| Compound ID | 2098 |
| Compound Structure | |
| Plant Source | Maesa macrophylla (Wall.) A. DC. Common Name: |
| Source Family | Myrsinaceae |
| Origin | India |
| Plant Part Used | Bark |
| Extract | Methanol |
| Target Bacteria | Mycobacterium phlei |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | Chloramphenicol (2 g/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | The allied species M. indica Wall. for syphilis, anthelmintic, woman disorders, diptheria |
| PubMed ID [Source Literature] | 8866730 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Taylor RS, Manandhar NP, Towers GH.Screening of selected medicinal plants of Nepal for antimicrobial activities.J Ethnopharmacol. 1995 Jun;46(3):153-9
|
| Curator | |
| Compound ID | 2229 |
| Compound Structure | |
| Plant Source | Myrsine coriacea (Sw.) R. Br. Common Name:Leathery Colicwood |
| Source Family | Myrsinaceae |
| Origin | Puerto Rico |
| Plant Part Used | Leaf, stem |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Middlebrook 7H9 Broth using BACTEC 460 System |
| Positive Control Used (conc.) | Rifampin |
| Inhibition [%] | 43 and 20 % |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 11746852 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Antoun MD, Ramos Z, Vazques J, Oquendo I, Proctor GR, Gerena L, Franzblau SG.Evaluation of the flora of Puerto Rico for in vitro antiplasmodial and antimycobacterial activities.Phytother Res. 2001 Nov;15(7):638-42
2) http://plants.usda.gov/java/profile?symbol=MYCO2
|
| Curator | |
| Compound ID | 2485 |
| Compound Structure | |
| Plant Source | Rapanea melanophloeos (L.) Mez Common Name:Cape Beech |
| Source Family | Myrsinaceae |
| Origin | Africa |
| Plant Part Used | Bark |
| Extract | Acetone |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 5000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis symptoms |
| PubMed ID [Source Literature] | 10473184 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Lall N, Meyer JJ.In vitro inhibition of drug-resistant and drug-sensitive strains of Mycobacterium tuberculosis by ethnobotanically selected South African plants.J Ethnopharmacol. 1999 Sep;66(3):347-54
2) http://www.plantzAfrica.com/plantqrs/rapanmelan.htm
|
| Curator | |
| Compound ID | 2653 |
| Compound Structure | |
| Plant Source | Stylogine cauliflora (Miq. & C. Mart.) Mez Common Name: |
| Source Family | Myrsinaceae |
| Origin | Peru |
| Plant Part Used | Stem |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis (ATCC 27294) |
| Assay / Test Done | BACTEC 460 (Becton Dickinson Diagnostic Instrument Systems, Sparks MD) radiometric assay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Ethambutol (7.5 µg/ml) |
| Inhibition [%] | 68 % |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 13678239 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Graham JG, Pendland SL, Prause JL, Danzinger LH, Schunke Vigo J, Cabieses F, Farnsworth NR.Antimycobacterial evaluation of Peruvian plants.Phytomedicine. 2003;10(6-7):528-35
|
| Curator | |
| Compound ID | 3991 |
| Compound Structure |  |
| Plant Source | Embelia Schimperi Common Name: |
| Source Family | Myrsinaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | One strain of H37Rv, 21 sensitive clinical strains, two clinical isolates resistant to isoniazid, and 13 MDR clinical strains |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml (inactive) |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Protoprimulagenin A |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Polycyclic, Terpene,Triterpene, Furanoid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 458.376 |
| Molecular Formula | C30H50O3
|
| SMILES | CC1(C)[C@@H](O)CC[C@@]2(C)C1CC[C@]1(C)C2CC[C@@]23OC[C@@]4([C@@H](C[C@@]12C)O)C3CC(C)(C)CC4 |
| XLogP | 8.018 |
| PSA | 49.690 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) Rogoza, L. N.; Salakhutdinov, N. F.; Tolstikov, G. A. Anti-tubercular Activity of Natural Products: Recent Developments. In Opportunity, Challenge and Scope of Natural Products in Medicinal Chemistry; Tiwari, V. K. Ed.; Research Signpost: India, 2011; pp 103-120
|
| Curator | |