |
| Plant Part Used | Seed |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | 1:40 dilutions |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, asthma, chest pain, cough, anthelmintic, antifungal, fever, urinary calculi, obesity, musculoskeletal disorder, dropsy, chronic diarrhoea |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
2) http://parisaramahiti.kar.nic.in/Medicinal_plants_new/med%20plants/p18.html
|
| Curator | |
| Compound ID | 1202 |
| Compound Structure | |
| Plant Source | Apium graveolens L. Common Name:Celery (English), Ajmodaa, Ajmoda, Ajmodikaa, Dipyaka (Sanskrit) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Malaysia, Worldwide |
| Plant Part Used | Seed |
| Extract | Methanol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | 1:40 dilutions |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, asthma, chest pain, cough, anthelmintic, antifungal, fever, urinary calculi, obesity, musculoskeletal disorder, dropsy, chronic diarrhoea |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
2) http://parisaramahiti.kar.nic.in/Medicinal_plants_new/med%20plants/p18.html
|
| Curator | |
| Compound ID | 1203 |
| Compound Structure | |
| Plant Source | Apium graveolens L. Common Name:Celery (English), Ajmodaa, Ajmoda, Ajmodikaa, Dipyaka (Sanskrit) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Malaysia, Worldwide |
| Plant Part Used | Leaf |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Colorimetric Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Isoniazid (0.078 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, asthma, chest pain, cough, anthelmintic, antifungal, fever, urinary calculi, obesity, musculoskeletal disorder, dropsy, chronic diarrhoea |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Chooi, O.H., 2003. Sayuran, Khasiat Makanan dan Ubatan. Utusan Publications and Distributors Sdn Bhd, Kuala Lumpur, Malaysia
2) http://parisaramahiti.kar.nic.in/Medicinal_plants_new/med%20plants/p18.html
|
| Curator | |
| Compound ID | 1409 |
| Compound Structure | |
| Plant Source | Centella asiatica (L.) Urban Common Name:Asiatic Pennywort, Indian Pennywort (English), Mandukaparni, Mandukaparnikaa (Sanskrit) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Malaysia, India |
| Plant Part Used | Whole plant |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Colorimetric Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Isoniazid (0.078 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1600 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Asthma, treatment of leprosy and skin diseases |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Anonymous, 2010d. Mai-herbs and their Benefits (Available at: http://mai-cafe.com/pmaiherbs.php (accessed 21.03.10))
2) http://www.himalayahealthcare.com/herbfinder/h_centel.htm
|
| Curator | |
| Compound ID | 1410 |
| Compound Structure | |
| Plant Source | Centella asiatica (L.) Urban Common Name:Asiatic Pennywort, Indian Pennywort (English), Mandukaparni, Mandukaparnikaa (Sanskrit) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Malaysia, India |
| Plant Part Used | Whole plant |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Asthma, treatment of leprosy and skin diseases |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) http://www.himalayahealthcare.com/herbfinder/h_centel.htm
|
| Curator | |
| Compound ID | 1411 |
| Compound Structure | |
| Plant Source | Centella asiatica (L.) Urban Common Name:Asiatic Pennywort, Indian Pennywort (English), Mandukaparni, Mandukaparnikaa (Sanskrit) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Malaysia, India |
| Plant Part Used | Whole plant |
| Extract | Methanol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Asthma, treatment of leprosy and skin diseases |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) http://www.himalayahealthcare.com/herbfinder/h_centel.htm
|
| Curator | |
| Compound ID | 1447 |
| Compound Structure | |
| Plant Source | Cicuta virosa L Common Name:Water Hemlock (English) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (human) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:40 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Spasmodic, random screening |
| PubMed ID [Source Literature] | 2118130 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Grange JM, Davey RW.Detection of antituberculous activity in plant extracts.J Appl Bacteriol. 1990 Jun;68(6):587-91
2) Anon., 1986. The Useful Plants of India. Council of Scientific and Industrial Research, New Delhi, India
|
| Curator | |
| Compound ID | 1592 |
| Compound Structure | |
| Plant Source | Daucus carota L. Common Name:Carrot (English), Gaajara, Garjara, Granjana (Sanskrit) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India |
| Plant Part Used | Leaf |
| Extract | Water |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Broth Dilution Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | < 1:20 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Leprosy, asthma, expectorant, chest troubles, bronchitis |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 14. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1738 |
| Compound Structure |  |
| Plant Source | Ferula communis Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Saudi Arabia |
| Plant Part Used | Rhizome |
| Extract | |
| Target Bacteria | Mycobacterium intracellulare |
| Assay / Test Done | |
| Positive Control Used (conc.) | Amikacin (0.25 µg/ml), Streptomycin (10 µg/ml), Isoniazid (10 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ferulenol |
| PubChem ID | 54679300 |
| Ethnomedicinal Information | Anti-mycobacterial |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 366.219 |
| Molecular Formula | C24H30O3
|
| SMILES | O1c2c(c(O)c(C/C=C(/CC/C=C(/CCC=C(C)C)C)C)c1=O)cccc2 |
| XLogP | 8.182 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Mohammed A. Al-Yahya, Ilias Muhammad, Humayun H. Mirza, Farouk S. El-Feraly.Antibacterial constituents from the rhizomes of Ferula communis.Phytotherapy Research.12/1998;12(5):335-339
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Ferula+communis
|
| Curator | |
| Compound ID | 1739 |
| Compound Structure |  |
| Plant Source | Ferula communis Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Saudi Arabia |
| Plant Part Used | Rhizome |
| Extract | |
| Target Bacteria | Mycobacterium intracellulare |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ferchromone |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Terpene, Sesquiterpene, Chromone, Prenylated, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 384.230 |
| Molecular Formula | C24H32O4
|
| SMILES | C1c2c(ccc1)OC1C(C2=O)CC([C@@](O1)(CC/C=C(/CCC=C(C)C)C)C)O |
| XLogP | 5.430 |
| PSA | 55.760 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Mohammed A. Al-Yahya, Ilias Muhammad, Humayun H. Mirza, Farouk S. El-Feraly.Antibacterial constituents from the rhizomes of Ferula communis.Phytotherapy Research.12/1998;12(5):335-339
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Ferula+communis
|
| Curator | |
| Compound ID | 1763 |
| Compound Structure | |
| Plant Source | Foeniculum vulgare Mill. Common Name:Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Pakistan, Mediterranean region, Mexico, Africa |
| Plant Part Used | Seed |
| Extract | Methanol (13.26 %) |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diseases of the chest, cough, fever, respiratory diseases, digestion, over - weight, boosting metabolism as well as for stomach cramps |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) http://www.ageless.co.za/fennel.htm
|
| Curator | |
| Compound ID | 1764 |
| Compound Structure | |
| Plant Source | Foeniculum vulgare Mill. Common Name:Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Pakistan, Mediterranean region, Mexico,Africa |
| Plant Part Used | Seed |
| Extract | Methanol (13.26 %) |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diseases of the chest, cough, fever, respiratory diseases,digestion, over - weight, boosting metabolism as well as for stomach cramps |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) http://www.ageless.co.za/fennel.htm
|
| Curator | |
| Compound ID | 1765 |
| Compound Structure | |
| Plant Source | Foeniculum vulgare Mill. Common Name:Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Pakistan, Mediterranean region,Mexico,Africa |
| Plant Part Used | Aerial |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Sensitive) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diseases of the chest, cough, fever, respiratory diseases,digestion, over - weight, boosting metabolism as well as for stomach cramps |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.ageless.co.za/fennel.htm
|
| Curator | |
| Compound ID | 1766 |
| Compound Structure | |
| Plant Source | Foeniculum vulgare Mill. Common Name:Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Pakistan, Mediterranean region, Mexico, Africa |
| Plant Part Used | Aerial |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Rifampin resistant), Mycobacterium tuberculosis (Isoniazid resistant), Mycobacterium tuberculosis (Streptomycin resistant), Mycobacterium tuberculosis (Ethambutol resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diseases of the chest, cough, fever, respiratory diseases,digestion, over - weight, boosting metabolism as well as for stomach cramps |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.ageless.co.za/fennel.htm
|
| Curator | |
| Compound ID | 1767 |
| Compound Structure | |
| Plant Source | Foeniculum vulgare Mill. Common Name:Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Pakistan, Mediterranean region, Mexico, Africa |
| Plant Part Used | Aerial |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Sensitive) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diseases of the chest, cough, fever, respiratory diseases,digestion, over - weight, boosting metabolism as well as for stomach cramps |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.ageless.co.za/fennel.htm
|
| Curator | |
| Compound ID | 1768 |
| Compound Structure | |
| Plant Source | Foeniculum vulgare Mill. Common Name:Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Pakistan, Mediterranean region, Mexico, Africa |
| Plant Part Used | Aerial |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Rifampin resistant), Mycobacterium tuberculosis (Isoniazid resistant), Mycobacterium tuberculosis (Streptomycin resistant), Mycobacterium tuberculosis (Ethambutol resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diseases of the chest, cough, fever, respiratory diseases, digestion, over - weight, boosting metabolism as well as for stomach cramps |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.ageless.co.za/fennel.htm
|
| Curator | |
| Compound ID | 1769 |
| Compound Structure | |
| Plant Source | Foeniculum vulgare Mill. Common Name:Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Pakistan, Mediterranean region, Mexico,Africa |
| Plant Part Used | Aerial |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Sensitive) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diseases of the chest, cough, fever, respiratory diseases, digestion, over - weight, boosting metabolism as well as for stomach cramps |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.ageless.co.za/fennel.htm
|
| Curator | |
| Compound ID | 1770 |
| Compound Structure | |
| Plant Source | Foeniculum vulgare Mill. Common Name:Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Pakistan, Mediterranean region, Mexico, Africa |
| Plant Part Used | Aerial |
| Extract | Water |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Sensitive) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.06 µg/ml), Isoniazid (0.06 µg/ml), Ethambutol (0.50 µg/ml), Rifampin (2.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diseases of the chest, cough, fever, respiratory diseases, digestion, over - weight, boosting metabolism as well as for stomach cramps |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://www.ageless.co.za/fennel.htm
|
| Curator | |
| Compound ID | 1771 |
| Compound Structure | |
| Plant Source | Foeniculum vulgare Mill. Common Name:Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Pakistan, Mediterranean region, Mexico, Africa |
| Plant Part Used | Fruit |
| Extract | Essential oil |
| Target Bacteria | |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diseases of the chest, cough, fever, respiratory diseases, digestion, over - weight, boosting metabolism as well as for stomach cramps |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Bruneton, J. 1995. Pharmacognosy, phytochemistry, medicinal plants. Intercept Ltd., Andover, Hampshire, England
2) Grieve, M. 1967. A modern herbal. Hafner Publishing Co., New York, Dictionary of Natural Products (2003). CD-ROM. London: Chapman & Hall/CRC, http://plants.usda.gov/java/profile?symbol=FOVU
3) http://www.ageless.co.za/fennel.htm
|
| Curator | |
| Compound ID | 1808 |
| Compound Structure | |
| Plant Source | Glehnia littoris F. Schmidt ssp Leiocarpa (Mathias) Hult. Common Name:Beach Silvertop, American Silvertop |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | British Columbia |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | Isoniazid |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 50 µg extract/Disc |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) A.R. McCutcheon, R.W. Stokes, L.M. Thorson, S.M. Ellis, R.E.W. Hancock and G.H.N. Towers.Anti-Mycobacterial Screening of British Columbian Medicinal Plants.Pharmaceutical Biology, 1997, Vol. 35, No. 2 , Pages 77-83
2) http://netartsbaytoday.org/html/white_flowers.html
|
| Curator | |
| Compound ID | 1863 |
| Compound Structure | |
| Plant Source | Heracleum maximum Bartr. Common Name:Common Cowparsnip |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | British Columbia |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | Isoniazid |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 50 µg extract/Disc |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Colic, cramps, headaches, sore throats, colds, coughs and flu, poultices used for sores, bruises, swelling, rheumatic joints and boils or other skin eruptions |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) A.R. McCutcheon, R.W. Stokes, L.M. Thorson, S.M. Ellis, R.E.W. Hancock and G.H.N. Towers.Anti-Mycobacterial Screening of British Columbian Medicinal Plants.Pharmaceutical Biology, 1997, Vol. 35, No. 2 , Pages 77-83
2) http://www.ionxchange.com/products/HERACLEUM-MAXIMUM-|-Cow-Parnsip.html
|
| Curator | |