| Compound ID | 1944 |
| Compound Structure | |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Berry |
| Extract | Methanol (21.82 %) |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1945 |
| Compound Structure | |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Berry |
| Extract | Methanol (21.82 %) |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1946 |
| Compound Structure | |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Leaf |
| Extract | Hexane, methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Isoniazid and Ethambutol resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 13680821 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Jimenez-Arellanes A, Meckes M, Ramirez R, Torres J, Luna-Herrera J.Activity against multidrug-resistant Mycobacterium tuberculosis in Mexican plants used to treat respiratory diseases.Phytother Res. 2003 Sep;17(8):903-8
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1947 |
| Compound Structure | |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Leaf |
| Extract | Hexane, methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Rifampin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Jimenez-Arellanes A, Meckes M, Ramirez R, Torres J, Luna-Herrera J.Activity against multidrug-resistant Mycobacterium tuberculosis in Mexican plants used to treat respiratory diseases.Phytother Res. 2003 Sep;17(8):903-8
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1948 |
| Compound Structure | |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Leaf |
| Extract | Water |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Broth Dilution Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:40 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1949 |
| Compound Structure | |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Mother tinture |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (human) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:40 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 2118130 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Grange JM, Davey RW.Detection of antituberculous activity in plant extracts.J Appl Bacteriol. 1990 Jun;68(6):587-91
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1950 |
| Compound Structure | |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Whole plant |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avium |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | Isoniazid (10 µl of mg/ml) |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 50 µg extract/Disc |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) A.R. McCutcheon, R.W. Stokes, L.M. Thorson, S.M. Ellis, R.E.W. Hancock and G.H.N. Towers.Anti-Mycobacterial Screening of British Columbian Medicinal Plants.Pharmaceutical Biology, 1997, Vol. 35, No. 2 , Pages 77-83
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1951 |
| Compound Structure |  |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Low Oxygen Recovery Assay (LORA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | 97.7 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Longifolene |
| PubChem ID | 289151 |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 19755141 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Sesquiterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against mammalian Vero cells (ATCC CCL-81) |
| Molecular Weight | 204.188 |
| Molecular Formula | C15H24 |
| SMILES | C12C3C(C(=C)C1CC3)(CCCC2(C)C)C |
| XLogP | 6.444 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Gordien AY, Gray AI, Franzblau SG, Seidel V.Antimycobacterial terpenoids from Juniperus communis L. (Cuppressaceae).J Ethnopharmacol. 2009 Dec 10;126(3):500-5
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1952 |
| Compound Structure |  |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 21.1 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Totarol |
| PubChem ID | 92783 |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 19755141 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 286.230 |
| Molecular Formula | C20H30O |
| SMILES | Oc1c(c2c([C@@]3([C@H](C(CCC3)(C)C)CC2)C)cc1)C(C)C |
| XLogP | 8.211 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Gordien AY, Gray AI, Franzblau SG, Seidel V.Antimycobacterial terpenoids from Juniperus communis L. (Cuppressaceae).J Ethnopharmacol. 2009 Dec 10;126(3):500-5
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1953 |
| Compound Structure |  |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Non-replicating Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Low Oxygen Recovery Assay (LORA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 23.3 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Totarol |
| PubChem ID | 92783 |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 19755141 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 286.230 |
| Molecular Formula | C20H30O |
| SMILES | Oc1c(c2c([C@@]3([C@H](C(CCC3)(C)C)CC2)C)cc1)C(C)C |
| XLogP | 8.211 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Gordien AY, Gray AI, Franzblau SG, Seidel V.Antimycobacterial terpenoids from Juniperus communis L. (Cuppressaceae).J Ethnopharmacol. 2009 Dec 10;126(3):500-5
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1954 |
| Compound Structure |  |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (Isoniazid - resistant variant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 11 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Totarol |
| PubChem ID | 92783 |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 19755141 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 286.230 |
| Molecular Formula | C20H30O |
| SMILES | Oc1c(c2c([C@@]3([C@H](C(CCC3)(C)C)CC2)C)cc1)C(C)C |
| XLogP | 8.211 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Gordien AY, Gray AI, Franzblau SG, Seidel V.Antimycobacterial terpenoids from Juniperus communis L. (Cuppressaceae).J Ethnopharmacol. 2009 Dec 10;126(3):500-5
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1955 |
| Compound Structure |  |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (Streptomycin - resistant variant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 23.9 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Totarol |
| PubChem ID | 92783 |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 19755141 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 286.230 |
| Molecular Formula | C20H30O |
| SMILES | Oc1c(c2c([C@@]3([C@H](C(CCC3)(C)C)CC2)C)cc1)C(C)C |
| XLogP | 8.211 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Gordien AY, Gray AI, Franzblau SG, Seidel V.Antimycobacterial terpenoids from Juniperus communis L. (Cuppressaceae).J Ethnopharmacol. 2009 Dec 10;126(3):500-5
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1956 |
| Compound Structure |  |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (Moxifloxacin - resistant variant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 17.2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Totarol |
| PubChem ID | 92783 |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 19755141 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 286.230 |
| Molecular Formula | C20H30O |
| SMILES | Oc1c(c2c([C@@]3([C@H](C(CCC3)(C)C)CC2)C)cc1)C(C)C |
| XLogP | 8.211 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Gordien AY, Gray AI, Franzblau SG, Seidel V.Antimycobacterial terpenoids from Juniperus communis L. (Cuppressaceae).J Ethnopharmacol. 2009 Dec 10;126(3):500-5
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1957 |
| Compound Structure |  |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (Rifampin resistant variant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 5.8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Totarol |
| PubChem ID | 92783 |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 19755141 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 286.230 |
| Molecular Formula | C20H30O |
| SMILES | Oc1c(c2c([C@@]3([C@H](C(CCC3)(C)C)CC2)C)cc1)C(C)C |
| XLogP | 8.211 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Gordien AY, Gray AI, Franzblau SG, Seidel V.Antimycobacterial terpenoids from Juniperus communis L. (Cuppressaceae).J Ethnopharmacol. 2009 Dec 10;126(3):500-5
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1958 |
| Compound Structure |  |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium aurum, Mycobacterium phlei, Mycobacterium fortuitum, Mycobacterium smegmatis |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2 - 4 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Totarol |
| PubChem ID | 92783 |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 19755141 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 286.230 |
| Molecular Formula | C20H30O |
| SMILES | Oc1c(c2c([C@@]3([C@H](C(CCC3)(C)C)CC2)C)cc1)C(C)C |
| XLogP | 8.211 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Gordien AY, Gray AI, Franzblau SG, Seidel V.Antimycobacterial terpenoids from Juniperus communis L. (Cuppressaceae).J Ethnopharmacol. 2009 Dec 10;126(3):500-5
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1959 |
| Compound Structure |  |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Trans - Communic Acid |
| PubChem ID | 637125 |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 19755141 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Alkene, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 302.225 |
| Molecular Formula | C20H30O2 |
| SMILES | OC(=O)[C@@]1([C@H]2[C@@]([C@H](C(=C)CC2)C/C=C(C)/C=C)(CCC1)C)C |
| XLogP | 6.407 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Gordien AY, Gray AI, Franzblau SG, Seidel V.Antimycobacterial terpenoids from Juniperus communis L. (Cuppressaceae).J Ethnopharmacol. 2009 Dec 10;126(3):500-5
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1960 |
| Compound Structure | |
| Plant Source | Juniperus excelsa M. Bieb. Common Name:Grecian Juniper |
| Source Family | Cupressaceae |
| Origin | India, Saudi Arabia |
| Plant Part Used | Fruit |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 15.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 10234860 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Topçu G, Erenler R, Cakmak O, Johansson CB, Celik C, Chai HB, Pezzuto JM.Diterpenes from the berries of Juniperus excelsa.Phytochemistry. 1999 Apr;50(7):1195-9
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Juniperus+excelsa
|
| Curator | |
| Compound ID | 1961 |
| Compound Structure | |
| Plant Source | Juniperus excelsa M. Bieb. Common Name:Grecian Juniper |
| Source Family | Cupressaceae |
| Origin | India, Saudi Arabia |
| Plant Part Used | Fruit |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 17 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 10234860 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Topçu G, Erenler R, Cakmak O, Johansson CB, Celik C, Chai HB, Pezzuto JM.Diterpenes from the berries of Juniperus excelsa.Phytochemistry. 1999 Apr;50(7):1195-9
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Juniperus+excelsa
|
| Curator | |
| Compound ID | 1962 |
| Compound Structure |  |
| Plant Source | Juniperus excelsa M. Bieb. Common Name:Grecian Juniper |
| Source Family | Cupressaceae |
| Origin | India, Saudi Arabia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 14.4 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Juniperexcelsic acid |
| PubChem ID | 490535 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 10234860 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Alkene, Acetyl, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB cells |
| Molecular Weight | 362.246 |
| Molecular Formula | C22H34O4 |
| SMILES | O(C1[C@](C2[C@@](C(C(CC2)C)CCC(=C)C=C)(CC1)C)(C)C(=O)O)C(=O)C |
| XLogP | 6.661 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Topçu G, Erenler R, Cakmak O, Johansson CB, Celik C, Chai HB, Pezzuto JM.Diterpenes from the berries of Juniperus excelsa.Phytochemistry. 1999 Apr;50(7):1195-9
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Juniperus+excelsa
|
| Curator | |
| Compound ID | 1963 |
| Compound Structure |  |
| Plant Source | Juniperus excelsa M. Bieb. Common Name:Grecian Juniper |
| Source Family | Cupressaceae |
| Origin | India, Saudi Arabia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 15 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sandaracopimaric acid |
| PubChem ID | 221580 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 10234860 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB cells |
| Molecular Weight | 302.225 |
| Molecular Formula | C20H30O2
|
| SMILES | OC(=O)[C@]1([C@H]2[C@@]([C@@H]3C(=C[C@@](CC3)(C)C=C)CC2)(CCC1)C)C |
| XLogP | 6.935 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Topçu G, Erenler R, Cakmak O, Johansson CB, Celik C, Chai HB, Pezzuto JM.Diterpenes from the berries of Juniperus excelsa.Phytochemistry. 1999 Apr;50(7):1195-9
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Juniperus+excelsa
|
| Curator | |
| Compound ID | 1964 |
| Compound Structure |  |
| Plant Source | Juniperus excelsa M. Bieb. Common Name:Grecian Juniper |
| Source Family | Cupressaceae |
| Origin | India, Saudi Arabia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sclareol |
| PubChem ID | 73114 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 10234860 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Alcohol, Alkene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB cells |
| Molecular Weight | 308.272 |
| Molecular Formula | C20H36O2
|
| SMILES | O[C@]1([C@@H]([C@@]2(C(C(CCC2)(C)C)CC1)C)CC[C@](O)(C)C=C)C |
| XLogP | 5.989 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Topçu G, Erenler R, Cakmak O, Johansson CB, Celik C, Chai HB, Pezzuto JM.Diterpenes from the berries of Juniperus excelsa.Phytochemistry. 1999 Apr;50(7):1195-9
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Juniperus+excelsa
|
| Curator | |
| Compound ID | 1965 |
| Compound Structure |  |
| Plant Source | Juniperus procera Hochst Common Name:Grecian Juniper |
| Source Family | Cupressaceae |
| Origin | India, Saudi Arabia |
| Plant Part Used | Leaf |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium smegmatis, Mycobacterium intracellulare, Mycobacterium chelonae, Mycobacterium xenopi |
| Assay / Test Done | |
| Positive Control Used (conc.) | Streptomycin (10 µg/ml), Isoniazid (10 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | (+)-Ferruginol |
| PubChem ID | 403773 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 10925394 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 286.230 |
| Molecular Formula | C20H30O |
| SMILES | Oc1cc2[C@@]3(C(C(CCC3)(C)C)CCc2cc1C(C)C)C |
| XLogP | 8.211 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) I. Muhammad*, J.S. Mossa, F.S. El-Feraly.Antibacterial diterpenes from the leaves and seeds of Juniperus excelsa M. Bieb.Phytotherapy Research, Volume 6, Issue 5, pages 261–264, September/October 1992
2) Newton SM, Lau C, Wright CW.A review of antimycobacterial natural products.Phytother Res. 2000 Aug;14(5):303-22
3) http://www.pfaf.org/user/Plant.aspx?LatinName=Juniperus+excelsa
|
| Curator | |
| Compound ID | 1966 |
| Compound Structure |  |
| Plant Source | Juniperus excelsa M. Bieb. Common Name:Grecian Juniper |
| Source Family | Cupressaceae |
| Origin | India, Saudi Arabia |
| Plant Part Used | Leaf |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | (-) - Sandaracopimaric acid |
| PubChem ID | 221580 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 302.225 |
| Molecular Formula | C20H30O2
|
| SMILES | OC(=O)[C@]1([C@H]2[C@@]([C@@H]3C(=C[C@@](CC3)(C)C=C)CC2)(CCC1)C)C |
| XLogP | 6.935 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) I. Muhammad*, J.S. Mossa, F.S. El-Feraly.Antibacterial diterpenes from the leaves and seeds of Juniperus excelsa M. Bieb.Phytotherapy Research, Volume 6, Issue 5, pages 261–264, September/October 1992
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Juniperus+excelsa
|
| Curator | |
| Compound ID | 1967 |
| Compound Structure |  |
| Plant Source | Juniperus excelsa M. Bieb. Common Name:Grecian Juniper |
| Source Family | Cupressaceae |
| Origin | India, Saudi Arabia |
| Plant Part Used | Leaf |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR (inactive) |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Hinokiol |
| PubChem ID | 432946 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 302.225 |
| Molecular Formula | C20H30O2 |
| SMILES | OC1C(C2C(CC1)(c1c(CC2)cc(c(O)c1)C(C)C)C)(C)C |
| XLogP | 5.704 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) I. Muhammad*, J.S. Mossa, F.S. El-Feraly.Antibacterial diterpenes from the leaves and seeds of Juniperus excelsa M. Bieb.Phytotherapy Research, Volume 6, Issue 5, pages 261–264, September/October 1992
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Juniperus+excelsa
|
| Curator | |
| Compound ID | 1968 |
| Compound Structure |  |
| Plant Source | Juniperus procera Hochst Common Name:African Pencil Cedar, Cedar, East African Cedar, East African Pencil Cedar, Pencil Cedar |
| Source Family | Cupressaceae |
| Origin | Saudi Arabia |
| Plant Part Used | Bark |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium intracellulare, Mycobacterium xenopi, Mycobacterium chelonae / chelonei, Mycobacterium smegmatis |
| Assay / Test Done | |
| Positive Control Used (conc.) | Streptomycin (10 µg/ml), Isoniazid (10 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | (+)-Totarol |
| PubChem ID | 460178 |
| Ethnomedicinal Information | Sore throat, chew fruits |
| PubMed ID [Source Literature] | 10925394 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 286.230 |
| Molecular Formula | C20H30O |
| SMILES | Oc1c(c2c([C@@]3(C(C(CCC3)(C)C)CC2)C)cc1)C(C)C |
| XLogP | 8.211 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Newton SM, Lau C, Wright CW.A review of antimycobacterial natural products.Phytother Res. 2000 Aug;14(5):303-22
2) http://www.worldagroforestrycentre.org/sea/Products/AFDbases/af/asp/SpeciesInfo.asp?SpID=1022
|
| Curator | |