| Compound ID | 1653 |
| Compound Structure | |
| Plant Source | Erythrina variegata L. var. orientalis (L.) Merr.syn. Erythrina indica Lam. Common Name:Indian Coral Tree (English), Paaribhadra, Paaribhadraka, Paarijaataka, Mandaara (Sanskrit) |
| Source Family | Papilionaceae |
| Origin | India |
| Plant Part Used | Root bark |
| Extract | Phenol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Agar Dilution - Streak Assay |
| Positive Control Used (conc.) | Streptomycin (1.7 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 17.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, microbial infections |
| PubMed ID [Source Literature] | 10820816 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Waffo AK, Azebaze GA, Nkengfack AE, Fomum ZT, Meyer M, Bodo B, van Heerden FR.Indicanines B and C, two isoflavonoid derivatives from the root bark of Erythrina indica.Phytochemistry. 2000 Apr;53(8):981-5
|
| Curator | |
| Compound ID | 1656 |
| Compound Structure |  |
| Plant Source | Erythrina variegata L. var. orientalis (L.) Merr.syn. Erythrina indica Lam. Common Name:Indian Coral Tree (English), Paaribhadra, Paaribhadraka, Paarijaataka, Mandaara (Sanskrit) |
| Source Family | Papilionaceae |
| Origin | India |
| Plant Part Used | Root bark |
| Extract | Phenol |
| Target Bacteria | Mycobacterium smegmatis (ATCC 607) |
| Assay / Test Done | Agar Dilution - Streak Assay |
| Positive Control Used (conc.) | Streptomycin (1.7 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 450 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 5,4'-Di-O-Methylalpinumisoflavone |
| PubChem ID | 10384155 |
| Ethnomedicinal Information | Cough, microbial infections |
| PubMed ID [Source Literature] | 10820816 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Flavonoid, Benzopyran, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 364.131 |
| Molecular Formula | C22H20O5
|
| SMILES | O1C(C=Cc2c1cc1occ(c(=O)c1c2OC)c1ccc(OC)cc1)(C)C |
| XLogP | 3.663 |
| PSA | 44.760 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Waffo AK, Azebaze GA, Nkengfack AE, Fomum ZT, Meyer M, Bodo B, van Heerden FR.Indicanines B and C, two isoflavonoid derivatives from the root bark of Erythrina indica.Phytochemistry. 2000 Apr;53(8):981-5
|
| Curator | |
