| Compound ID | 1300 |
| Compound Structure | |
| Plant Source | Buddleja saligna L. Common Name:Squarestem Butterflybush |
| Source Family | Buddlejaceae |
| Origin | Africa |
| Plant Part Used | Leaf, stem |
| Extract | Acetone:water (4:1) |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Bioautography on TLC plates |
| Positive Control Used (conc.) | Rifampin (2.5 µg/spot) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 18384988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Bamuamba K, Gammon DW, Meyers P, Dijoux-Franca MG, Scott G.Anti-mycobacterial activity of five plant species used as traditional medicines in the Western Cape Province (South Africa).J Ethnopharmacol. 2008 May 8;117(2):385-90
|
| Curator | |
| Compound ID | 1301 |
| Compound Structure |  |
| Plant Source | Buddleja saligna L. Common Name:Squarestem Butterflybush |
| Source Family | Buddlejaceae |
| Origin | Africa |
| Plant Part Used | Leaf, stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | Rifampin (2.5 µg/disk) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 5 µg/Disk |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleanolic acid |
| PubChem ID | 10494 |
| Ethnomedicinal Information | Tuberculosis symptoms |
| PubMed ID [Source Literature] | 18384988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.052 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bamuamba K, Gammon DW, Meyers P, Dijoux-Franca MG, Scott G.Anti-mycobacterial activity of five plant species used as traditional medicines in the Western Cape Province (South Africa).J Ethnopharmacol. 2008 May 8;117(2):385-90
|
| Curator | |
| Compound ID | 1302 |
| Compound Structure |  |
| Plant Source | Buddleja saligna L. Common Name:Squarestem Butterflybush |
| Source Family | Buddlejaceae |
| Origin | Africa |
| Plant Part Used | Leaf, stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Bioautography on TLC plates |
| Positive Control Used (conc.) | Rifampin (2.5 µg/spot) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2.5 µg/spot |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleanolic acid |
| PubChem ID | 10494 |
| Ethnomedicinal Information | Tuberculosis symptoms |
| PubMed ID [Source Literature] | 18384988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.052 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bamuamba K, Gammon DW, Meyers P, Dijoux-Franca MG, Scott G.Anti-mycobacterial activity of five plant species used as traditional medicines in the Western Cape Province (South Africa).J Ethnopharmacol. 2008 May 8;117(2):385-90
|
| Curator | |
| Compound ID | 1303 |
| Compound Structure |  |
| Plant Source | Buddleja saligna L. Common Name:Squarestem Butterflybush |
| Source Family | Buddlejaceae |
| Origin | Africa |
| Plant Part Used | Leaf, stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium avium (ATCC 25291) |
| Assay / Test Done | Bioautography on TLC plates |
| Positive Control Used (conc.) | Rifampin (2.5 µg/spot) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.25 µg/spot |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleanolic acid |
| PubChem ID | 10494 |
| Ethnomedicinal Information | Tuberculosis symptoms |
| PubMed ID [Source Literature] | 18384988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.052 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bamuamba K, Gammon DW, Meyers P, Dijoux-Franca MG, Scott G.Anti-mycobacterial activity of five plant species used as traditional medicines in the Western Cape Province (South Africa).J Ethnopharmacol. 2008 May 8;117(2):385-90
|
| Curator | |
| Compound ID | 1304 |
| Compound Structure |  |
| Plant Source | Buddleja saligna L. Common Name:Squarestem Butterflybush |
| Source Family | Buddlejaceae |
| Origin | Africa |
| Plant Part Used | Leaf, stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium scrofulaceum (ATCC 19981) |
| Assay / Test Done | Bioautography on TLC plates |
| Positive Control Used (conc.) | Rifampin (2.5 µg/spot) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.25 µg/spot |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleanolic acid |
| PubChem ID | 10494 |
| Ethnomedicinal Information | Tuberculosis symptoms |
| PubMed ID [Source Literature] | 18384988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.052 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bamuamba K, Gammon DW, Meyers P, Dijoux-Franca MG, Scott G.Anti-mycobacterial activity of five plant species used as traditional medicines in the Western Cape Province (South Africa).J Ethnopharmacol. 2008 May 8;117(2):385-90
|
| Curator | |
| Compound ID | 1305 |
| Compound Structure |  |
| Plant Source | Buddleja saligna L. Common Name:Squarestem Butterflybush |
| Source Family | Buddlejaceae |
| Origin | Africa |
| Plant Part Used | Leaf, stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium microti (ATCC 19422) |
| Assay / Test Done | Bioautography on TLC plates |
| Positive Control Used (conc.) | Rifampin (2.5 µg/spot) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2.5 µg/spot |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleanolic acid |
| PubChem ID | 10494 |
| Ethnomedicinal Information | Tuberculosis symptoms |
| PubMed ID [Source Literature] | 18384988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.052 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bamuamba K, Gammon DW, Meyers P, Dijoux-Franca MG, Scott G.Anti-mycobacterial activity of five plant species used as traditional medicines in the Western Cape Province (South Africa).J Ethnopharmacol. 2008 May 8;117(2):385-90
|
| Curator | |