| Compound ID | 1544 |
| Compound Structure | |
| Plant Source | Costus speciosus (J. Koenig) Sm. Common Name:Crepe Ginger (English), Kushtha (Sanskrit) |
| Source Family | Costaceae |
| Origin | Malaysia |
| Plant Part Used | Stem, flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Colorimetric Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Isoniazid (0.078 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 800 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Chooi, O.H., 2004. Tumbuhan Liar, Khasiat Ubatan dan Kegunaan Lain. Utusan Publications and Distributors Sdn Bhd, Kuala Lumpur, Malaysia
2) http://www.flowersofIndia.net/catalog/slides/Crepe%20Ginger.html
|
| Curator | |
| Compound ID | 3061 |
| Compound Structure |  |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Dehydrocostus lactone |
| PubChem ID | 73174 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 230.131 |
| Molecular Formula | C15H18O2 |
| SMILES | O1[C@@H]2[C@@H]3[C@@H](CCC3=C)C(=C)CC[C@H]2C(=C)C1=O |
| XLogP | 2.451 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuņez IS, Castaņeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | Farzana-shamsudeen, gppreetha |
| Compound ID | 3062 |
| Compound Structure |  |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Dehydrocostus lactone |
| PubChem ID | 73174 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 230.131 |
| Molecular Formula | C15H18O2 |
| SMILES | O1[C@@H]2[C@@H]3[C@@H](CCC3=C)C(=C)CC[C@H]2C(=C)C1=O |
| XLogP | 2.451 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuņez IS, Castaņeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | Farzana-shamsudeen, gppreetha |
| Compound ID | 3063 |
| Compound Structure |  |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | NR |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 128 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 3 - Epizaluzanin C |
| PubChem ID | 470970 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 246.126 |
| Molecular Formula | C15H18O3 |
| SMILES | O1[C@@H]2[C@@H]3[C@@H](C[C@@H](O)C3=C)C(=C)CC[C@H]2C(=C)C1=O |
| XLogP | 1.054 |
| PSA | 46.530 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuņez IS, Castaņeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | Farzana-shamsudeen, gppreetha |
| Compound ID | 3064 |
| Compound Structure |  |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 128 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 7 - α - Hydroxydehydrocostus Lactone |
| PubChem ID | 442258 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 246.126 |
| Molecular Formula | C15H18O3 |
| SMILES | O1[C@@H]2[C@@H]3[C@@H](CCC3=C)C(=C)CC[C@@]2(O)C(=C)C1=O |
| XLogP | 1.293 |
| PSA | 46.530 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuņez IS, Castaņeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | Farzana-shamsudeen, gppreetha |
| Compound ID | 3065 |
| Compound Structure |  |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 4-α-(15)-Epoxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Sesquiterpene, Epoxy, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 246.126 |
| Molecular Formula | C15H18O3 |
| SMILES | C1(=C)[C@H]2[C@@H]([C@@H]3[C@@H](CC1)C(=C)C(=O)O3)[C@]1(CC2)CO1 |
| XLogP | 1.715 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuņez IS, Castaņeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | Farzana-shamsudeen, gppreetha |
| Compound ID | 3066 |
| Compound Structure |  |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 10β(14)-Epoxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Sesquiterpene, Epoxy, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 246.126 |
| Molecular Formula | C15H18O3 |
| SMILES | C12([C@H]3[C@@H]([C@@H]4[C@@H](CC1)C(=C)C(=O)O4)C(=C)CC3)OC2 |
| XLogP | 1.504 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuņez IS, Castaņeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | Farzana-shamsudeen, gppreetha |
| Compound ID | 3067 |
| Compound Structure |  |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 64 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 10α(14)-Epoxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Epoxy, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 246.126 |
| Molecular Formula | C15H18O3 |
| SMILES | C12([C@H]3[C@@H]([C@@H]4[C@@H](CC1)C(=C)C(=O)O4)C(=C)CC3)OC2 |
| XLogP | 1.504 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuņez IS, Castaņeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | Farzana-shamsudeen, gppreetha |
| Compound ID | 3068 |
| Compound Structure |  |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 64 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 4β(15),10α(14)-diepoxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic,Terpene, Sesquiterpene, Epoxy, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 262.121 |
| Molecular Formula | C15H18O4 |
| SMILES | C12([C@H]3[C@@H]([C@@H]4[C@@H](CC1)C(=C)C(=O)O4)C1(CC3)OC1)OC2 |
| XLogP | 0.979 |
| PSA | 51.360 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuņez IS, Castaņeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | Farzana-shamsudeen, gppreetha |
| Compound ID | 3069 |
| Compound Structure |  |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 128 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 4α(15),10α(14)Diepoxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Sesquiterpene, Epoxy, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 262.121 |
| Molecular Formula | C15H18O4 |
| SMILES | C12([C@H]3[C@@H]([C@@H]4[C@@H](CC1)C(=C)C(=O)O4)C1(CC3)CO1)OC2 |
| XLogP | 0.979 |
| PSA | 51.360 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuņez IS, Castaņeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | Farzana-shamsudeen, gppreetha |
| Compound ID | 3070 |
| Compound Structure |  |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 128 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 4α(15),10β(14)-diepoxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic,Terpene, Sesquiterpene, Epoxy, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 262.121 |
| Molecular Formula | C15H18O4 |
| SMILES | C12([C@H]3[C@@H]([C@@H]4[C@@H](CC1)C(=C)C(=O)O4)C1(CC3)OC1)OC2 |
| XLogP | 0.979 |
| PSA | 51.360 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuņez IS, Castaņeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | Farzana-shamsudeen, gppreetha |
| Compound ID | 3071 |
| Compound Structure |  |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Micheliolide |
| PubChem ID | 442279 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 248.141 |
| Molecular Formula | C15H20O3 |
| SMILES | O1[C@@H]2[C@H]3[C@](O)(CCC3=C(CC[C@H]2C(=C)C1=O)C)C |
| XLogP | 1.233 |
| PSA | 46.530 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuņez IS, Castaņeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | Farzana-shamsudeen, gppreetha |
| Compound ID | 3072 |
| Compound Structure |  |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 128 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Pumilin |
| PubChem ID | 6436294 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone , Acyl, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 374.137 |
| Molecular Formula | C20H22O7 |
| SMILES | O1[C@H]2[C@@H]([C@@H](O)[C@H](OC(=O)/C(=CC)/C)C(=C3[C@]2(O)C(=CC3=O)C)C)C(=C)C1=O |
| XLogP | -0.432 |
| PSA | 110.130 |
| H-bond Donor | 2 |
| H-bond Acceptor | 7 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuņez IS, Castaņeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | Farzana-shamsudeen, gppreetha |
| Compound ID | 3073 |
| Compound Structure |  |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 128 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Pumilin |
| PubChem ID | 6436294 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone , Acyl, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 374.137 |
| Molecular Formula | C20H22O7
|
| SMILES | O1[C@H]2[C@@H]([C@@H](O)[C@H](OC(=O)/C(=CC)/C)C(=C3[C@]2(O)C(=CC3=O)C)C)C(=C)C1=O |
| XLogP | -0.432 |
| PSA | 110.130 |
| H-bond Donor | 2 |
| H-bond Acceptor | 7 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuņez IS, Castaņeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | |