| Compound ID | 1205 |
| Compound Structure | |
| Plant Source | Areca catechu L. Common Name:Arecanut, Betel Nut (English), Puuga, Puugi, Kramuka, Ghontaa, Guwaak, Ghorant (Sanskrit) |
| Source Family | Arecaceae (Palmae) |
| Origin | India, Malaysia |
| Plant Part Used | Mother tinture |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (human) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:40 dilutions |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, diuretic, digestive, small pox, dysentery, colic, cholera, leucorrhoea, random screening, cough and sore throat |
| PubMed ID [Source Literature] | 2118130 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Grange JM, Davey RW.Detection of antituberculous activity in plant extracts.J Appl Bacteriol. 1990 Jun;68(6):587-91
2) http://www.filipinoherbshealingwonders.filipinovegetarianrecipe.com/bunga.htm
|
| Curator | |
| Compound ID | 1206 |
| Compound Structure | |
| Plant Source | Areca catechu L. Common Name:Arecanut, Betel Nut (English), Puuga, Puugi, Kramuka, Ghontaa, Guwaak, Ghorant (Sanskrit) |
| Source Family | Arecaceae (Palmae) |
| Origin | India, Malaysia |
| Plant Part Used | Fruit |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Colorimetric Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Isoniazid (0.078 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, diuretic, digestive, small pox, dysentery, colic, cholera, leucorrhoea, random screening, cough and sore throat |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mohamad, S.R., Sintoh, M., 1999. Tinjauan kegunaan ubat-ubatan tradisional di Tamu terpilih di Sabah, Universiti Malaysia Sabah (Available at: http://rumahtani.multiply.com/journal/item/31/SENARAI TUMBUHAN UBATAN)
2) http://www.filipinoherbshealingwonders.filipinovegetarianrecipe.com/bunga.htm
|
| Curator | |
| Compound ID | 1232 |
| Compound Structure | |
| Plant Source | Bactris brongniartii Mart. Common Name: |
| Source Family | Arecaceae (Palmae) |
| Origin | Peru |
| Plant Part Used | Bark |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis (ATCC 27294) |
| Assay / Test Done | BACTEC 460 (Becton Dickinson Diagnostic Instrument Systems, Sparks MD) Radiometric Assay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Ethambutol (7.5 µg/ml) |
| Inhibition [%] | < 50 % |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 13678239 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Graham JG, Pendland SL, Prause JL, Danzinger LH, Schunke Vigo J, Cabieses F, Farnsworth NR.Antimycobacterial evaluation of Peruvian plants.Phytomedicine. 2003;10(6-7):528-35
|
| Curator | |
| Compound ID | 1426 |
| Compound Structure | |
| Plant Source | Chamaedora tepejilote Common Name:Pacaya Palm |
| Source Family | Arecaceae (Palmae) |
| Origin | Mexico |
| Plant Part Used | Leaf |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Radiorespirometric BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, Pneumonia |
| PubMed ID [Source Literature] | 16041726 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Jiménez A, Meckes M, Alvarez V, Torres J, Parra R. Secondary metabolites from Chamaedora tepejilote (Palmae) are active against Mycobacterium tuberculosis.Phytother Res. 2005 Apr;19(4):320-2
|
| Curator | |
| Compound ID | 1427 |
| Compound Structure | |
| Plant Source | Chamaedora tepejilote Common Name:Pacaya Palm |
| Source Family | Arecaceae (Palmae) |
| Origin | Mexico |
| Plant Part Used | Leaf |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Radiorespirometric BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, Pneumonia |
| PubMed ID [Source Literature] | 16041726 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Jiménez A, Meckes M, Alvarez V, Torres J, Parra R. Secondary metabolites from Chamaedora tepejilote (Palmae) are active against Mycobacterium tuberculosis.Phytother Res. 2005 Apr;19(4):320-2
|
| Curator | |
| Compound ID | 1428 |
| Compound Structure |  |
| Plant Source | Chamaedora tepejilote Common Name:Pacaya Palm |
| Source Family | Arecaceae (Palmae) |
| Origin | Mexico |
| Plant Part Used | Leaf |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Radiorespirometric BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | 99 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ursolic acid |
| PubChem ID | 64945 |
| Ethnomedicinal Information | Cough, Pneumonia |
| PubMed ID [Source Literature] | 16041726 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CC[C@H]([C@@H]3C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 8.954 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Jiménez A, Meckes M, Alvarez V, Torres J, Parra R. Secondary metabolites from Chamaedora tepejilote (Palmae) are active against Mycobacterium tuberculosis.Phytother Res. 2005 Apr;19(4):320-2
|
| Curator | |
| Compound ID | 1429 |
| Compound Structure |  |
| Plant Source | Chamaedora tepejilote Common Name:Pacaya Palm |
| Source Family | Arecaceae (Palmae) |
| Origin | Mexico |
| Plant Part Used | Leaf |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Radiorespirometric BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | 99 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Squalene |
| PubChem ID | 638072 |
| Ethnomedicinal Information | Cough, Pneumonia |
| PubMed ID [Source Literature] | 16041726 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Terpene, Triterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 410.391 |
| Molecular Formula | C30H50
|
| SMILES | C(C/C=C(/CCC=C(C)C)C)/C(=C/CC/C=C(/CC/C=C(/CCC=C(C)C)C)C)/C |
| XLogP | 11.482 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 15 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Jiménez A, Meckes M, Alvarez V, Torres J, Parra R. Secondary metabolites from Chamaedora tepejilote (Palmae) are active against Mycobacterium tuberculosis.Phytother Res. 2005 Apr;19(4):320-2
|
| Curator | |
| Compound ID | 1430 |
| Compound Structure |  |
| Plant Source | Chamaedora tepejilote Common Name:Pacaya Palm |
| Source Family | Arecaceae (Palmae) |
| Origin | Mexico |
| Plant Part Used | Leaf |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Radiorespirometric BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | 99 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Farnesol |
| PubChem ID | 445070 |
| Ethnomedicinal Information | Cough, Pneumonia |
| PubMed ID [Source Literature] | 16041726 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Terpene, Sesquiterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 222.198 |
| Molecular Formula | C15H26O
|
| SMILES | OC/C=C(/CC/C=C(/CCC=C(C)C)C)C |
| XLogP | 4.346 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Jiménez A, Meckes M, Alvarez V, Torres J, Parra R. Secondary metabolites from Chamaedora tepejilote (Palmae) are active against Mycobacterium tuberculosis.Phytother Res. 2005 Apr;19(4):320-2
|
| Curator | |
| Compound ID | 1502 |
| Compound Structure | |
| Plant Source | Cocos nucifera L. Common Name:Coconut Tree (English), Narekela, Sadaphala, Trinadruma, Dridhaphala (Sanskrit) |
| Source Family | Arecaceae (Palmae) |
| Origin | Malaysia |
| Plant Part Used | Leaf |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Colorimetric Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Isoniazid (0.078 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Ong Hean Chooi 2004. Buah: Khasiat Makanan & Ubatan. Utusan Publications and Distributors, Kuala Lumpur, Malaysia
2) http://ayurvedicmedicinalplants.com/index.php?option=com_zoom&Itemid=26&page=view&catid=43&key=9&hit=1
|
| Curator | |
| Compound ID | 2042 |
| Compound Structure | |
| Plant Source | Licuala spinosa Thunb. Common Name:Spiny Licuala Palm, Mangrove Fan Palm, Good Luck Palm (English) |
| Source Family | Arecaceae (Palmae) |
| Origin | Malaysia |
| Plant Part Used | Leaf |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Colorimetric Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Isoniazid (0.078 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1600 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 21094237 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mohamad S, Zin NM, Wahab HA, Ibrahim P, Sulaiman SF, Zahariluddin AS, Noor SS.Antituberculosis potential of some ethnobotanically selected Malaysian plants.J Ethnopharmacol. 2011 Feb 16;133(3):1021-6
2) http://www.impgc.com/plantinfo_A.php?id=2384
|
| Curator | |
| Compound ID | 2266 |
| Compound Structure | |
| Plant Source | Oenocarpus batahua C. Mart. Common Name: |
| Source Family | Arecaceae (Palmae) |
| Origin | Peru |
| Plant Part Used | Pedicel |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis (ATCC 27294) |
| Assay / Test Done | BACTEC 460 (Becton Dickinson Diagnostic Instrument Systems, Sparks MD) Radiometric Assay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml) and Ethambutol (7.5 µg/ml) |
| Inhibition [%] | < 50 % |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 13678239 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Graham JG, Pendland SL, Prause JL, Danzinger LH, Schunke Vigo J, Cabieses F, Farnsworth NR.Antimycobacterial evaluation of Peruvian plants.Phytomedicine. 2003;10(6-7):528-35
|
| Curator | |