| Compound ID | 1806 |
| Compound Structure | |
| Plant Source | Garcinia polyantha Oliv. Common Name: |
| Source Family | Clusiaceae |
| Origin | Africa |
| Plant Part Used | Stem bark |
| Extract | Dichloromethane:Methanol |
| Target Bacteria | Mycobacterium smegmatis, Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:01 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Wounds, various uses |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Kuete V., Meli A.L., Komguem J., Louh G.N., Tangmouo J.G., Lontsi D., Meyer J.J.M., Lall N.Antimycobacterial, Antibacterial and Antifungal Activities of the Methanolic Extract and Compounds from Garcinia Polyantha. Pharmacologyonline 3 : 87-95 (2007)
|
| Curator | |
| Compound ID | 2133 |
| Compound Structure | |
| Plant Source | Mammea americana L Common Name: |
| Source Family | Clusiaceae |
| Origin | India |
| Plant Part Used | Leaf |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | 10 mm |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bitter, resinous and highly toxic to several pests, jam, sauces |
| PubMed ID [Source Literature] | 10925394 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Wright CW.A review of antimycobacterial natural products.Phytother Res. 2000 Aug;14(5):303-22
2) Chopra, R.N., Chopra, I.C., Verma, B.S., 1969. Supplement to the Glossary of Indian Medicinal Plants. Council of Scientific and Industrial Research, New Delhi, India
|
| Curator | |
| Compound ID | 2134 |
| Compound Structure | |
| Plant Source | Mammea americana L Common Name: |
| Source Family | Clusiaceae |
| Origin | India |
| Plant Part Used | Leaf |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bitter, resinous and highly toxic to several pests, jam, sauces |
| PubMed ID [Source Literature] | 10925394 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Wright CW.A review of antimycobacterial natural products.Phytother Res. 2000 Aug;14(5):303-22
2) Chopra, R.N., Chopra, I.C., Verma, B.S., 1969. Supplement to the Glossary of Indian Medicinal Plants. Council of Scientific and Industrial Research, New Delhi, India
|
| Curator | |
| Compound ID | 2170 |
| Compound Structure | |
| Plant Source | Mesua ferrea L Common Name:Ironwood, Mesu (English), Naagakeshara, Naagapushpa (Sanskrit) |
| Source Family | Clusiaceae |
| Origin | India |
| Plant Part Used | Twig |
| Extract | Ethanol (95 %), petroleum ether |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Sore throat, cough, asthma |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Pongpan A, Chumsri P and Taworasate T .The antimicrobial activity of some Thai Medicinal. Plants. Mahidol Univ J Pharm Sci 1982; 9 4: 88-91
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1799 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Thailand, Malaysia |
| Plant Part Used | Arils and seed |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampicin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulfate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 9 - Hydroxycalabaxanthone |
| PubChem ID | NR |
| Ethnomedicinal Information | Treatment of diarrhea and dysentery and for skin diseases, to lower fever and for urinary disorders |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Xanthanoid, Benzopyran, Prenylated, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 422.173 |
| Molecular Formula | C25H26O6 |
| SMILES | C1(c(c(cc2c1c(=O)c1c(o2)cc2c(c1O)C=CC(O2)(C)C)O)OC)CCC=C(C)C |
| XLogP | 3.609 |
| PSA | 85.220 |
| H-bond Donor | 2 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | |
| Compound ID | 3108 |
| Compound Structure |  |
| Plant Source | Calophyllum lanigerum var. austrocoriaceum Common Name:NR |
| Source Family | Clusiaceae |
| Origin | Malaysian rain forest |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 - 16 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | (+)- Calanolide A |
| PubChem ID | 64972 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 16138106 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Coumarin, Benzopyran, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 370.178 |
| Molecular Formula | C22H26O5 |
| SMILES | O1[C@@H]([C@H]([C@H](O)c2c1c1c(OC(C=C1)(C)C)c1c2oc(=O)cc1CCC)C)C |
| XLogP | 4.029 |
| PSA | 55.760 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Pink R, Hudson A, Mouriès MA, Bendig M.Opportunities and challenges in antiparasitic drug discovery.Nat Rev Drug Discov. 2005 Sep;4(9):727-40
|
| Curator | Reshmi, gppreetha |
| Compound ID | 1798 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Thailand, Malaysia |
| Plant Part Used | Fruit |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampicin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulfate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Garcinone B |
| PubChem ID | 5495928 |
| Ethnomedicinal Information | Treatment of diarrhea and dysentery and for skin diseases, to lower fever and for urinary disorders |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Xanthonoid, Benzopyran, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 394.142 |
| Molecular Formula | C23H22O6
|
| SMILES | O1C(C=Cc2c3c(oc4c(c3=O)c(O)c(c(O)c4)CC=C(C)C)cc(O)c12)(C)C |
| XLogP | 2.203 |
| PSA | 86.990 |
| H-bond Donor | 3 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | |
| Compound ID | 1796 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Thailand, Malaysia |
| Plant Part Used | Fruit |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampicin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulfate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Garcinone D |
| PubChem ID | 5495926 |
| Ethnomedicinal Information | Treatment of diarrhea and dysentery and for skin diseases, to lower fever and for urinary disorders |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Prenylated, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 428.184 |
| Molecular Formula | C24H28O7
|
| SMILES | OC(CCc1c2c(oc3c(c2=O)c(O)c(c(O)c3)CC=C(C)C)cc(O)c1OC)(C)C |
| XLogP | 1.895 |
| PSA | 107.220 |
| H-bond Donor | 4 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | |
| Compound ID | 3573 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Southeast Asian countries (Thailand, Malaysia) |
| Plant Part Used | Fruit hull, fresh aril, seed |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulphate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | α - Mangostin |
| PubChem ID | 5281650 |
| Ethnomedicinal Information | Skin infections, wounds and diarrhea, to lower fever and for urinary disorders |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | MeOH extract were obtained from the fresh green fruit hulls of Garcinia mangostana. Pulverized, fresh arils and seeds were extracted throroughly with MeOH and evaporation of the solvent gave crude extract. The crude extract was partitioned between CHCl3 and H2O to afford CHCl3 extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Prenylated, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | 7H9GC medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 410.173 |
| Molecular Formula | C24H26O6 |
| SMILES | O1c2c(c(CC=C(C)C)c(OC)c(O)c2)c(=O)c2c1cc(O)c(c2O)CC=C(C)C |
| XLogP | 2.792 |
| PSA | 86.990 |
| H-bond Donor | 3 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | Gppreetha, vikramjitmandal, reshmi |
| Compound ID | 3575 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana L. Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Southeast Asia |
| Plant Part Used | Fruit hull |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulphate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Demethylcalabaxanthone |
| PubChem ID | 509270 |
| Ethnomedicinal Information | Skin infections, wounds and diarrhea |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | MeOH extract were obtained from the fresh green fruit hulls of Garcinia mangostana. Pulverized, fresh arils and seeds were extracted throroughly with MeOH and evaporation of the solvent gave crude extract. The crude extract was partitioned between CHCl3 and H2O to afford CHCl3 extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Xanthonoid, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 378.147 |
| Molecular Formula | C23H22O5 |
| SMILES | O1C(C=Cc2c1cc1oc3c(c(=O)c1c2O)c(CC=C(C)C)c(O)cc3)(C)C |
| XLogP | 3.163 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | Gppreetha, vikramjitmandal, reshmi |
| Compound ID | 3577 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana L. Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Southeast Asia |
| Plant Part Used | Fruit hull |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulphate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Trapezifolixanthone |
| PubChem ID | 188341 |
| Ethnomedicinal Information | Skin infections, wounds and diarrhea |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | MeOH extract were obtained from the fresh green fruit hulls of Garcinia mangostana. Pulverized, fresh arils and seeds were extracted throroughly with MeOH and evaporation of the solvent gave crude extract. The crude extract was partitioned between CHCl3 and H2O to afford CHCl3 extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Xanthonoid, Benzopyran, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 378.147 |
| Molecular Formula | C23H22O5 |
| SMILES | O1C(C=Cc2c1c(c1oc3c(c(=O)c1c2O)cccc3O)CC=C(C)C)(C)C |
| XLogP | 3.166 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | Gppreetha, vikramjitmandal, reshmi |
| Compound ID | 3578 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana L. Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Southeast Asia |
| Plant Part Used | Fruit hull |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulphate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | β - mangostin |
| PubChem ID | NR |
| Ethnomedicinal Information | Skin infections, wounds and diarrhea |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | MeOH extract were obtained from the fresh green fruit hulls of Garcinia mangostana. Pulverized, fresh arils and seeds were extracted throroughly with MeOH and evaporation of the solvent gave crude extract. The crude extract was partitioned between CHCl3 and H2O to afford CHCl3 extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Prenylated, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 424.189 |
| Molecular Formula | C25H28O6 |
| SMILES | O1c2c(c(CC=C(C)C)c(c(O)c2)OC)c(=O)c2c1cc(c(c2O)CC=C(C)C)OC |
| XLogP | 3.311 |
| PSA | 75.990 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | Gppreetha, vikramjitmandal, reshmi |
| Compound ID | 3579 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana L. Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Southeast Asia |
| Plant Part Used | Fruit hull |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulphate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | γ - Mangostin |
| PubChem ID | 5464078 |
| Ethnomedicinal Information | Skin infections, wounds and diarrhea |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | MeOH extract were obtained from the fresh green fruit hulls of Garcinia mangostana. Pulverized, fresh arils and seeds were extracted throroughly with MeOH and evaporation of the solvent gave crude extract. The crude extract was partitioned between CHCl3 and H2O to afford CHCl3 extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 396.157 |
| Molecular Formula | C23H24O6 |
| SMILES | O1c2c(c(CC=C(C)C)c(O)c(O)c2)c(=O)c2c1cc(O)c(c2O)CC=C(C)C |
| XLogP | 2.702 |
| PSA | 97.990 |
| H-bond Donor | 4 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | Gppreetha, vikramjitmandal, reshmi |
| Compound ID | 3581 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana L. Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Southeast Asia |
| Plant Part Used | Fruit hull |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulphate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Mangostenol |
| PubChem ID | NR |
| Ethnomedicinal Information | Skin infections, wounds and diarrhea |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | MeOH extract were obtained from the fresh green fruit hulls of Garcinia mangostana. Pulverized, fresh arils and seeds were extracted throroughly with MeOH and evaporation of the solvent gave crude extract. The crude extract was partitioned between CHCl3 and H2O to afford CHCl3 extract |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 426.168 |
| Molecular Formula | C24H26O7 |
| SMILES | O1c2c(c(O)c(c(c2)O)CC(C(=C)C)O)c(=O)c2c1cc(O)c(c2CC=C(C)C)OC |
| XLogP | 1.226 |
| PSA | 107.220 |
| H-bond Donor | 4 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | Gppreetha, vikramjitmandal, reshmi |
| Compound ID | 3583 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana L. Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Southeast Asia |
| Plant Part Used | Fruit hull |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulphate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Mangostanin |
| PubChem ID | 5495929 |
| Ethnomedicinal Information | Skin infections, wounds and diarrhea |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | MeOH extract were obtained from the fresh green fruit hulls of Garcinia mangostana. Pulverized, fresh arils and seeds were extracted throroughly with MeOH and evaporation of the solvent gave crude extract. The crude extract was partitioned between CHCl3 and H2O to afford CHCl3 extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Xanthanoid, Benzopyran, Prenylated, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 408.157 |
| Molecular Formula | C24H24O6 |
| SMILES | O1C(C=Cc2c1cc1oc3c(c(CC=C(C)C)c(OC)c(O)c3)c(=O)c1c2O)(C)C |
| XLogP | 2.719 |
| PSA | 75.990 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | Gppreetha, vikramjitmandal, reshmi |
| Compound ID | 3585 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana L. Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Southeast Asia |
| Plant Part Used | Fruit hull |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulphate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Mangostenone A |
| PubChem ID | 509267 |
| Ethnomedicinal Information | Skin infections, wounds and diarrhea |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | MeOH extract were obtained from the fresh green fruit hulls of Garcinia mangostana. Pulverized, fresh arils and seeds were extracted throroughly with MeOH and evaporation of the solvent gave crude extract. The crude extract was partitioned between CHCl3 and H2O to afford CHCl3 extract |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Xanthonoid, Benzopyran, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 460.189 |
| Molecular Formula | C28H28O6 |
| SMILES | O1C(C=Cc2c3oc4c(c(=O)c3c(c(O)c12)CC=C(C)C)c(O)c1c(OC(C=C1)(C)C)c4)(C)C |
| XLogP | 3.603 |
| PSA | 75.990 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | Gppreetha, vikramjitmandal, reshmi |
| Compound ID | 3586 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana L. Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Southeast Asia |
| Plant Part Used | Fruit hull |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulphate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Tovophyllin B |
| PubChem ID | 509268 |
| Ethnomedicinal Information | Skin infections, wounds and diarrhea |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | MeOH extract were obtained from the fresh green fruit hulls of Garcinia mangostana. Pulverized, fresh arils and seeds were extracted throroughly with MeOH and evaporation of the solvent gave crude extract. The crude extract was partitioned between CHCl3 and H2O to afford CHCl3 extract |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Xanthonoid, Benzopyran, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 460.189 |
| Molecular Formula | C28H28O6 |
| SMILES | O1C(C=Cc2c3c(oc4c(c3=O)c(O)c3c(OC(C=C3)(C)C)c4)c(c(O)c12)CC=C(C)C)(C)C |
| XLogP | 3.603 |
| PSA | 75.990 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | Gppreetha, vikramjitmandal, reshmi |
| Compound ID | 3587 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana L. Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Southeast Asia |
| Plant Part Used | Fruit hull |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulphate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Mangostanol |
| PubChem ID | 10048103 |
| Ethnomedicinal Information | Skin infections, wounds and diarrhea |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | MeOH extract were obtained from the fresh green fruit hulls of Garcinia mangostana. Pulverized, fresh arils and seeds were extracted throroughly with MeOH and evaporation of the solvent gave crude extract. The crude extract was partitioned between CHCl3 and H2O to afford CHCl3 extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Xanthonoid, Benzopyran, Prenylated, Phenol, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 426.168 |
| Molecular Formula | C24H26O7 |
| SMILES | O1C(C(O)Cc2c1cc1oc3c(c(=O)c1c2O)c(CC=C(C)C)c(OC)c(O)c3)(C)C |
| XLogP | 1.883 |
| PSA | 96.220 |
| H-bond Donor | 3 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | Gppreetha, vikramjitmandal, reshmi |
| Compound ID | 1805 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Thailand, Malaysia |
| Plant Part Used | Fruit |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampicin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulfate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Mangostinone |
| PubChem ID | 6478778 |
| Ethnomedicinal Information | Treatment of diarrhea and dysentery and for skin diseases, lower fever and for urinary disorders |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 380.162 |
| Molecular Formula | C23H24O5
|
| SMILES | O1c2c(c(O)c(C/C=C(/CCC=C(C)C)C)c(O)c2)c(=O)c2c1c(O)ccc2 |
| XLogP | 3.588 |
| PSA | 77.760 |
| H-bond Donor | 3 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | |