| Compound ID | 1874 |
| Compound Structure | |
| Plant Source | Humulus lupulus L. Common Name:Hops (English) |
| Source Family | Cannabaceae |
| Origin | India, USA |
| Plant Part Used | Flower |
| Extract | Water, ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Stomach ache, diuretic, antiseptic, indigestion, tonic, sedative, nervous conditions, bacteriostatic, random screening |
| PubMed ID [Source Literature] | 16695763 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gottshall RY, Lucas EH, Lickfeldt A, Roberts JM.The occurrence of antibacterial substances active against Mycobacterium tuberculosis in seed plants.J Clin Invest. 1949 Sep;28(5 Pt 1):920-3
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1875 |
| Compound Structure | |
| Plant Source | Humulus lupulus L. Common Name:Hops (English) |
| Source Family | Cannabaceae |
| Origin | India, USA |
| Plant Part Used | Mother tinture |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (human) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:80 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Stomach ache, diuretic, antiseptic, indigestion, tonic, sedative, nervous conditions, bacteriostatic, random screening |
| PubMed ID [Source Literature] | 2118130 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Grange JM, Davey RW.Detection of antituberculous activity in plant extracts.J Appl Bacteriol. 1990 Jun;68(6):587-91
|
| Curator | |
| Compound ID | 3215 |
| Compound Structure | NR |
| Plant Source | Cannabis sativa L. Common Name:Hemp, Indian Hemp (English), Vijayaa, Bhangaa (Sanskrit) |
| Source Family | Cannabaceae |
| Origin | India |
| Plant Part Used | NR |
| Extract | Essential oil |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | NR |
| PubChem ID | NR |
| Ethnomedicinal Information | Leprosy, cough, bronchitis |
| PubMed ID [Source Literature] | 754639 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | NR |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Reference(s) | 1) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
2) Fournier G, Paris MR, Fourniat MC, Quero AM.Bacteriostatic activity of Cannabis sativa L. essential oil Ann Pharm Fr. 1978;36(11-12):603-6
|
| Curator | Reshmi |
| Compound ID | 3433 |
| Compound Structure | |
| Plant Source | Humulus lupulus L. Common Name: |
| Source Family | Cannabaceae |
| Origin | India |
| Plant Part Used | Flower |
| Extract | Water |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Stomach ache, diuretic, antiseptic, indigestion, tonic, sedative, nervous conditions, bacteriostatic, random screening |
| PubMed ID [Source Literature] | 16695763 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Reference(s) | 1) Gottshall RY, Lucas EH, Lickfeldt A, Roberts JM. 1949. The occurrence of antibacterial substances active against Mycobacterium tuberculosis in seed plants. J Clin Invest 28: 920-923
|
| Curator | |
| Compound ID | 3434 |
| Compound Structure | |
| Plant Source | Humulus lupulus L. Common Name: |
| Source Family | Cannabaceae |
| Origin | India |
| Plant Part Used | Flower |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Stomach ache, diuretic, antiseptic, indigestion, tonic, sedative, nervous conditions, bacteriostatic, random screening |
| PubMed ID [Source Literature] | 16695763 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Reference(s) | 1) Gottshall RY, Lucas EH, Lickfeldt A, Roberts JM. 1949. The occurrence of antibacterial substances active against Mycobacterium tuberculosis in seed plants. J Clin Invest 28: 920-923
|
| Curator | |
| Compound ID | 3435 |
| Compound Structure | |
| Plant Source | Humulus lupulus L. Common Name: |
| Source Family | Cannabaceae |
| Origin | India |
| Plant Part Used | |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (human) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:80 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Stomach ache, diuretic, antiseptic, indigestion, tonic, sedative, nervous conditions, bacteriostatic, random screening |
| PubMed ID [Source Literature] | 2118130 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Reference(s) | 1) Grange JM, Davey RW.Detection of antituberculous activity in plant extracts.J Appl Bacteriol. 1990 Jun;68(6):587-91
|
| Curator | |
| Compound ID | 3607 |
| Compound Structure |  |
| Plant Source | Humulus lupulus Common Name: |
| Source Family | Cannabaceae |
| Origin | |
| Plant Part Used | Whole plant |
| Extract | Hexane |
| Target Bacteria | Mycobacterium aurum (Pasteur Institute 104482) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (1 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Linoleic acid |
| PubChem ID | 5280450 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15478197 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 280.240 |
| Molecular Formula | C18H32O2 |
| SMILES | OC(=O)CCCCCCC/C=CC/C=CCCCCC |
| XLogP | 7.865 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 14 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Stavri M, Schneider R, O'Donnell G, Lechner D, Bucar F, Gibbons S.The antimycobacterial components of hops (Humulus lupulus) and their dereplication.Phytother Res. 2004 Sep;18(9):774-6
|
| Curator | Gppreetha, vikramjitmandal |
| Compound ID | 3608 |
| Compound Structure |  |
| Plant Source | Humulus lupulus Common Name: |
| Source Family | Cannabaceae |
| Origin | |
| Plant Part Used | Whole plant |
| Extract | Hexane |
| Target Bacteria | Mycobacterium fortuitum (ATCC 6841) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (4 µg/ml), Isoniazid (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Linoleic acid |
| PubChem ID | 5280450 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15478197 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 280.240 |
| Molecular Formula | C18H32O2 |
| SMILES | OC(=O)CCCCCCC/C=CC/C=CCCCCC |
| XLogP | 7.865 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 14 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Stavri M, Schneider R, O'Donnell G, Lechner D, Bucar F, Gibbons S.The antimycobacterial components of hops (Humulus lupulus) and their dereplication.Phytother Res. 2004 Sep;18(9):774-6
|
| Curator | Gppreetha, vikramjitmandal |
| Compound ID | 3609 |
| Compound Structure |  |
| Plant Source | Humulus lupulus Common Name: |
| Source Family | Cannabaceae |
| Origin | |
| Plant Part Used | Whole plant |
| Extract | Hexane |
| Target Bacteria | Mycobacterium phlei (ATCC 11758) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Linoleic acid |
| PubChem ID | 5280450 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15478197 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 280.240 |
| Molecular Formula | C18H32O2 |
| SMILES | OC(=O)CCCCCCC/C=CC/C=CCCCCC |
| XLogP | 7.865 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 14 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Stavri M, Schneider R, O'Donnell G, Lechner D, Bucar F, Gibbons S.The antimycobacterial components of hops (Humulus lupulus) and their dereplication.Phytother Res. 2004 Sep;18(9):774-6
|
| Curator | Gppreetha, vikramjitmandal |
| Compound ID | 3610 |
| Compound Structure |  |
| Plant Source | Humulus lupulus Common Name: |
| Source Family | Cannabaceae |
| Origin | |
| Plant Part Used | Whole plant |
| Extract | Hexane |
| Target Bacteria | Mycobacterium smegmatis (ATCC 14468) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Linoleic acid |
| PubChem ID | 5280450 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15478197 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 280.240 |
| Molecular Formula | C18H32O2 |
| SMILES | OC(=O)CCCCCCC/C=CC/C=CCCCCC |
| XLogP | 7.865 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 14 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Stavri M, Schneider R, O'Donnell G, Lechner D, Bucar F, Gibbons S.The antimycobacterial components of hops (Humulus lupulus) and their dereplication.Phytother Res. 2004 Sep;18(9):774-6
|
| Curator | Gppreetha, vikramjitmandal |
| Compound ID | 3611 |
| Compound Structure |  |
| Plant Source | Humulus lupulus Common Name: |
| Source Family | Cannabaceae |
| Origin | |
| Plant Part Used | Whole plant |
| Extract | Hexane |
| Target Bacteria | Mycobacterium aurum (Pasteur Institute 104482) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (1 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleic acid |
| PubChem ID | 445639 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15478197 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 282.256 |
| Molecular Formula | C18H34O2 |
| SMILES | OC(=O)CCCCCCC/C=CCCCCCCCC |
| XLogP | 8.192 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 15 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Stavri M, Schneider R, O'Donnell G, Lechner D, Bucar F, Gibbons S.The antimycobacterial components of hops (Humulus lupulus) and their dereplication.Phytother Res. 2004 Sep;18(9):774-6
|
| Curator | Gppreetha, vikramjitmandal |
| Compound ID | 3612 |
| Compound Structure |  |
| Plant Source | Humulus lupulus Common Name: |
| Source Family | Cannabaceae |
| Origin | |
| Plant Part Used | Whole plant |
| Extract | Hexane |
| Target Bacteria | Mycobacterium smegmatis (ATCC 14468) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleic acid |
| PubChem ID | 445639 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15478197 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 282.256 |
| Molecular Formula | C18H34O2 |
| SMILES | OC(=O)CCCCCCC/C=CCCCCCCCC |
| XLogP | 8.192 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 15 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Stavri M, Schneider R, O'Donnell G, Lechner D, Bucar F, Gibbons S.The antimycobacterial components of hops (Humulus lupulus) and their dereplication.Phytother Res. 2004 Sep;18(9):774-6
|
| Curator | Gppreetha, vikramjitmandal |