| Compound ID | 1229 |
| Compound Structure | |
| Plant Source | Azadirachta indica A.juss. Common Name:Neem Tree, Margosa Tree (English), Nimba, Nimbaka (Sanskrit) |
| Source Family | Meliaceae |
| Origin | India, Kenya |
| Plant Part Used | Leaf |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, asthma, consumption, phthisis, tuberculosis, anthelmintic, antiseptic. Used to treat chronic leprosy, skin diseases, intestinal worms, chronic malaria fevers, small pox, syphylictic sores |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) Rao, R.R.Ethnobotanical studies on the flora of Meghalaya -- Some interesting reports of herbal medicines.1981, S.K. Jain (Ed.), 137-148
|
| Curator | |
| Compound ID | 1230 |
| Compound Structure | |
| Plant Source | Azadirachta indica A.juss. Common Name:Neem Tree, Margosa Tree (English), Nimba, Nimbaka (Sanskrit) |
| Source Family | Meliaceae |
| Origin | India, Kenya |
| Plant Part Used | Leaf |
| Extract | Methanol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, asthma, consumption, phthisis, tuberculosis, anthelmintic, antiseptic. Used to treat chronic leprosy, skin diseases, intestinal worms, chronic malaria fevers, small pox, syphylictic sores |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) Rao, R.R.Ethnobotanical studies on the flora of Meghalaya -- Some interesting reports of herbal medicines.1981, S.K. Jain (Ed.), 137-148
|
| Curator | |
| Compound ID | 1231 |
| Compound Structure | |
| Plant Source | Azadirachta indica A.juss. Common Name:Neem Tree, Margosa Tree (English), Nimba, Nimbaka (Sanskrit) |
| Source Family | Meliaceae |
| Origin | India, Kenya |
| Plant Part Used | Stem bark |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis, Mycobacterium avian, Mycobacterium chelonae, Mycobacterium intracellulare, Mycobacterium tarrae |
| Assay / Test Done | Broth Dilution Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | 10 % |
| Activity [MIC] µg/ml | 8000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, asthma, consumption, phthisis, tuberculosis, anthelmintic, antiseptic. Used to treat chronic leprosy, skin diseases, intestinal worms, chronic malaria fevers, small pox, syphylictic sores |
| PubMed ID [Source Literature] | 9533435 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Fabry W, Okemo PO, Ansorg R.Antibacterial activity of East African medicinal plants.J Ethnopharmacol. 1998 Feb;60(1):79-84
|
| Curator | |
| Compound ID | 1233 |
| Compound Structure | |
| Plant Source | Balsamorhiza sagittata (Pursh) Nutt. Common Name:Arrowleaf Balsamroot |
| Source Family | Meliaceae |
| Origin | British Columbia |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | Isoniazid |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 50 µg extract/Disc |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Stomach pains, colds, whooping cough, tuberculosis, fevers and headache, to treat sore mouths and throats, toothaches, for body aches such as rheumatism, on wounds, blisters, bites, swellings and sores (root), for dysentery (seeds) |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) A.R. McCutcheon, R.W. Stokes, L.M. Thorson, S.M. Ellis, R.E.W. Hancock and G.H.N. Towers.Anti-Mycobacterial Screening of British Columbian Medicinal Plants.Pharmaceutical Biology, 1997, Vol. 35, No. 2 , Pages 77-83
|
| Curator | |
| Compound ID | 1620 |
| Compound Structure | |
| Plant Source | Dysoxylum spectabile Common Name:Kohekohe |
| Source Family | Meliaceae |
| Origin | New Zealand |
| Plant Part Used | Leaf |
| Extract | |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | 96 well - plate format assay for bacteriostatic activity, two - fold serial dilution to measure any background optical density or fluorescence associated with the extract |
| Positive Control Used (conc.) | Rifampin (100 µM), Streptomycin (100 µM) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, colds and fevers |
| PubMed ID [Source Literature] | 20537175 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Earl EA, Altaf M, Murikoli RV, Swift S, O Toole R.Native New Zealand plants with inhibitory activity towards Mycobacterium tuberculosis.BMC Complement Altern Med. 2010 Jun 10;10:25
|
| Curator | |
| Compound ID | 1623 |
| Compound Structure | |
| Plant Source | Ekebergia capensis Sparrm. Common Name:Cape Ash, Dogplum |
| Source Family | Meliaceae |
| Origin | Africa |
| Plant Part Used | Root, leaf, bark |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Chronic coughs, respiratory chest complaints, Tuberculosis |
| PubMed ID [Source Literature] | 10473184 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Lall N, Meyer JJ.In vitro inhibition of drug-resistant and drug-sensitive strains of Mycobacterium tuberculosis by ethnobotanically selected South African plants.J Ethnopharmacol. 1999 Sep;66(3):347-54
2) http://www.plantzAfrica.com/plantefg/ekebergcap.htm
3) Watt, John Mitchell, and Maria Gerdina Breyer-Brandwijk. 1962. The medicinal and poisonous plants of southern and eastern Africa; being an account of their medicinal and other uses, chemical composition, pharmacological effects and toxicology in man and animal. Edinburgh: Livingstone (2nd Editio
|
| Curator | |
| Compound ID | 1829 |
| Compound Structure | |
| Plant Source | Guaria guidonia (L.) Sleumer Common Name:American Muskwood |
| Source Family | Meliaceae |
| Origin | Peru |
| Plant Part Used | Leaf |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis (ATCC 27294) |
| Assay / Test Done | BACTEC 460 (Becton Dickinson Diagnostic Instrument Systems, Sparks MD) Radiometric Assay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Ethambutol (7.5 µg/ml) |
| Inhibition [%] | 74 % |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 13678239 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Graham JG, Pendland SL, Prause JL, Danzinger LH, Schunke Vigo J, Cabieses F, Farnsworth NR.Antimycobacterial evaluation of Peruvian plants.Phytomedicine. 2003;10(6-7):528-35
|
| Curator | |
| Compound ID | 1830 |
| Compound Structure | |
| Plant Source | Guaria guidonia (L.) Sleumer Common Name: |
| Source Family | Meliaceae |
| Origin | Peru |
| Plant Part Used | Bark |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis (ATCC 27294) |
| Assay / Test Done | BACTEC 460 (Becton Dickinson Diagnostic Instrument Systems, Sparks MD) Radiometric Assay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Ethambutol (7.5 µg/ml) |
| Inhibition [%] | < 50 % |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 13678239 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Graham JG, Pendland SL, Prause JL, Danzinger LH, Schunke Vigo J, Cabieses F, Farnsworth NR.Antimycobacterial evaluation of Peruvian plants.Phytomedicine. 2003;10(6-7):528-35
|
| Curator | |
| Compound ID | 2655 |
| Compound Structure | |
| Plant Source | Swietenia humilis Common Name:Pacific Mahogany, Dry Zone Mahogany |
| Source Family | Meliaceae |
| Origin | Mexico |
| Plant Part Used | Seed |
| Extract | Hexane, methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Adelina Jimenez-Arellanes1, Mariana Meckes1, Raquel Ramirez1, Javier Torres2 and Julieta Luna-Herrera3 Activity against Multidrug-resistant Mycobacterium tuberculosis in Mexican Plants Used to Treat Respiratory Diseases PHYTOTHERAPY RESEARCH Phytother.
2) http://www.worldagroforestry.org/treedb2/AFTPDFS/Swietenia_humilis.pdf
|
| Curator | |
| Compound ID | 2656 |
| Compound Structure | |
| Plant Source | Swietenia humilis Common Name:Pacific Mahogany, Dry Zone Mahogany |
| Source Family | Meliaceae |
| Origin | Mexico |
| Plant Part Used | Leaf |
| Extract | Hexane, methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Adelina Jimenez-Arellanes1, Mariana Meckes1, Raquel Ramirez1, Javier Torres2 and Julieta Luna-Herrera3 Activity against Multidrug-resistant Mycobacterium tuberculosis in Mexican Plants Used to Treat Respiratory Diseases PHYTOTHERAPY RESEARCH Phytother.
2) http://www.worldagroforestry.org/treedb2/AFTPDFS/Swietenia_humilis.pdf
|
| Curator | |
| Compound ID | 2657 |
| Compound Structure | |
| Plant Source | Swietenia mahogani (L.)Jacq. Common Name:West Indian Mahogany |
| Source Family | Meliaceae |
| Origin | India, Puerto Rico |
| Plant Part Used | Stem |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (1 µg/ml) |
| Inhibition [%] | 83 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antipyretic, tonic, astringent and as a substitute for cinchona bark folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 11746852 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Antoun MD, Ramos Z, Vazques J, Oquendo I, Proctor GR, Gerena L, Franzblau SG.Evaluation of the flora of Puerto Rico for in vitro antiplasmodial and antimycobacterial activities.Phytother Res. 2001 Nov;15(7):638-42
2) Anonymous, 1986. The Useful Plants of India. Council of Scientific and Industrial Research, New Delhi, India
|
| Curator | |
| Compound ID | 2738 |
| Compound Structure | |
| Plant Source | Trichilia dregeana Harv. & Sond. Common Name:Forest Mahogany, Forest Natal Mahogany, Cape Mahogany, Thunder Tree, Christmas Bells, Red Ash |
| Source Family | Meliaceae |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | Ethyl acetate |
| Target Bacteria | Mycobacterium aurum A+ |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Ciprofloxacin (1.8 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6250 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Gonorrhea, fever, diarrhoea, pain in the back and as a purgative |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Eldeen, I.M.S., Van Staden, J., 2007. Antimycobacterial activity of some trees used in South African traditional medicine. South African Journal of Botany 73, 248–25
2) http://database.prota.org/PROTAhtml/Trichilia%20dregeana_En.htm
|
| Curator | |
| Compound ID | 2739 |
| Compound Structure | |
| Plant Source | Trichilia dregeana Harv. & Sond. Common Name:Forest Mahogany, Forest Natal Mahogany, Cape Mahogany, Thunder Tree, Christmas Bells, Red Ash |
| Source Family | Meliaceae |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium aurum A+ |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Ciprofloxacin (1.8 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 780 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Gonorrhea, fever, diarrhoea, pain in the back and as a purgative |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Eldeen, I.M.S., Van Staden, J., 2007. Antimycobacterial activity of some trees used in South African traditional medicine. South African Journal of Botany 73, 248–25
2) http://database.prota.org/PROTAhtml/Trichilia%20dregeana_En.htm
|
| Curator | |
| Compound ID | 2740 |
| Compound Structure | |
| Plant Source | Trichilia dregeana Harv. & Sond. Common Name:Forest Mahogany, Forest Natal Mahogany, Cape Mahogany, Thunder Tree, Christmas Bells, Red Ash |
| Source Family | Meliaceae |
| Origin | Africa |
| Plant Part Used | Bark |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium aurum A+ |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Ciprofloxacin (1.8 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1560 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Gonorrhea, fever, diarrhoea, pain in the back and as a purgative |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Eldeen, I.M.S., Van Staden, J., 2007. Antimycobacterial activity of some trees used in South African traditional medicine. South African Journal of Botany 73, 248–25
2) http://database.prota.org/PROTAhtml/Trichilia%20dregeana_En.htm
|
| Curator | |
| Compound ID | 2741 |
| Compound Structure | |
| Plant Source | Trichilia dregeana Harv. & Sond. Common Name:Forest Mahogany, Forest Natal Mahogany, Cape Mahogany, Thunder Tree, Christmas Bells, Red Ash |
| Source Family | Meliaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium aurum A+ |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Ciprofloxacin (1.8 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3120 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Gonorrhea, fever, diarrhoea, pain in the back and as a purgative |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Eldeen, I.M.S., Van Staden, J., 2007. Antimycobacterial activity of some trees used in South African traditional medicine. South African Journal of Botany 73, 248–25
2) http://database.prota.org/PROTAhtml/Trichilia%20dregeana_En.htm
|
| Curator | |
| Compound ID | 2742 |
| Compound Structure | |
| Plant Source | Trichilia dregeana Harv. & Sond. Common Name:Forest Mahogany, Forest Natal Mahogany, Cape Mahogany, Thunder Tree, Christmas Bells, Red Ash |
| Source Family | Meliaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium aurum A+ |
| Assay / Test Done | Broth Microdilution Method (BMM) |
| Positive Control Used (conc.) | Ciprofloxacin (1.8 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6250 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Gonorrhea, fever, diarrhoea, pain in the back and as a purgative |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Eldeen, I.M.S., Van Staden, J., 2007. Antimycobacterial activity of some trees used in South African traditional medicine. South African Journal of Botany 73, 248–25
2) http://database.prota.org/PROTAhtml/Trichilia%20dregeana_En.htm
|
| Curator | |
| Compound ID | 2743 |
| Compound Structure | |
| Plant Source | Trichilia hirta L. Common Name:Broomstick |
| Source Family | Meliaceae |
| Origin | Puerto Rico |
| Plant Part Used | Leaf |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Middlebrook 7H9 Broth using BACTEC 460 System |
| Positive Control Used (conc.) | Rifampin |
| Inhibition [%] | 67 % |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 11746852 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Antoun MD, Ramos Z, Vazques J, Oquendo I, Proctor GR, Gerena L, Franzblau SG.Evaluation of the flora of Puerto Rico for in vitro antiplasmodial and antimycobacterial activities.Phytother Res. 2001 Nov;15(7):638-42
2) http://plants.usda.gov/java/profile?symbol=TRHI3
|
| Curator | |
| Compound ID | 2744 |
| Compound Structure | |
| Plant Source | Trichilia rubra C. DC Common Name: |
| Source Family | Meliaceae |
| Origin | Peru |
| Plant Part Used | Bark |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis (ATCC 27294) |
| Assay / Test Done | BACTEC 460 (Becton Dickinson Diagnostic Instrument Systems, Sparks MD) radiometric assay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Ethambutol (7.5 µg/ml) |
| Inhibition [%] | < 50 % |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 13678239 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Graham JG, Pendland SL, Prause JL, Danzinger LH, Schunke Vigo J, Cabieses F, Farnsworth NR.Antimycobacterial evaluation of Peruvian plants.Phytomedicine. 2003;10(6-7):528-35
|
| Curator | |
| Compound ID | 2745 |
| Compound Structure | |
| Plant Source | Trichilia singularis C.DC Common Name: |
| Source Family | Meliaceae |
| Origin | Peru |
| Plant Part Used | Stem |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis (ATCC 27294) |
| Assay / Test Done | BACTEC 460 (Becton Dickinson Diagnostic Instrument Systems, Sparks MD) Radiometric Assay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Ethambutol (7.5 µg/ml) |
| Inhibition [%] | < 50 % |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 13678239 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Graham JG, Pendland SL, Prause JL, Danzinger LH, Schunke Vigo J, Cabieses F, Farnsworth NR.Antimycobacterial evaluation of Peruvian plants.Phytomedicine. 2003;10(6-7):528-35
|
| Curator | |
| Compound ID | 3399 |
| Compound Structure |  |
| Plant Source | Melia volkensii Gurke Common Name: |
| Source Family | Meliaceae |
| Origin | Voi, Kenya |
| Plant Part Used | Seed |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Radiorespirometric BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | 99 % |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 12 β - Hydroxykulactone |
| PubChem ID | 6476656 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 10217705 |
| Extract Preparation | Crushed seeds (1 kg) were allowed to stand in 2 l of MeOH for 1 week |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Steroid, Lactone, Ketone, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 468.324 |
| Molecular Formula | C30H44O4
|
| SMILES | O1[C@@H]2[C@H]([C@]3([C@@](C4=CC[C@@H]5[C@@](C4C[C@H]3O)(CCC(=O)C5(C)C)C)(C2)C)C)[C@H](C1=O)C/C=C/C(C)C |
| XLogP | 5.668 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Rajab MS, Franzblau SG, Fischer NH.Antimycobacterial triterpenes from Melia volkensii.J Nat Prod. 1999 Apr;62(4):546-8
|
| Curator | Vikramjitmandal |
| Compound ID | 3400 |
| Compound Structure |  |
| Plant Source | Melia volkensii Gurke Common Name: |
| Source Family | Meliaceae |
| Origin | Voi, Kenya |
| Plant Part Used | Seed |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Radiorespirometric BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | 99 % |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Kulonate |
| PubChem ID | 490539 |
| Ethnomedicinal Information | Used in folk medicine to alleviate pain - tea prepared from bark |
| PubMed ID [Source Literature] | 10217705 |
| Extract Preparation | Crushed seeds (1 kg) were allowed to stand in 2 l of MeOH for 1 week |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Ester, Ketone, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 526.366 |
| Molecular Formula | C33H50O5
|
| SMILES | O1[C@@H]2[C@H]([C@]3([C@](C2)(C2=CC[C@@H]4[C@@](C2CC3)(CCC(=O)C4(C)C)C)C)C)[C@@H]([C@H]1O)[C@@H](CCC=C(C)C)C(=O)OC |
| XLogP | 6.712 |
| PSA | 72.830 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Rajab MS, Franzblau SG, Fischer NH.Antimycobacterial triterpenes from Melia volkensii.J Nat Prod. 1999 Apr;62(4):546-8
|
| Curator | Vikramjitmandal |
| Compound ID | 3401 |
| Compound Structure |  |
| Plant Source | Melia volkensii Gurke Common Name: |
| Source Family | Meliaceae |
| Origin | Voi, Kenya |
| Plant Part Used | Seed |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Radiorespirometric BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | 99 % |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 6β - Hydroxykulactone |
| PubChem ID | 6476657 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 10217705 |
| Extract Preparation | Crushed seeds (1 kg) were allowed to stand in 2 l of MeOH for 1 week |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Steroid, Lactone, Ketone |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 468.324 |
| Molecular Formula | C30H44O4 |
| SMILES | O1[C@@H]2[C@H]([C@]3([C@@](C4=C[C@@H](O)[C@@H]5[C@@](C4CC3)(CCC(=O)C5(C)C)C)(C2)C)C)[C@H](C1=O)C/C=C/C(C)C |
| XLogP | 5.934 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Rajab MS, Franzblau SG, Fischer NH.Antimycobacterial triterpenes from Melia volkensii.J Nat Prod. 1999 Apr;62(4):546-8
|
| Curator | Rachana, vikramjitmandal |
| Compound ID | 3987 |
| Compound Structure |  |
| Plant Source | Melia volkensii Common Name: |
| Source Family | Meliaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 6-hydroxyculactone |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Ketone, Lactone, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 482.340 |
| Molecular Formula | C31H46O4
|
| SMILES | C[C@]12C([C@H](O)C=C3C1CC[C@]1(C)[C@]3(C)CC3OC(=O)[C@]([C@@H]13)(C)CCC=C(C)C)C(C)(C)C(=O)CC2 |
| XLogP | 5.798 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) Rogoza, L. N.; Salakhutdinov, N. F.; Tolstikov, G. A. Anti-tubercular Activity of Natural Products: Recent Developments. In Opportunity, Challenge and Scope of Natural Products in Medicinal Chemistry; Tiwari, V. K. Ed.; Research Signpost: India, 2011; pp 103-120
|
| Curator | |
| Compound ID | 4036 |
| Compound Structure |  |
| Plant Source | Chisocheton siamensis Common Name: |
| Source Family | Meliaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Azadiradione |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Triterpene, Furanoid, Ketone, O-Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 450.241 |
| Molecular Formula | C28H34O5
|
| SMILES | C[C@]12C(=CC(=O)[C@H]2c2cocc2)[C@]2(C)[C@H](OC(=O)C)CC3C(C)(C)C(=O)C=C[C@]3(C)C2CC1 |
| XLogP | 3.260 |
| PSA | 73.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4037 |
| Compound Structure |  |
| Plant Source | Chisocheton siamensis Common Name: |
| Source Family | Meliaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Epoxyazadiradione |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Triterpene, Epoxy, Furanoid, Ketone, O-Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 466.236 |
| Molecular Formula | C28H34O6
|
| SMILES | C1=CC(=O)C(C2[C@]1(C1[C@@](C(C2)OC(=O)C)([C@]23C(CC1)(C(C(=O)[C@H]2O3)c1ccoc1)C)C)C)(C)C |
| XLogP | 3.243 |
| PSA | 86.110 |
| H-bond Donor | 0 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
