| Compound ID | 2304 |
| Compound Structure | |
| Plant Source | Pelargonium grossularioides Common Name:Gooseberry Leaved Pelargonium |
| Source Family | Geraniaceae |
| Origin | Africa |
| Plant Part Used | Tuber |
| Extract | |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis, coughs |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) G. Scott, E.P. Springfield and N. Coldrey.A Pharmacognostical Study of 26 South African Plant Species Used as Traditional Medicines.Pharmaceutical Biology, 2004, Vol. 42, No. 3 , Pages 186-213
2) http://www.plantzAfrica.com/plantnop/pelarggross.htm
|
| Curator | |
| Compound ID | 2305 |
| Compound Structure | |
| Plant Source | Pelargonium reniforme Common Name: |
| Source Family | Geraniaceae |
| Origin | Africa |
| Plant Part Used | Tuber |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium aurum, Mycobacterium smegmatis, Mycobacterium fortuitum, Mycobacterium abscessus, Mycobacterium phlei |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis, coughs |
| PubMed ID [Source Literature] | 15194133 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Seidel V, Taylor PW. In vitro activity of extracts and constituents of Pelagonium against rapidly growing mycobacteria. Int J Antimicrob Agents. 2004, Jun;23(6):613-9
|
| Curator | |
| Compound ID | 2306 |
| Compound Structure |  |
| Plant Source | Pelargonium reniforme Common Name: |
| Source Family | Geraniaceae |
| Origin | Africa |
| Plant Part Used | Tuber |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Linoleic Acid |
| PubChem ID | 5280450 |
| Ethnomedicinal Information | Tuberculosis, coughs |
| PubMed ID [Source Literature] | 15194133 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 280.240 |
| Molecular Formula | C18H32O2 |
| SMILES | OC(=O)CCCCCCC/C=CC/C=CCCCCC |
| XLogP | 7.865 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 14 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Seidel V, Taylor PW. In vitro activity of extracts and constituents of Pelagonium against rapidly growing mycobacteria. Int J Antimicrob Agents. 2004, Jun;23(6):613-9
|
| Curator | |
| Compound ID | 2307 |
| Compound Structure | |
| Plant Source | Pelargonium sidoides Common Name:African Geranium |
| Source Family | Geraniaceae |
| Origin | Africa |
| Plant Part Used | Tuber |
| Extract | Unsaturated fatty acids |
| Target Bacteria | Mycobacterium aurum, Mycobacterium smegmatis, Mycobacterium fortuitum, Mycobacterium abscessus, Mycobacterium phlei |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis, coughs |
| PubMed ID [Source Literature] | 15194133 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Seidel V, Taylor PW. In vitro activity of extracts and constituents of Pelagonium against rapidly growing mycobacteria. Int J Antimicrob Agents. 2004, Jun;23(6):613-9
|
| Curator | |
