| Compound ID | 2288 |
| Compound Structure |  |
| Plant Source | Parmelia saxatilis L. Common Name:Lichen |
| Source Family | Parmeliaceae |
| Origin | British Columbia |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Streptomycin (0.25 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 250 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Salazinic acid |
| PubChem ID | 5320418 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 9795033 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Depside, Aldehyde, Lactone, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 388.043 |
| Molecular Formula | C18H12O10
|
| SMILES | O1c2c3c(c(O)c(c2OC(=O)c2c1c(c(O)cc2C)C=O)CO)C(=O)OC3O |
| XLogP | 0.720 |
| PSA | 159.820 |
| H-bond Donor | 4 |
| H-bond Acceptor | 10 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) Ingólfsdóttir K, Chung GA, Skúlason VG, Gissurarson SR, Vilhelmsdóttir M.Antimycobacterial activity of lichen metabolites in vitro.Eur J Pharm Sci. 1998 Apr;6(2):141-4
|
| Curator | |
