| Compound ID | 3667 |
| Compound Structure |  |
| Plant Source | Engelhardia roxburghiana Hay Common Name: |
| Source Family | Juglandaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3-Methoxycarbonyl-1,5-dihydroxyanthraquinone |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15729627 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Anthraquinone, Ester, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 298.048 |
| Molecular Formula | C16H10O6 |
| SMILES | C1ccc(c2c1C(=O)c1c(C2=O)cc(cc1O)C(=O)OC)O |
| XLogP | 0.862 |
| PSA | 100.900 |
| H-bond Donor | 2 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Lin WY, Peng CF, Tsai IL, Chen JJ, Cheng MJ, Chen IS.Antitubercular constituents from the roots of Engelhardia roxburghiana.Planta Med. 2005 Feb;71(2):171-5
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3668 |
| Compound Structure |  |
| Plant Source | Engelhardia roxburghiana Hay Common Name: |
| Source Family | Juglandaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 5 - Hydroxy - 4 - Methoxy - 1 - Tetralone |
| PubChem ID | 11355988 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15729627 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Napthalene, Ketone, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 192.079 |
| Molecular Formula | C11H12O3 |
| SMILES | O([C@H]1CCC(=O)c2c1c(O)ccc2)C |
| XLogP | 0.849 |
| PSA | 46.530 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Lin WY, Peng CF, Tsai IL, Chen JJ, Cheng MJ, Chen IS.Antitubercular constituents from the roots of Engelhardia roxburghiana.Planta Med. 2005 Feb;71(2):171-5
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3669 |
| Compound Structure |  |
| Plant Source | Engelhardia roxburghiana Hay Common Name: |
| Source Family | Juglandaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 0.2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Engelhardione |
| PubChem ID | 11404174 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15729627 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Ketone, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 312.136 |
| Molecular Formula | C19H20O4 |
| SMILES | O1c2cc(CCCCC(=O)CCc3cc1c(O)cc3)ccc2O |
| XLogP | 3.415 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Lin WY, Peng CF, Tsai IL, Chen JJ, Cheng MJ, Chen IS.Antitubercular constituents from the roots of Engelhardia roxburghiana.Planta Med. 2005 Feb;71(2):171-5
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3985 |
| Compound Structure |  |
| Plant Source | Engelhardia roxburghiana Common Name: |
| Source Family | Juglandaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 4.0 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | (-)-4-Hydroxy-1-tetralone |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Cyclohexanone, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 162.068 |
| Molecular Formula | C10H10O2
|
| SMILES | O[C@H]1CCC(=O)c2c1cccc2 |
| XLogP | 1.715 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) Rogoza, L. N.; Salakhutdinov, N. F.; Tolstikov, G. A. Anti-tubercular Activity of Natural Products: Recent Developments. In Opportunity, Challenge and Scope of Natural Products in Medicinal Chemistry; Tiwari, V. K. Ed.; Research Signpost: India, 2011; pp 103-120
|
| Curator | |
| Compound ID | 4085 |
| Compound Structure |  |
| Plant Source | Engelhardia roxburghiana Common Name: |
| Source Family | Juglandaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 20 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Engelharquinone |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Napthoquinone, Ketone, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 348.063 |
| Molecular Formula | C20H12O6 |
| SMILES | O=C1C2=C([C@@]3(O)c4cccc(O)c4C(=O)[C@@H]2C3)C(=O)c2c(O)cccc12 |
| XLogP | -0.276 |
| PSA | 111.900 |
| H-bond Donor | 3 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4086 |
| Compound Structure |  |
| Plant Source | Engelhardia roxburghiana Common Name: |
| Source Family | Juglandaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 30 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 2-Methoxyjuglone |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Napthalene, Quinone, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 204.042 |
| Molecular Formula | C11H8O4
|
| SMILES | O=C1C(=CC(=O)c2c(O)cccc12)OC |
| XLogP | 0.815 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4087 |
| Compound Structure |  |
| Plant Source | Engelhardia roxburghiana Common Name: |
| Source Family | Juglandaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3.125 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3-Methoxyjuglone |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Napthalene, Quinone, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 204.042 |
| Molecular Formula | C11H8O4
|
| SMILES | O=C1C(=CC(=O)c2cccc(O)c12)OC |
| XLogP | 0.815 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |