| Compound ID | 1207 |
| Compound Structure | |
| Plant Source | Aristolochia cauliflora Ule Common Name: |
| Source Family | Aristolochiaceae |
| Origin | Peru |
| Plant Part Used | Stem |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis (ATCC 27294) |
| Assay / Test Done | BACTEC 460 (Becton Dickinson Diagnostic Instrument Systems, Sparks MD) Radiometric Assay |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml) and Ethambutol (7.5 µg/ml) |
| Inhibition [%] | 81 % |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 13678239 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Graham JG, Pendland SL, Prause JL, Danzinger LH, Schunke Vigo J, Cabieses F, Farnsworth NR.Antimycobacterial evaluation of Peruvian plants.Phytomedicine. 2003;10(6-7):528-35
|
| Curator | |
| Compound ID | 2864 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 35837) (Ethambutol resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Eupomatenoid 7 |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 L of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | C1c(cc(c2c1c(c(o2)c1cc(c(cc1)O)OC)C)OC)/C=C/C |
| XLogP | 4.461 |
| PSA | 51.830 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2865 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 L of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2866 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 35822) (Isoniazid resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 L of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2867 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 35838) (Rifampin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 L of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2868 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 35820) (Streptomycin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 L of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2869 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 35837) (Ethambutol resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 L of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2870 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (Clinical isolate MMDO) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 L of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2871 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY650) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2872 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY663) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2873 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY675) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2874 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY282) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2875 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (Clinical isolate HG8) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2876 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (Clinical isolate SIN3) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2877 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY234) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2878 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY112) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2879 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY559) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2880 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (Clinical isolate SIN4) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4 |
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2881 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY172) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4 |
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | |
| Compound ID | 2883 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Eupomatenoid 7 |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | C1c(cc(c2c1c(c(o2)c1cc(c(cc1)O)OC)C)OC)/C=C/C |
| XLogP | 4.461 |
| PSA | 51.830 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2884 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 35822) (Isoniazid resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Eupomatenoid 7 |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | C1c(cc(c2c1c(c(o2)c1cc(c(cc1)O)OC)C)OC)/C=C/C |
| XLogP | 4.461 |
| PSA | 51.830 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2885 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 35838) (Rifampin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Eupomatenoid 7 |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | C1c(cc(c2c1c(c(o2)c1cc(c(cc1)O)OC)C)OC)/C=C/C |
| XLogP | 4.461 |
| PSA | 51.830 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2886 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 35820) (Streptomycin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Eupomatenoid 7 |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | C1c(cc(c2c1c(c(o2)c1cc(c(cc1)O)OC)C)OC)/C=C/C |
| XLogP | 4.461 |
| PSA | 51.830 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2887 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (Clinical isolate MMDO) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Eupomatenoid 7 |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | C1c(cc(c2c1c(c(o2)c1cc(c(cc1)O)OC)C)OC)/C=C/C |
| XLogP | 4.461 |
| PSA | 51.830 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2888 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY650) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Eupomatenoid 7 |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Furanoid, Alkene, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | C1c(cc(c2c1c(c(o2)c1cc(c(cc1)O)OC)C)OC)/C=C/C |
| XLogP | 4.461 |
| PSA | 51.830 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |