| Compound ID | 1031 |
| Compound Structure | |
| Plant Source | Achillea biebersteinii Afan Common Name:Yarrow |
| Source Family | Asteraceae (Compositae) |
| Origin | Turkey |
| Plant Part Used | Aerial |
| Extract | Ethanol (70 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.0047 0.0095 µg/ml), Isoniazid (0.05 0.1 µg/ml), Kanamycin (2.5 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Used for diarrhea, abdominal pain, stomach ache and healing of wounds in folk medicine |
| PubMed ID [Source Literature] | 15507348 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Tosun F, Kizilay CA, Sener B, Vural M, Palittapongarnpim P.Antimycobacterial screening of some Turkish plants.J Ethnopharmacol. 2004 Dec;95(2-3):273-5
2) Akkol EK, Koca U, Pesin I, Yilmazer D.Evaluation of the Wound Healing Potential of Achillea biebersteinii Afan. (Asteraceae) by In Vivo Excision and Incision Models.Evid Based Complement Alternat Med. 2011;2011:474026
|
| Curator | |
| Compound ID | 1032 |
| Compound Structure | |
| Plant Source | Achillea millefolium L. Common Name:Yarrow (English), Brinjasipha (Sanskrit) |
| Source Family | Asteraceae (Compositae) |
| Origin | Mexico, India |
| Plant Part Used | Aerial |
| Extract | Hexane, methanol |
| Target Bacteria | |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, tuberculosis, colds, flu, fever, astringent |
| PubMed ID [Source Literature] | 13680821 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Jimenez-Arellanes A, Meckes M, Ramirez R, Torres J, Luna-Herrera J. Activity against multidrug-resistant Mycobacterium tuberculosis in Mexican plants used to treat respiratory diseases. Phytother Res. 2003 Sep;17(8):903-8
2) http://plants.usda.gov/java/profile?symbol=ACMI2
|
| Curator | |
| Compound ID | 1033 |
| Compound Structure | |
| Plant Source | Achillea millefolium L. Common Name:Yarrow (English), Brinjasipha (Sanskrit) |
| Source Family | Asteraceae (Compositae) |
| Origin | Mexico, India |
| Plant Part Used | Flower, leaf |
| Extract | Water |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Broth Dilution Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | < 1:20 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, tuberculosis, colds, flu, fever, astringent |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
|
| Curator | |
| Compound ID | 1034 |
| Compound Structure | |
| Plant Source | Achillea nobilis L. ssp. neilreichii (Kerner) Form΄anek Common Name: |
| Source Family | Asteraceae (Compositae) |
| Origin | Turkey |
| Plant Part Used | Aerial |
| Extract | Ethanol (70 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.0047 0.0095 µg/ml), Isoniazid (0.05 0.1 µg/ml), Kanamycin (2.5 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 15507348 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Tosun F, Kizilay CA, Sener B, Vural M, Palittapongarnpim P.Antimycobacterial screening of some Turkish plants.J Ethnopharmacol. 2004 Dec;95(2-3):273-5
|
| Curator | |
| Compound ID | 1035 |
| Compound Structure | |
| Plant Source | Achillea wilhelmsii C. Koch Common Name: |
| Source Family | Asteraceae (Compositae) |
| Origin | Turkey |
| Plant Part Used | Aerial |
| Extract | Ethanol (70 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.0047 0.0095 µg/ml), Isoniazid (0.05 0.1 µg/ml), Kanamycin (2.5 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 15507348 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Tosun F, Kizilay CA, Sener B, Vural M, Palittapongarnpim P.Antimycobacterial screening of some Turkish plants.J Ethnopharmacol. 2004 Dec;95(2-3):273-5
|
| Curator | |
| Compound ID | 1079 |
| Compound Structure | |
| Plant Source | Ageratum conyzoides L. Common Name:Ageratum, Billy Goat Weed, Blue Flowered Groundsel, Blue Top (English) |
| Source Family | Asteraceae (Compositae) |
| Origin | Malaysia |
| Plant Part Used | Whole plant |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Colorimetric Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Isoniazid (0.078 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1600 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Anonymous, 2010a. Traditional Malay Poisons, Available at: http://www.prn.usm.my/old website/mainsite/plant/plant.html (accessed 30.20.09)
2) http://www.ars-grin.gov/cgi-bin/npgs/html/taxon.pl?103793
|
| Curator | |
| Compound ID | 1080 |
| Compound Structure | |
| Plant Source | Ageratum corimbosum Common Name:Flat - Top Whiteweed |
| Source Family | Asteraceae (Compositae) |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | Hexane, methanol |
| Target Bacteria | |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough |
| PubMed ID [Source Literature] | 13680821 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Jimenez-Arellanes A, Meckes M, Ramirez R, Torres J, Luna-Herrera J. Activity against multidrug-resistant Mycobacterium tuberculosis in Mexican plants used to treat respiratory diseases. Phytother Res. 2003 Sep;17(8):903-8
|
| Curator | |
| Compound ID | 1166 |
| Compound Structure | |
| Plant Source | Ambrosia peruviana Willd Common Name:Peruvian Ragweed |
| Source Family | Asteraceae (Compositae) |
| Origin | Peru |
| Plant Part Used | Stem |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis (ATCC 27294) |
| Assay / Test Done | BACTEC 460 (Becton Dickinson Diagnostic Instrument Systems, Sparks MD) radiometric assay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Ethambutol (7.5 µg/ml) |
| Inhibition [%] | 81 % |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 13678239 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Graham JG, Pendland SL, Prause JL, Danzinger LH, Schunke Vigo J, Cabieses F, Farnsworth NR.Antimycobacterial evaluation of Peruvian plants.Phytomedicine. 2003;10(6-7):528-35
|
| Curator | |
| Compound ID | 1167 |
| Compound Structure | |
| Plant Source | Ambrosia peruviana Willd Common Name: |
| Source Family | Asteraceae (Compositae) |
| Origin | Peru |
| Plant Part Used | Leaf and flower |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis (ATCC 27294) |
| Assay / Test Done | BACTEC 460 (Becton Dickinson Diagnostic Instrument Systems, Sparks MD) Radiometric Assay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Ethambutol (7.5 µg/ml) |
| Inhibition [%] | 58 % |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 13678239 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Graham JG, Pendland SL, Prause JL, Danzinger LH, Schunke Vigo J, Cabieses F, Farnsworth NR.Antimycobacterial evaluation of Peruvian plants.Phytomedicine. 2003;10(6-7):528-35
|
| Curator | |
| Compound ID | 1204 |
| Compound Structure | |
| Plant Source | Arctotis auriculata Jacq. Common Name: |
| Source Family | Asteraceae (Compositae) |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | Petroleum ether |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Infectious diseases |
| PubMed ID [Source Literature] | 8733116 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Salie F, Eagles PF, Leng HM.Preliminary antimicrobial screening of four South African Asteraceae species.J Ethnopharmacol. 1996 May;52(1):27-33
|
| Curator | |
| Compound ID | 1209 |
| Compound Structure | |
| Plant Source | Artemisia absinthium L. Common Name:Wormwood, Maderwood, Absinthe (English), Indhana, Damar (Sanskrit) |
| Source Family | Asteraceae (Compositae) |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (human) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Chronic fever, swellings, inflammation of liver, rheumatism, wounds, dandruff, vermifuge, random screening |
| PubMed ID [Source Literature] | 2118130 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Grange JM, Davey RW.Detection of antituberculous activity in plant extracts.J Appl Bacteriol. 1990 Jun;68(6):587-91
|
| Curator | |
| Compound ID | 1210 |
| Compound Structure | |
| Plant Source | Artemisia afra Jacq. ex Willd. Common Name:Wild Wormwood |
| Source Family | Asteraceae (Compositae) |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Radiometric assay using BACTEC 460 system |
| Positive Control Used (conc.) | Ciprofloxacin (0.156 mg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1563 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Coughs, colds, fever, loss of appetite, chest pains |
| PubMed ID [Source Literature] | 18412151 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mativandlela SP, Meyer JJ, Hussein AA, Houghton PJ, Hamilton CJ, Lall N.Activity against Mycobacterium smegmatis and M. tuberculosis by extract of South African medicinal plants.Phytother Res. 2008 Jun;22(6):841-5
|
| Curator | |
| Compound ID | 1211 |
| Compound Structure | |
| Plant Source | Artemisia afra Jacq. ex Willd. Common Name:Wild Wormwood |
| Source Family | Asteraceae (Compositae) |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | Water |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Radiometric assay using BACTEC 460 system |
| Positive Control Used (conc.) | Ciprofloxacin (0.156 mg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1563 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Coughs, colds, fever, loss of appetite, chest pains |
| PubMed ID [Source Literature] | 18412151 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mativandlela SP, Meyer JJ, Hussein AA, Houghton PJ, Hamilton CJ, Lall N.Activity against Mycobacterium smegmatis and M. tuberculosis by extract of South African medicinal plants.Phytother Res. 2008 Jun;22(6):841-5
|
| Curator | |
| Compound ID | 1212 |
| Compound Structure | |
| Plant Source | Artemisia afra Jacq. ex Willd. Common Name:Wild Wormwood |
| Source Family | Asteraceae (Compositae) |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Radiometric assay using BACTEC 460 system |
| Positive Control Used (conc.) | Ciprofloxacin (0.156 mg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3125 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Coughs, colds, fever, loss of appetite, chest pains |
| PubMed ID [Source Literature] | 18412151 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mativandlela SP, Meyer JJ, Hussein AA, Houghton PJ, Hamilton CJ, Lall N.Activity against Mycobacterium smegmatis and M. tuberculosis by extract of South African medicinal plants.Phytother Res. 2008 Jun;22(6):841-5
|
| Curator | |
| Compound ID | 1213 |
| Compound Structure | |
| Plant Source | Artemisia afra Jacq. ex Willd. Common Name:Wild Wormwood |
| Source Family | Asteraceae (Compositae) |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Radiometric assay using BACTEC 460 system |
| Positive Control Used (conc.) | Ciprofloxacin (0.156 mg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3125 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Coughs, colds, fever, loss of appetite, chest pains |
| PubMed ID [Source Literature] | 18412151 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mativandlela SP, Meyer JJ, Hussein AA, Houghton PJ, Hamilton CJ, Lall N.Activity against Mycobacterium smegmatis and M. tuberculosis by extract of South African medicinal plants.Phytother Res. 2008 Jun;22(6):841-5
|
| Curator | |
| Compound ID | 1214 |
| Compound Structure | |
| Plant Source | Artemisia ludoviciana Common Name:White Sagebrush |
| Source Family | Asteraceae (Compositae) |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | Hexane, methanol |
| Target Bacteria | |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, Pneumonia |
| PubMed ID [Source Literature] | 13680821 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Jimenez-Arellanes A, Meckes M, Ramirez R, Torres J, Luna-Herrera J. Activity against multidrug-resistant Mycobacterium tuberculosis in Mexican plants used to treat respiratory diseases. Phytother Res. 2003 Sep;17(8):903-8
2) http://plants.usda.gov/java/profile?symbol=ARLU
|
| Curator | |
| Compound ID | 1215 |
| Compound Structure | |
| Plant Source | Artemisia scoparia Waldst. & Kit Common Name:Red Stem Wormwood (English) |
| Source Family | Asteraceae (Compositae) |
| Origin | India |
| Plant Part Used | Whole plant |
| Extract | Ethanol (80 %) |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Agar Dilution - Streak Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | Partial |
| Activity [MIC] µg/ml | 1563 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Earache, purgative, used in herbal medicine for diseases |
| PubMed ID [Source Literature] | 541687 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Al-Shamma A, Mitscher LA.Comprehensive survey of indigenous Iraqi plants for potential economic value. 1. Screening results of 327 species for alkaloids and antimicrobial agents.J Nat Prod. 1979 Nov-Dec;42(6):633-42
2) Sudhanshu Kumar Jain.Dictionary of Indian Folk Medicine and Ethnobotany:A Reference Manual of Man-Plant Relationships, Ethnic Groups & Ethnobotanists in India.Deep Publications, 1991 - 311 pages
|
| Curator | |
| Compound ID | 1217 |
| Compound Structure | |
| Plant Source | Articun lappa Common Name:Burdock |
| Source Family | Asteraceae (Compositae) |
| Origin | Brazil |
| Plant Part Used | Leaf |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.015 - 0.05 µg/ml) |
| Inhibition [%] | 90 % |
| Activity [MIC] µg/ml | 4000 µg/ml |
| Activity (In terms of dilution) | 1:25 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Pavan FR, Sato DN, Higuchi CT, Santos ACB, Vilegas W, Leite CQE 2009. In vitro anti-Mycobacterium tuberculosis activity of some Brazilian "Cerrado" plants. Rev Bras Farmacogn 19: 204-206
|
| Curator | |
| Compound ID | 1256 |
| Compound Structure | |
| Plant Source | Bidens pilosa L. Common Name:Hairy Beggarticks (English) |
| Source Family | Asteraceae (Compositae) |
| Origin | India |
| Plant Part Used | Leaf |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | Isoniazid (0.2 µg/ml), p - aminosalicylic acid (0.5 µg/ml), Ethambutol (2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Pulmonary diseases, leprosy |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) L. van Puyvelde, J.D. Ntawukiliyayo, F. Portaels, E. Hakizamungu.In vitro inhibition of mycobacteria by Rwandese medicinal plants.Phytotherapy Research, Volume 8, Issue 2, pages 6569, March 1994
|
| Curator | |
| Compound ID | 1280 |
| Compound Structure |  |
| Plant Source | Borrichia frutescens L. Common Name:Sea Daisy |
| Source Family | Asteraceae (Compositae) |
| Origin | Southeastern USA |
| Plant Part Used | Flower, leaf, stem |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | Fusidic acid (4 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | (24R)-24,25-epoxycycloartan-3-one |
| PubChem ID | 469544 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 8988597 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Triterpene, Cycloartane, Ketone, Epoxy |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against vero cells |
| Molecular Weight | 440.365 |
| Molecular Formula | C30H48O2 |
| SMILES | O=C1C([C@H]2[C@@]3([C@@]4(C3)[C@H]([C@]3([C@](CC4)([C@H](CC3)[C@@H](CC[C@H]3OC3(C)C)C)C)C)CC2)CC1)(C)C |
| XLogP | 9.983 |
| PSA | 29.600 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Lu T, Fronczek FR, Fischer NH, Adams LB, Franzblau SG.Antimycobacterial cycloartanes from Borrichia frutescens.J Nat Prod. 1996 Dec;59(12):1131-6
|
| Curator | |
| Compound ID | 1281 |
| Compound Structure |  |
| Plant Source | Borrichia frutescens L. Common Name:Sea Daisy |
| Source Family | Asteraceae (Compositae) |
| Origin | USA |
| Plant Part Used | Flower, leaf, stem |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | Fusidic acid (4 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | (3β, 24R) - 24, 25 - Epoxycycloartan - 3 - Ol |
| PubChem ID | 469545 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 8988597 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Triterpene, Cycloartane, Epoxy, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against Vero cells |
| Molecular Weight | 442.381 |
| Molecular Formula | C30H50O2 |
| SMILES | O[C@H]1C([C@H]2[C@@]3([C@@]4(C3)[C@H]([C@]3([C@](CC4)([C@H](CC3)[C@@H](CC[C@H]3OC3(C)C)C)C)C)CC2)CC1)(C)C |
| XLogP | 10.590 |
| PSA | 32.760 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Lu T, Fronczek FR, Fischer NH, Adams LB, Franzblau SG.Antimycobacterial cycloartanes from Borrichia frutescens.J Nat Prod. 1996 Dec;59(12):1131-6
|
| Curator | |
| Compound ID | 1282 |
| Compound Structure |  |
| Plant Source | Borrichia frutescens L. Common Name:Sea Daisy |
| Source Family | Asteraceae (Compositae) |
| Origin | USA |
| Plant Part Used | Flower, leaf, stem |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | Fusidic acid (4 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 64 - 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | (23R)-3-Oxolanosta-8,24-dien-23-Ol |
| PubChem ID | 469546 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 8988597 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Ketone, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against Vero cells |
| Molecular Weight | 440.365 |
| Molecular Formula | C30H48O2
|
| SMILES | O=C1C([C@H]2[C@@](C3=C([C@]4([C@@]([C@H](CC4)[C@@H](C[C@@H](O)C=C(C)C)C)(CC3)C)C)CC2)(CC1)C)(C)C |
| XLogP | 7.784 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Lu T, Fronczek FR, Fischer NH, Adams LB, Franzblau SG.Antimycobacterial cycloartanes from Borrichia frutescens.J Nat Prod. 1996 Dec;59(12):1131-6
|
| Curator | |
| Compound ID | 1283 |
| Compound Structure | |
| Plant Source | Borrichia frutescens L. Common Name:Sea Daisy |
| Source Family | Asteraceae (Compositae) |
| Origin | USA |
| Plant Part Used | Flower |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | Fusidic acid (4 µg/ml) |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 8988597 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Cantrell CL, Lu T, Fronczek FR, Fischer NH, Adams LB, Franzblau SG.Antimycobacterial cycloartanes from Borrichia frutescens.J Nat Prod. 1996 Dec;59(12):1131-6
|
| Curator | |
| Compound ID | 1284 |
| Compound Structure | |
| Plant Source | Borrichia frutescens L. Common Name:Sea Daisy |
| Source Family | Asteraceae (Compositae) |
| Origin | USA |
| Plant Part Used | Flower |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | |
| Positive Control Used (conc.) | Rifampin, Clarithromycin |
| Inhibition [%] | 99 % |
| Activity [MIC] µg/ml | 1000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 23195767 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) C.L. Cantrell, N.H. Fischer, L. Urbatsch, M.S. McGuire, S.G. Franzblau.Antimycobacterial crude plant extracts from South, Central, and North America.Phytomedicine, Volume 5, Issue 2, April 1998, Pages 137145
|
| Curator | |
| Compound ID | 1287 |
| Compound Structure | |
| Plant Source | Brachyglottis repanda Common Name:Rangiora |
| Source Family | Asteraceae (Compositae) |
| Origin | New Zealand |
| Plant Part Used | Leaf |
| Extract | |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | 96 well - plate format assay for bacteriostatic activity, two - fold serial dilution to measure any background optical density or fluorescence associated with the extract |
| Positive Control Used (conc.) | Rifampin (100 µM), Streptomycin (100 µM) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Wounds, ulcers and boils |
| PubMed ID [Source Literature] | 20537175 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Earl EA, Altaf M, Murikoli RV, Swift S, O Toole R.Native New Zealand plants with inhibitory activity towards Mycobacterium tuberculosis.BMC Complement Altern Med. 2010 Jun 10;10:25
|
| Curator | |