| Compound ID | 1530 |
| Compound Structure | |
| Plant Source | Convolvulus arvensis L. Common Name:Deers Foot (English), Bhadrabalaa, Hiranpadi (Sanskrit) |
| Source Family | Convolvulaceae |
| Origin | India |
| Plant Part Used | Leaf |
| Extract | Water |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Broth Dilution Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1:40 dilution |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Fever, purgative, cathartic, Random screening |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 14. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1531 |
| Compound Structure | |
| Plant Source | Convolvulus arvensis L. Common Name:Deers Foot (English), Bhadrabalaa, Hiranpadi (Sanskrit) |
| Source Family | Convolvulaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (human) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:80 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Fever, purgative, cathartic, random screening |
| PubMed ID [Source Literature] | 2118130 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Grange JM, Davey RW.Detection of antituberculous activity in plant extracts.J Appl Bacteriol. 1990 Jun;68(6):587-91
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1931 |
| Compound Structure |  |
| Plant Source | Ipomoea leptophylla Common Name:Bush Morning Glory, Manroot |
| Source Family | Convolvulaceae |
| Origin | North America |
| Plant Part Used | Leaf |
| Extract | Soluble extract |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC 460 radiometric system |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR (inactive) |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Operculinic acid |
| PubChem ID | 44584575 |
| Ethnomedicinal Information | Treatment for stomach troubles, tuberculosis |
| PubMed ID [Source Literature] | 14640518 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Fatty acid, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 1018.520 |
| Molecular Formula | C46H82O24 |
| SMILES | O([C@@H]1O[C@H]([C@H](O[C@@H]2O[C@H]([C@H](O)[C@@H](O)[C@H]2O)C)[C@@H](O)[C@H]1O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO)C)[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O[C@H]1C)O[C@@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]1O[C@H](CCCCCCCCCC(=O)O)CCCCC)C |
| XLogP | 1.041 |
| PSA | 372.360 |
| H-bond Donor | 13 |
| H-bond Acceptor | 24 |
| No. of Rotatable Bond Count | 25 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 24 |
| No. of S | 0 |
| Reference(s) | 1) Barnes CC, Smalley MK, Manfredi KP, Kindscher K, Loring H, Sheeley DM.Characterization of an anti-tuberculosis resin glycoside from the prairie medicinal plant Ipomoea leptophylla.J Nat Prod. 2003 Nov;66(11):1457-62
|
| Curator | |
| Compound ID | 1932 |
| Compound Structure |  |
| Plant Source | Ipomoea leptophylla Common Name:Bush Morning Glory, Manroot |
| Source Family | Convolvulaceae |
| Origin | North America |
| Plant Part Used | Leaf |
| Extract | Soluble extract |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC 460 radiometric system |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Trans - Cinnamic Acid |
| PubChem ID | 444539 |
| Ethnomedicinal Information | Treatment for stomach troubles, tuberculosis |
| PubMed ID [Source Literature] | 14640518 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 148.052 |
| Molecular Formula | C9H8O2 |
| SMILES | OC(=O)/C=C/c1ccccc1 |
| XLogP | 3.904 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Barnes CC, Smalley MK, Manfredi KP, Kindscher K, Loring H, Sheeley DM.Characterization of an anti-tuberculosis resin glycoside from the prairie medicinal plant Ipomoea leptophylla.J Nat Prod. 2003 Nov;66(11):1457-62
|
| Curator | |
| Compound ID | 1933 |
| Compound Structure |  |
| Plant Source | Ipomoea leptophylla Common Name:Bush Morning Glory, Manroot |
| Source Family | Convolvulaceae |
| Origin | North America |
| Plant Part Used | Leaf |
| Extract | Soluble extract |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC 460 radiometric system |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Propanoic acid |
| PubChem ID | 1032 |
| Ethnomedicinal Information | Treatment for stomach troubles, tuberculosis |
| PubMed ID [Source Literature] | 14640518 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Acid
|
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 74.037 |
| Molecular Formula | C3H6O2 |
| SMILES | OC(=O)CC |
| XLogP | 0.173 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Barnes CC, Smalley MK, Manfredi KP, Kindscher K, Loring H, Sheeley DM.Characterization of an anti-tuberculosis resin glycoside from the prairie medicinal plant Ipomoea leptophylla.J Nat Prod. 2003 Nov;66(11):1457-62
|
| Curator | |
| Compound ID | 1934 |
| Compound Structure |  |
| Plant Source | Ipomoea leptophylla Common Name:Bush Morning Glory, Manroot |
| Source Family | Convolvulaceae |
| Origin | North America |
| Plant Part Used | Leaf |
| Extract | Soluble extract |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC 460 radiometric system |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Lauric acid |
| PubChem ID | 3893 |
| Ethnomedicinal Information | Treatment for stomach troubles, tuberculosis |
| PubMed ID [Source Literature] | 14640518 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 200.178 |
| Molecular Formula | C12H24O2 |
| SMILES | OC(=O)CCCCCCCCCCC |
| XLogP | 5.294 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 10 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Barnes CC, Smalley MK, Manfredi KP, Kindscher K, Loring H, Sheeley DM.Characterization of an anti-tuberculosis resin glycoside from the prairie medicinal plant Ipomoea leptophylla.J Nat Prod. 2003 Nov;66(11):1457-62
|
| Curator | |
| Compound ID | 1935 |
| Compound Structure | |
| Plant Source | Ipomoea muricatum Don syn. Calonyction muricatum Don Common Name: |
| Source Family | Convolvulaceae |
| Origin | India |
| Plant Part Used | Seed |
| Extract | Alkaloid fraction of chloroform extract |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cathartic, purgative |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
|
| Curator | |
| Compound ID | 1936 |
| Compound Structure | |
| Plant Source | Ipomoea purga Common Name:Jalap |
| Source Family | Convolvulaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 1:160 dilution |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Unsuitable due to purgative property |
| PubMed ID [Source Literature] | 2118130 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Grange JM, Davey RW.Detection of antituberculous activity in plant extracts.J Appl Bacteriol. 1990 Jun;68(6):587-91
2) http://plants.usda.gov/java/profile?symbol=IPPU6
|
| Curator | |
| Compound ID | 1937 |
| Compound Structure | |
| Plant Source | Ipomoea purga Common Name:Jalap |
| Source Family | Convolvulaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | Partial |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:320 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Unsuitable due to purgative property |
| PubMed ID [Source Literature] | 2118130 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Grange JM, Davey RW.Detection of antituberculous activity in plant extracts.J Appl Bacteriol. 1990 Jun;68(6):587-91
2) http://plants.usda.gov/java/profile?symbol=IPPU6
|
| Curator | |
| Compound ID | 1939 |
| Compound Structure | |
| Plant Source | Iseia luxurians (Moricand) O’Donell Common Name: |
| Source Family | Convolvulaceae |
| Origin | Peru |
| Plant Part Used | Whole plant |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis (ATCC 27294) |
| Assay / Test Done | BACTEC 460 (Becton Dickinson Diagnostic Instrument Systems, Sparks MD) Radiometric Assay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Ethambutol (7.5 µg/ml) |
| Inhibition [%] | 70 % |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 13678239 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Graham JG, Pendland SL, Prause JL, Danzinger LH, Schunke Vigo J, Cabieses F, Farnsworth NR.Antimycobacterial evaluation of Peruvian plants.Phytomedicine. 2003;10(6-7):528-35
|
| Curator | |
| Compound ID | 3470 |
| Compound Structure | N/A |
| Plant Source | Ipomoea muricatum Don syn. Calonyction muricatum Don Common Name: |
| Source Family | Convolvulaceae |
| Origin | India |
| Plant Part Used | Seed |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Alkaloidal fractions (Mixture) |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Mixture |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Reference(s) | 1) Guevara, Beatrice Q, Solevilla, Rosalinda C, Ochoa, Yolanda B, Santiago, Asuncion T, Chua, Jose A.Preliminary phytochemical, microbiological and pharmacological studies of Calonyction muricatum Linn (Convolvulaceae).1978, Acta Manilana, Vol.(Issue) 17(27), Pages 20-39
|
| Curator | |
| Compound ID | 3953 |
| Compound Structure |  |
| Plant Source | Ipomoea tyrianthina Common Name:NR |
| Source Family | Convolvulaceae |
| Origin | NR |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Tyrianthin A |
| PubChem ID | 56674844 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19596196 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Fattyacid, Tyrianthinic acids, Glycolipid, Glycoside, Acylated |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 2093.117 |
| Molecular Formula | C100H172O45 |
| SMILES | O1C2C(OC3C(O)C(O)C(OC3OC(CCCCCCCCCC(=O)OC3C(OC4OC(C(OC(=O)CCCCCCCCCC(OC5OC(C(O)C(O)C5OC5OC(C(O)C(O)C5OC5OC(C(OC6OC(C(OC(=O)C(CC)C)C(O)C6O)C)C(O)C5OC(=O)C(C(O)C)C)C)CO)C)CCCCC)C(O)C4O)C)C(OC1C3OC(=O)C(C(O)C)C)C)CCCCC)C)OC(C(O)C2O)COC(=O)C(C(O)C)C |
| XLogP | 6.942 |
| PSA | 649.390 |
| H-bond Donor | 17 |
| H-bond Acceptor | 45 |
| No. of Rotatable Bond Count | 48 |
| No. of Rings | 9 |
| No. of N | 0 |
| No. of O | 45 |
| No. of S | 0 |
| Reference(s) | 1) León-Rivera I, Mirón-López G, Estrada-Soto S, Aguirre-Crespo F, Gutiérrez Mdel C, Molina-Salinas GM, Hurtado G, Navarrete-Vázquez G, Montiel E.Glycolipid ester-type heterodimers from Ipomoea tyrianthina and their pharmacological activity.Bioorg Med Chem Lett. 2009 Aug 15;19(16):4652-6. Epub 2009 Jun 25
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 3954 |
| Compound Structure |  |
| Plant Source | Ipomoea tyrianthina Common Name:NR |
| Source Family | Convolvulaceae |
| Origin | NR |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Tyrianthin B |
| PubChem ID | 56664530 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19596196 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Fattyacid, Tyrianthinic acids, Glycolipid, Glycoside, Acylated |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 1979.049 |
| Molecular Formula | C94H162O43 |
| SMILES | O1C2C(OC3C(O)C(O)C(OC3OC(CCCCCCCCCC(=O)OC3C(OC4OC(C(OC(=O)CCCCCCCCCC(OC5OC(C(O)C(O)C5OC5OC(C(O)C(O)C5OC5OC(C(OC6OC(C(O)C(O)C6O)C)C(O)C5OC(=O)CCC)C)CO)C)CCCCC)C(O)C4O)C)C(OC1C3OC(=O)C(C(O)C)C)C)CCCCC)C)OC(C(O)C2O)COC(=O)C(C(O)C)C |
| XLogP | 6.464 |
| PSA | 623.090 |
| H-bond Donor | 17 |
| H-bond Acceptor | 43 |
| No. of Rotatable Bond Count | 44 |
| No. of Rings | 9 |
| No. of N | 0 |
| No. of O | 43 |
| No. of S | 0 |
| Reference(s) | 1) León-Rivera I, Mirón-López G, Estrada-Soto S, Aguirre-Crespo F, Gutiérrez Mdel C, Molina-Salinas GM, Hurtado G, Navarrete-Vázquez G, Montiel E.Glycolipid ester-type heterodimers from Ipomoea tyrianthina and their pharmacological activity.Bioorg Med Chem Lett. 2009 Aug 15;19(16):4652-6. Epub 2009 Jun 25
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 4116 |
| Compound Structure |  |
| Plant Source | Ipomoea tyrianthina Common Name: |
| Source Family | Convolvulaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv ATCC 27294 |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | EJMC238 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Fattyacid, Tyrianthinic acids, Glycolipid, Glycoside, Acylated |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 910.477 |
| Molecular Formula | C43H74O20
|
| SMILES | O[C@H]1[C@H](O)[C@H]2O[C@H]3[C@H](O[C@H]4[C@H](OC(=O)CC)[C@H](OC(=O)CCCCCCCCCC(O[C@@H]2O[C@@H]1C)CCCCC)[C@@H](O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](C)O1)[C@H](C)O4)[C@@H](O)[C@H](O)[C@@H](CO)O3 |
| XLogP | 3.259 |
| PSA | 288.280 |
| H-bond Donor | 8 |
| H-bond Acceptor | 20 |
| No. of Rotatable Bond Count | 10 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 20 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4117 |
| Compound Structure |  |
| Plant Source | Ipomoea tyrianthina Common Name: |
| Source Family | Convolvulaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv ATCC 27295 |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | EJMC239 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Fattyacid, Tyrianthinic acids, Glycolipid, Glycoside, Acylated |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 938.509 |
| Molecular Formula | C45H78O20
|
| SMILES | O[C@H]1[C@H](O)[C@H]2O[C@H]3[C@H](O[C@H]4[C@H](OC(=O)C(CC)C)[C@H](OC(=O)CCCCCCCCCC(O[C@@H]2O[C@@H]1C)CCCCC)[C@@H](O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](C)O1)[C@H](C)O4)[C@@H](O)[C@H](O)[C@@H](CO)O3 |
| XLogP | 4.121 |
| PSA | 288.280 |
| H-bond Donor | 8 |
| H-bond Acceptor | 20 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 20 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4118 |
| Compound Structure |  |
| Plant Source | Ipomoea tyrianthina Common Name: |
| Source Family | Convolvulaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv ATCC 27296 |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | EJMC240 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Fatty acid, Acyl, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 1072.567 |
| Molecular Formula | C50H88O24 |
| SMILES | O[C@H]1[C@H](O)[C@@H](O[C@H]2[C@H](O[C@H]3[C@H](OC(=O)C(CC)C)[C@H](O)[C@@H](O[C@H]4[C@H](O)[C@@H](O)[C@H](OC(=O)C(C)C(O)C)[C@@H](C)O4)[C@H](C)O3)[C@@H](O)[C@H](O)[C@@H](CO)O2)[C@H](O[C@@](CCCCC)(O)CCCCCCCCCC(=O)O)O[C@@H]1C |
| XLogP | 2.908 |
| PSA | 366.040 |
| H-bond Donor | 11 |
| H-bond Acceptor | 24 |
| No. of Rotatable Bond Count | 31 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 24 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4119 |
| Compound Structure |  |
| Plant Source | Ipomoea tyrianthina Common Name: |
| Source Family | Convolvulaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv ATCC 27297 |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | EJMC241 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Fatty acid, Acyl, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 1054.556 |
| Molecular Formula | C50H86O23 |
| SMILES | O[C@H]1[C@H](O)[C@@H](O[C@H]2[C@H](O[C@H]3[C@H](OC(=O)C(CC)C)[C@H](O)[C@@H](O[C@H]4[C@H](O)[C@@H](O)[C@H](OC(=O)/C(=C/C)/C)[C@@H](C)O4)[C@H](C)O3)[C@@H](O)[C@H](O)[C@@H](CO)O2)[C@H](O[C@@](CCCCC)(O)CCCCCCCCCC(=O)O)O[C@@H]1C |
| XLogP | 4.031 |
| PSA | 345.810 |
| H-bond Donor | 10 |
| H-bond Acceptor | 23 |
| No. of Rotatable Bond Count | 30 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 23 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |